| 214-17-5 |
benzo[b]chrysen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 215-58-7 |
dibenz[a,c]anthracen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 217-37-8 |
benzo[c]picen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 217-59-4 |
triphenylen- |
N;R50/53 |
|
* |
|
|
| 218-01-9 |
chrysen |
Carc2;R45 Mut3;R68 N;R50/53 |
* |
|
|
|
| 220-77-9 |
naphtho[1,2-b]chrysen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 222-93-5 |
pentapheno- |
N;R50/53 |
|
* |
|
|
| 224-41-9 |
dibenz[a,j]anthracen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 225-11-6 |
benz[a]acridin |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 226-88-0 |
benzo[a]naphthacen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 227-09-8 |
dibenzo[a,l]pentacen |
Mut3;R40 R52/53 |
|
* |
|
|
| 232-95-1 |
naphtho[2,1-b]furan |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R51/5 |
|
* |
|
|
| 233-02-3 |
naphtho[2,1-b]thiophen |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 234-03-7 |
naphtho[1,2-b]furan |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R51/5 |
|
* |
|
|
| 239-98-5 |
benzo[a]pentacen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 243-28-7 |
5H-benzo[b]carbazol |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 243-46-9 |
benzo[b]naphtho[2,3-d]thiophen |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 268-77-9 |
naphtho[2,3-b]thiophen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 281-23-2 |
tricyclo[3.3.1.1-{3,7}-]decan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 288-88-0 |
1,2,4-triazol |
Xn;R22 Xi;R36 Rep3;R63 |
* |
|
|
|
| 294-62-2 |
cyclododecane |
|
|
|
* |
|
| 298-04-4 |
disulfoton eller O,O-diethyl-2-ethylthioethyldithiophosphat |
Tx;R27/28 N;R50/53 |
* |
|
|
|
| 299-86-5 |
crufomat eller 4-tert-butyl-2-chlorphenylmethylmethyl-phosphoramidat |
Xn;R21/22 N;R50/53 |
* |
|
|
|
| 300-30-1 |
O-(4-hydroxy-3,5-diiodphenyl)-3,5-diiod-DL-tyrosin |
R43 N;R50/53 |
|
* |
|
|
| 301-04-2 |
blydi(acetat) |
Rep1;R61 R33 Xn;R48/22 Rep3;R62 N;R50/53 |
* |
|
|
|
| 302-01-2 |
hydrazin |
Carc2;R45 R10 T;R23/24/25 C;R34 R43 N;R50/53 |
* |
|
|
|
| 303-42-4 |
metenolonenantat- |
N;R50/53 |
|
* |
|
|
| 305-03-3 |
chlorambucil- |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/5 |
|
* |
|
|
| 306-94-5 |
perflunafen- |
N;R50/53 |
|
* |
|
|
| 307-30-2 |
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctan-1-ol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 307-98-2 |
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctylacrylat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 309-00-2 |
aldrin |
T;R24/25-48/24/25 Carc3;R40 N;R50/53 |
* |
|
|
|
| 315-18-4 |
mexacarbat eller 4-dimethylamino-3,5-xylylmethylcarbamat |
Xn;R21 Tx;R28 N;R50/53 |
* |
|
|
|
| 315-37-7 |
testosteronenantat- |
N;R50/53 |
|
* |
|
|
| 316-05-2 |
mepacrinmesilat- |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 319-88-0 |
1,3,5-trichlor-2,4,6-trifluorbenzen |
N;R50/53 |
|
* |
|
|
| 320-51-4 |
4-chlor-alpha-alpha-alpha-trifluor-m-toluidin |
Mut3;R40 R52/53 |
|
* |
|
|
| 320-60-5 |
2,4-dichlor-alpha-alpha-alpha-trifluortoluen |
N;R50/53 |
|
* |
|
|
| 321-28-8 |
2-fluoranisol |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 322-75-8 |
1-(4-chlorphenoxy)-2-nitro-4-(trifluormethyl)benzen |
N;R50/53 |
|
* |
|
|
| 322-97-4 |
7-(trifluorphenyl)quinolin-4-ol |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 323-09-1 |
2-fluornaphthalen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 324-00-5 |
2-butoxy-3,4-dihydro-4-phenyl-2H-pyran |
N;R50/53 |
|
* |
|
|
| 324-93-6 |
4'-fluor[1,1'-biphenyl]-4-amin |
Xn;R22 Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 327-92-4 |
1,5-difluor-2,4-dinitrobenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 327-98-0 |
trichloronat |
T;R24 Tx;R28 N;R50/53 |
* |
|
|
|
| 329-71-5 |
2,5-dinitrophenol |
T;R23/24/25 R33 N;R51/53 |
* |
|
|
|
| 330-54-1 |
diuron |
Xn;R22-48/22 Carc3;R40 N;R50/53 |
* |
|
|
|
| 330-55-2 |
Linuron (Lorox) = 3-(3,4-dichlorphenyl)-1-methoxy-1-methylurinstof
|
Xn;R22-48/22 Carc3;R40 N;R50/53 |
* |
|
|
* |
| 332-43-4 |
1-(2-chlorethyl)-4-fluorbenzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 333-41-5 |
diazinon |
Xn;R22 N;R50/53 |
* |
|
|
|
| 334-88-3 |
diazomethan |
Carc2;R45 |
* |
|
|
|
| 335-56-8 |
1-brom-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorhexan |
N;R50/53 |
|
* |
|
|
| 335-57-9 |
perfluorheptan- |
N;R50/53 |
|
* |
|
|
| 335-58-0 |
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluor-7-iodheptan |
N;R50/53 |
|
* |
|
|
| 335-65-9 |
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoroctan |
N;R50/53 |
|
* |
|
|
| 338-83-0 |
perfluamin- |
N;R50/53 |
|
* |
|
|
| 341-69-5 |
orphenadrinhydrochlorid- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 343-27-1 |
harminhydrochlorid- |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 344-80-9 |
2-amino-2'-fluor-5-nitrobenzophenon |
N;R50/53 |
|
* |
|
|
| 345-16-4 |
5-fluorsalicylsyre |
Xn;R22 N;R50/53 |
|
* |
|
|
| 345-35-7 |
alpha-chlor-2-fluortoluen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 345-89-1 |
4-fluor-4'-methoxybenzophenon |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 345-90-4 |
1,1'-(brommethylen)bis(4-fluorbenzen) |
Xn;R22 N;R50/53 |
|
* |
|
|
| 346-44-1 |
alpha,alpha,alpha-trifluor-3-nitro-4-(phenylthio)toluen |
R43 N;R50/53 |
|
* |
|
|
| 347-93-3 |
2-chlor-4'-fluorpropiophenon |
Xn;R22 Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 348-54-9 |
2-fluoranilin |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 349-20-2 |
2-(4-chlorphenoxy)-5-(trifluormethyl)anilin |
Mut3;R40 |
|
* |
|
|
| 350-31-2 |
1-chlor-2-fluor-4-nitrobenzen |
Xn;R22 Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 350-46-9 |
1-fluor-4-nitrobenzen |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 352-11-4 |
alpha-chlor-4-fluortoluen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 355-41-9 |
1-chlor-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorhexan |
N;R50/53 |
|
* |
|
|
| 355-42-0 |
tetradecafluorhexan- |
N;R50/53 |
|
* |
|
|
| 355-43-1 |
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluor-6-iodhexan |
N;R50/53 |
|
* |
|
|
| 357-57-3 |
brucin |
Tx;R26/28 R52/53 |
* |
|
|
|
| 366-63-2 |
4-fluorbenzanilid |
Mut3;R40 R52/53 |
|
* |
|
|
| 366-70-1 |
procarbazinhydrochlorid- |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 370-50-3 |
1,3-bis(4-chlor-alpha-alpha-alpha-trifluor-m-tolyl)urinstof |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 371-86-8 |
mipafox eller N,N'-diisopropylphosphorsyrediamid-fluorid |
Tx;R39/26/27/28 |
* |
|
|
|
| 375-34-8 |
2,2,3,3-tetrachlorhexafluorbutan |
N;R50/53 |
|
* |
|
|
| 375-80-4 |
1,6-diiodperfluorhexan |
N;R50/53 |
|
* |
|
|
| 375-81-5 |
perfluorpentan-1-sulfonylfluorid |
N;R50/53 |
|
* |
|
|
| 375-88-2 |
1-brompentadecafluorheptan |
N;R50/53 |
|
* |
|
|
| 376-18-1 |
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluornonan-1-ol |
N;R50/53 |
|
* |
|
|
| 384-22-5 |
2-nitro-alpha-alpha-alpha-trifluortoluen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 388-82-9 |
2,2'-difluor-1,1'-biphenyl |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 390-64-7 |
prenylamin- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 394-32-1 |
1-(5-fluor-2-hydroxyphenyl)ethan-1-on |
N;R50/53 |
|
* |
|
|
| 396-64-5 |
3,3'-difluor-1,1'-biphenyl |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 398-21-0 |
4-brom-4'-fluor-1,1'-biphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 398-24-3 |
4-fluor-4'-nitro-1,1'-biphenyl |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 398-32-3 |
N-(4'-fluor[1,1'-biphenyl]-4-yl)acetamid |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 399-31-5 |
N-(2-fluorphenyl)acetamid |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 399-95-1 |
4-amino-3-fluorphenol |
Carc2;R45 Xn;R22 R43 N;R51/53 |
* |
|
|
|
| 400-04-4 |
1,2,4-trichlor-5-fluorbenzen |
N;R50/53 |
|
* |
|
|
| 405-22-1 |
nidroxyzon- |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 423-50-7 |
perfluorhexansulfonylfluorid- |
N;R50/53 |
|
* |
|
|
| 427-36-1 |
1,1',1''-(fluormethylidyn)trisbenzen |
N;R50/53 |
|
* |
|
|
| 432-60-0 |
allylestrenol- |
N;R50/53 |
|
* |
|
|
| 433-94-3 |
2-chlor-6-(trifluormethyl)anilin |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 434-90-2 |
decafluorbiphenyl- |
N;R50/53 |
|
* |
|
|
| 438-22-2 |
(5alpha).-androstan |
N;R50/53 |
|
* |
|
|
| 442-16-0 |
ethacridin- |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 445-03-4 |
4-chlor-alpha-alpha-alpha-trifluor-o-toluidin |
Mut3;R40 R52/53 |
|
* |
|
|
| 445-14-7 |
5-chlor-2-(trifluormethyl)anilin |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 452-75-5 |
4-chlor-2-fluortoluen |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 454-89-7 |
alpha-alpha-alpha-trifluor-3-tolualdehyd |
Xn;R22 N;R50/53 |
|
* |
|
|
| 456-04-2 |
alpha-chlor-4-fluoracetophenon |
N;R50/53 |
|
* |
|
|
| 456-42-8 |
alpha-chlor-p-fluortoluen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 456-49-5 |
3-fluoranisol |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 460-19-5 |
oxalonitril |
F;R11 T;R23 N;R50/53 |
* |
|
|
|
| 462-06-6 |
fluorbenzen- |
Mut3;R40 R52/53 |
|
* |
|
|
| 464-06-2 |
heptan [og heptanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 464-41-5 |
endo-2-chlorbornan |
N;R50/53 |
|
* |
|
|
| 464-72-2 |
1,1,2,2-tetraphenylethan-1,2-diol |
N;R50/53 |
|
* |
|
|
| 465-73-6 |
isodrin |
Tx;R26/27/28 N;R50/53 |
* |
|
|
|
| 466-37-5 |
2,2,2-triphenylacetophenon |
Xn;R22 N;R50/53 |
|
* |
|
|
| 467-55-0 |
3-beta-hydroxy-5-alpha-spirostan-12-on |
N;R50/53 |
|
* |
|
|
| 467-63-0 |
p,p',p''-tris(dimethylamino)tritylalkohol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 467-83-4 |
dipipanon- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 467-84-5 |
phenadoxon- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 467-85-6 |
normethadon- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 467-86-7 |
dioxaphetylbutyrat- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 468-28-0 |
3,5-dihydroxy-2,6,6-tris(3-methylbuten-2-yl)-4-(3-methyl-1-oxobutyl)cyclohexa-2,4-dien-1-on |
Xn;R22 N;R50/53 |
|
* |
|
|
| 468-61-1 |
oxeladin- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 469-61-4 |
[3R-(3alpha,3abeta,7beta,8aalpha)]-2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-1H-3a,7-methanoazulen |
N;R50/53 |
|
* |
|
|
| 470-90-6 |
chlorfenvinphos |
T;R24 Tx;R28 N;R50/53 |
* |
|
|
|
| 472-86-6 |
13-cis-retinal |
N;R50/53 |
|
* |
|
|
| 472-87-7 |
dehydroretinaldehyd- |
N;R50/53 |
|
* |
|
|
| 473-55-2 |
2,6,6-trimethylbicyclo[3.1.1]heptan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 474-08-8 |
solanidan-3-ol, (3beta,5alpha)- |
N;R50/53 |
|
* |
|
|
| 474-45-3 |
3alpha-amino-5alpha-pregnan-20-on |
N;R50/53 |
|
* |
|
|
| 475-20-7 |
[1S-(1alpha,3abeta,4alpha,8abeta)]-decahydro-4,8,8-trimethyl-9-methylen-1,4-methanoazulen |
N;R50/53 |
|
* |
|
|
| 475-26-3 |
1,1'-(2,2,2-trichlorethyliden)bis(p-fluorbenzen) |
N;R50/53 |
|
* |
|
|
| 475-63-8 |
dibenzo[a,o]perylen-7,16-dion |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 479-20-9 |
3-hydroxy-4-(methoxycarbonyl)-2,5-dimethylphenyl-3-formyl-2,4-dihydroxy-6-methylbenzoat |
N;R50/53 |
|
* |
|
|
| 479-27-6 |
1,8-naphthylendiamin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 479-33-4 |
tetraphenylcyclopentadienon- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 479-45-8 |
tetryl eller N-methyl-2,4,6-N-tetranitroanilin |
E;R2 T;R23/24/25 R33 |
* |
|
|
|
| 481-29-8 |
3-beta-hydroxy-5-alpha-androstan-17-on |
N;R50/53 |
|
* |
|
|
| 481-91-4 |
1,1'-binaphthyl-4,4'-ylendiamin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 483-65-8 |
7-isopropyl-1-methylphenanthren |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 483-75-0 |
1,2,4a,5,6,8a-hexahydro-1-isopropyl-4,7-dimethylnaphthalen |
N;R50/53 |
|
* |
|
|
| 484-17-3 |
phenanthren-9-ol |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 484-65-1 |
(chlormethyl)pentamethylbenzen |
R43 N;R50/53 |
|
* |
|
|
| 485-31-4 |
binapacryl eller 2-sec-butyl-4,6-dinitrophenyl(3-methylbut-2-enoat) |
Rep2;R61 Xn;R21/22 N;R50/53 |
* |
|
|
|
| 485-65-4 |
(9S)-10,11-dihydrocinchonan-9-ol |
Mut3;R40 |
|
* |
|
|
| 485-71-2 |
cinchonidin- |
Mut3;R40 |
|
* |
|
|
| 486-25-9 |
fluoren-9-on |
Mut3;R40 |
|
* |
|
|
| 486-34-0 |
1,2,7-trimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 486-84-0 |
harman- |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 487-03-6 |
harmol- |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 488-47-1 |
tetrabrompyrocatechol- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 488-97-1 |
1,3,3-trimethyltricyclo[2.2.1.02,6]heptan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 489-39-4 |
[1aR-(1aalpha,4aalpha,7alpha,7abeta,7balpha)]-decahydro-1,1,7-trimethyl-4-methylen-1H-cycloprop[e]azulen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 489-40-7 |
[1aR-(1aalpha,4alpha,4abeta,7balpha)]-1a,2,3,4,4a,5,6,7b-octahydro-1,1,4,7-tetramethyl-1H-cycloprop[e]azulen |
N;R50/53 |
|
* |
|
|
| 489-78-1 |
8-amino-4-hydroxynaphthalen-2-sulfonsyre |
Mut3;R40 |
|
* |
|
|
| 491-35-0 |
4-methylquinolin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 492-80-8 |
4,4'-carbonimidoylbis(N,N-dimethylanilin) |
Xn;R22 Xi;R36 Carc3;R40 N;R51/53 |
* |
|
|
|
| 493-76-5 |
propanocain- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 493-77-6 |
2,4,6-triphenyl-1,3,5-triazin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 493-80-1 |
histapyrrodin- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 494-03-1 |
chlornaphazin- |
Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 495-18-1 |
N-hydroxybenzamid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 495-54-5 |
4-(phenylazo)benzen-1,3-diamin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 495-60-3 |
[S-(R*,S*)]-5-(1,5-dimethylhexen-4-yl)-2-methyl-1,3-cyclohexa-1,3-dien |
N;R50/53 |
|
* |
|
|
| 495-62-5 |
6-methyl-2-(4-methylcyclohex-3-enyl)hept-1,5-dien |
N;R50/53 |
|
* |
|
|
| 497-26-7 |
2-methyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 497-39-2 |
4,6-di-tert-butyl-m-cresol |
N;R50/53 |
|
* |
|
|
| 499-75-2 |
carvacrol- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 500-38-9 |
4,4'-(2,3-dimethyltetramethylen)dipyrocatechol |
R43 N;R50/53 |
|
* |
|
|
| 500-67-4 |
5-heptylresorcinol |
R43 N;R50/53 |
|
* |
|
|
| 501-53-1 |
benzylchlorformiat |
C;R34 N;R50/53 |
* |
|
|
|
| 501-65-5 |
diphenylacetylen- |
N;R50/53 |
|
* |
|
|
| 501-68-8 |
beclamid- |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 502-61-4 |
2,6,10-trimethyldodeca-2,6,9,11-tetraen |
N;R50/53 |
|
* |
|
|
| 503-47-9 |
1,3,3-trimethylcyclohexen |
N;R50/53 |
|
* |
|
|
| 508-32-7 |
1,7,7-trimethyltricyclo[2.2.1.02,6]heptan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 510-13-4 |
alpha-alpha-bis(p-dimethylaminophenyl)benzylalkohol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 510-15-6 |
chlorobenzilat eller ethyl-4,4'-dichlorbenzilat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 511-45-5 |
pridinol- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 511-59-1 |
(1S-exo)-2-methyl-3-methylen-2-(4-methyl-3-pentenyl)bicyclo[2.2.1]heptan |
N;R50/53 |
|
* |
|
|
| 512-04-9 |
(20R,25R)-spirost-5-en-3beta-ol |
N;R50/53 |
|
* |
|
|
| 512-56-1 |
trimethylphosphat- |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 514-51-2 |
[1S-(1alpha,4alpha,7alpha)]-1,2,3,4,5,6,7,8-octahydro-1,4,9,9-tetramethyl-4,7-methanoazulen |
N;R50/53 |
|
* |
|
|
| 514-85-2 |
9-cis-retinal |
N;R50/53 |
|
* |
|
|
| 515-40-2 |
(2-chlor-1,1-dimethylethyl)benzen |
Mut3;R40 |
|
* |
|
|
| 516-55-2 |
3-beta-hydroxy-5-alpha-pregnan-20-on |
N;R50/53 |
|
* |
|
|
| 519-73-3 |
triphenylmethan- |
N;R50/53 |
|
* |
|
|
| 519-95-9 |
florantyron- |
N;R50/53 |
|
* |
|
|
| 522-20-3 |
1-[(6-chlor-2-methoxyacridin-9-yl)amino]-3-(diethylamino)propan-2-ol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 522-34-9 |
(E,E)-diphenylethandiondioxim |
R43 N;R50/53 |
|
* |
|
|
| 523-27-3 |
9,10-dibromanthracen |
N;R50/53 |
|
* |
|
|
| 523-31-9 |
dibenzylphthalat- |
N;R50/53 |
|
* |
|
|
| 524-61-8 |
cinchonidinsulfat- |
Mut3;R40 |
|
* |
|
|
| 524-99-2 |
medrylamin- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 525-68-8 |
galipin- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 526-18-1 |
osalmid- |
Mut3;R40 |
|
* |
|
|
| 526-36-3 |
xylometazolin- |
N;R50/53 |
|
* |
|
|
| 526-75-0 |
2,3-dimethylphenol eller 2,3-xylenol |
T;R24/25 C;R34 N;R51/53 |
* |
|
|
|
| 527-20-8 |
pentachloranilin- |
R43 N;R50/53 |
|
* |
|
|
| 528-29-0 |
1,2-dinitrobenzen |
Tx;R26/27/28 R33 N;R50/53 |
* |
|
|
|
| 530-45-0 |
1,1-di-p-tolylethan |
N;R50/53 |
|
* |
|
|
| 530-48-3 |
1,1-diphenylethylen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 530-66-5 |
quinoliniumhydrogensulfat- |
Mut3;R40 R43 |
|
* |
|
|
| 531-26-0 |
4-allyl-2-methoxyphenylbenzoat |
N;R50/53 |
|
* |
|
|
| 531-85-1 |
benzidin, salte heraf |
Carc1;R45 Xn;R22 N;R50/53 |
* |
|
|
|
| 531-86-2 |
benzidin, salte heraf |
Carc1;R45 Xn;R22 N;R50/53 |
* |
|
|
|
| 531-91-9 |
N,N'-diphenylbenzidin |
R43 N;R50/53 |
|
* |
|
|
| 532-08-1 |
4-allyl-2-methoxyphenylcinnamat |
N;R50/53 |
|
* |
|
|
| 532-18-3 |
di-2-naphthylamin |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 533-17-5 |
2'-chloracetanilid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 533-74-4 |
dazomet eller tetrahydro-3,5-dimethyl-1,3,5-thiadiazin-2-thion |
Xn;R22 Xi;R36 N;R50/53 |
* |
|
|
|
| 534-07-6 |
1,3-dichloracetone |
Xn;R22 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 534-52-1 |
DNOC eller 2-methyl-4,6-dinitrophenol |
Tx;R26/27/28 Xi;R38-41 R43 R44 Mut3;R68 N;R50/53 |
* |
|
|
|
| 536-25-4 |
methyl-3-amino-4-hydroxybenzoat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 536-46-9 |
N,N-dimethylbenzen-1,4-diamindihydrochlorid |
Mut3;R40 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 536-90-3 |
m-anisidin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 537-12-2 |
diperodonhydrochlorid- |
N;R50/53 |
|
* |
|
|
| 537-91-7 |
bis(3-nitrophenyl)disulfid |
N;R50/53 |
|
* |
|
|
| 538-51-2 |
benzylidenanilin- |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 538-58-9 |
1,5-diphenylpenta-1,4-dien-3-on |
Xn;R22 N;R50/53 |
|
* |
|
|
| 538-65-8 |
butylcinnamat- |
N;R50/53 |
|
* |
|
|
| 538-93-2 |
isobutylbenzen- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 540-23-8 |
p-toluidiniumchlorid |
T;R23/24/25 Xi;R36 Carc3;R40 R43 N;R50 |
* |
|
|
|
| 540-25-0 |
p-toluidinsulfat (1:1) |
T;R23/24/25 Xi;R36 Carc3;R40 R43 N;R50 |
* |
|
|
|
| 540-51-2 |
2-bromethanol |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 540-73-8 |
1,2-dimethylhydrazin |
Carc2;R45 T;R23/24/25 N;R51/53 |
* |
|
|
|
| 540-84-1 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 541-69-5 |
m-phenylendiamindihydrochlorid |
T;R23/24/25 Xi;R36 R43 Mut3;R68 N;R50/53 |
* |
|
|
|
| 542-44-9 |
2,3-dihydroxypropylpalmitat |
N;R50/53 |
|
* |
|
|
| 542-75-6 |
1,3-dichlorpropen |
R10 Xn;R20/21 T;R25 Xi;R36/37/38 R43 N;R50/53 |
* |
|
|
|
| 542-83-6 |
cadmiumcyanid |
Tx;R26/27/28 R32 R33 Xn;R68 N;R50/53 |
* |
|
|
|
| 542-88-1 |
dichlordimethylether |
Carc1;R45 R10 Xn;R22 T;R24 Tx;R26 |
* |
|
|
|
| 544-97-8 |
dimethylzink |
R14 F;R17 C;R34 N;R50/53 |
* |
|
|
|
| 545-91-5 |
phenadoxonhydrochlorid- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 548-66-3 |
drofeninhydrochlorid- |
R43 N;R50/53 |
|
* |
|
|
| 549-40-6 |
furostilbestrol- |
N;R50/53 |
|
* |
|
|
| 550-99-2 |
naphazolinhydrochlorid- |
N;R50/53 |
|
* |
|
|
| 551-09-7 |
N-(1-naphthyl)ethylendiamin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 552-02-3 |
[1aR-(1aalpha,4beta,4abeta,7alpha,7abeta,7balpha)]-decahydro-1,1,4,7-tetramethyl-1H-cycloprop[e]azulen-4-ol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 552-30-7 |
benzen-1,2,4-tricarboxylsyre-1,2-anhydrid |
Xi;R37-41 R42/43 |
* |
|
|
|
| 553-00-4 |
2-naphthylamin, salte heraf |
Carc1;R45 Xn;R22 N;R51/53 |
* |
|
|
|
| 555-03-3 |
3-nitroanisol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 555-16-8 |
4-nitrobenzaldehyd |
Mut3;R40 |
|
* |
|
|
| 555-48-6 |
2-amino-N-phenylacetamid |
Mut3;R40 |
|
* |
|
|
| 556-52-5 |
2,3-epoxypropan-1-ol |
Carc2;R45 Rep2;R60 Xn;R21/22 T;R23 Xi;R36/37/38 Mut3;R68 |
* |
|
|
|
| 556-61-6 |
methylisothiocyanat |
T;R23/25 C;R34 R43 N;R50/53 |
* |
|
|
|
| 556-67-2 |
octamethylcyclotetrasiloxan |
Rep3;R62 R53 |
* |
|
* |
|
| 557-20-0 |
diethylzink |
R14 F;R17 C;R34 N;R50/53 |
* |
|
|
|
| 559-11-5 |
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluorheptylacrylat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 559-14-8 |
perfluoroct-1-en |
N;R50/53 |
|
* |
|
|
| 560-21-4 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 560-88-3 |
endo-1,7,7-trimethylbicyclo[2.2.1]hept-2-ylsalicylat |
N;R50/53 |
|
* |
|
|
| 561-48-8 |
norpipanon- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 562-49-2 |
heptan [og heptanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 563-16-6 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 564-02-3 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 565-00-4 |
(±)-2,2-dimethyl-3-methylenbicyclo[2.2.1]heptan |
N;R50/53 |
|
* |
|
|
| 565-59-3 |
heptan [og heptanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 565-75-3 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 566-56-3 |
5-alpha-pregnan-3-beta,20-alpha-diol |
N;R50/53 |
|
* |
|
|
| 568-93-4 |
1,2-dihydroxy-3-nitroanthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 569-41-5 |
1,8-dimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 569-57-3 |
chlortrianisen- |
N;R50/53 |
|
* |
|
|
| 569-61-9 |
4,4'-(4-iminocyclohexa-2,5-dienylidenmethylen)dianilinhydrochlorid |
Carc2;R45 |
* |
|
|
|
| 569-65-3 |
meclozin- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 570-24-1 |
nitrotoluidin |
T;R23/24/25 R33 N;R51/53 |
* |
|
|
|
| 571-20-0 |
5-alpha-androstan-3-beta,17-beta-diol |
N;R50/53 |
|
* |
|
|
| 571-58-4 |
1,4-dimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 571-61-9 |
1,5-dimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 572-59-8 |
(9R)-6'-methoxycinchonan-9-ol |
Mut3;R40 |
|
* |
|
|
| 572-60-1 |
(8alpha,9S)-6'-methoxycinchonan-9-ol |
Mut3;R40 |
|
* |
|
|
| 573-20-6 |
menadioldi(acetat) |
N;R50/53 |
|
* |
|
|
| 573-56-8 |
2,6-dinitrophenol |
T;R23/24/25 R33 N;R51/53 |
* |
|
|
|
| 573-58-0 |
dinatrium-3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis(4-aminonaphthalen-1-sulfonat) |
Carc2;R45 Rep3;R63 |
* |
|
|
|
| 573-98-8 |
1,2-dimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 575-36-0 |
N-1-naphthylacetamid |
Mut3;R40 R43 |
|
* |
|
|
| 575-37-1 |
1,7-dimethylnaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 575-41-7 |
1,3-dimethylnaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 575-43-9 |
1,6-dimethylnaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 575-67-7 |
5'-fluor-2'-hydroxybutyrophenon |
Xn;R22 N;R50/53 |
|
* |
|
|
| 576-26-1 |
2,6-dimethylphenol eller 2,6-xylenol |
T;R24/25 C;R34 N;R51/53 |
* |
|
|
|
| 576-55-6 |
3,4,5,6-tetrabrom-o-cresol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 577-71-9 |
3,4-dinitrophenol |
T;R23/24/25 R33 N;R51/53 |
* |
|
|
|
| 577-91-3 |
3-(4-hydroxy-3,5-diiodphenyl)-2-phenylpropionsyre |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 577-92-4 |
5-(1,1-dimethylethyl)[1,1'-biphenyl]-2-ol |
R43 N;R50/53 |
|
* |
|
|
| 578-46-1 |
nitrotoluidin |
T;R23/24/25 R33 N;R51/53 |
* |
|
|
|
| 578-54-1 |
2-ethylanilin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 578-66-5 |
8-quinolylamin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 578-67-6 |
quinolin-5-ol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 579-23-7 |
cyclovalon- |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 580-15-4 |
quinolin-6-amin |
Carc3;R40 R43 R52/53 |
|
* |
|
|
| 581-29-3 |
acridin-3-ylamin |
Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 581-40-8 |
2,3-dimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 581-42-0 |
2,6-dimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 581-89-5 |
2-nitronaphthalen |
Carc2;R45 N;R51/53 |
* |
|
|
|
| 581-97-5 |
N-2-naphthylacetamid |
Mut3;R40 R43 |
|
* |
|
|
| 582-16-1 |
2,7-dimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 582-77-4 |
3'-methylbenzanilid |
Mut3;R40 R43 |
|
* |
|
|
| 582-78-5 |
4'-methylbenzanilid |
Mut3;R40 R43 |
|
* |
|
|
| 583-48-2 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 584-42-9 |
2-hydroxy-5-(3-nitrophenylazo)benzoat natrium |
Carc3;R40 R43 |
|
* |
|
|
| 584-70-3 |
2'-methylbenzanilid |
Mut3;R40 R43 |
|
* |
|
|
| 584-79-2 |
allethrin eller bioallethrin |
Xn;R20/22 N;R50/53 |
* |
|
|
|
| 584-84-9 |
2,4-diisocyanatotoluen |
Tx;R26 Xi;R36/37/38 Carc3;R40 R42/43 R52/53 |
* |
|
|
|
| 584-94-1 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 586-62-9 |
p-mentha-1,4(8)-dien |
N;R50/53 |
|
* |
|
|
| 586-78-7 |
1-brom-4-nitrobenzen |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 586-84-5 |
2-(methoxymethyl)-5-nitrofuran |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 587-01-9 |
2-chlor-1-(chlormethyl)ethylcarbamat |
Carc3;R40 R43 |
|
* |
|
|
| 587-65-5 |
2-chloracetanilid |
Mut3;R40 R43 N;R50 |
|
* |
|
|
| 587-90-6 |
1,3-bis(4-nitrophenyl)urinstof |
Mut3;R40 R52/53 |
|
* |
|
|
| 588-04-5 |
3,3'-azotoluen m |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 588-16-9 |
3'-methoxyacetanilid |
Mut3;R40 R43 |
|
* |
|
|
| 588-59-0 |
stilben- |
N;R50/53 |
|
* |
|
|
| 589-17-3 |
1-brom-4-(chlormethyl)benzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 589-34-4 |
heptan [og heptanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 589-41-3 |
ethylhydroxycarbamat- |
Mut3;R40 |
|
* |
|
|
| 589-43-5 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 589-53-7 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 589-81-1 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 590-35-2 |
heptan [og heptanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 590-73-8 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 591-18-4 |
1-brom-3-iodbenzen |
R43 N;R50/53 |
|
* |
|
|
| 591-21-9 |
1,3-dimethylcyclohexan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 591-33-3 |
3'-ethoxyacetanilid |
Mut3;R40 R43 |
|
* |
|
|
| 591-49-1 |
1-methylcyclohexen |
N;R50/53 |
|
* |
|
|
| 591-76-4 |
heptan [og heptanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 591-78-6 |
hexan-2-on eller butylmethylketon |
R10 T;R48/23 Rep3;R62 R67 |
* |
|
|
|
| 592-01-8 |
calciumcyanid |
Tx;R28 R32 N;R50/53 |
* |
|
|
|
| 592-13-2 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 592-27-8 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 592-62-1 |
(methylazoxymethyl)acetat |
Carc2;R45 Rep2;R61 |
* |
|
|
|
| 592-82-5 |
butylisothiocyanat- |
Xn;R22 N;R50 |
|
* |
|
|
| 593-60-2 |
vinylbromid eller bromethylen |
Carc2;R45 Fx;R12 |
* |
|
|
|
| 593-74-8 |
dimethylkviksølv |
Tx;R26/27/28 R33 N;R50/53 |
* |
|
|
|
| 594-82-1 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 594-89-8 |
1,1,1,2,2,3,3-heptachlorpropan |
N;R50/53 |
|
* |
|
|
| 596-42-9 |
2,-chlor-4',4''-bis(dimethylamino)tritylalkohol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 596-49-6 |
p,p',p''-tris(diethylamino)tritylalkohol |
N;R50/53 |
|
* |
|
|
| 597-82-0 |
O,O,O-triphenylphosphorothioat |
N;R50/53 |
|
* |
|
|
| 599-64-4 |
4-(alpha-alpha-dimethylbenzyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 600-59-9 |
3-beta-hydroxy-5-alpha-pregnan-11,20-dion |
N;R50/53 |
|
* |
|
|
| 601-63-8 |
17beta-hydroxyestr-4-en-3-on-17-(3-cyclopentylpropionat) |
N;R50/53 |
|
* |
|
|
| 602-01-7 |
2,3-dinitrotoluen |
Carc2;R45 T;R23/24/25 Xn;R48/22 Rep3;R62 Mut3;R68 N;R50/53 |
* |
|
|
|
| 602-09-5 |
1,1'-binaphthyl-2,2'-diol |
R43 N;R50/53 |
|
* |
|
|
| 602-38-0 |
1,8-dinitronaphthalen |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 602-55-1 |
9-phenylanthracen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 602-56-2 |
9-phenylacridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 602-60-8 |
9-nitroanthracen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 602-87-9 |
5-nitroacenaphthen |
Carc2;R45 |
* |
|
|
|
| 603-34-9 |
triphenylamin- |
N;R50/53 |
|
* |
|
|
| 603-40-7 |
4,4'-benzylidendianilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/5 |
|
* |
|
|
| 603-44-1 |
4,4',4''-methylidyntrisphenol |
R43 N;R50/53 |
|
* |
|
|
| 603-45-2 |
4-[bis(p-hydroxyphenyl)methylen]cyclohexa-2,5-dien-1-on |
Xn;R22 R43 N;R50 |
|
* |
|
|
| 603-48-5 |
N,N,N',N',N'',N''-hexamethyl-4,4',4''-methylidyntrianilin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 603-83-8 |
nitrotoluidin |
T;R23/24/25 R33 N;R51/53 |
* |
|
|
|
| 603-86-1 |
2-chlor-6-nitrophenol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 604-53-5 |
1,1'-binaphthyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 604-60-4 |
2,2'-binaphthyl-1,1'-diol |
N;R50/53 |
|
* |
|
|
| 605-01-6 |
pentaethylbenzen- |
N;R50/53 |
|
* |
|
|
| 605-02-7 |
1-phenylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 605-50-5 |
diisopentylphthalat- |
N;R50/53 |
|
* |
|
|
| 605-55-0 |
phenanthren-2-ol |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 605-71-0 |
1,5-dinitronaphthalen |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 606-03-1 |
1,3,5-tribenzyl-1,3,5-triazin-2,4,6(1H,3H,5H)-trion |
N;R50/53 |
|
* |
|
|
| 606-20-2 |
2,6-dinitrotoluen |
Carc2;R45 T;R23/24/25 Xn;R48/22 Rep3;R62 Mut3;R68 R52/53 |
* |
|
|
|
| 606-37-1 |
1,3-dinitronaphthalen |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 606-41-7 |
2-amino-1-naphthol |
Mut3;R40 R43 |
|
* |
|
|
| 606-81-5 |
2,4'-dinitro-1,1'-biphenyl |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 606-87-1 |
benzyldiphenylamin- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 607-12-5 |
5-chlor[1,1'-biphenyl]-2-ol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 607-24-9 |
2-nitro-1-naphthol |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 607-34-1 |
5-nitroquinolin |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 607-55-6 |
1-naphthylbenzoat |
N;R50/53 |
|
* |
|
|
| 607-57-8 |
2-nitrofluoren |
Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 607-88-5 |
p-tolylsalicylat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 607-93-2 |
N-(2,4,6-tribromphenyl)acetamid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 607-95-4 |
2,4,6-tribromphenylacetat |
R43 N;R50/53 |
|
* |
|
|
| 608-71-9 |
pentabromphenol- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 608-73-1 |
BHC-eller-HCH- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 608-93-5 |
pentachlorbenzen |
F;R11 Xn;R22 N;R50/53 |
* |
|
|
|
| 609-17-6 |
2,3,5-tribromanilin |
R43 N;R50/53 |
|
* |
|
|
| 609-20-1 |
2,6-dichlorbenzen-1,4-diamin |
Xn;R22 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 609-26-7 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 609-72-3 |
N,N-dimethyl-o-toluidin |
T;R23/24/25 R33 R52/53 |
* |
|
|
|
| 610-39-9 |
3,4-dinitrotoluen |
Carc2;R45 T;R23/24/25 Xn;R48/22 Rep3;R62 Mut3;R68 N;R51/53 |
* |
|
|
|
| 610-48-0 |
1-methylanthracen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 610-49-1 |
1-anthrylamin |
Mut3;R40 |
|
* |
|
|
| 610-51-5 |
4-methylacridin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 610-54-8 |
2,4-dinitrophenetol |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 610-57-1 |
alpha-chlor-2,4-dinitrotoluen |
R43 N;R50/53 |
|
* |
|
|
| 610-67-3 |
2-nitrophenetol |
Xn;R22 Carc3;R40 R52/53 |
|
* |
|
|
| 611-05-2 |
nitrotoluidin |
T;R23/24/25 R33 N;R51/53 |
* |
|
|
|
| 611-19-8 |
alpha-2-dichlortoluen |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 611-21-2 |
N-methyl-o-toluidin |
T;R23/24/25 R33 R52/53 |
* |
|
|
|
| 611-32-5 |
8-methylquinolin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 611-34-7 |
5-aminoquinolin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 611-36-9 |
quinolin-4-ol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 611-64-3 |
9-methylacridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 612-12-4 |
1,2-bis(chlormethyl)benzen |
R43 N;R50/53 |
|
* |
|
|
| 612-22-6 |
1-ethyl-2-nitrobenzen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 612-23-7 |
alpha-chlor-2-nitrotoluen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 612-25-9 |
2-nitrobenzylalkohol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 612-36-2 |
2-nitro-N-(4-nitrophenyl)anilin |
Mut3;R40 |
|
* |
|
|
| 612-41-9 |
o-nitrokanelsyre |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 612-52-2 |
2-naphthylamin, salte heraf |
Carc1;R45 Xn;R22 N;R51/53 |
* |
|
|
|
| 612-57-7 |
6-chlorquinolin |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R51/5 |
|
* |
|
|
| 612-58-8 |
3-methylquinolin |
Mut3;R40 R43 |
|
* |
|
|
| 612-71-5 |
1,3,5-triphenylbenzen |
N;R50/53 |
|
* |
|
|
| 612-75-9 |
3,3'-dimethylbiphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 612-78-2 |
2,2'-binaphthalen |
N;R50/53 |
|
* |
|
|
| 612-82-8 |
4,4'-bi-o-toluidin, salte heraf |
Carc2;R45 Xn;R22 N;R51/53 |
* |
|
|
|
| 612-83-9 |
3,3'-dichlorbenzidin, salte heraf |
Carc2;R45 Xn;R21 R43 N;R50/53 |
* |
|
|
|
| 612-94-2 |
2-phenylnaphthalen |
N;R50/53 |
|
* |
|
|
| 612-95-3 |
6-phenylquinolin |
Xn;R22 Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 613-06-9 |
2,3-dimethylanthracen |
N;R50/53 |
|
* |
|
|
| 613-12-7 |
2-methylanthracen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 613-13-8 |
2-anthrylamin |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 613-15-0 |
2-methylacridin |
R43 N;R50/53 |
|
* |
|
|
| 613-26-3 |
2,6-dimethylanthracen |
N;R50/53 |
|
* |
|
|
| 613-29-6 |
N,N-dibutylanilin |
R43 N;R50/53 |
|
* |
|
|
| 613-33-2 |
4,4'-dimethylbiphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 613-42-3 |
4-(phenylmethyl)-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 613-78-5 |
2-naphthylsalicylat |
R43 N;R50/53 |
|
* |
|
|
| 613-80-9 |
di-2-naphthylether |
N;R50/53 |
|
* |
|
|
| 614-33-5 |
glyceroltribenzoat- |
R43 N;R50/53 |
|
* |
|
|
| 615-05-4 |
4-methoxy-m-phenylendiamin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 615-28-1 |
o-phenylendiamindihydrochlorid |
Xn;R20/21 T;R25 Xi;R36 Carc3;R40 R43 Mut3;R68 N;R50/53 |
* |
|
|
|
| 615-49-6 |
2,4-xylidiniumacetat |
Carc3;R40 R43 |
|
* |
|
|
| 615-54-3 |
1,2,4-tribrombenzen |
R43 N;R50/53 |
|
* |
|
|
| 616-55-7 |
4,6-di-tert-butyl-o-cresol m |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 616-72-8 |
4,6-dinitro-m-xylen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 616-86-4 |
2-nitro-p-phenetidin |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 617-19-6 |
6'-butoxy-3,3'-azopyridin-2,6-diyldiamin |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 617-78-7 |
heptan [og heptanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 618-45-1 |
3-isopropylhydroxybenzen |
R43 N;R50 |
|
* |
|
|
| 618-71-3 |
ethyl-3,5-dinitrobenzoat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 618-76-8 |
4-hydroxy-3,5-diiodbenzoesyre |
R43 N;R50/53 |
|
* |
|
|
| 618-85-9 |
3,5-dinitrotoluen |
Carc2;R45 T;R23/24/25 Xn;R48/22 Rep3;R62 Mut3;R68 R52/53 |
* |
|
|
|
| 618-94-0 |
3-nitrobenzohydrazid |
Carc3;R40 |
|
* |
|
|
| 618-95-1 |
methyl-3-nitrobenzoat |
Mut3;R40 |
|
* |
|
|
| 618-98-4 |
ethyl-3-nitrobenzoat |
Mut3;R40 |
|
* |
|
|
| 619-10-3 |
2-chlor-5-nitrophenol |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 619-15-8 |
2,5-dinitrotoluen |
Carc2;R45 T;R23/24/25 Xn;R48/22 Rep3;R62 Mut3;R68 N;R51/53 |
* |
|
|
|
| 619-73-8 |
4-nitrobenzylalkohol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 619-80-7 |
4-nitrobenzamid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 619-89-6 |
p-nitrokanelsyre |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 619-93-2 |
cis-4,4'-dinitrostilben |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 619-99-8 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 620-20-2 |
alpha-3-dichlortoluen |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 620-40-6 |
tribenzylamin- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 620-55-3 |
1-nitro-3-phenoxybenzen |
Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 620-88-2 |
4-nitrophenylphenylether |
Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 620-94-0 |
di-p-tolylsulfid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 620-95-1 |
3-benzylpyridin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 621-13-6 |
dicyclohexylmaleat- |
R43 N;R50/53 |
|
* |
|
|
| 621-21-6 |
1,5-bis(3-nitrophenyl)penta-1,4-dien-3-on |
N;R50/53 |
|
* |
|
|
| 621-33-0 |
m-phenetidin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 621-52-3 |
3-nitrophenetol |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 621-62-5 |
2-chlor-1,1-diethoxyethan |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 621-64-7 |
nitrosodipropylamin |
Carc2;R45 Xn;R22 N;R51/53 |
* |
|
|
|
| 621-66-9 |
4-(phenylazo)-o-cresol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 621-77-2 |
tripentylamin- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 621-91-0 |
1,4-dibenzyloxybenzen |
N;R50/53 |
|
* |
|
|
| 622-15-1 |
N,N'-diphenylformamidin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 622-20-8 |
1,1'-[ethan-1,2-diylbis(thio)]bisbenzen |
N;R50/53 |
|
* |
|
|
| 622-21-9 |
1,9-diphenylnona-1,3,6,8-tetraen-5-on |
N;R50/53 |
|
* |
|
|
| 622-24-2 |
1-chlor-2-phenylethan |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 622-86-6 |
beta-chlorphenetol |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 623-08-5 |
N-methyl-p-toluidin |
T;R23/24/25 R33 R52/53 |
* |
|
|
|
| 623-09-6 |
4-amino-N-methylanilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 623-17-6 |
furfurylacetat- |
Mut3;R40 |
|
* |
|
|
| 623-21-2 |
furfurylbutyrat- |
Mut3;R40 |
|
* |
|
|
| 623-25-6 |
alpha-alpha'-dichlor-p-xylen |
Xn;R22 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 623-71-2 |
ethyl-3-chlorpropionat |
Mut3;R40 R43 |
|
* |
|
|
| 624-09-9 |
heptylheptanoat- |
N;R50/53 |
|
* |
|
|
| 624-18-0 |
benzen-1,4-diamindihydrochlorid |
T;R23/24/25 Xi;R36 R43 N;R50/53 |
* |
|
|
|
| 624-86-2 |
O-ethylhydroxylamin |
F;R11 T;R23/24/25-48/23 Xi;R36 R43 N;R50 |
* |
|
|
|
| 625-45-6 |
methoxyeddikesyre |
Rep2;R60-61 Xn;R22 C;R34 |
* |
|
|
|
| 625-92-3 |
3,5-dibrompyridin |
Xn;R22 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 626-00-6 |
m-diiodbenzen |
N;R50/53 |
|
* |
|
|
| 626-16-4 |
1,3-bis(chlormethyl)benzen |
Xn;R22 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 626-39-1 |
1,3,5-tribrombenzen |
R43 N;R50/53 |
|
* |
|
|
| 627-42-9 |
2-chlorethylmethylether |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 627-44-1 |
diethylkviksølv |
Tx;R26/27/28 R33 N;R50/53 |
* |
|
|
|
| 627-58-7 |
2,5-dimethylhexa-1,5-dien |
N;R50/53 |
|
* |
|
|
| 627-90-7 |
ethylundecanoat- |
N;R50/53 |
|
* |
|
|
| 627-97-4 |
2-methylhept-2-en |
N;R50/53 |
|
* |
|
|
| 628-34-2 |
2-chlorethylethylether |
Mut3;R40 R43 |
|
* |
|
|
| 628-86-4 |
kviksølvdifulminat |
E;R3 T;R23/24/25 R33 N;R50/53 |
* |
|
|
|
| 628-96-6 |
1,2-ethandioldinitrat |
E;R2 Tx;R26/27/28 R33 |
* |
|
|
|
| 629-23-2 |
tetradecan-3-on |
N;R50/53 |
|
* |
|
|
| 629-45-8 |
dibutyldisulfid- |
R43 N;R50/53 |
|
* |
|
|
| 629-54-9 |
palmitamid- |
R43 N;R50/53 |
|
* |
|
|
| 629-64-1 |
1,1'-oxybisheptan |
N;R50/53 |
|
* |
|
|
| 630-08-0 |
carbonmonoxid |
Rep1;R61 Fx;R12 T;R23-48/23 |
* |
|
|
|
| 630-60-4 |
G-strophantin |
T;R23/25 R33 |
* |
|
|
|
| 630-76-2 |
tetraphenylmethan- |
N;R50/53 |
|
* |
|
|
| 631-71-0 |
ethylabietat, teknisk |
R43 N;R50/53 |
|
* |
|
|
| 632-51-9 |
tetraphenylethylen- |
N;R50/53 |
|
* |
|
|
| 632-58-6 |
tetrachlorphthalsyre- |
R43 N;R50/53 |
|
* |
|
|
| 632-92-8 |
2,4,6-trinitro-m-xylen |
E;R2 Xn;R20/21/22 R33 |
* |
|
|
|
| 634-66-2 |
1,2,3,4-tetrachlorbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 634-83-3 |
2,3,4,5-tetrachloranilin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 634-90-2 |
1,2,3,5-tetrachlorbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 635-11-0 |
1,2,4,5-tetraisopropylbenzen |
N;R50/53 |
|
* |
|
|
| 636-28-2 |
1,2,4,5-tetrabrombenzen |
R43 N;R50/53 |
|
* |
|
|
| 636-93-1 |
2-methoxy-5-nitrophenol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 636-97-5 |
p-nitrobenzohydrazid |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 638-04-0 |
cis-1,3-dimethylcyclohexan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 638-25-5 |
pentyloctanoat- |
N;R50/53 |
|
* |
|
|
| 641-83-8 |
17-methyl-5alpha-androstan-3beta,17beta-diol |
N;R50/53 |
|
* |
|
|
| 641-85-0 |
5alpha-pregnan |
N;R50/53 |
|
* |
|
|
| 641-91-8 |
1,2,5-trimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 642-84-2 |
3',4',5-trichlorsalicylanilid |
R43 N;R50/53 |
|
* |
|
|
| 643-28-7 |
2-isopropylanilin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 643-58-3 |
2-methyl-1,1'-biphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 643-93-6 |
3-methylbiphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 643-94-7 |
o-phenylendibenzoat |
N;R50/53 |
|
* |
|
|
| 644-08-6 |
4-phenyltoluen |
N;R50/53 |
|
* |
|
|
| 644-64-4 |
dimetilan eller 1-dimethylcarbamoyl-5-methylpyrazol-3-yldimethylcarbamat |
Xn;R21 T;R25 N;R50/53 |
* |
|
|
|
| 645-49-8 |
cis-stilben |
Xn;R22 N;R50/53 |
|
* |
|
|
| 647-12-1 |
perfluoroctannitril- |
N;R50/53 |
|
* |
|
|
| 650-51-1 |
natriumtrichloracetat |
Xi;R37 N;R50/53 |
* |
|
|
|
| 653-14-5 |
lithium-3,5-diiodsalicylat |
R43 N;R50/53 |
|
* |
|
|
| 653-35-0 |
(chlormethyl)pentafluorbenzen |
N;R50/53 |
|
* |
|
|
| 654-76-2 |
4-nitro-2-(trifluormethyl)anisol |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 655-86-7 |
phenazin-2,3-diyldiamin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 656-31-5 |
(2-fluorphenyl)urinstof |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 659-04-1 |
methyl-(E)-m-nitrocinnamat |
Mut3;R40 |
|
* |
|
|
| 659-22-3 |
stilben-4,4'-diol |
R43 N;R50/53 |
|
* |
|
|
| 666-84-2 |
[1R-(1alpha,4abeta,4balpha,10aalpha)]-1,2,3,4,4a,4b,5,6,10,10a-decahydro-7-isopropyl-1,4a-dimethylphenanthren-1-methanol |
N;R50/53 |
|
* |
|
|
| 671-16-9 |
procarbazin- |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 672-57-1 |
1-chlor-2-iod-4-(trifluormethyl)benzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 678-39-7 |
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecan-1-ol |
N;R50/53 |
|
* |
|
|
| 680-31-9 |
hexamethylphosphortriamid |
Carc2;R45 Mut2;R46 |
* |
|
|
|
| 684-93-5 |
1-methyl-1-nitrosourinstof |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 688-73-3 |
Tributyltin |
|
|
|
|
* |
| 692-86-4 |
ethylundec-10-enoat |
N;R50/53 |
|
* |
|
|
| 693-21-0 |
diethylenglycoldinitrat |
E;R3 Tx;R26/27/28 R33 R52/53 |
* |
|
|
|
| 693-58-3 |
1-bromnonan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 696-44-6 |
N-methyl-m-toluidin |
T;R23/24/25 R33 R52/53 |
* |
|
|
|
| 698-63-5 |
5-nitro-2-furaldehyd |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 700-13-0 |
2,3,5-trimethylhydroquionon |
Xn;R20 Xi;R37/38-41 R43 N;R50/53 |
* |
|
|
|
| 700-60-7 |
(trichlorvinyl)benzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 702-79-4 |
1,3-dimethyltricyclo[3.3.1.13,7]decan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 705-29-3 |
alpha'-chlor-alpha-alpha-alpha-trifluor-m-xylen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 707-55-1 |
1,1,2,3,4,5,6-heptachlorcyclohexan |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 709-09-1 |
4-nitroveratrol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 713-36-0 |
o-benzyltoluen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 717-74-8 |
1,3,5-triisopropylbenzen |
N;R50/53 |
|
* |
|
|
| 719-59-5 |
2-amino-5-chlorbenzophenon |
R43 N;R50/53 |
|
* |
|
|
| 720-82-1 |
(S)-2-amino-N-(2-naphthyl)propionamid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 721-50-6 |
prilocain- |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 721-91-5 |
N-cyclohexyl-4-ethoxyanilin |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 722-27-0 |
4,4'-dithiodianilin |
N;R50/53 |
|
* |
|
|
| 727-99-1 |
2-(trifluormethyl)benzophenon |
R43 N;R50/53 |
|
* |
|
|
| 728-81-4 |
3-(trifluormethyl)benzophenon |
R43 N;R50/53 |
|
* |
|
|
| 728-86-9 |
4-(trifluormethyl)benzophenon |
R43 N;R50/53 |
|
* |
|
|
| 729-43-1 |
1-phenylethan-1-on-(1-phenylethyliden)hydrazon |
R43 N;R50/53 |
|
* |
|
|
| 730-23-4 |
4-[(3-nitrophenyl)azo]anilin |
Carc3;R40 R43 |
|
* |
|
|
| 730-40-5 |
4-[(4-nitrophenyl)azo]anilin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 731-27-1 |
tolylfluanid |
T;R23 Xi;R36/37/38 R43 Xn;R48/20 N;R50/53 |
* |
|
|
|
| 732-26-3 |
2,4,6-tri-tert-butylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 733-07-3 |
1,1'-methylenbis[2,4,6-trimethylbenzen] |
R43 N;R50/53 |
|
* |
|
|
| 736-30-1 |
p,p'-dinitrobibenzyl |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 736-31-2 |
trans-4,4'-dinitrostilben |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 744-45-6 |
diphenylisophthalat- |
N;R50/53 |
|
* |
|
|
| 747-36-4 |
hydroxychloroquinsulfat- |
Mut3;R40 R43 |
|
* |
|
|
| 754-91-6 |
heptadecafluoroctansulfonamid- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 757-86-8 |
methyl-[(dimethoxyphosphinothioyl)thio]acetat |
Mut3;R40 |
|
* |
|
|
| 759-73-9 |
N-ethyl-N-nitrosourinstof |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 762-29-8 |
6,10,14-trimethylpentadeca-5,9,13-trien-2-on |
N;R50/53 |
|
* |
|
|
| 764-22-7 |
[R-(R*,S*)]-2-aminooctadecan-1,3-diol |
R43 N;R50/53 |
|
* |
|
|
| 764-41-0 |
1,4-dichlorbut-2-en |
Carc2;R45 T;R24/25 Tx;R26 C;R34 N;R50/53 |
* |
|
|
|
| 765-03-7 |
dodec-1-yn |
N;R50/53 |
|
* |
|
|
| 765-47-9 |
1,2-dimethylcyclopenten |
Xn;R22 N;R50/53 |
|
* |
|
|
| 767-04-4 |
1-(1,3-dioxolan-2-yl)acetone |
Xn;R22 N;R50/53 |
|
* |
|
|
| 768-49-0 |
beta,beta-dimethylstyren |
N;R50/53 |
|
* |
|
|
| 769-25-5 |
2,4,6-trimethylstyren |
R43 N;R50/53 |
|
* |
|
|
| 771-29-9 |
1,2,3,4-tetrahydro-1-naphthylhydroperoxid |
O;R7 Xn;R22 C;R34 N;R50/53 |
* |
|
|
|
| 771-97-1 |
2,3-naphthylendiamin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 771-98-2 |
cyclohexen-1-ylbenzen |
R43 N;R50/53 |
|
* |
|
|
| 776-34-1 |
4-nitro-1-naphthylamin |
Mut3;R40 R43 |
|
* |
|
|
| 776-74-9 |
brom(diphenyl)methan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 778-22-3 |
2,2-diphenylpropan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 779-02-2 |
9-methylanthracen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 779-51-1 |
1,2-diphenylpropen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 781-15-7 |
1,2,3,4-tetrachlor-5,6-dinitrobenzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 781-43-1 |
9,10-dimethylanthracen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 781-73-7 |
fluoren-2-ylmethylketon |
Mut3;R40 |
|
* |
|
|
| 782-23-0 |
2,7-dimethylanthracen |
N;R50/53 |
|
* |
|
|
| 782-74-1 |
1,2-bis(2-chlorphenyl)hydrazin |
Mut3;R40 R43 |
|
* |
|
|
| 784-38-3 |
2-amino-5-chlor-2'-fluorbenzophenon |
N;R50/53 |
|
* |
|
|
| 784-50-9 |
9-oxofluoren-2-carboxylsyre |
Mut3;R40 R43 |
|
* |
|
|
| 785-30-8 |
4,4'-diaminobenzanilid |
Mut3;R40 R43 |
|
* |
|
|
| 786-19-6 |
carbophenothion |
T;R24/25 N;R50/53 |
* |
|
|
|
| 788-17-0 |
N-(1-methylpropyl)-N'-phenylbenzen-1,4-diamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 789-02-6 |
2,2,2,o,p'-pentachlorethylidenbisbenzen |
R43 N;R50/53 |
|
* |
|
|
| 789-47-9 |
chrysen-2-amin |
Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 793-24-8 |
N-1,3-dimethylbutyl-N'-phenyl-p-phenylendiamin |
R43 N;R50/53 |
|
* |
|
|
| 802-93-7 |
alpha,alpha,alpha',alpha'-tetrakis(trifluormethyl)-m-xylen-alpha,alpha'-diol |
N;R50/53 |
|
* |
|
|
| 818-23-5 |
pentadecan-8-on |
N;R50/53 |
|
* |
|
|
| 821-95-4 |
undec-1-en |
N;R50/53 |
|
* |
|
|
| 822-06-0 |
hexamethylen-1,6-diisocyanat |
T;R23 Xi;R36/37/38 R42/43 |
* |
|
|
|
| 823-40-5 |
2-methyl-m-phenylendiamin |
Xn;R21/22 R43 Mut3;R68 N;R51/53 |
* |
|
|
|
| 823-82-5 |
furan-2,5-dicarbaldehyd |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 824-45-3 |
2-chlormethyl-p-xylen |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 824-55-5 |
4-(chlormethyl)-m-xylen |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 824-94-2 |
p-(chlormethyl)anisol |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 824-98-6 |
m-(chlormethyl)anisol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 825-76-3 |
alpha-cyclopropylstyren |
R43 N;R50/53 |
|
* |
|
|
| 826-18-6 |
1-pentenylbenzen |
N;R50/53 |
|
* |
|
|
| 826-62-0 |
1,2,3,6-tetrahydro-3,6-methanophthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 826-74-4 |
1-vinylnaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 826-77-7 |
4,6-dimethylquinolin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 827-52-1 |
cyclohexylbenzen- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 827-54-3 |
2-vinylnaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 828-26-2 |
2,2,4,4,6,6-hexamethyl-1,3,5-trithian |
N;R50/53 |
|
* |
|
|
| 829-26-5 |
2,3,6-trimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 832-64-4 |
4-methylphenanthren |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 832-69-9 |
1-methylphenanthren |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 832-71-3 |
3-methylphenanthren |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 833-43-2 |
o-nitrophenethylacetat |
Mut3;R40 |
|
* |
|
|
| 834-12-8 |
ametryn eller 2-ethylamino-4-isopropylamino-6-methylthio-1,3,5-triazin |
Xn;R22 N;R50/53 |
* |
|
|
|
| 835-31-4 |
naphazolin- |
N;R50/53 |
|
* |
|
|
| 836-30-6 |
4-nitro-N-phenylanilin |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 836-41-9 |
N-(4-methoxybenzyliden)anilin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 836-42-0 |
3-benzyloxybenzylalkohol |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 838-57-3 |
ethyl-4-nitrobenzoylacetat |
Mut3;R40 |
|
* |
|
|
| 838-88-0 |
4,4'-methylendi-o-toluidin |
Carc2;R45 Xn;R22 R43 N;R50/53 |
* |
|
|
|
| 842-07-9 |
C.I. Solvent Yellow 14 eller 1-phenylazo-2-naphthol |
Carc3;R40 R43 Mut3;R68 R53 |
* |
|
|
|
| 843-55-0 |
4,4'-cyclohexylidenbisphenol |
R43 N;R50/53 |
|
* |
|
|
| 847-83-6 |
p-methoxytritylalkohol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 847-84-7 |
dimethyl(4-oxo-3,3-diphenylhexyl)ammoniumchlorid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 848-53-3 |
homochlorcyclizin- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 849-99-0 |
dicyclohexyladipat- |
N;R50/53 |
|
* |
|
|
| 850-92-0 |
2-[2-(3,4-dihydro-6-methoxy-1(2H)-naphthyliden)ethyl]-2-ethylcyclopentan-1,3-dion |
Xn;R22 N;R50/53 |
|
* |
|
|
| 853-23-6 |
3beta-hydroxyandrost-5-en-17-onacetat |
N;R50/53 |
|
* |
|
|
| 853-39-4 |
decafluorbenzophenon- |
N;R50/53 |
|
* |
|
|
| 859-65-4 |
2-(triphenylphosphoranyliden)acetophenon |
N;R50/53 |
|
* |
|
|
| 868-85-9 |
dimethylphosphonat- |
Mut3;R40 |
|
* |
|
|
| 869-59-0 |
trioctylstannan |
Xi;R38 T;R48/25 R53 |
* |
|
|
|
| 871-83-0 |
2-methylnonan |
N;R50/53 |
|
* |
|
|
| 872-05-9 |
dec-1-en |
N;R50/53 |
|
* |
|
|
| 876-86-8 |
7-chlorquinolin-8-ol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 877-09-8 |
2,4,5,6-tetrachlor-m-xylen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 877-10-1 |
2,3,5,6-tetrachlor-p-xylen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 877-44-1 |
1,2,4-triethylbenzen |
N;R50/53 |
|
* |
|
|
| 879-12-9 |
1,2,3-trimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 879-39-0 |
2,3,4,5-tetrachlornitrobenzen |
R43 N;R50/53 |
|
* |
|
|
| 881-03-8 |
2-methyl-1-nitronaphthalen |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 882-06-4 |
(E)-p-nitrokanelsyre |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 882-33-7 |
diphenyldisulfid- |
N;R50/53 |
|
* |
|
|
| 883-20-5 |
9-methylphenanthren |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 883-80-7 |
3-(tert-butyl)-1-methylnaphthalen |
R43 N;R50/53 |
|
* |
|
|
| 885-81-4 |
N-(4-ethoxy-2-nitrophenyl)acetamid |
Mut3;R40 R43 |
|
* |
|
|
| 885-82-5 |
3-nitro[1,1'-biphenyl]-4-ol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 886-65-7 |
1,4-diphenylbuta-1,3-dien |
Xn;R22 N;R50/53 |
|
* |
|
|
| 886-66-8 |
1,1'-(1,3-butadiyn-1,4-diyl)bisbenzen |
N;R50/53 |
|
* |
|
|
| 895-85-2 |
bis(4-methylbenzoyl)peroxid |
E;R2 O;R7 N;R50/53 |
* |
|
|
|
| 897-78-9 |
2,6-dibenzylidencyclohexan-1-on |
R43 N;R50/53 |
|
* |
|
|
| 900-95-8 |
fentinacetat eller triphenyltinacetat |
T;R24/25 Tx;R26-48/23 Xi;R37/38-41 Carc3;R40 Rep3;R63 N;R50/53 |
* |
|
|
* |
| 904-04-1 |
captodiamhydrochlorid- |
R43 N;R50/53 |
|
* |
|
|
| 906-65-0 |
2-(triphenylphosphoranyliden)ravsyreanhydrid |
N;R50/53 |
|
* |
|
|
| 910-86-1 |
tiocarlid- |
R43 N;R50/53 |
|
* |
|
|
| 912-57-2 |
17beta-hydroxyestr-4-en-3-on-17-(3-cyclohexylpropionat) |
N;R50/53 |
|
* |
|
|
| 915-30-0 |
diphenoxylat- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 915-35-5 |
12-oxo-5-alpha-spirostan-3-beta-ylacetat |
N;R50/53 |
|
* |
|
|
| 924-16-3 |
N-nitrosodibutylamin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 926-06-7 |
isopropylmethansulfonat- |
Mut3;R40 |
|
* |
|
|
| 927-73-1 |
4-chlorbut-1-en |
Xn;R22 R43 N;R50 |
|
* |
|
|
| 930-08-5 |
3,6,9,12-tetraoxapentacosan-1-ol |
N;R50/53 |
|
* |
|
|
| 930-37-0 |
(methoxymethyl)oxiran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 930-55-2 |
1-nitrosopyrrolidin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 932-83-2 |
hexahydro-1-nitroso-1H-azepin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 935-56-8 |
1-chlortricyclo[3.3.1.13,7]decan |
N;R50/53 |
|
* |
|
|
| 935-79-5 |
cis-1,2,3,6-tetrahydrophthalsyreanhydrid |
Xi;R41 R42/43 R52/53 |
* |
|
|
|
| 935-95-5 |
2,3,5,6-tetrachlorphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 936-51-6 |
2-phenyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 937-20-2 |
2,4'-dichloracetophenon |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 937-94-0 |
2-hexyl-2-methyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 938-33-0 |
methyl-8-quinolylether |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 938-71-6 |
alpha-4-dichlor-2-nitrotoluen |
R43 N;R50/53 |
|
* |
|
|
| 938-86-3 |
1,2,3,4-tetrachlor-5-methoxybenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 939-27-5 |
2-ethylnaphthalen |
N;R50/53 |
|
* |
|
|
| 941-43-5 |
ethyl-2-methyl-1,3-dioxolan-2-propionat |
N;R50/53 |
|
* |
|
|
| 942-93-8 |
5-chlor-1-phenylpentan-1-on |
Xn;R22 R43 N;R50 |
|
* |
|
|
| 943-37-3 |
ethyl-5-nitro-2-furoat |
Mut3;R40 |
|
* |
|
|
| 944-22-9 |
fonofos eller O-ethylphenylethyldithiophosphonat |
Tx;R27/28 N;R50/53 |
* |
|
|
|
| 945-24-4 |
2,4-diaminopteridin-6-ylmethanol |
Mut3;R40 |
|
* |
|
|
| 946-49-6 |
(Z)-4-(4-nitrophenyl)-3-buten-2-on |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 947-73-9 |
phenanthren-9-amin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 949-13-3 |
o-octylphenol |
R43 N;R50/53 |
|
* |
|
|
| 949-87-1 |
4-methylazobenzen |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 949-99-5 |
4-nitro-3-phenyl-L-alanin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 950-37-8 |
methidathion eller 2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl-O,O-dimethyldithiophosphat |
Xn;R21 Tx;R28 N;R50/53 |
* |
|
|
|
| 952-97-6 |
4-nitrophenylphenylsulfid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 953-26-4 |
ethyl-4-nitrocinnamat |
Mut3;R40 |
|
* |
|
|
| 954-16-5 |
2,4,6-trimethylbenzophenon |
Xn;R22 Xi;R36 N;R50/53 |
* |
|
|
|
| 959-10-4 |
xenbucin- |
Xn;R22 N;R50 |
|
* |
|
|
| 961-38-6 |
2,4,6-tri-tert-butylanilin |
R43 N;R50/53 |
|
* |
|
|
| 961-68-2 |
2,4-dinitro-N-phenylanilin |
Mut3;R40 R43 |
|
* |
|
|
| 963-75-7 |
5alpha-androst-2-en-17-on |
N;R50/53 |
|
* |
|
|
| 965-90-2 |
ethylestrenol- |
N;R50/53 |
|
* |
|
|
| 968-58-1 |
alpha,alpha-diphenylpiperidin-1-propanolhydrochlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 970-76-3 |
2,4-dinitro-N-(4-nitrophenyl)anilin |
Mut3;R40 R43 |
|
* |
|
|
| 972-02-1 |
difenidol- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 973-21-7 |
dinobuton eller 2-sec-butyl-4,6-dinitrophenylisopropylcarbonat |
T;R25 N;R50/53 |
* |
|
|
|
| 978-86-9 |
4-tritylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 980-71-2 |
brompheniraminhydrogenmaleat- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 983-80-2 |
cis-vinylenbis[diphenylphosphin] |
N;R50/53 |
|
* |
|
|
| 983-81-3 |
trans-vinylenbis[diphenylphosphin] |
N;R50/53 |
|
* |
|
|
| 995-33-5 |
butyl-4,4-bis(tert-butyldioxy)valerat |
N;R50/53 |
|
* |
|
|
| 997-95-5 |
diisobutylnitrosoamin- |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 999-40-6 |
nerylbutyrat- |
N;R50/53 |
|
* |
|
|
| 999-64-4 |
3-bromoctan |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1001-45-2 |
pentadecan-6-on |
N;R50/53 |
|
* |
|
|
| 1002-69-3 |
1-chlordecan |
R43 N;R50/53 |
|
* |
|
|
| 1008-76-0 |
gamma-phenyl-gamma-butyrolacton |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 1009-36-5 |
2-chlor-5-nitroanisol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 1012-72-2 |
1,4-di-tert-butylbenzen |
N;R50/53 |
|
* |
|
|
| 1014-69-3 |
desmetryn eller 6-isopropylamino-2-methylamino-4-methylthio-1,3,5-triazin |
Xn;R21/22 N;R50/53 |
* |
|
|
|
| 1014-70-6 |
simetryn eller 2,4-bis(ethylamino)-6-methylthio-1,3,5-triazin |
Xn;R22 N;R50/53 |
* |
|
|
|
| 1016-58-6 |
6-nitroveratrumylalkohol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 1018-71-9 |
pyrrolnitrin- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1022-07-7 |
N-methyl-2,4,6-trinitroanilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 1022-13-5 |
5-chlor-2-(methylamino)benzophenon |
Mut3;R40 R43 |
|
* |
|
|
| 1022-22-6 |
1,1'-(chlorvinyliden)bis[4-chlorbenzen] |
N;R50/53 |
|
* |
|
|
| 1024-57-3 |
2,3-epoxy-1,4,5,6,7,8,8-heptachlor-3a,4,7,7a-tetrahydro-4,7-methanoindan
eller heptachlorepoxid |
T;R25 R33 Carc3;R40 N;R50/53 |
* |
|
|
|
| 1034-49-7 |
(bromomethyl)triphenylphosphoniumbromid |
N;R50/53 |
|
* |
|
|
| 1038-28-4 |
(±)-13-ethyl-3-methoxygona-2,5(10)-dien-17beta-ol |
R43 N;R50/53 |
|
* |
|
|
| 1038-95-5 |
tris(4-methylphenyl)phosphin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1043-50-1 |
bis(2,3,4,5,6-pentafluorphenyl)sulfid |
N;R50/53 |
|
* |
|
|
| 1050-10-8 |
O-2-naphthylmethyl-2-naphthylthiocarbamat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1052-38-6 |
4,4'-[1,3-phenylenbis(azo)]bisbenzen-1,3-diamin |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 1061-54-7 |
(20R,25R)-spirost-5-en-3beta-ylacetat |
N;R50/53 |
|
* |
|
|
| 1067-08-9 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 1068-57-1 |
acetohydrazid- |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 1071-26-7 |
2,2-dimethylheptan |
N;R50/53 |
|
* |
|
|
| 1073-69-4 |
(4-chlorphenyl)hydrazin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 1073-70-7 |
p-chlorphenylhydrazinhydrochlorid |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 1077-16-3 |
hexylbenzen- |
N;R50/53 |
|
* |
|
|
| 1078-71-3 |
heptylbenzen- |
N;R50/53 |
|
* |
|
|
| 1079-17-0 |
alpha-alpha',2,3,5,6-hexachlor-4-xylen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1081-75-0 |
1,3-diphenylpropan |
N;R50/53 |
|
* |
|
|
| 1083-48-3 |
4-(4-nitrobenzyl)pyridin |
Xn;R22 Mut3;R40 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 1085-12-7 |
heptyl-4-hydroxybenzoat |
R43 N;R50/53 |
|
* |
|
|
| 1085-98-9 |
dichlofluanid eller N-dichlorfluormethylthio-N',N'-dimethyl-N-phenylsulfamid |
Xn;R20 Xi;R36 R43 N;R50/53 |
* |
|
|
|
| 1087-02-1 |
1,4-dicyclohexylbenzen |
N;R50/53 |
|
* |
|
|
| 1095-04-1 |
triphenyltrithiophosphit- |
N;R50/53 |
|
* |
|
|
| 1095-90-5 |
methadonhydrochlorid- |
Xn;R22 øN;R50/53 |
|
* |
|
|
| 1096-48-6 |
1-(cyclohexylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 1096-84-0 |
1,1'-methylenbis(2-naphthol) |
R43 N;R50/53 |
|
* |
|
|
| 1101-41-3 |
tetraphenyldiphosphin- |
N;R50/53 |
|
* |
|
|
| 1112-99-8 |
(S)-3,7,11-trimethyldodeca-1,6,10-trien-3-ylformiat |
N;R50/53 |
|
* |
|
|
| 1113-21-9 |
(E,E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol |
N;R50/53 |
|
* |
|
|
| 1115-01-1 |
methyl-9,10-dihydroxyoctadecanoat |
N;R50/53 |
|
* |
|
|
| 1116-54-7 |
2,2'-(nitrosoimino)bisethanol |
Carc2;R45 |
* |
|
|
|
| 1117-52-8 |
(E,E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-on |
N;R50/53 |
|
* |
|
|
| 1117-55-1 |
hexyloctanoat- |
N;R50/53 |
|
* |
|
|
| 1117-79-9 |
3-chloroctan |
N;R50/53 |
|
* |
|
|
| 1118-39-4 |
myrcenylacetat- |
N;R50/53 |
|
* |
|
|
| 1120-16-7 |
lauramid- |
R43 N;R50/53 |
|
* |
|
|
| 1120-17-8 |
(E)-1,1'-[vinylenbis(thio)]bispropan |
N;R50/53 |
|
* |
|
|
| 1120-21-4 |
undecan- |
N;R50/53 |
|
* |
|
|
| 1120-71-4 |
1,3-propansulton |
Carc2;R45 Xn;R21/22 |
* |
|
|
|
| 1127-76-0 |
1-ethylnaphthalen |
N;R50/53 |
|
* |
|
|
| 1129-52-8 |
2,4,6-tris(chlormethyl)-1,3,5-trioxan |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 1133-57-9 |
1,2,3,5-tetrachlor-4,6-bis(chlormethyl)benzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1134-36-7 |
3-aminobiphenyl-4-ol |
Mut3;R40 R43 |
|
* |
|
|
| 1134-40-3 |
2,3,6,7-tetramethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1137-36-6 |
4-(3,3-dimethylbicyclo[2.2.1]hept-2-yliden)-2-methylbutanol |
N;R50/53 |
|
* |
|
|
| 1138-47-2 |
(trans)-1,1'-(1,2-cyclopropandiyl)bisbenzen |
N;R50/53 |
|
* |
|
|
| 1138-48-3 |
(cis)-1,1'-(1,2-cyclopropandiyl)bisbenzen |
N;R50/53 |
|
* |
|
|
| 1139-52-2 |
4-brom-2,6-di-tert-butylphenol |
R43 N;R50/53 |
|
* |
|
|
| 1142-15-0 |
p-methoxystilben |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1142-19-4 |
bis(4-chlorphenyl)disulfid |
N;R50/53 |
|
* |
|
|
| 1145-76-2 |
p-(benzyloxy)nitrobenzen |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 1146-56-1 |
4-(3,3-dimethylbicyclo[2.2.1]hept-2-yl)-2-methylbutylacetat |
N;R50/53 |
|
* |
|
|
| 1150-26-1 |
N-(p-methoxyphenyl)-p-toluensulfonamid |
Mut3;R40 |
|
* |
|
|
| 1151-97-9 |
2-[(2,4-dinitrophenyl)methyl]pyridin |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 1153-51-1 |
5alpha-androst-16-en-3alpha-ol |
N;R50/53 |
|
* |
|
|
| 1154-59-2 |
3,3',4',5-tetrachlorsalicylanilid |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 1154-92-3 |
2-isopropyl-5-methylcyclohexylphenylacetat |
N;R50/53 |
|
* |
|
|
| 1155-00-6 |
bis(2-nitrophenyl)disulfid |
N;R50/53 |
|
* |
|
|
| 1155-56-2 |
1-benzyl-N-phenylpiperidin-4-amin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1156-50-9 |
bis(4-nitrophenyl)sulfon |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 1159-53-1 |
N,N-di-p-tolyl-p-toluidin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1163-19-5 |
bis(pentabromophenyl) ether |
|
|
|
* |
|
| 1164-95-0 |
androsteronacetat- |
N;R50/53 |
|
* |
|
|
| 1169-98-8 |
cyclohexyl-2-ethylhexylphthalat |
N;R50/53 |
|
* |
|
|
| 1174-69-2 |
(20S)-5-beta-pregnan-3alpha,20-dioldiacetat |
N;R50/53 |
|
* |
|
|
| 1175-06-0 |
6-oxocholestanol |
N;R50/53 |
|
* |
|
|
| 1176-08-5 |
phenyltoloxamindihydrogencitrat- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1176-74-5 |
ethyl-2-[(3,5-dibrom-4-hydroxyphenyl)(3,5-dibrom-4-oxo-2,5-cyclohexadien-1-yliden)methyl]benzoat |
N;R50/53 |
|
* |
|
|
| 1192-63-8 |
pyrrolidin-1-carbonylchlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 1193-72-2 |
1-brom-2,4-dichlorbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1195-31-9 |
(R)-4-(isopropyl)-1-methylcyclohexen |
N;R50/53 |
|
* |
|
|
| 1195-32-0 |
p,alpha-dimethylstyren |
N;R50/53 |
|
* |
|
|
| 1197-37-1 |
4-ethoxybenzen-1,2-diamin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 1198-14-7 |
5-bromquinolin-8-ol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 1203-86-7 |
2,2-dichlor-1-(2,4,5-trichlorphenyl)ethan-1-on |
R43 N;R50/53 |
|
* |
|
|
| 1205-42-1 |
cis-2-methyl-5-(1-methylvinyl)cyclohex-2-en-1-ylacetat |
N;R50/53 |
|
* |
|
|
| 1205-64-7 |
N-phenyl-m-toluidin |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 1207-12-1 |
4,6-dimethyldibenzothiophen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1208-52-2 |
2,4'-methylendianilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 1208-86-2 |
N-phenyl-p-anisidin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 1208-87-3 |
1-(chlormethyl)-4-(phenylthio)benzen |
R43 N;R50/53 |
|
* |
|
|
| 1208-88-4 |
p-(phenylthio)benzaldehyd |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1218-35-5 |
xylometazolinhydrochlorid- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1218-65-1 |
bicyclo[2.2.1]hept-5-en-2-ylmethylbicyclo[2.2.1]hept-5-en-2-carboxylat |
N;R50/53 |
|
* |
|
|
| 1219-38-1 |
octyl-4-hydroxybenzoat |
R43 N;R50/53 |
|
* |
|
|
| 1220-94-6 |
1-amino-4-(methylamino)anthraquinon |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 1223-31-0 |
bis(4-nitrophenyl)sulfid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1224-92-6 |
5alpha-androstan-3beta-ol |
N;R50/53 |
|
* |
|
|
| 1226-46-6 |
4,4'-bis(dimethylamino)thiobenzophenon |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 1229-55-6 |
1-[(2-methoxyphenyl)azo]-2-naphthol |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 1233-26-7 |
p,p'-octylidenbisphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1237-75-8 |
6-brom-2-hydroxy-N-o-hydroxyphenylnaphthalen-3-carboxamid |
N;R50/53 |
|
* |
|
|
| 1249-75-8 |
methyllithocholat- |
N;R50/53 |
|
* |
|
|
| 1254-35-9 |
oxaboloncipionat- |
N;R50/53 |
|
* |
|
|
| 1255-49-8 |
17beta-hydroxyandrost-4-en-3-on-3-phenylpropionat |
N;R50/53 |
|
* |
|
|
| 1255-69-2 |
2-[bis[4-(dimethylamino)phenyl]methyl]-5-(dimethylamino)benzoesyre |
R43 N;R50/53 |
|
* |
|
|
| 1260-35-1 |
methyl-N-[3-(acetylamino)-4-[(2-chlor-4-nitrophenyl)azo]phenyl]-N-(3-methoxy-3-oxopropyl)-beta-alaninat |
Mut3;R40 R43 |
|
* |
|
|
| 1303-28-2 |
diarsenpentaoxid |
Carc1;R45 T;R23/25 N;R50/53 |
* |
|
|
|
| 1304-56-9 |
berylliumoxid |
Carc2;R49 T;R25-48/23 Tx;R26 Xi;R36/37/38 R43 |
* |
|
|
|
| 1306-19-0 |
cadmiumoxid |
Carc2;R49 Xn;R22 T;R48/23/25 |
* |
|
|
|
| 1306-23-6 |
cadmiumsulfid |
Xn;R22 Carc3;R40 T;R48/23/25 R53 |
* |
|
|
|
| 1307-96-6 |
cobaltoxid |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| 1309-64-4 |
antimontrioxid |
Carc3;R40 |
* |
|
|
|
| 1313-27-5 |
molybdentrioxid |
Xi;R36/37 Xn;R48/20/22 |
* |
|
|
|
| 1313-99-1 |
nikkelmonoxid |
Carc1;R49 R43 R53 |
* |
|
|
|
| 1314-06-3 |
dinikkeltrioxid |
Carc1;R49 R43 R53 |
* |
|
|
|
| 1314-62-1 |
divanadiumpentaoxid |
Xn;R20/22 Xi;R37 T;R48/23 Rep3;R63 Mut3;R68 N;R51/53 |
* |
|
|
|
| 1314-84-7 |
trizinkdiphosphid |
F;R15/29 Tx;R28 R32 N;R50/53 |
* |
|
|
|
| 1317-42-6 |
cobaltsulfid |
R43 N;R50/53 |
* |
|
|
|
| 1321-64-8 |
pentachlornaphthalen |
Xn;R21/22 Xi;R36/38 N;R50/53 |
* |
|
|
|
| 1321-94-4 |
methylnaphthalen- |
R43 N;R50/53 |
|
* |
|
|
| 1323-00-8 |
santalylacetat- |
N;R50/53 |
|
* |
|
|
| 1323-38-2 |
(R)-12-hydroxyoliesyre, monoester med glycerol |
N;R50/53 |
|
* |
|
|
| 1323-75-7 |
santalylphenylacetat- |
N;R50/53 |
|
* |
|
|
| 1327-53-3 |
diarsentrioxid |
Carc1;R45 Tx;R28 C;R34 N;R50/53 |
* |
|
|
|
| 1330-78-5 |
tris(methylphenyl)phosphat |
N;R50/53 |
|
* |
|
|
| 1332-21-4 |
asbest |
Carc1;R45 T;R48/23 |
* |
|
|
|
| 1333-53-5 |
isopropylquinolin- |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 1333-58-0 |
(isobutyl)quinolin |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 1333-82-0 |
chromtrioxid |
Carc1;R49 O;R8 T;R25 C;R35 R43 N;R50/53 |
* |
|
|
|
| 1335-31-5 |
dikviksølvdicyanidoxid |
E;R3 T;R23/24/25 R33 N;R50/53 |
* |
|
|
|
| 1335-32-6 |
blyacetat, basisk |
Rep1;R61 R33 Carc3;R40 Xn;R48/22 Rep3;R62 N;R50/53 |
* |
|
|
|
| 1335-87-1 |
hexachlornaphthalen- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1336-36-3 |
PCB |
R33 N;R50/53 |
* |
|
|
* |
| 1338-02-9 |
naphthensyrer, kobbersalte |
R10 Xn;R22 N;R50/53 |
* |
|
|
|
| 1344-32-7 |
trichlor(chlormethyl)benzen |
R43 N;R50/53 |
|
* |
|
|
| 1344-37-2 |
blysulfochromatgul (C.I. 77603) |
Rep1;R61 R33 Carc3;R40 Rep3;R62 N;R50/53 |
* |
|
|
|
| 1405-92-1 |
[3R-(3alpha,3abeta,7beta,8aalpha)]-2,3,4,7,8,8a-hexahydro-3,8,8-trimethyl-1H-3a,7-methanoazulen-6-methylacetat |
R43 N;R50/53 |
|
* |
|
|
| 1420-06-0 |
trifenmorph eller 4-tritylmorpholin |
Xn;R22 N;R50/53 |
* |
|
|
|
| 1420-07-1 |
dinoterb eller 2-tert-butyl-4,6-dinitrophenol |
Rep2;R61 T;R24 Tx;R28 R44 N;R50/53 |
* |
|
|
|
| 1420-68-4 |
21-hydroxypregn-4-en-3,20-dion-21-heptanoat |
N;R50/53 |
|
* |
|
|
| 1424-79-9 |
1,2,4-trichlor-3-(chlormethyl)benzen |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 1435-48-9 |
1,3-dichlor-4-fluorbenzen |
Xn;R22-48/20/22 Xi;R38 N;R51/53 |
* |
|
|
|
| 1435-50-3 |
2-brom-1,4-dichlorbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1435-71-8 |
2-[(o-nitrophenyl)azo]-p-cresol |
Carc3;R40 R43 |
|
* |
|
|
| 1436-34-6 |
1,2-epoxyhexan |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 1440-61-5 |
4-(chloracetyl)morpholin |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 1443-76-1 |
4-hydroxy-3,5-dimethoxybenzoesyre |
Mut3;R40 R43 |
|
* |
|
|
| 1448-36-8 |
methylcholat- |
N;R50/53 |
|
* |
|
|
| 1448-62-0 |
diethyl-4,4'-[hexamethylenbis(oxy)]dibenzimidat |
N;R50/53 |
|
* |
|
|
| 1449-46-3 |
benzyltriphenylphosphoniumbromid- |
N;R50/53 |
|
* |
|
|
| 1449-55-4 |
tetracyclohexylstannan |
Xn;R20/21/22 N;R50/53 |
* |
|
|
|
| 1450-63-1 |
1,1,4,4-tetraphenylbuta-1,3-dien |
N;R50/53 |
|
* |
|
|
| 1453-82-3 |
isonicotinamid- |
Mut3;R40 |
|
* |
|
|
| 1454-12-2 |
2-(beta,beta-diethoxycarbonylphenethyl)pyridiniumchlorid |
N;R50/53 |
|
* |
|
|
| 1459-00-3 |
beta-bromcumen |
Xn;R22 Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 1460-02-2 |
1,3,5-tri-tert-butylbenzen |
N;R50/53 |
|
* |
|
|
| 1461-25-2 |
tetrabutyltin (TTBT) |
|
|
|
* |
* |
| 1464-53-5 |
2,2'-bioxiran |
Carc2;R45 Mut2;R46 T;R24/25 Tx;R26 C;R34 |
* |
|
|
|
| 1465-25-4 |
N-2-aminoethyl-1-naphthylamindihydrochlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 1467-35-2 |
2,3,4-trimethylanilin |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 1468-37-7 |
dimexano eller bis(methoxythiocarbonyl)disulfid |
Xn;R22 N;R50/53 |
* |
|
|
|
| 1474-02-8 |
N-(1-benzylpiperidin-4-yl)-N-phenylpropionamid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1478-61-1 |
4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethyliden]diphenol |
N;R50/53 |
|
* |
|
|
| 1479-58-9 |
2-amino-5-brom-2'-fluorbenzophenon |
N;R50/53 |
|
* |
|
|
| 1484-08-8 |
9-butyl-9H-carbazol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1484-09-9 |
9-isopropyl-9H-carbazol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1484-12-4 |
9-methylcarbazol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1484-13-5 |
9-vinylcarbazol |
N;R50/53 |
|
* |
|
|
| 1484-13-5 |
9-vinylcarbazol |
Xn;R21/22 Xi;R38 R43 Mut3;R68 N;R50/53 |
* |
|
|
|
| 1484-26-0 |
3-benzyloxyanilin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 1491-59-4 |
oxymetazolin- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1503-54-4 |
O-acetyl-5-iodsalicylsyre |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1506-15-6 |
1,2,3,4,5,6-hexachlor-7-methoxynaphthalen |
R43 N;R50/53 |
|
* |
|
|
| 1520-44-1 |
(1-methylpropan-1,3-diyl)dibenzen |
N;R50/53 |
|
* |
|
|
| 1528-52-5 |
triisobutylbenzen-1,2,4-tricarboxylat |
N;R50/53 |
|
* |
|
|
| 1528-74-1 |
4,4'-dinitrobiphenyl |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 1529-68-6 |
1,2,3,4-tetrabrombutan |
Carc3;R40 N;R50/53 |
|
* |
|
|
| 1530-03-6 |
1,1-diphenylpropan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1530-34-3 |
(3-methylbut-2-enyl)triphenylphosphoniumbromid |
N;R50/53 |
|
* |
|
|
| 1533-65-9 |
1-(3-pyridylazo)-2-naphthol |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 1533-74-0 |
2,2'-[[3-acetamido-4-[(4-nitrophenyl)azo]phenyl]imino]diethyldiacetat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 1533-77-3 |
2,2'-[[3-carbamoyl-4-[(2-methoxy-4-nitrophenyl)azo]phenyl]imino]diethyldiacetat |
Mut3;R40 R43 |
|
* |
|
|
| 1533-78-4 |
2,2'-[[3-acetamido-4-[(2-chlor-4-nitrophenyl)azo]phenyl]imino]diethyldiacetat |
Carc3;R40 R43 |
|
* |
|
|
| 1539-04-4 |
diphenylterephthalat- |
N;R50/53 |
|
* |
|
|
| 1541-81-7 |
4-dodecylmorpholin |
R43 N;R50/53 |
|
* |
|
|
| 1544-19-0 |
1,1'-isopropylidenbis[4-(1,1,2,2-tetrafluorethoxy)benzen] |
N;R50/53 |
|
* |
|
|
| 1555-94-8 |
8-ethoxyquinolin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 1558-97-0 |
diethyl-[2-(phenylthio)ethyl]malonat |
N;R50/53 |
|
* |
|
|
| 1559-87-1 |
1,3-dibromtetrafluorbenzen |
N;R50/53 |
|
* |
|
|
| 1560-54-9 |
allyltriphenylphosphoniumbromid- |
N;R50/53 |
|
* |
|
|
| 1562-93-2 |
4-phenylazobenzoesyre |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 1563-56-0 |
2-amino-5-brombenzoylpyridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1563-66-2 |
carbofuran eller 2,3-dihydro-2,2-dimethylbenzofuran-7-ylmethylcarbamat |
Tx;R26/28 N;R50/53 |
* |
|
|
|
| 1565-94-2 |
(1-methylethyliden)bis[4,1-phenylenoxy(2-hydroxy-3,1-propandiyl)]bismethacrylat |
N;R50/53 |
|
* |
|
|
| 1568-11-2 |
kanelaldehydazin- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1574-10-3 |
benzaldehydsemicarbazon- |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 1576-67-6 |
3,6-dimethylphenanthren |
N;R50/53 |
|
* |
|
|
| 1582-09-8 |
2,6-dinitro-N,N-dipropyl-4-(trifluormethyl)anilin (indeholdende<
5 ppm NPDA) |
Xi;R36 R43 N;R50/53 |
* |
|
|
|
| 1582-09-8 |
trifluralin (indeholdende < 0,5 ppm NPDA) |
Xi;R36 R43 N;R50/53 |
* |
|
|
|
| 1585-16-6 |
2,4,6-trimethylbenzylchlorid |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 1589-47-5 |
2-methoxypropanol |
Rep2;R61 R10 Xi;R37/38-41 |
* |
|
|
|
| 1591-31-7 |
4-iodbiphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1592-20-7 |
1-(chlormethyl)-4-vinylbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1592-31-0 |
1,4-bis(dibrommethyl)benzen |
N;R50/53 |
|
* |
|
|
| 1596-84-5 |
daminozid |
Carc3;R40 |
* |
|
|
|
| 1605-18-1 |
1,4-bis(1-methylvinyl)benzen |
N;R50/53 |
|
* |
|
|
| 1606-67-3 |
pyren-1-ylamin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 1607-23-4 |
1,2-epoxy-3-(propenyloxy)propan |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 1609-66-1 |
N-phenyl-N-piperidin-4-ylpropionamid |
Mut3;R40 |
|
* |
|
|
| 1610-52-2 |
11,20-dioxo-5-beta-pregnan-3-alpha-ylacetat |
N;R50/53 |
|
* |
|
|
| 1620-68-4 |
2,6-bis[(2-hydroxy-5-methylphenyl)methyl]p-cresol |
R43 N;R50/53 |
|
* |
|
|
| 1620-98-0 |
3,5-di-tert-butyl-4-hydroxybenzaldehyd |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1625-91-8 |
4,4'-di-tert-butyl-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 1635-84-3 |
6-nitro-2,4-xylidin |
Xn;R22 Carc3;R40 R52/53 |
|
* |
|
|
| 1639-31-2 |
3,4,5-trimethylanilin |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 1639-43-6 |
17beta-hydroxyandrost-5-en-3beta-ylacetat |
N;R50/53 |
|
* |
|
|
| 1642-81-5 |
4-(chlormethyl)benzoesyre |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 1647-16-1 |
1,9-decadien |
N;R50/53 |
|
* |
|
|
| 1653-33-4 |
tetradecan-4-ol |
N;R50/53 |
|
* |
|
|
| 1663-45-2 |
bis(1,2-diphenylphosphino)ethan |
N;R50/53 |
|
* |
|
|
| 1667-10-3 |
4,4'-bis(chlormethyl)-1,1'-biphenyl |
Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 1667-11-4 |
4-(chlormethyl)biphenyl |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 1673-06-9 |
amphotalid- |
Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 1673-47-8 |
3-chlorbenzohydrazid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 1674-10-8 |
1,2-dimethylcyclohexen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1674-18-6 |
1,1',1'',1'''-(propa-1,2-dien-1,3-diyliden)tetrakisbenzen |
N;R50/53 |
|
* |
|
|
| 1674-37-9 |
1-phenyloctan-1-on |
N;R50/53 |
|
* |
|
|
| 1679-02-3 |
2,9-dimethylpicen |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 1682-31-1 |
1,1,1,2,2,3,3,4,4,5,5-undecafluor-7-iodheptan |
N;R50/53 |
|
* |
|
|
| 1684-14-6 |
2,3-diphenylquinoxalin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1684-42-0 |
1-[(6-chlor-2-methoxyacridin-9-yl)amino]-3-(diethylamino)propan-2-oldihydrochlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 1687-53-2 |
5-amino-2-methoxyphenol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 1689-82-3 |
4-hydroxyazobenzen |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 1689-83-4 |
ioxynil eller 4-hydroxy-3,5-diiodbenzonitril |
Xn;R21 T;R25 Rep3;R63 N;R50/53 |
* |
|
|
|
| 1689-84-5 |
bromoxynil eller 3,5-dibrom-4-hydroxybenzonitril |
T;R25 Rep3;R63 |
* |
|
|
|
| 1689-99-2 |
bromoxynil-octanoat eller 2,6-dibrom-4-cyanphenyloctanoat |
Xn;R21/22 Rep3;R63 N;R50/53 |
* |
|
|
|
| 1691-99-2 |
N-ethylheptadecafluor-N-(2-hydroxyethyl)octansulfonamid |
N;R50/53 |
|
* |
|
|
| 1694-09-3 |
benzylviolet 4B eller ?-(4-(4-dimethylamino-?-(4-(ethyl(3-natriosulfonatobenzyl)amino)phenyl)benzyliden)cyclohexa-2,5-dienyliden(ethyl)ammonio)toluen-3-sulfonat |
Carc3;R40 |
* |
|
|
|
| 1694-82-2 |
cis-1,2,3,6-tetrahydro-4-methylphthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 1698-60-8 |
pyrazon eller chloridazon eller 5-amino-4-chlor-2-phenylpyridazin-3-on |
R43 N;R50/53 |
* |
|
|
|
| 1699-56-5 |
3,4-bis(benzyloxy)phenethylaminhydrochlorid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1699-59-8 |
3,5-bis(benzyloxy)-alpha-chlortoluen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 1700-02-3 |
2,4-dichlor-6-phenyl-1,3,5-triazin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1703-90-8 |
4'-tert-butyl-2',6'-dimethylbutyrophenon |
R43 N;R50/53 |
|
* |
|
|
| 1705-85-7 |
6-methylchrysen |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 1706-69-0 |
2-octylhydroquinon |
R43 N;R50/53 |
|
* |
|
|
| 1707-92-2 |
tribenzylphosphat- |
N;R50/53 |
|
* |
|
|
| 1708-34-5 |
2-hexyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 1715-40-8 |
bromocyclen- |
N;R50/53 |
|
* |
|
|
| 1716-09-2 |
O,O-diethyl-O-[3-methyl-4-(methylthio)phenyl]thiophosphat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1717-00-6 |
1,1-dichlor-1-fluorethan |
R52/53 N;R59 |
* |
|
|
|
| 1720-32-7 |
1,6-diphenylhexa-1,3,5-trien |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1726-23-4 |
tributylbenzen-1,2,4-tricarboxylat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1731-88-0 |
methyltridecanoat- |
N;R50/53 |
|
* |
|
|
| 1733-76-2 |
1,5-bis(chlormethyl)naphthalen |
Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 1735-48-4 |
1,1,1,2,2,3,4,5,5,6,6,6-dodecafluor-3,4-bis(trifluormethyl)hexan |
N;R50/53 |
|
* |
|
|
| 1742-14-9 |
alpha-(3,4-dimethylphenyl)-alpha-methyl-3,4-dimethyltoluen |
N;R50/53 |
|
* |
|
|
| 1743-61-9 |
1,4-dimethyl-4-vinylcyclohexen |
N;R50/53 |
|
* |
|
|
| 1745-89-7 |
4,4'-isopropylidenbis[2-allylphenol] |
R43 N;R50/53 |
|
* |
|
|
| 1746-81-2 |
monolinuron eller 3-(4-chlorphenyl)-1-methoxy-1-methylurinstof |
Xn;R22-48/22 N;R50/53 |
* |
|
|
|
| 1755-51-7 |
2,2',2'',4,4'-pentamethoxytritylalkohol |
N;R50/53 |
|
* |
|
|
| 1758-68-5 |
1,2-diaminoanthraquinon |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 1759-05-3 |
bis(4-chlor-3-nitrophenyl)sulfon |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 1770-80-5 |
dibutyl-1,4,5,6,7,7-hexachlorbicyclo[2.2.1]hept-5-en-2,3-dicarboxylat |
N;R50/53 |
|
* |
|
|
| 1775-95-7 |
2-amino-5-nitrobenzophenon |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 1777-84-0 |
N-(4-ethoxy-3-nitrophenyl)acetamid |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 1779-51-7 |
n-butyltriphenylphosphoniumchlorid |
N;R50/53 |
|
* |
|
|
| 1786-81-8 |
prilocainhydrochlorid- |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 1788-31-4 |
1,3-diphenylacetoneoxim |
N;R50/53 |
|
* |
|
|
| 1789-30-6 |
2-amino-5-chlorphenylcyclohexylketon |
N;R50/53 |
|
* |
|
|
| 1795-15-9 |
octylcyclohexan- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1798-11-4 |
4-nitrophenoxyeddikesyre |
Mut3;R40 |
|
* |
|
|
| 1799-84-4 |
3,3,4,4,5,5,6,6,6-nonafluorhexylmethacrylat |
N;R50/53 |
|
* |
|
|
| 1800-91-5 |
3,3,4,4,5,5,6,6,7,7,8,8-dodecafluordeca-1,9-dien |
N;R50/53 |
|
* |
|
|
| 1806-26-4 |
p-octylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1807-55-2 |
4,4'-methylenbis(N-methylanilin) |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 1808-12-4 |
2-[(4-bromphenyl)phenylmethoxy]ethyl(dimethyl)ammoniumchlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1809-14-9 |
dioctylphosphonat- |
N;R50/53 |
|
* |
|
|
| 1817-47-6 |
p-nitrocumen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 1817-68-1 |
2,6-bis(1-phenylethyl)-p-cresol |
R43 N;R50/53 |
|
* |
|
|
| 1817-74-9 |
bis(4-nitrophenyl)methan |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 1818-08-2 |
p-(1-methylheptyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 1821-27-8 |
4-nitro-N-(4-nitrophenyl)anilin |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 1822-51-1 |
4-(chlormethyl)pyridiniumchlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1825-19-0 |
pentachlor(methylthio)benzen |
N;R50/53 |
|
* |
|
|
| 1830-77-9 |
3-hydroxy-2'-methylanthracen-2-carboxanilid |
R43 N;R50/53 |
|
* |
|
|
| 1836-73-3 |
3-chlor-2-(4-nitrophenoxy)toluen |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 1836-74-4 |
1-chlor-4-(4-nitrophenoxy)benzen |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/5 |
|
* |
|
|
| 1836-75-5 |
nitrofen eller2,4-dichlorphenyl-4-nitrophenylether |
R45-61-22-50/53 |
* |
|
* |
* |
| 1836-77-7 |
chlornitrofen- |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 1838-04-6 |
tetradecylammoniumchlorid- |
R43 N;R50/53 |
|
* |
|
|
| 1839-63-0 |
1,3,5-trimethylcyclohexan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1852-53-5 |
5-alpha-androstan-3-alpha-17-beta-diol |
N;R50/53 |
|
* |
|
|
| 1864-92-2 |
N,N-diethyl-m-phenetidin |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 1871-57-4 |
3-chlor-2-(chlormethyl)propen |
Xn;R22 Carc3;R40 N;R50/53 |
|
* |
|
|
| 1874-22-2 |
5-nitrofuran-2-acrylaldehyd |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 1889-67-4 |
1,1'-(1,1,2,2-tetramethylethylen)dibenzen |
N;R50/53 |
|
* |
|
|
| 1893-52-3 |
2-[ethyl[(tridecafluorhexyl)sulfonyl]amino]ethylacrylat |
N;R50/53 |
|
* |
|
|
| 1897-41-2 |
tetrachlorterephthalonitril |
R43 N;R50/53 |
* |
|
|
|
| 1897-45-6 |
chlorothalonil eller tetrachlorisophthalonitril |
Carc3;R40 N;R50/53 |
* |
|
|
|
| 1910-42-5 |
paraquat-dichlorid |
T;R24/25-48/25 Tx;R26 Xi;R36/37/38 N;R50/53 |
* |
|
|
|
| 1912-24-9 |
Atrazine |
R43 Xn;R48/22 N;R50/53 |
* |
|
|
* |
| 1912-31-8 |
propylmethansulfonat- |
Mut3;R40 |
|
* |
|
|
| 1912-32-9 |
butylmethansulfonat- |
Mut3;R40 |
|
* |
|
|
| 1918-00-9 |
dicamba eller 3,6-dichlor-2-methoxybenzoesyre |
Xn;R22 Xi;R41 R52/53 |
* |
|
|
|
| 1918-16-7 |
propachlor eller 2-chlor-N-isopropylacetanilid |
Xn;R22 Xi;R36 R43 N;R50/53 |
* |
|
|
|
| 1920-05-4 |
dodecyldimethylammoniumacetat- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1936-57-8 |
p-(methylamino)phenolsulfat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 1937-37-7 |
dinatrium-4-amino-3-[[4'-[(2,4-diaminophenyl)azo][1,1'-biphenyl]-4-yl]azo]-5-hydroxy-6-(phenylazo)naphthalen-2,7-disulfonat |
Carc2;R45 Rep3;R63 |
* |
|
|
|
| 1938-32-5 |
5-(chlormethyl)-6-propyl-1,3-benzodioxol |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 1939-27-1 |
3'-trifluormethylisobutyranilid |
Xn;R48/22 N;R51/53 |
* |
|
|
|
| 1939-46-4 |
3-(2-bornyl)cyclohexan-1-ol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 1940-43-8 |
2,2'-methylenbis(4,6-dichlorphenol) |
R43 N;R50/53 |
|
* |
|
|
| 1943-82-4 |
2-phenylethylisocyanat |
Xn;R22 T;R23 C;R35 R42/43 N;R51/53 |
* |
|
|
|
| 1943-87-9 |
methyl-(4-nitrophenyl)carbamate |
Mut3;R40 R52/53 |
|
* |
|
|
| 1943-96-0 |
4,4'-bicyclo[2.2.1]hept-2-ylidenbisphenol |
R43 N;R50/53 |
|
* |
|
|
| 1943-97-1 |
p,p'-(octahydro-4,7-methano-5H-inden-5-yliden)bisphenol |
R43 N;R50/53 |
|
* |
|
|
| 1949-07-1 |
1-methyl-4-[3,3,3-tris(4-chlorphenyl)propionyl]piperaziniumchlorid |
N;R50/53 |
|
* |
|
|
| 1949-51-5 |
ethyl-3,5-diaminobenzoat |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 1954-28-5 |
etoglucid- |
Mut3;R40 R43 |
|
* |
|
|
| 1954-96-7 |
3-amino-5-[(methylamino)carbonyl]benzoesyre |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 1954-97-8 |
3-[(methylamino)carbonyl]-5-nitrobenzoesyre |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 1962-75-0 |
dibutylterephthalat- |
N;R50/53 |
|
* |
|
|
| 1973-05-3 |
N,N',N''-triphenyl-1,3,5-triazin-2,4,6-triamin |
R43 N;R50/53 |
|
* |
|
|
| 1982-69-0 |
dicamba-natrium eller natrium-3,6-dichlor-o-anisat |
R52/53 |
|
* |
|
|
| 20-07-7329 |
Stannane, tributylfluoro- |
|
|
|
|
* |
| 1987-50-4 |
4-heptylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 1988-89-2 |
p-(1-phenylethyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 1991-52-2 |
2,5-di-tert-butyl-4-methoxyphenol |
N;R50/53 |
|
* |
|
|
| 2001-32-3 |
3-(2-nitrophenyl)propionsyre |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 2001-96-9 |
p-nitrophenyl-beta-D-xylopyranosid |
Mut3;R40 |
|
* |
|
|
| 2005-08-5 |
4-chlorphenylbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 2011-66-7 |
2-amino-2'-chlor-5-nitrobenzophenon |
R43 N;R50/53 |
|
* |
|
|
| 2012-21-7 |
2,4-distyrylphenol |
R43 N;R50/53 |
|
* |
|
|
| 2014-83-7 |
2,6-dichlorbenzylchlorid |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 2016-38-8 |
decylammoniumacetat- |
R43 N;R50/53 |
|
* |
|
|
| 2016-42-4 |
tetradecylamin- |
R43 N;R50/53 |
|
* |
|
|
| 2016-48-0 |
dodecyldimethylammoniumchlorid- |
R43 N;R50/53 |
|
* |
|
|
| 2016-54-8 |
tetradecylammoniumacetat- |
R43 N;R50/53 |
|
* |
|
|
| 2016-57-1 |
decylamin- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2027-17-0 |
2-isopropylnaphthalen |
N;R50/53 |
|
* |
|
|
| 2032-35-1 |
2-brom-1,1-diethoxyethan |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 2032-59-9 |
aminocarb eller 4-dimethylamino-3-tolylmethylcarbamat |
T;R24/25 N;R50/53 |
* |
|
|
|
| 2032-65-7 |
mercaptodimethur eller methiocarb |
T;R25 N;R50/53 |
* |
|
|
|
| 2034-94-8 |
testosteron-3-cyclohexylpropionat |
N;R50/53 |
|
* |
|
|
| 2035-99-6 |
isopentyloctanoat- |
N;R50/53 |
|
* |
|
|
| 2039-76-1 |
methyl-3-phenanthrylketon |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 2043-57-4 |
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluor-8-iodoctan |
N;R50/53 |
|
* |
|
|
| 2044-72-6 |
2',5'-dichloracetoacetanilid |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 2044-88-4 |
N-methyl-2,4-dinitroanilin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2049-95-8 |
tert-pentylbenzen |
N;R50/53 |
|
* |
|
|
| 2050-47-7 |
bis(4-bromphenyl)ether |
R43 N;R50/53 |
|
* |
|
|
| 2050-66-0 |
bis(4-chlor-2-nitrophenyl)disulfid |
N;R50/53 |
|
* |
|
|
| 2050-75-1 |
2,3-dichlornaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2050-85-3 |
N,N'-(o-phenylen)di(acetamid) |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 2051-04-9 |
diisopentyldisulfid- |
N;R50/53 |
|
* |
|
|
| 2051-18-5 |
7-chlor-p-cymen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2051-79-8 |
N5,N5-diethyltoluen-2,5-diaminmonohydrochlorid |
T;R25 Xi;R36 R43 N;R50/53 |
* |
|
|
|
| 2051-85-6 |
4-(phenylazo)resorcinol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 2052-07-5 |
2-brombiphenyl |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2055-40-5 |
p-isopropylstyren |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2057-47-8 |
4-[3-phenyl-1-(2-phenylethyl)propyl]pyridin |
R43 N;R50/53 |
|
* |
|
|
| 2062-77-3 |
trifluperidolhydrochlorid- |
N;R50/53 |
|
* |
|
|
| 2062-78-4 |
pimozid- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2065-66-9 |
methyltriphenylphosphoniumiodid- |
N;R50/53 |
|
* |
|
|
| 2065-70-5 |
2,6-dichlornaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2069-41-2 |
4-brom-4'-fluorbenzophenon |
N;R50/53 |
|
* |
|
|
| 2071-20-7 |
methylenbis[diphenylphosphin] |
N;R50/53 |
|
* |
|
|
| 2074-50-2 |
paraquat-dimethylsulfat |
T;R24/25-48/25 Tx;R26 Xi;R36/37/38 N;R50/53 |
* |
|
|
|
| 2077-46-5 |
2,3,6-trichlortoluen |
R43 N;R50/53 |
|
* |
|
|
| 2078-42-4 |
natrium-2,3,6-trichlorbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 2082-79-3 |
octadecyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate |
|
|
* |
|
| 2083-09-2 |
2,5-di(biphenyl-4-yl)oxazol |
N;R50/53 |
|
* |
|
|
| 2091-46-5 |
prop-2-ynyltriphenylphosphoniumbromid |
N;R50/53 |
|
* |
|
|
| 2091-61-4 |
2-chlor-1-(4-nitrophenoxy)benzen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 2094-73-7 |
ethyltricyclo[3.3.1.13,7]decan-1-carboxylat |
N;R50/53 |
|
* |
|
|
| 2094-99-7 |
2-(3-(prop-1-en-2-yl)phenyl)prop-2-ylisocyanat |
Tx;R26 C;R34 R42/43 Xn;R48/20 N;R50/53 |
* |
|
|
|
| 2095-01-4 |
2,6-diamino-3,5-diethyltoluen |
Xn;R21/22-48/22 Xi;R36 N;R50/53 |
* |
|
|
|
| 2095-02-5 |
2,4-diamino-3,5-diethyltoluen |
Xn;R21/22-48/22 Xi;R36 N;R50/53 |
* |
|
|
|
| 2095-06-9 |
N,N-bis(2,3-epoxypropyl)anilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2100-25-6 |
1-iod-2,3,5,6-tetramethylbenzen |
N;R50/53 |
|
* |
|
|
| 2104-64-5 |
EPN eller O-ethyl-O-(4-nitrophenyl)phenylthiophosphonat |
Tx;R27/28 N;R50/53 |
* |
|
|
|
| 2106-04-9 |
3-chlor-2-fluoranilin |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 2109-12-8 |
2,4,6-triiod-m-cresol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2109-45-7 |
2-[[(2-amino-5-chlorphenyl)phenylmethylen]amino]ethanol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2113-51-1 |
2-iodbiphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2113-57-7 |
3-brombiphenyl |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2113-58-8 |
3-nitrobiphenyl |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 2122-19-2 |
propylenthiourinstof |
Xn;R22 Rep3;R63 R52/53 |
* |
|
|
|
| 2123-27-5 |
2,4-dichlorstyren |
R43 N;R50/53 |
|
* |
|
|
| 2128-93-0 |
4-phenylbenzophenon |
N;R50/53 |
|
* |
|
|
| 2131-38-6 |
1,3,7-trimethylnaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2131-39-7 |
1,3,5-trimethylnaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2131-41-1 |
1,4,5-trimethylnaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2131-42-2 |
1,4,6-trimethylnaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2136-70-1 |
2-(tetradecyloxy)ethanol |
N;R50/53 |
|
* |
|
|
| 2144-00-5 |
naphthalen-1-carbaldehyd(1-naphthylmethylen)hydrazon |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2144-37-8 |
methyl-5-(chlormethyl)-2-furoat |
Mut3;R40 |
|
* |
|
|
| 2144-53-8 |
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctylmethacrylat |
N;R50/53 |
|
* |
|
|
| 2148-56-3 |
2-amino-6-chlorbenzoesyre |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 2155-70-6 |
Tributyl[(2-methyl-1-oxo-2-propenyl)oxy]stannane |
|
|
|
|
* |
| 2162-73-4 |
2,4,6-triisopropyl-m-phenylendiisocyanat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2162-98-3 |
1,10-dichlordecan |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2172-49-8 |
3,3,3-tris(p-chlorphenyl)propionylchlorid |
N;R50/53 |
|
* |
|
|
| 2172-51-2 |
2,2,3-tris(4-chlorphenyl)propiononitril |
N;R50/53 |
|
* |
|
|
| 2174-13-2 |
20-hydroxyiminopregna-5,16-dien-3-beta-ylacetat |
N;R50/53 |
|
* |
|
|
| 2175-90-8 |
6,6'-diphenylfulven |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2176-62-7 |
pentachlorpyridin- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2179-37-5 |
bencyclan- |
R43 N;R50/53 |
|
* |
|
|
| 2186-24-5 |
2,3-epoxypropyl-p-tolylether |
Xi;R38 R43 Mut3;R68 N;R51/53 |
* |
|
|
|
| 2186-25-6 |
2,3-epoxypropyl-m-tolylether |
Xi;R38 R43 Mut3;R68 N;R51/53 |
* |
|
|
|
| 2189-60-8 |
octylbenzen- |
N;R50/53 |
|
* |
|
|
| 2192-21-4 |
2'-[2-(diethylamino)ethoxy]-3-phenylpropiophenonhydrochlorid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2198-23-4 |
non-4-en |
N;R50/53 |
|
* |
|
|
| 2198-77-8 |
2,7-dichlornaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2207-68-3 |
1-(4-nitrophenyl)glycerol |
Mut3;R40 |
|
* |
|
|
| 2210-72-2 |
[(p-isopropylphenoxy)methyl]oxiran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2210-74-4 |
[(o-methoxyphenoxy)methyl]oxiran |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 2210-79-9 |
2,3-epoxypropyl-o-tolylether |
Xi;R38 R43 Mut3;R68 N;R51/53 |
* |
|
|
|
| 2211-28-1 |
4-hydroxy-2-methylnaphthylbenzoat |
N;R50/53 |
|
* |
|
|
| 2211-31-6 |
2-methylnaphthalen-1,4-diyldibenzoat |
R43 N;R50/53 |
|
* |
|
|
| 2211-94-1 |
2,3-epoxypropyl 4'-methoxyphenyl ether |
Mut3;R40 R43 |
|
* |
|
|
| 2212-05-7 |
4-chlorphenyl-2,3-epoxypropylether |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2212-06-8 |
[(p-bromphenoxy)methyl]oxiran |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 2213-68-5 |
5-methyl-3-(1,1,3,3-tetramethylbutyl)pyrocatechol |
R43 N;R50/53 |
|
* |
|
|
| 2213-81-2 |
4-tert-butyl-2,6-dinitrochlorbenzen |
R43 N;R50/53 |
|
* |
|
|
| 2216-12-8 |
1-nitro-2-phenoxybenzen |
Carc3;R40 |
|
* |
|
|
| 2216-15-1 |
N,N-diethyl-4-nitroanilin |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 2216-33-3 |
3-methyloctan |
N;R50/53 |
|
* |
|
|
| 2216-34-4 |
4-methyloctan |
N;R50/53 |
|
* |
|
|
| 2216-68-4 |
methyl(1-naphthyl)amin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2217-06-3 |
bis(2,4,6-trinitrophenyl)sulfid |
N;R50/53 |
|
* |
|
|
| 2219-84-3 |
4-(1,1,3,3-tetramethylbutyl)-o-cresol |
R43 N;R50/53 |
|
* |
|
|
| 2223-71-4 |
8-tert-butyl-1,4-dioxaspiro[4.5]decan |
N;R50/53 |
|
* |
|
|
| 2224-15-9 |
2,2'-[ethylenbis(oxymethylen)]bisoxiran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2226-11-1 |
bornelon- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2226-14-4 |
alpha,3,3-trimethylbicyclo[2.2.1]heptan-2-butanol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2227-13-6 |
tetrasul- |
N;R50/53 |
|
* |
|
|
| 2231-66-5 |
2,2-dimethyl-5-(1-methylethyliden)-1,3-dioxan-4,6-dion |
N;R50/53 |
|
* |
|
|
| 2234-13-1 |
octachlornaphthalen- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2234-75-5 |
1,2,4-trimethylcyclohexan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2238-07-5 |
2,2'-[oxybis(methylen)]bisoxiran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2243-44-9 |
2-chlorethyl-2-phenoxyethylether |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 2243-61-0 |
naphthalen-1,4-diamin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2243-62-1 |
1,5-naphthylendiamin |
Carc3;R40 N;R50/53 |
* |
|
|
|
| 2244-21-5 |
troclosenkalium |
O;R8 Xn;R22 R31 Xi;R36/37 N;R50/53 |
* |
|
|
|
| 2245-30-9 |
tert-butyloxiran |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 2245-38-7 |
1,6,7-trimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2261-99-6 |
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorheptylmethacrylat |
N;R50/53 |
|
* |
|
|
| 2275-14-1 |
phenkapton eller O,O-diethyl-S-(2,5-dichlorphenylthiomethyl)-dithiophosphat |
T;R23/24/25 N;R50/53 |
* |
|
|
|
| 2277-92-1 |
oxyclozanid- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2279-76-7 |
Tri-n-propyltin (TPrT) |
|
|
|
|
* |
| 2284-36-8 |
methyl-3alpha,7alpha-diacetoxy-5beta-chol-11-en-24-oat |
N;R50/53 |
|
* |
|
|
| 2287-32-3 |
1-[2-(2-chlorethoxy)ethoxy]-2-methoxybenzen |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 2297-30-5 |
androst-5-en-(3beta,17beta)-dioldipropionat |
N;R50/53 |
|
* |
|
|
| 2300-15-4 |
2,4-bis[1-(4-hydroxyphenyl)isopropyl]phenol |
N;R50/53 |
|
* |
|
|
| 2303-16-4 |
di-allat eller S-2,3-dichlorallyldiisopropylthiocarbamat |
Xn;R22 Carc3;R40 N;R50/53 |
* |
|
|
|
| 2303-17-5 |
tri-allat eller S-2,3,3-trichlorallyldiisopropylthiocarbamat
|
Xn;R22-48/22 R43 N;R50/53 |
* |
|
|
|
| 2306-78-7 |
3,7,11-trimethyldodeca-1,6,10-trien-3-ylacetat |
N;R50/53 |
|
* |
|
|
| 2307-49-5 |
tricamba- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2310-17-0 |
phosalon eller O,O-diethyl-S-(6-chlor-2-oxo-benz[b]-1,3-oxalin-3-yl)methyldithiophosphat |
Xn;R21 T;R25 N;R50/53 |
* |
|
|
|
| 2311-59-3 |
isopropyldecanoat- |
N;R50/53 |
|
* |
|
|
| 2312-35-8 |
propargit eller 2-(4-tert-butylphenoxy) cyclohexylprop-2-ynylsulfit |
Xn;R22 Xi;R36 N;R50/53 |
* |
|
|
|
| 2312-76-7 |
DNOC-Na |
T;R23/24/25 R33 N;R50/53 |
* |
|
|
|
| 2314-97-8 |
trifluoriodmethan |
Mut3;R68 |
* |
|
|
|
| 2315-02-8 |
oxymetazolinhydrochlorid- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2315-36-8 |
2-chlor-N,N-diethylacetamid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 2325-27-1 |
N-(triphenylphosphoranyliden)anilin |
N;R50/53 |
|
* |
|
|
| 2327-67-5 |
N-(triphenylphosphoranyliden)-p-toluidin |
N;R50/53 |
|
* |
|
|
| 2338-20-7 |
3,4,5-triiodbenzoesyre |
R43 N;R50/53 |
|
* |
|
|
| 2345-24-6 |
nerylisobutyrat- |
N;R50/53 |
|
* |
|
|
| 2345-26-8 |
geranylisobutyrat- |
N;R50/53 |
|
* |
|
|
| 2345-27-9 |
tetradecan-2-on |
N;R50/53 |
|
* |
|
|
| 2345-28-0 |
pentadecan-2-on |
N;R50/53 |
|
* |
|
|
| 2350-89-2 |
p-vinylbiphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2359-46-8 |
2-ethoxy-N-{4}-,N-{4}-diethyl-p-phenylendiamin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 2362-14-3 |
4,4'-cyclohexylidendi-o-cresol |
R43 N;R50/53 |
|
* |
|
|
| 2370-64-1 |
17-hydroxy-3,6,9,12,15-pentaoxaheptadec-1-yllaurat |
N;R50/53 |
|
* |
|
|
| 2379-75-1 |
5-chlor-2-(5-chlor-4,7-dimethyl-3-oxobenzo[b]thien-2(3H)-yliden)-4,7-dimethylbenzo[b]thiophen-3(2H)-on |
N;R50/53 |
|
* |
|
|
| 2379-90-0 |
1-amino-4-hydroxy-2-methoxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 2381-21-7 |
1-methylpyren |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2381-39-7 |
6-methylbenzo[def]chrysen |
Xn;R22 Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 2385-85-5 |
Mirex eller Dodecachlorpentacyclo (5.2.1.02,6.03,9.05,8)decan |
R21/22-40-62-63-64-50/53 |
* |
|
|
* |
| 2386-56-3 |
kaliummethansulfonat- |
Mut3;R40 |
|
* |
|
|
| 2386-57-4 |
natriummethansulfonat- |
Mut3;R40 |
|
* |
|
|
| 2387-18-0 |
3,6-bis(chlormethyl)toluen |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 2387-20-4 |
1-(2-chlorethyl)imidazolidin-2-on |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 2388-14-9 |
p-isopropyl-alpha-methylstyren |
N;R50/53 |
|
* |
|
|
| 2390-22-9 |
1-methyl-4-[3,3,3-tris(4-chlorphenyl)propionyl]piperazin |
N;R50/53 |
|
* |
|
|
| 2396-60-3 |
4-methoxyazobenzen |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 2399-48-6 |
tetrahydrofurfurylacrylat- |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 2401-21-0 |
1,2-dichlor-3-iodobenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2401-24-3 |
6-chlor-m-anisidinhydrochlorid |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 2402-79-1 |
2,3,5,6-tetrachlorpyridin |
R43 N;R50/53 |
|
* |
|
|
| 2416-98-0 |
3-(1,1-dimethylethyl)[1,1'-biphenyl]-2-ol |
R43 N;R50/53 |
|
* |
|
|
| 2422-91-5 |
methylidyntri-p-phenylentriisocyanat |
R43 N;R50/53 |
|
* |
|
|
| 2425-06-1 |
captafol eller 1,2,3,6-tetrahydro-N-(1,1,2,2-tetrachlorethylthio)phthalimid |
Carc2;R45 R43 N;R50/53 |
* |
|
|
|
| 2425-10-7 |
MPMC eller xylylcarb eller 3,4-xylylmethylcarbamat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 2425-28-7 |
alpha-(brommethyl)benzylalkohol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 2426-02-0 |
3,4,5,6-tetrahydrophthalsyreanhydrid |
Xi;R41 R42/43 R52/53 |
* |
|
|
|
| 2426-08-6 |
butylglycidylether |
R10 Xn;R20/22 Xi;R37 Carc3;R40 R43 Mut3;R68 R52/53 |
* |
|
|
|
| 2431-50-7 |
2,3,4-trichlorbut-1-en |
Xn;R22 T;R23 Xi;R36/37/38 Carc3;R40 N;R50/53 |
* |
|
|
|
| 2432-11-3 |
m-terphenyl-2'-ol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2536-05-2 |
diphenylmethan-2,2'-diisocyanat |
Xn;R20 Xi;R36/37/38 R42/43 |
* |
|
|
|
| 2436-85-3 |
dimethyl(2-naphthyl)amin |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 2436-96-6 |
2,2'-dinitrobiphenyl |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 2437-79-8 |
PCB47 |
|
|
|
|
* |
| 2437-95-8 |
DL-pin-2(3)-en |
N;R50/53 |
|
* |
|
|
| 2439-01-2 |
6chinomethionat eller -methyl-1,3-dithiolo[4,5-b]quinoxalin-2-on |
Xn;R20/21/22-48/22 Xi;R36 R43 Rep3;R62 N;R50/53 |
* |
|
|
|
| 2439-04-5 |
isoquinolin-5-ol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 2439-10-3 |
dodin eller dodecylguanidinacetat |
Xn;R22 Xi;R36/38 N;R50/53 |
* |
|
|
|
| 2444-68-0 |
9-vinylanthracen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2446-69-7 |
p-hexylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2451-62-9 |
tgic eller 1,3,5-tris(oxiranylmethyl)-1,3,5-triazin-2,4,6-(1H,3H,5H)-trion |
Mut2;R46 T;R23/25 Xi;R41 R43 Xn;R48/22 R52/53 |
* |
|
|
|
| 2451-84-5 |
dibenzyladipat- |
N;R50/53 |
|
* |
|
|
| 2457-72-9 |
beta-methyl-1H-indol-1-propionsyre |
R43 N;R50 |
|
* |
|
|
| 2461-15-6 |
[[(2-ethylhexyl)oxy]methyl]oxiran |
Mut3;R40 R43 |
|
* |
|
|
| 2461-18-9 |
[(dodecyloxy)methyl]oxiran |
Mut3;R40 R43 |
|
* |
|
|
| 2461-42-9 |
[(naphthyloxy)methyl]oxiran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2461-46-3 |
4,4'-bis(2,3-epoxypropoxy)biphenyl |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2473-01-0 |
1-chlornonan |
R43 N;R50/53 |
|
* |
|
|
| 2473-03-2 |
1-chlorundecan |
R43 N;R50/53 |
|
* |
|
|
| 2475-43-6 |
5-methyl-4-[(4-nitrophenyl)azo]-o-anisidin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 2475-44-7 |
1,4-bis(methylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 2475-45-8 |
1,4,5,8-tetraaminoanthraquinon |
Carc2;R45 Xi;R38-41 R43 |
* |
|
|
|
| 2478-67-3 |
1-amino-2-chlor-4-hydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 2482-39-5 |
methyl-2-decenoat |
N;R50/53 |
|
* |
|
|
| 2486-07-9 |
2,4-dinitro-1-phenoxybenzen |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 2486-13-7 |
2,4-dinitrostilben |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 2491-52-3 |
4-nitroazobenzen |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2492-87-7 |
4-nitrophenyl-beta-D-glucopyranosid |
Mut3;R40 |
|
* |
|
|
| 2497-59-8 |
20-[4-(1,1,3,3-tetramethylbutyl)phenoxy]-3,6,9,12,15,18-hexaoxaicosan-1-ol |
N;R50/53 |
|
* |
|
|
| 2500-59-6 |
methyl-9,10-epoxystearat |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 2506-41-4 |
2-(chlormethyl)naphthalen |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 2511-22-0 |
methyl-3,5-bis-tert-butyl-4-hydroxybenzoat |
R43 N;R50/53 |
|
* |
|
|
| 2516-96-3 |
2-chlor-5-nitrobenzoesyre |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 2530-07-6 |
(25R)-5alpha-spirostan-3beta-ylacetat |
N;R50/53 |
|
* |
|
|
| 2531-84-2 |
2-methylphenanthren |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 2540-35-4 |
3,3-bis(p-chlorphenyl)propionsyre |
R43 N;R50/53 |
|
* |
|
|
| 2541-69-7 |
7-methylbenz[a]anthracen |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 2547-66-2 |
1,3,5-tribenzylhexahydro-1,3,5-triazin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2550-40-5 |
dicyclohexyldisulfid- |
N;R50/53 |
|
* |
|
|
| 2553-08-4 |
4-(1,1,3,3-tetramethylbutyl)phenylsalicylat |
N;R50/53 |
|
* |
|
|
| 2553-71-1 |
4,4'-(3H-2,1-benzoxathiol-3-yliden)bis[2-brom-6-chlorphenol]S,S-dioxid |
N;R50/53 |
|
* |
|
|
| 2563-08-8 |
3-methyl-5-(1,1,3,3-tetramethylbutyl)pyrocatechol |
R43 N;R50/53 |
|
* |
|
|
| 2565-82-4 |
(E)-1-methoxy-3,7-dimethylocta-2,6-dien |
N;R50/53 |
|
* |
|
|
| 2565-83-5 |
(Z)-1-methoxy-3,7-dimethylocta-2,6-dien |
N;R50/53 |
|
* |
|
|
| 2567-14-8 |
1,1,3-trichlorpropen |
Xn;R22 Carc3;R40 N;R50/53 |
|
* |
|
|
| 2568-30-1 |
2-(chlormethyl)-1,3-dioxolan |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 2568-96-9 |
2-ethyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 2577-72-2 |
metabromsalan- |
R43 N;R50/53 |
|
* |
|
|
| 2578-40-7 |
1,6-dimethyl-2-[(1-methyl-4(1H)-quinolyliden)methyl]quinoliniumiodid |
N;R50/53 |
|
* |
|
|
| 2580-80-5 |
5'-amino-2',4'-dimethylbenzanilid |
Mut3;R40 R43 |
|
* |
|
|
| 2581-69-3 |
4-[(4-nitrophenyl)azo]-N-phenylanilin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2589-01-7 |
2,4,6-tris(oxiranylmethoxy)-1,3,5-triazin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 2589-73-3 |
4'-hydroxyoctanophenon |
Xn;R22 R43 N;R50 |
|
* |
|
|
| 2593-15-9 |
etridiazol eller 5-ethoxy-3-trichlormethyl-1,2,4-thiadiazol |
Xn;R21/22 T;R23 Carc3;R40 N;R50/53 |
* |
|
|
|
| 2595-54-2 |
mecarbam eller N-ethoxycarbonyl-N-methylcarbamoylmethyl-O,O-diethyldithiophosphat |
T;R24/25 N;R50/53 |
* |
|
|
|
| 2597-56-0 |
4-nitro-o-anissyre |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 2602-46-2 |
tetranatrium-3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis[5-amino-4-hydroxynaphthalen-2,7-disulfonat] |
Carc2;R45 Rep3;R63 |
* |
|
|
|
| 2613-72-1 |
(1alpha,2alpha,4alpha)-1,2,4-trimethylcyclopentan |
N;R50/53 |
|
* |
|
|
| 2620-05-5 |
2-chlor-N-methyl-N-phenylacetamid |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 2620-44-2 |
1,2-(methylendioxy)-4-nitrobenzen |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 2622-83-5 |
4-(1-methylpropyl)-2-(1-phenylethyl)phenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2623-50-9 |
5,8-dimethylquinolin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 2624-43-3 |
cyclofenil- |
N;R50/53 |
|
* |
|
|
| 2627-27-2 |
3-phenylpropylisothiocyanat |
N;R50/53 |
|
* |
|
|
| 2631-37-0 |
promecarb eller 5-isopropyl-3-tolylmethylcarbamat |
T;R25 N;R50/53 |
* |
|
|
|
| 2631-40-5 |
isoprocarb eller o-cumenylmethylcarbamat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 2631-68-7 |
1,3,5-trichlortrinitrobenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2631-77-8 |
3,5-diiodsalicylaldehyd |
R43 N;R50/53 |
|
* |
|
|
| 2636-26-2 |
cyanophos eller O-4-cyanophenyl-O,O-dimethylthiophosphat |
Xn;R21/22 N;R50/53 |
* |
|
|
|
| 2639-64-7 |
nonylbutyrat- |
N;R50/53 |
|
* |
|
|
| 2639-68-1 |
1,5,9-trimethyl-1-vinyldeca-4,8-dienylisobutyrat |
N;R50/53 |
|
* |
|
|
| 2641-89-6 |
2,3,5,6-tetrabromhydroquinon |
R43 N;R50/53 |
|
* |
|
|
| 2642-71-9 |
azinphos-ethyl eller O,O-diethyl-4-oxobenzotriazin-3-ylmethyldithiophosphat |
T;R24 Tx;R28 N;R50/53 |
* |
|
|
|
| 2642-82-2 |
2,2-bis(p-chlorphenyl)ethanol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2642-98-0 |
chrysen-6-ylamin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 2643-07-4 |
p-[(2-chlorethyl)ethylamino]benzaldehyd |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 2646-15-3 |
1,4-bis(pentylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 2651-46-9 |
4-chlorbutylphenylether |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 2657-87-6 |
3-(4-aminophenoxy)anilin |
Xn;R22 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 2668-47-5 |
2,6-di-tert-butyl-4-phenylphenol |
R43 N;R50/53 |
|
* |
|
|
| 2672-77-7 |
N-(2,4-dimethoxyphenyl)-3-hydroxynaphthalen-2-carboxamid |
N;R50/53 |
|
* |
|
|
| 2672-81-3 |
3-hydroxy-N-(2-methoxydibenzofuran-3-yl)-2-naphthamid |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 2675-89-0 |
2-chlor-N,N-dimethylacetamid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 2676-59-7 |
4,4'-oxybis(benzen-1,2-diamin) |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 2678-21-9 |
1,2,4-trichlor-3,5-dinitrobenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2687-12-9 |
(3-chlorprop-1-enyl)benzen |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 2687-96-9 |
1-dodecyl-2-pyrrolidon |
C;R34 R43 N;R50/53 |
* |
|
|
|
| 2688-84-8 |
2-phenoxyanilin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 2694-54-4 |
triallylbenzen-1,2,4-tricarboxylat |
N;R50/53 |
|
* |
|
|
| 2695-48-9 |
8-bromoct-1-en |
N;R50/53 |
|
* |
|
|
| 2697-92-9 |
(17beta)-17-[[(cyclohexylmethoxy)carbonyl]oxy]androst-4-en-3-on |
N;R50/53 |
|
* |
|
|
| 2702-58-1 |
methyl-3,5-dinitrobenzoat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 2708-97-6 |
1,2,3,4-tetrafluor-5,6-diiodbenzen |
N;R50/53 |
|
* |
|
|
| 2717-42-2 |
1,2,4-trimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2719-52-0 |
2-phenylpentan |
N;R50/53 |
|
* |
|
|
| 2732-58-3 |
6-ethylchrysen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 2734-52-3 |
2,2'-[[4-[(4-nitrophenyl)azo]phenyl]imino]bisethanol |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2735-04-8 |
2,4-dimethoxyanilin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 2735-05-9 |
2,4-bis(chlormethyl)toluen |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 2745-49-5 |
1,4-dichlor-2-(chlormethyl)benzen |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 2746-19-2 |
(1?,2?,3?,6?)-1,2,3,6-tetrahydro-3,6-methanophthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 2751-90-8 |
tetraphenylphosphoniumbromid- |
N;R50/53 |
|
* |
|
|
| 2753-45-9 |
mebeverinhydrochlorid- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2754-17-8 |
bis(2,3-epoxypropyl)adipat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2765-18-6 |
1-propylnaphthalen |
N;R50/53 |
|
* |
|
|
| 2767-70-6 |
(p-nitrobenzyl)triphenylphosphoniumbromid |
N;R50/53 |
|
* |
|
|
| 2768-07-2 |
3-methoxybutylacrylat |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 2769-94-0 |
2,4-bis(1-phenylethyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 2770-11-8 |
2-(4-chlorphenoxy)anilin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 2772-45-4 |
2,4-bis(1-methyl-1-phenylethyl)phenol |
N;R50/53 |
|
* |
|
|
| 2773-50-4 |
2,6-bis(tert-butyl)-4-(4-morpholinylmethyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 2782-57-2 |
dichlor-1,3,5-triazintrion |
O;R8 Xn;R22 R31 Xi;R36/37 N;R50/53 |
* |
|
|
|
| 2784-89-6 |
2-nitro-N-phenylbenzen-1,4-diamin |
Mut3;R40 R43 |
|
* |
|
|
| 2784-94-3 |
2,2'-[[4-(methylamino)-3-nitrophenyl]imino]bisethanol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2808-86-8 |
2,3,4,5-tetrachlorpyridin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2815-58-9 |
1,2,4-trimethylcyclopentan |
N;R50/53 |
|
* |
|
|
| 2825-82-3 |
(3aalpha,4beta,7beta,7aalpha)-octahydro-4,7-methano-1H-inden |
N;R50/53 |
|
* |
|
|
| 2825-83-4 |
(3aalpha,4alpha,7alpha,7aalpha)-octahydro-4,7-methano-1H-inden |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2832-40-8 |
C.I. Disperse Yellow 3 eller N-[4-[(2-hydroxy-5-methylphenyl)azo]phenyl]acetamid |
Carc3;R40 R43 |
* |
|
|
|
| 2835-58-7 |
2-(phenylazo)anilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2835-78-1 |
3-aminobenzophenon |
Mut3;R40 R43 |
|
* |
|
|
| 2840-26-8 |
3-amino-p-anissyre |
Mut3;R40 |
|
* |
|
|
| 2840-28-0 |
3-amino-4-chlorbenzoesyre |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 2844-92-0 |
dipicrylamin, ammoniumsalt |
E;R1 Tx;R26/27/28 R33 N;R51/53 |
* |
|
|
|
| 2851-82-3 |
o-bis(2,3-epoxypropoxy)benzen |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 2855-27-8 |
cyclohexan-1,2,4-triyltris(ethylen) |
N;R50/53 |
|
* |
|
|
| 2869-34-3 |
tridecylamin- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2872-48-2 |
1,4-diamino-2-methoxyanthraquinon |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 2872-52-8 |
2-[ethyl[4-[(4-nitrophenyl)azo]phenyl]amino]ethanol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 2876-22-4 |
phenazin-1-ylamin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 2888-15-5 |
1,1'-methylenbis[2,4,5-trichlorbenzen] |
Xn;R22 N;R50/53 |
|
* |
|
|
| 2893-78-9 |
troclosennatrium |
O;R8 Xn;R22 R31 Xi;R36/37 N;R50/53 |
* |
|
|
|
| 2900-63-2 |
3,5-dinitrobenzohydrazid |
Carc3;R40 |
|
* |
|
|
| 2903-34-6 |
N-(p-chlorphenyl)-p-toluensulfonamid |
Mut3;R40 |
|
* |
|
|
| 2905-17-1 |
di(2,6-xylyl)disulfid |
N;R50/53 |
|
* |
|
|
| 2909-38-8 |
3-chlorphenylisocyanat |
Mut3;R40 R43 |
|
* |
|
|
| 2909-82-2 |
4-tert-butyl-o-toluidin |
Xn;R22 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 2916-31-6 |
2,2-dimethyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 2917-73-9 |
dibutylazelat-m- |
N;R50/53 |
|
* |
|
|
| 2921-88-2 |
chlorpyrifos |
T;R24/25 N;R50/53 |
* |
|
|
|
| 2922-40-9 |
4-nitro-DL-phenylalanin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 2929-91-1 |
4-nitrobenzylidendi(acetat) |
Mut3;R40 |
|
* |
|
|
| 2930-05-4 |
[(benzyloxy)methyl]benzen |
Mut3;R40 R43 |
|
* |
|
|
| 2933-59-7 |
2-(1-naphthylamino)ethanol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 2934-07-8 |
2,4,6-triisopropylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 2944-12-9 |
1,4-bis(phenylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 2944-19-6 |
1-[(4-methylphenyl)amino]anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 2944-30-1 |
1,4-bis[(4-methoxyphenyl)amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 2944-58-3 |
4-chlorphenylsalicylat |
R43 N;R50/53 |
|
* |
|
|
| 2946-76-1 |
2-methyl-1-phenylpiperazin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 2958-36-3 |
2-amino-2',5-dichlorbenzophenon |
N;R50/53 |
|
* |
|
|
| 2958-60-3 |
tetramethylterephthalaldehyddioxim- |
N;R50/53 |
|
* |
|
|
| 2964-48-9 |
[S(R*,R*)]-2-amino-1-(p-nitrophenyl)propan-1,3-diol |
Mut3;R40 R43 |
|
* |
|
|
| 2971-22-4 |
1,1'-(2,2,2-trichlorethyliden)dibenzen |
R43 N;R50/53 |
|
* |
|
|
| 2973-21-9 |
N-methyl-2-nitrobenzen-1,4-diamin |
Mut3;R40 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 2980-64-5 |
DNOC-ammonium |
Tx;R26/27/28 R33 N;R50/53 |
* |
|
|
|
| 2987-66-8 |
1,5-bis(methylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 2987-68-0 |
N,N'-(9,10-dihydro-9,10-dioxoanthracen-1,4-diyl)bisbenzamid |
N;R50/53 |
|
* |
|
|
| 2998-56-3 |
bis(2-chlorethyl)carbamoylchlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 3001-15-8 |
4,4'-diiodbiphenyl |
N;R50/53 |
|
* |
|
|
| 3008-76-2 |
1,5-bis[[4-(dimethylamino)phenyl]amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 3008-87-5 |
4-(cyclohexylamino)-2-methyl-7H-dibenz[f,ij]isoquinolin-7-on |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 3010-63-7 |
4-[(4-ethoxyphenyl)azo]-N,N-diethylanilin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 3010-80-8 |
4,4',4''-trichlortritylalkohol |
R43 N;R50/53 |
|
* |
|
|
| 3015-65-4 |
N,N-dimethylmyristamid |
N;R50/53 |
|
* |
|
|
| 3015-66-5 |
dibutyltetrachlorphthalat- |
R43 N;R50/53 |
|
* |
|
|
| 3016-76-0 |
4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethyliden]bisphthalsyre |
N;R50/53 |
|
* |
|
|
| 3017-96-7 |
1-brom-2-chlorpropan |
Carc3;R40 |
|
* |
|
|
| 3021-31-6 |
2-(p-tert-butylphenoxy)cyclohexylchlorosulfit |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3022-16-0 |
1,4-bis(chlormethyl)-2,3,5,6-tetramethylbenzen |
R43 N;R50/53 |
|
* |
|
|
| 3025-30-7 |
ethyl-(2E,4Z)-2,4-decadienoat |
N;R50/53 |
|
* |
|
|
| 3025-41-0 |
2,2'-[[4-[(2-chlor-4-nitrophenyl)azo]phenyl]imino]bisethanol |
Carc3;R40 R43 |
|
* |
|
|
| 3025-52-3 |
N,N-diethyl-4-[(4-nitrophenyl)azo]anilin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 3025-77-2 |
1-[(4-nitrophenyl)azo]naphthalen-2-amin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 3029-40-1 |
1,8-diphenylocta-1,3,5,7-tetraen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3031-05-8 |
1,2,6-trimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3031-08-1 |
1,3,6-trimethylnaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3032-81-3 |
1,3-dichlor-5-iodobenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3034-19-3 |
2-nitrophenylhydrazin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 3042-69-1 |
1-cyclohexylnaphthalen |
N;R50/53 |
|
* |
|
|
| 3046-94-4 |
2-(N-butylanilino)ethanol |
Mut3;R40 R43 |
|
* |
|
|
| 3055-94-5 |
2-[2-[2-(dodecyloxy)ethoxy]ethoxy]ethanol |
N;R50/53 |
|
* |
|
|
| 3055-95-6 |
3,6,9,12,15-pentaoxaheptacosan-1-ol |
N;R50/53 |
|
* |
|
|
| 3055-96-7 |
3,6,9,12,15,18-hexaoxatriacontan-1-ol |
N;R50/53 |
|
* |
|
|
| 3055-97-8 |
3,6,9,12,15,18,21-heptaoxatritriacontanol |
N;R50/53 |
|
* |
|
|
| 3055-99-0 |
3,6,9,12,15,18,21,24,27-nonaoxanonatriacontan-1-ol |
N;R50/53 |
|
* |
|
|
| 3056-00-6 |
3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaoctatetracontan-1-ol |
N;R50/53 |
|
* |
|
|
| 3056-73-3 |
cinnamanilid- |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 3065-23-4 |
2,4,5-trichlorphenyl-N-[(benzyloxy)carbonyl]-L-valinat |
N;R50/53 |
|
* |
|
|
| 3065-27-8 |
2,4,5-trichlorphenyl-3-phenyl-N-[(phenylmethoxy)carbonyl]-L-alaninat |
N;R50/53 |
|
* |
|
|
| 3070-15-3 |
O,O-diethyl-O-[4-(methylthio)phenyl]thiophosphat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3072-84-2 |
2,2'-[(1-methylethyliden)bis[(2,6-dibrom-4,1-phenylen)oxymethylen]]bisoxiran |
N;R50/53 |
|
* |
|
|
| 3076-87-7 |
N,N'-(9,10-dihydro-4,8-dihydroxy-9,10-dioxoanthracen-1,5-diyl)bis[4-methoxybenzamid] |
N;R50/53 |
|
* |
|
|
| 3077-85-8 |
3-nitrocarbazol |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 3080-97-5 |
N,N'-dicinnamylidenethylendiamin |
N;R50/53 |
|
* |
|
|
| 3081-01-4 |
N-(1,4-dimethylpentyl)-N'-phenylbenzen-1,4-diamin |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 3081-14-9 |
N,N'-bis(1,4-dimethylpentyl)-p-phenylendiamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3084-21-7 |
2-[[4-[(2,6-dichlor-4-nitrophenyl)azo]-3-methylphenyl]methylamino]ethanol |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 3090-35-5 |
Stannane, tributyl[(1-oxo-9-octadecenyl) |
|
|
|
|
* |
| 3091-32-5 |
chlortricyclohexylstannan |
Xn;R20/21/22 N;R50/53 |
* |
|
|
|
| 3095-73-6 |
hexakis(brommethyl)benzen |
R43 N;R50/53 |
|
* |
|
|
| 3096-57-9 |
2-aminofluoren-9-on |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R51/5 |
|
* |
|
|
| 3099-30-7 |
6-chlormethyl-2-methylpyridiniumchlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3100-36-5 |
cis- og trans-cyclohexadec-8-en-1-on, blanding |
N;R50/53 |
* |
|
|
|
| 3101-60-8 |
p-tert-butylphenyl-1-(2,3-epoxy)propylether |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 3102-08-7 |
(S)-2-acetamido-3-(p-hydroxyphenyl)-N-(p-nitrophenyl)propionamid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 3121-70-8 |
1-naphthylbutyrat |
N;R50/53 |
|
* |
|
|
| 3123-13-5 |
N-[1-(hydroxymethyl)-2-(4-nitrophenyl)-2-oxoethyl]acetamid |
Mut3;R40 |
|
* |
|
|
| 3126-95-2 |
(propoxymethyl)oxiran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 3130-96-9 |
rathyronin- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3137-00-6 |
diallylsebacat- |
N;R50/53 |
|
* |
|
|
| 3147-53-3 |
5-(phenylazo)salicylsyre |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 3147-75-9 |
2-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol |
N;R50/53 |
|
* |
|
|
| 3150-24-1 |
4-nitrophenyl-beta-D-galactopyranosid |
Mut3;R40 |
|
* |
|
|
| 3150-25-2 |
m-nitrophenyl-beta-D-galactopyranosid |
Mut3;R40 |
|
* |
|
|
| 3150-82-1 |
4-[(2-chlor-4-nitrophenyl)azo]-N-phenylanilin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 3153-36-4 |
ethyl-4-chlorbutyrat |
Mut3;R40 R43 |
|
* |
|
|
| 3153-37-5 |
methyl-4-chlorbutyrat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 3158-73-4 |
2-cyclopropylanilin |
Mut3;R40 R43 |
|
* |
|
|
| 3158-98-3 |
2-amino-5-chlor-alpha-methylbenzhydrylalkohol |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 3167-31-5 |
N,N'-bis(1,3-dimethylbutyliden)hexan-1,6-diamin |
N;R50/53 |
|
* |
|
|
| 3171-45-7 |
4,5-dimethyl-o-phenylendiamin |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 3173-72-6 |
1,5-naphthylendiisocyanat |
Xn;R20 Xi;R36/37/38 R42 R52/53 |
* |
|
|
|
| 3179-89-3 |
2,2'-[[3-methyl-4-[(4-nitrophenyl)azo]phenyl]imino]bisethanol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 3179-90-6 |
1,4-dihydroxy-5,8-bis[(2-hydroxyethyl)amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 3179-96-2 |
1-(methylamino)-4-(phenylamino)anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 3180-81-2 |
2-[[4-[(2-chlor-4-nitrophenyl)azo]phenyl]ethylamino]ethanol |
Carc3;R40 R43 |
|
* |
|
|
| 3182-02-3 |
3-(2,4-dichloranilino)-1-(2,4,6-trichlorphenyl)-5-pyrazolon |
N;R50/53 |
|
* |
|
|
| 3184-65-4 |
natrium-2-benzyl-4-chlorphenolat |
R43 N;R50/53 |
|
* |
|
|
| 3188-83-8 |
5-[1-methyl-1-[4-(oxiranylmethoxy)phenyl]ethyl]-2-(oxiranylmethoxy)benzylalkohol |
Mut3;R40 R43 |
|
* |
|
|
| 3209-37-8 |
oxiranylmethyl-p-vinylbenzoat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 3216-47-5 |
3-(chlormethyl)benzo[b]thiophen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3221-61-2 |
2-methyloctan |
N;R50/53 |
|
* |
|
|
| 3224-36-0 |
2,4-dichlor-6-pyren-1-yl-1,3,5-triazin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3234-49-9 |
1,2-dibrompentan |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 3236-71-3 |
9,9-bis(4-hydroxyphenyl)fluoren |
Xi;R36/38 N;R50/53 |
* |
|
|
|
| 3239-35-8 |
(E)-6,10-dimethylundeca-5,9-dien-2-ylacetat |
N;R50/53 |
|
* |
|
|
| 3239-37-0 |
(Z)-6,10-dimethylundeca-5,9-dien-2-ylacetat |
N;R50/53 |
|
* |
|
|
| 3240-94-6 |
4-(2-chlorethyl)morpholin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 3242-08-8 |
1-methyl-4-(1-methylethyliden)-2-(1-methylvinyl)-1-vinylcyclohexan |
N;R50/53 |
|
* |
|
|
| 3244-90-4 |
O,O,O',O'-tetrapropyl-dithiopyrophosphat |
Xn;R21/22 N;R50/53 |
* |
|
|
|
| 3245-38-3 |
methyl-3-alpha-12-alpha-dihydroxy-5-beta-cholan-24-oat |
N;R50/53 |
|
* |
|
|
| 3247-00-5 |
4,4',4''-trimethyltritylalkohol |
N;R50/53 |
|
* |
|
|
| 3247-34-5 |
dinatrium-2,2'-methylenbis[3,4,6-trichlorphenolat] |
R43 N;R50/53 |
|
* |
|
|
| 3251-56-7 |
2-methoxy-4-nitrophenol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 3253-39-2 |
4,4'-isopropylidendiphenyldimethacrylat |
N;R50/53 |
|
* |
|
|
| 3254-89-5 |
alpha,alpha-diphenylpiperidin-1-butanolhydrochlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3271-22-5 |
2,4-dimethoxy-6-pyren-1-yl-1,3,5-triazin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3274-19-9 |
N-anthraquinon-1-ylacetamid |
Mut3;R40 |
|
* |
|
|
| 3278-89-5 |
2-(allyloxy)-1,3,5-tribrombenzen |
N;R50/53 |
|
* |
|
|
| 3282-56-2 |
1-tert-butyl-4-nitrobenzen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 3290-01-5 |
1,2-dichlor-3-(chlormethyl)benzen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 3290-99-1 |
p-anisohydrazid |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 3291-03-0 |
3,4,5-trimethoxybenzohydrazid |
Mut3;R40 |
|
* |
|
|
| 3293-32-1 |
2,6-di(cyclohexyliden)cyclohexan-1-on |
N;R50/53 |
|
* |
|
|
| 3293-47-8 |
alpha,2,6,6-tetramethylcyclohexen-1-propan-1-ol |
N;R50/53 |
|
* |
|
|
| 3295-96-3 |
1-(allyloxy)decan |
N;R50/53 |
|
* |
|
|
| 3307-00-4 |
p-(1-ethylhexyl)phenol |
N;R50/53 |
|
* |
|
|
| 3307-01-5 |
p-(1-propylpentyl)phenol |
N;R50/53 |
|
* |
|
|
| 3312-04-7 |
1,1'-(4-chlorbutyliden)bis[4-fluorbenzen] |
N;R50/53 |
|
* |
|
|
| 3312-08-1 |
1,1'-(4-chlorbutyliden)bisbenzen |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 3320-86-3 |
2-nitrophenylisocyanat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 3321-49-1 |
4-[(2-chlor-4,6-dinitrophenyl)azo]naphthalen-1-amin |
Mut3;R40 |
|
* |
|
|
| 3321-50-4 |
1,2-dicyclohexylethan |
N;R50/53 |
|
* |
|
|
| 3321-86-6 |
10,10'-(ethen-1,2-diyliden)dianthron |
N;R50/53 |
|
* |
|
|
| 3322-32-5 |
2-[4-(2,3-epoxypropoxy)phenyl]-6-oxabicyclo[3.1.0]hexan |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 3322-93-8 |
1,2-dibrom-4-(1,2-dibromethyl)cyclohexan |
N;R50/53 |
|
* |
|
|
| 3326-64-5 |
(2S-trans)-4-hydroxy-N-2-naphthylpyrrolidin-2-carboxamid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 3326-90-7 |
3-chlor-2-hydroxypropylacrylat |
Xn;R22 Mut3;R40 N;R50 |
|
* |
|
|
| 3332-48-7 |
1,3-bis(2,3-epoxypropoxy)butan |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 3333-67-3 |
nikkelcarbonat |
Xn;R22 Carc3;R40 R43 N;R50/53 |
* |
|
|
|
| 3339-11-5 |
tolpropaminhydrochlorid- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3347-22-6 |
dithianon |
Xn;R22 N;R50/53 |
* |
|
|
|
| 3351-28-8 |
1-methylchrysen |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 3352-87-2 |
N,N-diethyldodecanamid |
N;R50/53 |
|
* |
|
|
| 3353-12-6 |
4-methylpyren |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3366-63-0 |
O,O'-(4,4'-diaminobiphenyl-3,3'-ylen)diglycolsyre |
Mut3;R40 |
|
* |
|
|
| 3370-27-2 |
m-di-tert-pentylbenzen |
N;R50/53 |
|
* |
|
|
| 3370-28-3 |
o-di-tert-pentylbenzen |
N;R50/53 |
|
* |
|
|
| 3373-10-2 |
p-di-tert-pentylbenzen |
N;R50/53 |
|
* |
|
|
| 3379-38-2 |
m-diphenoxybenzen |
N;R50/53 |
|
* |
|
|
| 3380-34-5 |
triclosan; phenol, 5-chloro-2-(2,4-dichlorophenoxy)- |
N;R50/53 |
* |
|
|
|
| 3383-30-0 |
N-[4-hydroxy-2-methyl-5-(1-methylethyl)phenyl]acetamid |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 3383-96-8 |
temephos- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3384-04-1 |
(3-chlorpropoxy)benzen |
Xn;R22 Mut3;R40 N;R50 |
|
* |
|
|
| 3385-66-8 |
[(octyloxy)methyl]oxiran |
Mut3;R40 |
|
* |
|
|
| 3393-72-4 |
8-amino-3,4-dimethylquinolin |
Mut3;R40 |
|
* |
|
|
| 3393-78-0 |
bis(4-bromphenyl)sulfid |
R43 N;R50/53 |
|
* |
|
|
| 3393-96-2 |
4'-nitrobenzanilid |
Mut3;R40 |
|
* |
|
|
| 3398-09-2 |
4-m-tolylazo-m-toluidin |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 3402-74-2 |
p-(p-nitrophenoxy)toluen |
Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 3407-42-9 |
3-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-ol |
N;R50/53 |
|
* |
|
|
| 3424-82-6 |
2,2,o,p'-tetrachlorvinylidenbisbenzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3425-89-6 |
1,2,3,6-tetrahydro-4-methylphthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 3426-08-2 |
prozapin- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3442-78-2 |
2-methylpyren |
N;R50/53 |
|
* |
|
|
| 3443-45-6 |
pyren-1-smorsyre |
N;R50/53 |
|
* |
|
|
| 3454-07-7 |
4-ethylstyren |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3454-28-2 |
furfurylmethacrylat- |
Mut3;R40 |
|
* |
|
|
| 3459-18-5 |
4'-nitrophenyl-2-acetamido-2-deoxy-beta-glucopyranosid |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 3460-11-5 |
4-nitrobenzanilid |
Mut3;R40 |
|
* |
|
|
| 3460-67-1 |
1'(og 2')-[1-(2-furyl)ethyliden]nicotinohydrazid |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 3468-63-1 |
1-[(2,4-dinitrophenyl)azo]-2-naphthol |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 3478-94-2 |
3-(2-methylpiperidino)propyl-3,4-dichlorbenzoat |
N;R50/53 |
|
* |
|
|
| 3481-20-7 |
2,3,5,6-tetrachloranilin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3482-63-1 |
1-methoxydodecan |
N;R50/53 |
|
* |
|
|
| 3486-08-6 |
1,1,1,2,3,3,4,4,5,5,6,6-dodecafluor-6-iod-2-(trifluormethyl)hexan |
N;R50/53 |
|
* |
|
|
| 3488-00-4 |
hexylcinnamat- |
N;R50/53 |
|
* |
|
|
| 3488-53-7 |
4-[4-(isopropyl)phenyl]-3-methylbut-3-en-2-on |
N;R50/53 |
|
* |
|
|
| 3497-06-1 |
[(decyloxy)methyl]oxiran |
Mut3;R40 |
|
* |
|
|
| 3515-94-4 |
2-pentyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 3520-72-7 |
4,4'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one] |
|
|
|
* |
|
| 3539-38-6 |
2-hydroxypropylmyristat |
N;R50/53 |
|
* |
|
|
| 3542-36-7 |
dichlorodioctylstannane |
|
|
|
* |
|
| 3550-43-4 |
2-hydroxyhept-4-oxybenzophenon |
N;R50/53 |
|
* |
|
|
| 3555-11-1 |
allylpentabromphenylether- |
N;R50/53 |
|
* |
|
|
| 3558-69-8 |
2,6-diphenylpyridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3561-67-9 |
[methylenbis(thio)]bisbenzen |
N;R50/53 |
|
* |
|
|
| 3562-03-6 |
4-nitrophenyl-O-benzyl-N-[(benzyloxy)carbonyl]-L-tyrosinat |
N;R50/53 |
|
* |
|
|
| 3563-45-9 |
Tetrachloro DDT = 1,1,1,2-Tetrachloro-2,2-bis(4-chlorophenyl)ethane |
|
|
|
|
* |
| 3566-44-7 |
N-(4-methoxyphenyl)benzen-1,4-diaminmonohydrochlorid |
Xn;R22 Mut3;R40 R43 R52/53 |
|
|
|
|
| 3570-58-9 |
2-chlorethylmethansulfonat |
Mut3;R40 |
|
* |
|
|
| 3572-43-8 |
bromhexin- |
R43 N;R50/53 |
|
* |
|
|
| 3572-52-9 |
xenysalat- |
N;R50/53 |
|
* |
|
|
| 3575-32-4 |
N,N-dimethylbenzen-1,3-diamindihydrochlorid |
Carc3;R40 R43 R52/53 |
|
* |
|
|
| 3579-85-9 |
N-(4-hydroxyphenyl)cinnamamid |
Mut3;R40 R43 |
|
* |
|
|
| 3586-12-7 |
3-phenoxyanilin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 3590-84-9 |
Tetraoctyltin |
|
|
|
* |
|
| 3593-85-9 |
methandrioldipropionat- |
N;R50/53 |
|
* |
|
|
| 3602-47-9 |
4'-fluor-2-hydroxy-4-methoxybenzophenon |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 3606-21-1 |
5-methyl-2,4-dinitroanisol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 3607-17-8 |
brom(3-brompropyl)triphenylphosphor |
N;R50/53 |
|
* |
|
|
| 3614-69-5 |
dimetindenhydrogenmaleat- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3625-06-7 |
mebeverin- |
N;R50/53 |
|
* |
|
|
| 3634-86-4 |
6,6'-methylenbis(4-tert-butyl-o-cresol) |
R43 N;R50/53 |
|
* |
|
|
| 3634-95-5 |
dihexylglutarat- |
N;R50/53 |
|
* |
|
|
| 3644-56-2 |
2-chlor-N-(2,6-dichlorphenyl)acetamid |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 3651-02-3 |
4-(phenylazo)-1-naphthol |
Mut3;R40 |
|
* |
|
|
| 3651-62-5 |
3-hydroxy-4'-methyl-2-naphthanilid |
R43 N;R50/53 |
|
* |
|
|
| 3652-91-3 |
2-methyl-9H-carbazol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 3658-48-8 |
bis(2-ethylhexyl)phosphonat |
N;R50/53 |
|
* |
|
|
| 3678-15-7 |
[(vinyloxy)methyl]oxiran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 3678-70-4 |
2-benzhydrylpyridin |
N;R50/53 |
|
* |
|
|
| 3678-71-5 |
3-benzhydrylpyridin |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 3678-72-6 |
4-benzhydrylpyridin |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 3679-64-9 |
5-brom-4'-chlorsalicylanilid |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 3681-02-5 |
[(cyclohexyloxy)methyl]oxiran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 3688-79-7 |
3-methoxy-7H-benz[de]anthracen-7-on |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 3689-20-1 |
3-hydroxy-4'-methoxy-2'-methyl-2-naphthanilid |
R43 N;R50/53 |
|
* |
|
|
| 3689-55-2 |
(R*,R*)-(±)-2-amino-1-(p-nitrophenyl)propan-1,3-diol |
Mut3;R40 R43 |
|
* |
|
|
| 3691-35-8 |
chlorophacinon |
T;R23-48/24/25 Tx;R27/28 N;R50/53 |
* |
|
|
|
| 3691-93-8 |
N-(2-ethoxyphenyl)-2-hydroxydibenzofuran-3-carboxamid |
N;R50/53 |
|
* |
|
|
| 3695-38-3 |
2-methyl-2-(4-methylpent-3-enyl)-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 3698-83-7 |
1,5-dichlor-2,4-dinitrobenzen |
R43 N;R50/53 |
|
* |
|
|
| 3710-23-4 |
2-(1-methylvinyl)naphthalen |
N;R50/53 |
|
* |
|
|
| 3714-62-3 |
1,2,3,5-tetrachlor-4-nitrobenzen |
R43 N;R50/53 |
|
* |
|
|
| 3726-36-1 |
1,2,3,5-tetramethylcyclohexan |
N;R50/53 |
|
* |
|
|
| 3731-39-3 |
N,N-dimethyl-4-(o-tolylazo)anilin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 3734-48-3 |
4,5,6,7,8,8-hexachlor-3a,4,7,7a-tetrahydro-4,7-methano-1H-inden |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3734-97-2 |
[2-(diethylthiophosphor-S-yl)ethyl]diethylammoniumhydrogenoxalat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 3739-67-1 |
4,4'-isopropylidenbis[(allyloxy)benzen] |
N;R50/53 |
|
* |
|
|
| 3741-77-3 |
2,4,6-tribromphenylacrylat |
R43 N;R50/53 |
|
* |
|
|
| 3741-80-8 |
N-(1,1-dimethylethyl)bis(2-benzothiazolsulfen)amid |
N;R50/53 |
* |
|
|
|
| 3747-74-8 |
2-(chlormethyl)quinolinhydrochlorid |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 3748-13-8 |
m-bis(1-methylvinyl)benzen |
R43 N;R50/53 |
|
* |
|
|
| 3749-87-9 |
methyl-3-alpha-7-alpha-diacetoxy-12-alpha-hydroxy-5-beta-cholan-24-oat |
N;R50/53 |
|
* |
|
|
| 3760-66-5 |
2-brom-4,4'-dichlorbutyrophenon |
R43 N;R50/53 |
|
* |
|
|
| 3766-81-2 |
fenobucarb eller 2-sec-butylphenylmethylcarbamat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 3767-28-0 |
4-nitrophenyl-alpha-D-glucopyranosid |
Mut3;R40 |
|
* |
|
|
| 3767-59-7 |
2-[4-[2-(benzoxazol-2-yl)vinyl]phenyl]-5-methylbenzoxazol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3769-57-1 |
2,2'-[[4-[(2-chlor-4-nitrophenyl)azo]-3-methylphenyl]imino]bisethanol |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 3772-23-4 |
2,2'-butylidenbis[4,6-xylenol] |
R43 N;R50/53 |
|
* |
|
|
| 3775-84-6 |
acetaldehydbis(2,3-epoxypropyl)acetal |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 3777-71-7 |
2-heptylfuran |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3780-50-5 |
p-(octyloxy)phenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3788-66-7 |
2-[2-[4-(benzoxazol-2-yl)phenyl]vinyl]-5-methylbenzoxazol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3808-86-4 |
di(2,5-xylyl)disulfid |
N;R50/53 |
|
* |
|
|
| 3808-87-5 |
2,4,5-trichlorphenyldisulfid |
N;R50/53 |
|
* |
|
|
| 3810-80-8 |
diphenoxylathydrochlorid- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3811-49-2 |
dioxabenzofos eller 2-methoxy-4H-1,3,2-benzodioxaphosphorin-2-sulfid |
T;R24/25-39/25 N;R51/53 |
* |
|
|
|
| 3813-13-6 |
2',6-dichlor-2,4'-methylendianilin |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 3814-55-9 |
(isobutoxymethyl)oxiran |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 3820-83-5 |
N-ethylheptadecafluor-N-[2-(phosphonooxy)ethyl]octansulfonamid |
N;R50/53 |
|
* |
|
|
| 3836-23-5 |
norethisteronenantat- |
N;R50/53 |
|
* |
|
|
| 3839-46-1 |
stilben-4-ol |
R43 N;R50/53 |
|
* |
|
|
| 3840-18-4 |
2-(2-methylphenoxy)anilin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 3840-30-0 |
5-(chlormethyl)-1,2,3-trimethoxybenzen |
Mut3;R40 R43 |
|
* |
|
|
| 3846-49-9 |
1,3-diethyl-1,3-bis(4-nitrophenyl)urinstof |
Mut3;R40 R43 |
|
* |
|
|
| 3846-71-7 |
2-benzotriazol-2-yl-4,6-di-tert-butylphenol |
N;R50/53 |
|
* |
|
|
| 3847-57-2 |
natrium-4-nitrobenzoat |
Mut3;R40 R43 |
|
* |
|
|
| 3847-58-3 |
3-chlor-2,4-difluornitrobenzen |
Xn;R22 C;R34 R43 N;R50/53 |
* |
|
|
|
| 3853-91-6 |
iodpentamethylbenzen- |
N;R50/53 |
|
* |
|
|
| 3860-63-7 |
1,5-dihydroxy-4,8-bis(methylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 3861-41-4 |
2,6-dibrom-4-cyanphenylbutyrat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3861-47-0 |
ioxynil-octanoat eller 4-cyan-2,6-diiodphenyloctanoat |
Xn;R22 Rep3;R63 N;R50/53 |
* |
|
|
|
| 3864-99-1 |
2,4-di-tert-butyl-6-(5-chlorbenzotriazol-2-yl)phenol |
N;R50/53 |
|
* |
|
|
| 3871-31-6 |
tris(4-chlorphenyl)phosphat |
N;R50/53 |
|
* |
|
|
| 3874-54-2 |
4-chlor-4'-fluorbutyrophenon |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 3874-84-8 |
6-amino-5-[(2-chlor-4-nitrophenyl)azo]naphthalen-1-sulfonamid |
Mut3;R40 |
|
* |
|
|
| 3876-97-9 |
1,2,8-trimethylnaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3878-19-1 |
fuberidazol eller 2-(2-furyl)benzimidazol |
Xn;R22 N;R50/53 |
* |
|
|
|
| 3878-45-3 |
triphenylphosphinsulfid- |
N;R50/53 |
|
* |
|
|
| 3883-86-1 |
2,2',3,3',5,5',6,6'-octafluor-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 3884-95-5 |
o-(1,1,3,3-tetramethylbutyl)phenol |
N;R50/53 |
|
* |
|
|
| 3898-26-8 |
(2-chlor-1-methoxyethyl)benzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 3905-64-4 |
2,6-di-tert-butylnaphthalen |
N;R50/53 |
|
* |
|
|
| 3905-96-2 |
2,2',3,3',5,5',6,6'-octafluor-4,4'-dinitro-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 3913-71-1 |
2-decenal |
N;R50/53 |
|
* |
|
|
| 3913-81-3 |
(E)-2-decenal |
N;R50/53 |
|
* |
|
|
| 3915-83-1 |
nerylisovalerat- |
N;R50/53 |
|
* |
|
|
| 3918-33-0 |
3-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-on |
N;R50/53 |
|
* |
|
|
| 3933-94-6 |
4-phenoxy-1,1'-biphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 3946-29-0 |
3,4'-dichlorpropiophenon |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 3955-26-8 |
1,2,4-trichlor-5-(chlormethyl)benzen |
R43 N;R50/53 |
|
* |
|
|
| 3968-92-1 |
sec-butyltriphenylphosphoniumbromid |
N;R50/53 |
|
* |
|
|
| 3988-03-2 |
4,4'-dibrombenzophenon |
R43 N;R50/53 |
|
* |
|
|
| 4003-94-5 |
p-nitrostilben |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 4005-68-9 |
3-[(4-anilinophenyl)azo]benzensulfonsyre |
Mut3;R40 R43 |
|
* |
|
|
| 4006-73-9 |
1-benzylcycloheptan-1-ol |
N;R50/53 |
|
* |
|
|
| 4008-48-4 |
nitroxolin- |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 4016-11-9 |
(ethoxymethyl)oxiran |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 4016-14-2 |
2,3-epoxypropylisopropylether |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 4024-34-4 |
2-[(p-methyl-alpha-phenylbenzyl)oxy]ethyl(dimethyl)ammoniumchlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4032-26-2 |
diquatdichlorid |
Xn;R22 Tx;R26 Xi;R36/37/38 R43 T;R48/25 N;R50/53 |
* |
|
|
|
| 4032-80-8 |
di-o-tolyldisulfid |
N;R50/53 |
|
* |
|
|
| 4049-81-4 |
2-methylhexa-1,5-dien |
N;R50/53 |
|
* |
|
|
| 4067-16-7 |
pentaethylenhexamin |
C;R34 R43 N;R50/53 |
* |
|
|
|
| 4072-67-7 |
1,1'-[1,1'-biphenyl]-4,4'-diylbis[2-bromethan-1-on] |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4074-25-3 |
1,3,5-tri(tert-butyl)-2-nitrobenzen |
R43 N;R50/53 |
|
* |
|
|
| 4081-35-0 |
2,2'-[1,6-hexandiylbis(nitrilomethylidyn)]bisphenol |
N;R50/53 |
|
* |
|
|
| 4083-64-1 |
tosylisocyanat eller 4-toluensulfonylisocyanat |
R14 Xi;R36/37/38 R42 |
* |
|
|
|
| 4085-18-1 |
3-nitrobiphenyl-4-ylamin |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 4096-72-4 |
2,6-di-tert-butyl-4-chlorphenol |
R43 N;R50/53 |
|
* |
|
|
| 4097-36-3 |
dinosam eller 2-(1-methylbutyl)-4,6-dinitrophenol |
T;R23/24/25 N;R50/53 |
* |
|
|
|
| 4098-71-9 |
isophorondiisocyanat eller 3-isocyanatomethyl-3,5,5-trimethylcyclohexylisocyanat |
T;R23 Xi;R36/37/38 R42/43 N;R51/53 |
* |
|
|
|
| 4099-65-4 |
2-hexyl-4,6-dinitrophenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4101-68-2 |
1,10-dibromdecan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 4104-14-7 |
phosacetim eller O,O-bis(4-chlorphenyl)-N-acetimidoylthiophosphoramidat |
Tx;R27/28 N;R50/53 |
* |
|
|
|
| 4105-12-8 |
(1S*,3S*)-[1alpha,2alpha,4alpha,6alpha]-3-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-ol |
N;R50/53 |
|
* |
|
|
| 4130-42-1 |
2,6-di-tert-butyl-4-ethylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4136-97-4 |
methyl-p-aminosalicylat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 4137-11-5 |
p,p',p''-(1-propanyl-3-yliden)triphenol |
R43 N;R50/53 |
|
* |
|
|
| 4151-97-7 |
1-chlor-3-methoxypropan-2-ol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 4157-74-8 |
p-[butyl(2-chlorethyl)amino]benzaldehyd |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 4162-45-2 |
4,4'-isopropylidenbis(2-(2,6-dibromphenoxy)ethanol) |
R43 N;R50/53 |
|
* |
|
|
| 4163-78-4 |
methyl-2,4,5-trichlorphenylsulfid |
N;R50/53 |
|
* |
|
|
| 4175-38-6 |
N,N'-dicyclohexyl-p-phenylendiamin |
R43 N;R50/53 |
|
* |
|
|
| 4178-93-2 |
(S)-2-amino-4-methyl-N-(4-nitrophenyl)valeramid |
Mut3;R40 R43 |
|
* |
|
|
| 4179-38-8 |
2-octylfuran |
N;R50/53 |
|
* |
|
|
| 4180-26-1 |
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluornonylacrylat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 4194-00-7 |
2-methoxy-4-prop-1-enylphenylbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 4196-86-5 |
pentaerythritoltetrabenzoat- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 4206-61-5 |
2,2'-[oxybis(ethylenoxymethylen)]bisoxiran |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 4209-02-3 |
1-(4-bromphenyl)-2-chlorethan-1-on |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 4213-45-0 |
N-{1}-,N-{1}-bis(2-chlorethyl)-N-{4}-(6-chlor-2-methoxyacridin-9-yl)pentan-1,4-diamindihydrochlorid |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 4223-14-7 |
1,3,5-tris(2,3-epoxypropoxy)benzen |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 4223-17-0 |
[(p-octylphenoxy)methyl]oxiran |
Mut3;R40 R43 |
|
* |
|
|
| 4230-97-1 |
allyloctanoat- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 4237-40-5 |
1-sec-butyl-4-nitrobenzen |
Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 4237-44-9 |
o-(1-phenylethyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 4250-81-1 |
1-pentynylbenzen |
N;R50/53 |
|
* |
|
|
| 4252-78-2 |
2,2',4'-trichloracetophenon |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 4265-25-2 |
2-methylbenzofuran |
Mut3;R40 R43 |
|
* |
|
|
| 4265-27-4 |
2-butylbenzofuran |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 4269-15-2 |
4-amino-9H-fluoren-9-on |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 4273-92-1 |
4'-chlor-3-hydroxy-2',5'-dimethoxy-2-naphthanilid |
R43 N;R50/53 |
|
* |
|
|
| 4274-06-0 |
2-(2-chlor-4-nitrophenylazo)-5-methoxy-p-toluidin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 4285-42-1 |
methylphenylcarbamoylchlorid- |
Mut3;R40 R43 |
|
* |
|
|
| 4292-75-5 |
hexylcyclohexan- |
N;R50/53 |
|
* |
|
|
| 4292-92-6 |
pentylcyclohexan- |
N;R50/53 |
|
* |
|
|
| 4317-79-7 |
N-tetradecylpropan-1,3-diamin |
R43 N;R50/53 |
|
* |
|
|
| 4320-32-5 |
1,1-diphenyl-3-dimethylaminobutan-1-ol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4325-77-3 |
2-phenylphenanthren |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 4342-30-7 |
Phenol, 2-[[(tributylstannyl)oxy]carbony |
|
|
|
|
* |
| 4342-36-3 |
Stannane, (benzoyloxy)tributyl |
|
|
|
|
* |
| 4353-06-4 |
2-nonyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 4356-32-5 |
methyl-3beta-hydroxy-20-oxo-30-norlupan-28-oat |
N;R50/53 |
|
* |
|
|
| 4359-47-1 |
2-(1-ethylpentyl)-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 4359-57-3 |
2-heptyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 4360-60-5 |
2-phenethyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 4360-63-8 |
2-brommethyl-1,3-dioxolan |
Xn;R22 Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 4362-20-3 |
2-benzyl-4-phenyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 4362-22-5 |
2-(1-phenylethyl)-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 4362-36-1 |
2-(2-chlorethyl)-1,3-dioxolan |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 4377-41-7 |
2-(chlormethyl)quinolin |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 4378-61-4 |
4,10-dibromdibenzo[def,mno]chrysen-6,12-dion |
N;R50/53 |
|
* |
|
|
| 4388-58-3 |
1,3-dioxolan-2-propiononitril |
Xn;R22 N;R50/53 |
|
* |
|
|
| 4388-60-7 |
1,3-dioxolan-2-propylamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4390-04-9 |
2,2,4,4,6,8,8-heptamethylnonan |
N;R50/53 |
|
* |
|
|
| 4395-65-7 |
1-amino-4-(phenylamino)anthraquinon |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 4403-12-7 |
2-[2-[2-(tridecyloxy)ethoxy]ethoxy]ethanol |
N;R50/53 |
|
* |
|
|
| 4404-45-9 |
1-hexylisothiocyanat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 4405-17-8 |
2,2'-methylenbis[1,3-dioxolan] |
N;R50/53 |
|
* |
|
|
| 4409-11-4 |
4-(4'-chlorbenzyl)pyridin |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R51/5 |
|
* |
|
|
| 4421-10-7 |
2,2-diisopropyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 4425-73-4 |
9H-fluoren-9-ylideneddikesyre |
Mut3;R40 |
|
* |
|
|
| 4426-83-9 |
heptylisothiocyanat- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 4428-13-1 |
1,1,2-triphenylethanol |
N;R50/53 |
|
* |
|
|
| 4438-16-8 |
5-(phenylazo)toluen-3,4-diaminmonohydrochlorid |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 4444-48-8 |
2-hydroxy-N-naphthyl-3-dibenzofuran-3-carboxamid |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 4464-23-7 |
cadmiumdiformiat |
T;R23/25 R33 Xn;R68 N;R50/53 |
* |
|
|
|
| 4465-58-1 |
1-[(2-hydroxyethyl)amino]anthraquinon |
Carc3;R40 |
|
* |
|
|
| 4471-41-4 |
1,4-bis[(2-hydroxyethyl)amino]anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 4482-55-7 |
fenuron-TCA eller 1,1-dimethylphenyluroniumtrichlor-acetat |
Xi;R38 N;R50/53 |
* |
|
|
|
| 4486-13-9 |
1-amino-9,10-dihydro-4-(methylamino)-9,10-dioxoanthracen-2-carboxamid |
Mut3;R40 |
|
* |
|
|
| 4488-57-7 |
3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden |
N;R50/53 |
|
* |
|
|
| 4488-58-8 |
exo-p-(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 4490-10-2 |
1-chlor-3,7-dimethylocta-2,6-dien |
N;R50/53 |
|
* |
|
|
| 4496-47-3 |
N-[4-(1,1,3,3-tetramethylbutyl)phenyl]naphthalen-2-amin |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 4497-92-1 |
(1S-cis)-3,7,7-trimethylbicyclo[4.1.0]hept-2-en |
N;R50/53 |
|
* |
|
|
| 4501-53-5 |
4-cyclohexyl-o-xylen |
N;R50/53 |
|
* |
|
|
| 4509-09-5 |
methyl-3,4-epoxybutyrat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 4513-56-8 |
2-bromethylmethacrylat |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 4524-95-2 |
2-methyl-2-azabicyclo[2.2.1]heptan |
R10 Xn;R21/22-48/20 C;R34 |
* |
|
|
|
| 4533-92-0 |
(Z)-1,1'-[vinylenbis(thio)]bispropan |
N;R50/53 |
|
* |
|
|
| 4540-00-5 |
2,2'-[[3-chlor-4-[(4-nitrophenyl)azo]phenyl]imino]bisethanol |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 4559-30-2 |
kalium-2,3,6-trichlorbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 4559-96-0 |
4'-brom-4-chlorbutyrophenon |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 4563-40-0 |
(3,4-dihydro-2H-pyran-2-yl)methylacrylat |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 4563-45-5 |
(3,4-dihydro-2H-pyran-2-yl)methylmethacrylat |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 4569-00-0 |
2-[N-(2,4-dimethylphenyl)carbamoyl]-3-naphthylacetat |
R43 N;R50/53 |
|
* |
|
|
| 4596-16-1 |
17-hydroxypregn-4-en-3,20-dion-17-heptanoat |
N;R50/53 |
|
* |
|
|
| 4598-67-8 |
3beta-hydroxypregn-5-en-20-on-3-(hydrogensuccinat) |
N;R50/53 |
|
* |
|
|
| 4602-84-0 |
farnesol- |
N;R50/53 |
|
* |
|
|
| 4618-99-9 |
(R*,R*)-(±)-N-[2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]acetamid |
Mut3;R40 |
|
* |
|
|
| 4619-74-3 |
2,4,6-tribrom-m-cresol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4629-58-7 |
4-(4-nitrostyryl)anilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 4630-07-3 |
[1R-(1alpha,7beta,8alpha)]-1,2,3,5,6,7,8,8a-octahydro-1,8a-dimethyl-7-(1-methylvinyl)naphthalen |
N;R50/53 |
|
* |
|
|
| 4630-20-0 |
3-methyl-9H-carbazol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 4638-04-4 |
[(o-allylphenoxy)methyl]oxiran |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 4638-48-6 |
5-chlorsalicylanilid |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 4645-15-2 |
1,1'-oxybis(cyclohexan) |
N;R50/53 |
|
* |
|
|
| 4650-79-7 |
bis(tetrahydrofurfuryl)sebacat |
N;R50/53 |
|
* |
|
|
| 4651-67-6 |
3-alpha-hydroxy-7-oxo-5-beta-cholan-24-syre |
N;R50/53 |
|
* |
|
|
| 4657-33-4 |
butyl-4'-hydroxy-3'-methoxycinnamat |
Xn;R22 N;R50 |
|
* |
|
|
| 4660-80-4 |
ethyloxiran-2-carboxylat |
Mut3;R40 R43 |
|
* |
|
|
| 4662-17-3 |
furidaron- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4682-36-4 |
orphenadrindihydrogencitrat- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4693-68-9 |
N,N'-ethylendi-p-toluidin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4698-96-8 |
1-(biphenyl-4-yloxy)-2,3-epoxypropan |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 4702-64-1 |
4,8-diamino-1,5-dihydroxy-2-(4-methoxyphenyl)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 4702-65-2 |
4,8-diamino-1,5-dihydroxy-2-(4-hydroxy-3-methylphenyl)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 4705-34-4 |
p,p'-dimethoxystilben |
N;R50/53 |
|
* |
|
|
| 4706-81-4 |
tetradecan-2-ol |
N;R50/53 |
|
* |
|
|
| 4711-68-6 |
4'-ethoxy-3-hydroxy-2-naphthanilid |
R43 N;R50/53 |
|
* |
|
|
| 4714-23-2 |
1-chlor-4-(2-phenylvinyl)benzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4732-13-2 |
5-isopropyl-2-methylphenetol |
N;R50/53 |
|
* |
|
|
| 4733-39-5 |
2,9-dimethyl-4,7-diphenyl-1,10-phenanthrolin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 4751-41-1 |
2,2'-(2,5-furandiyl)bis-1H-benzimidazol |
Mut3;R40 Carc3;R40 R43 N;R50 |
|
* |
|
|
| 4755-33-3 |
[1S-(1alpha,2beta,5alpha)]-2,6,6-trimethylbicyclo[3.1.1]heptan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 4755-83-3 |
1-(2,3-dihydro-1,1,2,3,3-pentamethyl-1H-inden-5-yl)ethan-1-on |
N;R50/53 |
|
* |
|
|
| 4760-34-3 |
N-methylbenzen-1,2-diamin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 4769-73-7 |
1-chlor-3-phenoxypropan-2-ol |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 4771-08-8 |
3'-nitrobenzanilid |
Mut3;R40 R43 |
|
* |
|
|
| 4782-29-0 |
Stannane, [1,2-phenylenebis(carbonyloxy) |
|
|
|
|
* |
| 4783-79-3 |
2-(2,4-dichlorphenoxy)pyridin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4795-86-2 |
[1R-(1alpha,2beta,5alpha)]-2,6,6-trimethylbicyclo[3.1.1]heptan |
N;R50/53 |
|
* |
|
|
| 4821-19-6 |
2,6-dicyclohexylphenol |
R43 N;R50/53 |
|
* |
|
|
| 4824-78-6 |
bromophos-ethyl eller O-(4-brom-2,5-dichlorphenyl)-O,O-diethylthiophosphat |
Xn;R21 T;R25 N;R50/53 |
* |
|
|
|
| 4825-53-0 |
4,4'-(1,2-diethylethylen)diphenyldipropionat |
N;R50/53 |
|
* |
|
|
| 4830-93-7 |
(4-chlorbutyl)benzen |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 4835-39-6 |
4'-nitroacetoacetanilid |
Mut3;R40 R43 |
|
* |
|
|
| 4837-88-1 |
2-methyl-3-nitroanisol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 4845-50-5 |
1,4-dioxan-2,3-diol |
N;R50/53 |
|
* |
|
|
| 4850-28-6 |
(1alpha,2alpha,4beta)-1,2,4-trimethylcyclopentan |
N;R50/53 |
|
* |
|
|
| 4857-04-9 |
2-chlormethylbenzimidazol |
Xn;R22 Mut3;R40 Carc3;R40 N;R50 |
|
* |
|
|
| 4860-15-5 |
[22alpha,25(R)]-28-acetylspirosol-5-en-3beta-ylacetat |
N;R50/53 |
|
* |
|
|
| 4863-59-6 |
[1R-(1alpha,2alpha,5alpha)]-2,6,6-trimethylbicyclo[3.1.1]heptan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 4887-30-3 |
octylhexanoat- |
N;R50/53 |
|
* |
|
|
| 4898-58-2 |
dimethyl-2,5-dianilinocyclohexa-1,4-dien-1,4-dicarboxylat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 4900-30-5 |
nona-1,8-dien |
N;R50/53 |
|
* |
|
|
| 4900-63-4 |
methyl-4-nitronaphthylether |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 4901-51-3 |
2,3,4,5-tetrachlorphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4904-61-4 |
cyclododeca-1,5,9-triene |
|
|
|
* |
|
| 4920-79-0 |
2-chlor-4-nitroanisol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 4920-84-7 |
1,3-dimethoxy-4-nitrobenzen |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 4951-40-0 |
3-(2,6,6-trimethyl-1-cyclohexen-1-yl)acrylaldehyd |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 4951-48-8 |
(-)-menthylpropionat |
N;R50/53 |
|
* |
|
|
| 4958-56-9 |
2-methylamino-5-nitrobenzophenon |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 4998-82-7 |
1-[(2-hydroxy-3,5-dinitrophenyl)azo]-2-naphthol |
Mut3;R40 |
|
* |
|
|
| 5014-86-8 |
4-(o-tolylazo)-m-toluidin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5026-74-4 |
p-(2,3-epoxypropoxy)-N,N-bis(2,3-epoxypropyl)anilin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5042-54-6 |
5-(phenylazo)toluen-2,4-diamin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5044-23-5 |
1-(4-chlorphenyl)-2,5-dimethyl-1H-pyrrol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 5044-52-0 |
triphenylvinylphosphoniumbromid- |
N;R50/53 |
|
* |
|
|
| 5048-82-8 |
ethyl-p-aminocinnamat |
Mut3;R40 |
|
* |
|
|
| 5061-22-3 |
nafiverin- |
N;R50/53 |
|
* |
|
|
| 5074-71-5 |
bis(pentafluorphenyl)phenylphosphit |
N;R50/53 |
|
* |
|
|
| 5081-36-7 |
3-methoxy-4-nitrobenzoesyre |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 5101-28-0 |
2-phenylpyren |
N;R50/53 |
|
* |
|
|
| 5102-83-0 |
2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[N-(2,4-dimethylphenyl)-3-oxobutyramide] |
x |
|
|
* |
|
| 5112-95-8 |
ethynylenbis[diphenylphosphin] |
N;R50/53 |
|
* |
|
|
| 5122-82-7 |
brommethyltricyclo[3.3.1.1-{3,7}-]dec-1-ylketon |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5124-30-1 |
dicyclohexylmethan-4,4'-diisocyanat |
T;R23 Xi;R36/37/38 R42/43 |
* |
|
|
|
| 5131-60-2 |
4-chlorbenzen-1,3-diamin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5136-53-8 |
1,2,3-tris(2,3-epoxypropoxy)benzen |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5144-52-5 |
naphazolinnitrat- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 5153-25-3 |
2-ethylhexyl-4-hydroxybenzoat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 5153-40-2 |
brompentamethylbenzen- |
R43 N;R50/53 |
|
* |
|
|
| 5157-04-0 |
3,6,9,12,15,18-hexaoxadotriacontan-1-ol |
N;R50/53 |
|
* |
|
|
| 5165-81-1 |
4'-chlor-3-hydroxy-2'-methoxy-5'-methyl-2-naphthanilid |
R43 N;R50/53 |
|
* |
|
|
| 5173-05-7 |
1-[1,1':2',1''-terphenyl]-4-ylethan-1-on |
N;R50/53 |
|
* |
|
|
| 5189-40-2 |
4-[cyclohexyliden(4-hydroxyphenyl)methyl]phenol |
R43 N;R50/53 |
|
* |
|
|
| 5190-63-6 |
4-[(1,3-dihydro-1,3,3-trimethyl-2H-indol-2-yliden)ethyliden]-2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-on |
N;R50/53 |
|
* |
|
|
| 5197-28-4 |
2-brom-4-nitroanisol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 5202-86-8 |
N-(4-chlor-2-methylphenyl)acetamid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 5205-10-7 |
3-methylbut-2-enylheptanoat |
N;R50/53 |
|
* |
|
|
| 5205-11-8 |
3-methyl-2-butenylbenzoat |
N;R50/53 |
|
* |
|
|
| 5205-34-5 |
decan-5-ol |
N;R50/53 |
|
* |
|
|
| 5234-06-0 |
[(2-naphthyloxy)methyl]oxiran |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5235-82-5 |
4-[3-(1-naphthylamino)propyl]morpholin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5248-39-5 |
4-methoxy-N,6-dimethyl-1,3,5-triazin-2-ylamin |
Xn;R22-48/22 |
* |
|
|
|
| 5255-75-4 |
[(p-nitrophenoxy)methyl]oxiran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5259-88-1 |
oxycarboxin eller 5,6-dihydro-2-methyl-1,4-oxathiin-3-carboxanilid-4,4-dioxid |
Xn;R22 R52/53 |
* |
|
|
|
| 5263-87-6 |
methyl-6-quinolylether |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 5274-68-0 |
3,6,9,12-tetraoxatetracosan-1-ol |
N;R50/53 |
|
* |
|
|
| 5285-60-9 |
4,4'-methylenbis[N-sec-butylanilin] |
R43 N;R50/53 |
|
* |
|
|
| 5293-84-5 |
(chlormethyl)triphenylphosphoniumchlorid |
N;R50/53 |
|
* |
|
|
| 5296-40-2 |
[(2,4,6-tribromphenoxy)methyl]oxiran |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5307-02-8 |
2,5-diaminoanisol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 5307-14-2 |
2-nitro-p-phenylendiamin |
Carc3;R40 R43 R52/53 |
|
* |
|
|
| 5318-76-3 |
1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urinstofdihydrochlorid |
N;R50/53 |
|
* |
|
|
| 5320-75-2 |
cinnamylbenzoat- |
R43 N;R50/53 |
|
* |
|
|
| 5323-87-5 |
3-ethoxycyclohex-2-en-1-on |
Mut3;R40 |
|
* |
|
|
| 5326-47-6 |
5-iodoanthranilsyre |
Xn;R22 N;R50/53 |
|
* |
|
|
| 5327-72-0 |
1,4-diaminoanthracen-9,10-diol |
Mut3;R40 |
|
* |
|
|
| 5330-29-0 |
N,N-diethyl-N'-(6-methoxy-4-methyl-8-quinolyl)hexan-1,6-diamindihydrochlorid |
Mut3;R40 R43 |
|
* |
|
|
| 5332-24-1 |
3-bromquinolin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5332-25-2 |
6-bromquinolin |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 5333-84-6 |
1,2,3,6-tetrahydro-3-methylphthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 5333-88-0 |
ethyl-2-bromheptanoat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5334-09-8 |
cyclohexylisobutylphthalat- |
N;R50/53 |
|
* |
|
|
| 5339-26-4 |
4-nitrophenethylbromid |
Xn;R22 Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 5341-58-2 |
3-hydroxy-2-naphthohydrazid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5344-90-1 |
2-aminobenzylalcohol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 5345-54-0 |
3-chlor-p-anisidin |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 5349-52-0 |
26-hydroxy-3,6,9,12,15,18,21,24-octaoxahexacos-1-ylstearat |
N;R50/53 |
|
* |
|
|
| 5355-88-4 |
1-amino-6,7-dichloranthraquinon |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 5367-28-2 |
3-chlor-6-nitrotoluen |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 5367-32-8 |
3-methyl-4-nitroanisol |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 5380-87-0 |
2-[(2,3-epoxypropoxy)methyl]furan |
Mut3;R40 R43 |
|
* |
|
|
| 5384-21-4 |
4,4'-methylendi-2,6-xylenol |
R43 N;R50/53 |
|
* |
|
|
| 5393-46-4 |
N-(3-nitrobiphenyl-4-yl)acetamid |
Mut3;R40 R43 |
|
* |
|
|
| 5396-71-4 |
ethyl-3-nitrocinnamat |
Mut3;R40 |
|
* |
|
|
| 5398-10-7 |
diethylhexylmalonat- |
N;R50/53 |
|
* |
|
|
| 5398-27-6 |
2,6-diiod-4-nitroanilin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5400-20-4 |
N-(6-hydroxy-1-naphthyl)acetamid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5401-17-2 |
2-(2-hydroxyethoxy)ethyl-(R)-12-hydroxyoleat |
N;R50/53 |
|
* |
|
|
| 5405-13-0 |
N-benzyl-o-toluidin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 5405-15-2 |
N-benzyl-p-toluidin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5405-53-8 |
2,7-dinitrofluoren |
Carc3;R40 N;R51/53 |
|
* |
|
|
| 5405-58-3 |
ethylidenbis(oxy)dihexan |
N;R50/53 |
|
* |
|
|
| 5406-86-0 |
2-(4-tert-butylphenyl)ethanol |
Xi;R41 Xn;R48/22 Rep3;R62 N;R51/53 |
* |
|
|
|
| 5407-68-1 |
5-nitrofurfurylacetat |
Carc3;R40 |
|
* |
|
|
| 5411-22-3 |
benzphetaminhydrochlorid- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5417-63-0 |
3-amino-2-naphthol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5421-40-9 |
4'-methoxybutyranilid |
Mut3;R40 R43 |
|
* |
|
|
| 5427-03-2 |
2,6-di-tert-butyl-4-isopropylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5427-46-3 |
N-[2-(diethylamino)ethyl]-N',N'-diethyl-N-phenylethylendiamin |
R43 N;R50/53 |
|
* |
|
|
| 5428-02-4 |
2-nitro-2-phenylpropan-1,3-diol |
Xn;R21/22 T;R39-48/25 Xi;R41 R43 N;R51/53 |
* |
|
|
|
| 5430-02-4 |
3,6-dimethyloct-6-en-3-ol |
N;R50/53 |
|
* |
|
|
| 5431-33-4 |
2,3-epoxypropyloleat |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 5432-30-4 |
2-octyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 5434-30-0 |
5'-amino-2'-methylacetanilid |
Carc3;R40 R43 |
|
* |
|
|
| 5436-77-1 |
2-[1-(benzyliden)hexyl]-4-methyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 5437-98-9 |
4'-methoxyacetoacetanilid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 5442-40-0 |
N-(3-chlorphenyl)-3-hydroxynaphthalen-2-carboxamid |
R43 N;R50/53 |
|
* |
|
|
| 5444-75-7 |
2-ethylhexylbenzoat |
N;R50/53 |
|
* |
|
|
| 5445-26-1 |
ethyl-4-nitrophenyleacetat |
Mut3;R40 |
|
* |
|
|
| 5445-29-4 |
ethyl-2-bromoctanoat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5445-40-9 |
ethyl-2-bromundecanoat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5446-18-4 |
(2,4-dichlorphenyl)hydrazinmonohydrochlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 5447-02-9 |
3,4-bis(benzyloxy)benzaldehyd |
N;R50/53 |
|
* |
|
|
| 5447-28-9 |
N-(3-chlorphenyl)naphthalen-2-amin |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 5450-24-8 |
4-tert-butyl-2-cyclohexylphenol |
R43 N;R50/53 |
|
* |
|
|
| 5451-85-4 |
octylvalerat- |
N;R50/53 |
|
* |
|
|
| 5451-95-6 |
nonylbenzoat- |
N;R50/53 |
|
* |
|
|
| 5454-09-1 |
decylbutyrat- |
N;R50/53 |
|
* |
|
|
| 5454-11-5 |
2-phenylethylheptanoat |
N;R50/53 |
|
* |
|
|
| 5454-19-3 |
decylpropionat- |
N;R50/53 |
|
* |
|
|
| 5454-21-7 |
benzylheptanoat- |
N;R50/53 |
|
* |
|
|
| 5454-22-8 |
decylisobutyrat- |
N;R50/53 |
|
* |
|
|
| 5455-98-1 |
N-(2,3-epoxypropyl)phthalimid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5457-66-9 |
tert-butyloctanoat |
N;R50/53 |
|
* |
|
|
| 5457-70-5 |
phenethyloctanoat- |
N;R50/53 |
|
* |
|
|
| 5458-48-0 |
1-cyclohexyl-4-nitrobenzen |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 5459-63-2 |
dimethyl-2,2'-dithiobisbenzoat |
N;R50/53 |
|
* |
|
|
| 5459-98-3 |
isopropylundec-10-enoat |
N;R50/53 |
|
* |
|
|
| 5461-06-3 |
isobutyloctanoat- |
N;R50/53 |
|
* |
|
|
| 5465-33-8 |
2-chlor-6-nitro-p-toluidin |
Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 5465-65-6 |
4'-chlor-3'-nitroacetophenon |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 5466-77-3 |
2-ethylhexyl-4-methoxycinnamat |
N;R50/53 |
|
* |
|
|
| 5468-75-7 |
2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[N-(2-methylphenyl)-3-oxobutyramide] |
|
|
|
* |
|
| 5470-11-1 |
hydroxylammoniumchlorid |
Xn;R22-48/22 Xi;R36/38 R43 N;R50 |
* |
|
|
|
| 5471-63-6 |
1,3-diphenylisobenzofuran |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5471-76-1 |
2-amino-4-chlorphenolhydrochlorid |
Mut3;R40 R43 |
|
* |
|
|
| 5486-03-3 |
buquinolat- |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 5493-45-8 |
bis(2,3-epoxypropyl)cyclohexan-1,2-dicarboxylat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5502-88-5 |
4-isopropyl-1-methylcyclohexen |
N;R50/53 |
|
* |
|
|
| 5503-13-9 |
4-(3,3-dimethylbicyclo[2.2.1]hept-2-yliden)-2-methyl-2-buten-1-ol |
N;R50/53 |
|
* |
|
|
| 5516-20-1 |
2-[2-(4-chlorphenyl)vinyl]-5-(2H-naphtho[1,2-d]triazol-2-yl)benzonitril |
N;R50/53 |
|
* |
|
|
| 5522-43-0 |
1-nitropyren |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 5529-38-4 |
2,5-dimethoxy-4'-nitrostilben |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 5530-30-3 |
4-butyl-2,6-di-tert-butylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5535-73-9 |
1-[(2-chlorethyl)thio]-4-nitrobenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5538-57-8 |
3-hydroxy-7-methoxy-N-(o-tolyl)naphthalen-2-carboxamid |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 5540-60-3 |
N-(4-chlor-3-nitrophenyl)acetamid |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 5541-67-3 |
5-methylquinolin-8-ol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 5543-57-7 |
warfarin eller (S)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyron |
Rep1;R61 T;R48/25 R52/53 |
* |
|
|
|
| 5543-58-8 |
warfarin eller (R)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyron |
Rep1;R61 T;R48/25 R52/53 |
* |
|
|
|
| 5560-59-8 |
alverindihydrogencitrat- |
R43 N;R50/53 |
|
* |
|
|
| 5560-69-0 |
ethyldibunat- |
N;R50/53 |
|
* |
|
|
| 5567-15-7 |
2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[N-(4-chloro-2,5-dimethoxyphenyl)-3-oxobutyramide] |
|
|
|
* |
|
| 5569-45-9 |
4-(ethylnitrosoamino)-4-methylpentan-2-on |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 5576-62-5 |
1-[2-[(2-chlorphenyl)phenylmethoxy]ethyl]-4-[(o-tolyl)methyl]piperazindihydrochlorid |
N;R50/53 |
|
* |
|
|
| 5586-87-8 |
N-(3-chlorpropyl)-alpha-methylphenethylaminhydrochlorid |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 5598-13-0 |
chlorpyrifos-methyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 5600-62-4 |
4-(4-nitrophenyl)smoersyre |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 5613-46-7 |
4,4'-isopropylidendi-2,6-xylol |
R43 N;R50/53 |
|
* |
|
|
| 5617-41-4 |
heptylcyclohexan- |
N;R50/53 |
|
* |
|
|
| 5623-45-0 |
2,2',4,4',6,6'-hexamethylbenzophenon |
R43 N;R50/53 |
|
* |
|
|
| 5632-44-0 |
tolpropamin- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 5635-50-7 |
hexestrol- |
N;R50/53 |
|
* |
|
|
| 5636-83-9 |
dimetinden- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 5650-10-2 |
4-isopropyl-N-phenylanilin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 5659-44-9 |
1,1,2,3,4-pentachlorbuta-1,3-dien |
Xn;R22 N;R50/53 |
|
* |
|
|
| 5660-91-3 |
1,3-diphenyl-2H-cyclopenta[l]phenantren-2-on |
N;R50/53 |
|
* |
|
|
| 5707-69-7 |
drazoxolon eller 4-(2-chlorphenylhydrazono)-3-methyl-5-isoxazolon |
T;R25 N;R50/53 |
* |
|
|
|
| 5714-08-9 |
detrothyronin- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5717-37-3 |
ethyl-2-(triphenylphosphoranyliden)propionat |
N;R50/53 |
|
* |
|
|
| 5718-26-3 |
methyl-2-[(1,5-dihydro-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yliden)ethyliden]-1,3,3-trimethylindolin-5-carboxylat |
N;R50/53 |
|
* |
|
|
| 5736-15-2 |
natriumhydrogen-2,2'-methylenbis[3,4,6-trichlorphenolat] |
R43 N;R50/53 |
|
* |
|
|
| 5736-49-2 |
1,1'-(brommethylen)bis[2,3,4,5,6-pentafluorbenzen] |
N;R50/53 |
|
* |
|
|
| 5736-94-7 |
p-(hexyloxy)benzaldehyd |
N;R50/53 |
|
* |
|
|
| 5742-07-4 |
2,2'-dichlorbenzidindihydrochlorid |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 5754-35-8 |
1,3-dioxolan-2-ethylamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5770-03-6 |
tridecan-6-ol |
N;R50/53 |
|
* |
|
|
| 5779-51-1 |
N,N-dibutylphenethylamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5785-06-8 |
m-anisohydrazid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 5787-96-2 |
DNOC-K |
T;R23/24/25 R33 N;R50/53 |
* |
|
|
|
| 5789-30-0 |
1,2-dibrom-1,2-diphenylethan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 5794-03-6 |
(1R)-2,2-dimethyl-3-methylenbicyclo[2.2.1]heptan |
N;R50/53 |
|
* |
|
|
| 5794-04-7 |
(1S)-2,2-dimethyl-3-methylenbicyclo[2.2.1]heptan |
N;R50/53 |
|
* |
|
|
| 5805-76-5 |
1-ethyl-2-methylbenzimidazol |
Mut3;R40 |
|
* |
|
|
| 5814-85-7 |
1,2-diphenylpropan |
R43 N;R50/53 |
|
* |
|
|
| 5828-70-6 |
dl-4-chlor-2-(alpha-methylbenzyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 5833-18-1 |
ethylbis(2,4-dinitrophenyl)acetat |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 5836-29-3 |
coumatetralyl eller 4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthyl)cumarin |
Tx;R27/28 T;R48/24/25 R52/53 |
* |
|
|
|
| 5840-15-3 |
3-anilinopropan-1,2-diol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 5855-70-9 |
2,2'-dichlor-5,5'-dimethoxybenzidin |
Mut3;R40 R43 |
|
* |
|
|
| 5856-00-8 |
N-(4-amino-m-tolyl)-N-ethylbenzamid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 5856-99-5 |
2,4,6-triisobutylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5873-54-1 |
diphenylmethan-2,4'-diisocyanat |
Xn;R20 Xi;R36/37/38 R42/43 |
* |
|
|
|
| 5877-58-7 |
N-benzyliden-m-toluidin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 5892-47-7 |
2,4,6-tri-sec-butylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5901-56-4 |
N-4-nitrophenylguanidin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 5910-19-0 |
N-methyl-2,6-dinitroanilin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 5911-04-6 |
3-methylnonan |
N;R50/53 |
|
* |
|
|
| 5924-63-0 |
N-(9,10-dihydro-9,10-dioxo-1-anthryl)[1,1'-biphenyl]-4-carboxamid |
N;R50/53 |
|
* |
|
|
| 5926-90-9 |
[(hexyloxy)methyl]oxiran |
Mut3;R40 R43 |
|
* |
|
|
| 5950-83-4 |
1-nitro-2-(4-nitrophenoxy)benzen |
Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 5953-63-9 |
androst-5-en-(3beta,17beta)-diyl-3-acetat-17-benzoat |
N;R50/53 |
|
* |
|
|
| 5960-69-0 |
methyl-2-phenanthrylketon |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 5960-99-6 |
3,4,5,6-tetrahydro-2H-azepin-7-pentylamin |
N;R50/53 |
|
* |
|
|
| 5961-59-1 |
N-methyl-4-anisidin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 5966-41-6 |
diisopromin- |
R43 N;R50/53 |
|
* |
|
|
| 5967-73-7 |
(R)-dimethyl(1-methyl-4-oxo-3,3-diphenylhexyl)ammoniumchlorid |
N;R50/53 |
|
* |
|
|
| 5974-09-4 |
vetrabutinhydrochlorid- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 5978-08-5 |
2-(3-chlorpropyl)-2-methyl-1,3-dioxolan |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5982-87-6 |
ethylbis(3-phenylpropyl)ammoniumchlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 5986-55-0 |
[1R-(1alpha,4beta,4aalpha,6beta,8aalpha)]-octahydro-4,8a,9,9-tetramethyl-1,6-methano-1(2H)-naphthol |
N;R50/53 |
|
* |
|
|
| 5989-05-9 |
[1S-(1alpha,3abeta,4alpha,8abeta)]-2-(decahydro-4,8,8-trimethyl-1,4-methanoazulen-9-yliden)ethanol |
N;R50/53 |
|
* |
|
|
| 5989-27-5 |
D-limonen |
R10 Xi;R38 R43 N;R50/53 |
* |
|
|
|
| 5989-54-8 |
L-limonen |
R10 Xi;R38 R43 N;R50/53 |
* |
|
|
|
| 6001-87-2 |
methyl-3-chlorpropionat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 6004-38-2 |
tricyclo[5.2.1.0-{2,6}-]decan |
N;R50/53 |
|
* |
|
|
| 6027-00-5 |
2-[(p-methoxy-.alpha.-phenylbenzyl)oxy]ethyl(dimethyl)ammoniumchlorid |
R43 N;R50/53 |
|
* |
|
|
| 6043-01-2 |
domazolin- |
N;R50/53 |
|
* |
|
|
| 6048-29-9 |
phenacyltriphenylphosphoniumbromid- |
N;R50/53 |
|
* |
|
|
| 6048-88-0 |
5,9-dimethyldeca-2,4,8-trienal |
N;R50/53 |
|
* |
|
|
| 6061-06-9 |
1,1-dichlorbuta-1,3-dien |
Xn;R22 Carc3;R40 R52/53 |
|
* |
|
|
| 6070-14-0 |
menthylbutyrat- |
N;R50/53 |
|
* |
|
|
| 6070-16-2 |
(1beta,2alpha,4alpha)-p-menth-2-ylhexanoat |
N;R50/53 |
|
* |
|
|
| 6072-22-6 |
alpha,alpha-diphenylpyrrolidin-1-propanol |
R43 N;R50/53 |
|
* |
|
|
| 6079-76-1 |
4-benzyloxy-2-hydroxybenzophenon |
N;R50/53 |
|
* |
|
|
| 6088-51-3 |
6,6'-dithiodi-2-naphthol |
N;R50/53 |
|
* |
|
|
| 6094-02-6 |
2-methylhex-1-en |
N;R50/53 |
|
* |
|
|
| 6109-97-3 |
(9-ethyl-9H-carbazol-3-yl)ammoniumchlorid |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 6119-53-5 |
quininphosphonat- |
Mut3;R40 |
|
* |
|
|
| 6137-45-7 |
3-brom-N-(4-bromphenyl)-5-chlorsalicylamid |
R43 N;R50/53 |
|
* |
|
|
| 6138-47-2 |
O-(4-hydroxy-3-iodphenyl)-3,5-diiod-L-tyrosinhydrochlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 6149-33-3 |
4-(4-nitrophenoxy)anilin |
Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 6153-92-0 |
4,4'-diphenyl-2,2'-bipyridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 6158-45-8 |
1-isopropylnaphthalen |
N;R50/53 |
|
* |
|
|
| 6163-58-2 |
tris(2-methylphenyl)phosphin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 6164-98-3 |
chlordimeform eller N'-(4-chlor-o-tolyl)-N,N-dimethylformamidin |
Xn;R21/22 Carc3;R40 N;R50/53 |
* |
|
|
|
| 6165-51-1 |
2-(1-phenylethyl)-p-xylen |
N;R50/53 |
|
* |
|
|
| 6165-52-2 |
4-(1-phenylethyl)-m-xylen |
N;R50/53 |
|
* |
|
|
| 6170-08-7 |
(20S)-5alpha-pregnan-3beta,20-dioldiacetat |
N;R50/53 |
|
* |
|
|
| 6177-60-2 |
2,3-epoxypropylmethansulfonat |
Mut3;R40 |
|
* |
|
|
| 6178-32-1 |
[(p-nonylphenoxy)methyl]oxiran |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 6196-95-8 |
4-(1-phenylethyl)-o-xylen |
N;R50/53 |
|
* |
|
|
| 6197-30-4 |
octocrilen- |
N;R50/53 |
|
* |
|
|
| 6204-42-8 |
cis-2-(brommethyl)-1,3-dioxolan-4-methanol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 6204-43-9 |
trans-2-brommethyl-1,3-dioxolan-4-methanol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 6219-67-6 |
4-methoxybenzen-1,3-diaminsulfat |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6224-63-1 |
tris(3-methylphenyl)phosphin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 6232-56-0 |
2-[[4-[(2,6-dichlor-4-nitrophenyl)azo]phenyl]methylamino]ethanol |
Carc3;R40 R43 |
|
* |
|
|
| 6232-57-1 |
4-[(4-aminophenyl)azo]-5-methyl-o-anisidin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6243-10-3 |
cyclohexylhexanoat- |
N;R50/53 |
|
* |
|
|
| 6250-23-3 |
p-[[p-(phenylazo)phenyl]azo]phenol |
Mut3;R40 R43 |
|
* |
|
|
| 6254-98-4 |
bis[N-(p-methoxyphenyl)-p-phenylendiamin]sulfat |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 6258-73-7 |
1,1'-(1,3,3-trimethylprop-1-en-1,3-diyl)dibenzen |
R43 N;R50/53 |
|
* |
|
|
| 6259-08-1 |
5-chlor-4-nitro-o-anisidin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 6259-09-2 |
4,4'-cyclohexylidendi-o-anisidin |
Mut3;R40 |
|
* |
|
|
| 6259-38-7 |
5-chlor-2-phenoxyaniliniumchlorid |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 6259-39-8 |
5-chlor-2-(4-chlorphenoxy)aniliniumchlorid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 6259-53-6 |
4-hydroxy-6-(methylamino)naphthalen-2-sulfonsyre |
Mut3;R40 R43 |
|
* |
|
|
| 6259-76-3 |
hexylsalicylat- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 6259-77-4 |
heptylsalicylat- |
N;R50/53 |
|
* |
|
|
| 6263-54-3 |
1-[4-(4-fluorphenyl)-4-phenylbutyl]piperazin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 6264-66-0 |
4-(4-aminophenoxy)-1,2-benzendiamin |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 6264-98-8 |
m-(o-toluidino)phenol |
Mut3;R40 R43 |
|
* |
|
|
| 6268-05-9 |
4'-amino-2',5'-dimethoxybenzanilid |
Mut3;R40 |
|
* |
|
|
| 6269-89-2 |
1-(4-nitrophenyl)piperazin |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 6270-19-5 |
4-(2,3-epoxypropyl)morpholin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 6270-55-9 |
furfurylisobutyrat- |
Mut3;R40 |
|
* |
|
|
| 6271-79-0 |
3,3'-dinitro[1,1'-biphenyl]-4,4'-diamin |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 6272-52-2 |
4'-nitro-[1,1'-biphenyl]-2-amin |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 6275-32-7 |
2,6-bis(4-methoxybenzyliden)cyclohexan-1-on |
R43 N;R50/53 |
|
* |
|
|
| 6277-38-9 |
1-(4-methoxy-3-nitrophenyl)ethan-1-on |
Mut3;R40 R52/53 |
|
* |
|
|
| 6281-14-7 |
hexahydro-1,3,5-tricyclohexyl-s-triazin |
N;R50/53 |
|
* |
|
|
| 6281-23-8 |
3-(5-nitro-2-furyl)acrylsyre |
Carc3;R40 R43 |
|
* |
|
|
| 6281-32-9 |
4-quinolylmethanol |
Mut3;R40 |
|
* |
|
|
| 6281-40-9 |
3-phenylpropylhexanoat |
N;R50/53 |
|
* |
|
|
| 6284-35-1 |
(-)-menthylbenzoat |
N;R50/53 |
|
* |
|
|
| 6284-43-1 |
2,3-dihydroxypropyl-12-hydroxyoctadecanoat |
N;R50/53 |
|
* |
|
|
| 6284-79-3 |
4,4'-dichlorbenzophenon |
R43 N;R50/53 |
|
* |
|
|
| 6284-83-9 |
1,3,5-trichlor-2,4-dinitrobenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 6286-28-8 |
6-(1,1,3,3-tetramethylbutyl)-2,4-xylenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 6287-47-4 |
2,4-di-tert-butyl-6-ethylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 6288-63-7 |
N-(2-chlorethyl)benzylaminhydrochlorid |
Xn;R22 Mut3;R40 N;R50 |
|
* |
|
|
| 6291-23-2 |
4-morpholinophenol |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 6292-62-2 |
stilben-4,4'-dicarbonitril |
N;R50/53 |
|
* |
|
|
| 6294-31-1 |
dihexylsulfid- |
N;R50/53 |
|
* |
|
|
| 6298-72-2 |
2,5-bis(chlormethyl)-p-xylen |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 6299-37-2 |
1,3,5-tris(2-chlorethyl)-1,3,5-triazin-2,4,6(1H,3H,5H)-trion |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6300-07-8 |
natrium-m-[(4-amino-3-methoxyphenyl)azo]benzensulfonat |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6300-22-7 |
natrium-m-[(4-amino-1-naphthyl)azo]benzensulfonat |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6300-23-8 |
natrium-5-amino-8-(phenylazo)naphthalen-2-sulfonat |
Mut3;R40 |
|
* |
|
|
| 6300-37-4 |
4-[[p-(phenylazo)phenyl]azo]-o-cresol |
Mut3;R40 R43 |
|
* |
|
|
| 6300-63-6 |
2,5-dimethoxy-4-(phenylazo)anilin |
Mut3;R40 |
|
* |
|
|
| 6305-04-0 |
2-chlor-1-(4-hydroxyphenyl)ethan-1-on |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 6309-52-0 |
2-methoxyethyllaurat |
N;R50/53 |
|
* |
|
|
| 6310-21-0 |
2-tert-butylanilin |
Mut3;R40 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 6313-37-7 |
2,5-dimethoxy-4-nitroanilin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 6315-89-5 |
3,4-dimethoxyanilin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 6316-24-1 |
2-decyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 6320-40-7 |
2,4,6-tribromtoluen |
R43 N;R50/53 |
|
* |
|
|
| 6322-37-8 |
natrium-8-aminonaphthalen-2-sulfonat |
Mut3;R40 R43 |
|
* |
|
|
| 6328-01-4 |
ethyl-m-aminocinnamat |
Mut3;R40 |
|
* |
|
|
| 6329-26-6 |
ethyl-2-chlorethylcarbamat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 6331-70-0 |
2-ethoxy-5-methylanilin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6333-15-9 |
4,4'-dinitrobenzanilid |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 6334-30-1 |
2-hydroxybenzen-1,3,5-triyltriammoniumtrichlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 6337-24-2 |
p-(p-nitrophenoxy)anisol |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 6343-72-2 |
6-brom-2-naphthylacetat |
R43 N;R50/53 |
|
* |
|
|
| 6344-60-1 |
1-hydroxyfluoren-9-on |
Mut3;R40 R43 |
|
* |
|
|
| 6344-62-3 |
1-aminofluoren-9-on |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6358-26-5 |
4-[(9-ethyl-9H-carbazol-3-yl)amino]phenol |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 6358-51-6 |
2,5-dimethoxy-4-(4-nitrophenylazo)anilin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6358-64-1 |
4-chlor-2,5-dimethoxyanilin |
Mut3;R40 R43 |
|
* |
|
|
| 6358-83-4 |
4,4'-[(4-methoxy-1,3-phenylen)bis(azo)]bisbenzen-1,3-diamin |
Mut3;R40 |
|
* |
|
|
| 6361-21-3 |
2-chlor-5-nitrobenzaldehyd |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 6361-30-4 |
N-(7-hydroxy-1-naphthyl)benzamid |
Mut3;R40 R43 |
|
* |
|
|
| 6362-80-7 |
1,1'-(1,1-dimethyl-3-methylen-1,3-propandiyl)bisbenzen |
R43 N;R50/53 |
|
* |
|
|
| 6364-00-7 |
N-(4-ethoxyphenyl)naphthalen-1-amin |
Mut3;R40 R43 |
|
* |
|
|
| 6364-35-8 |
4-(o-tolylazo)benzen-1,3-diaminmonohydrochlorid |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 6364-39-2 |
4-methyl-6-(naphthylazo)benzen-1,3-diamin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6368-72-5 |
N-ethyl-1-(4-(phenylazo)phenylazo)-2-naphthylamin |
Mut3;R40 |
|
* |
|
|
| 6368-90-7 |
4'-amino-5'-chlor-2'-methoxybenzanilid |
Mut3;R40 R43 |
|
* |
|
|
| 6369-12-6 |
N-(5-brom-2-methoxyphenyl)-3-hydroxynaphthalen-2-carboxamid |
N;R50/53 |
|
* |
|
|
| 6370-43-0 |
2-(o-tolylazo)-p-cresol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 6370-44-1 |
2-[(4-ethoxyphenyl)azo]-p-cresol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 6372-42-5 |
cyclohexyldiphenylphosphin- |
N;R50/53 |
|
* |
|
|
| 6373-16-6 |
1-hydroxy-4-(methylamino)anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 6373-46-2 |
4-benzyloxyanilin |
Mut3;R40 R43 |
|
* |
|
|
| 6373-95-1 |
N,N-diethyl-4-[(2-methoxy-4-nitrophenyl)azo]anilin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6374-78-3 |
1-amino-4,5,8-trihydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 6375-16-2 |
N-(3-amino-4-methylphenyl)acetamid |
Carc3;R40 R43 |
|
* |
|
|
| 6375-47-9 |
3'-amino-4'-methoxyacetanilid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 6376-14-3 |
4-chlor-5-methyl-o-anisidin |
Mut3;R40 R43 |
|
* |
|
|
| 6376-56-3 |
3,8-dibromfluoranthen |
R43 N;R50/53 |
|
* |
|
|
| 6377-12-4 |
carbazol-3-ylamin |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 6378-19-4 |
4-(chlormethyl)-2-nitroanisol |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 6379-72-2 |
4-trans-propenylveratrol |
Mut3;R40 |
|
* |
|
|
| 6379-73-3 |
5-isopropyl-2-methylanisol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 6380-28-5 |
5-isopropyl-o-tolylacetat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 6383-73-9 |
4'-nitro-2-phthalimidoglutaranilsyre |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 6386-38-5 |
methyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate |
N;R50/53 |
|
* |
* |
|
| 6386-73-8 |
2,6-dibrom-4-[1-(3-brom-4-hydroxyphenyl)-1-methylethyl]phenol |
R43 N;R50/53 |
|
* |
|
|
| 6387-89-9 |
2,3-epoxypropylacetat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 6393-42-6 |
2,6-dinitro-p-toluidin |
Xn;R22 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 6402-08-0 |
2-(4-aminophenyl)-2,4-dihydro-5-methyl-3H-pyrazol-3-on |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 6408-45-3 |
1-amino-4-(cyclohexylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 6408-50-0 |
1-(methylamino)-4-[(3-methylphenyl)amino]anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 6408-72-6 |
1,4-diamino-2,3-diphenoxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 6409-15-0 |
1,4-diamino-2,3-dibromanthraquinon |
Mut3;R40 |
|
* |
|
|
| 6409-74-1 |
N-(9,10-dihydro-4-hydroxy-9,10-dioxo-1-anthryl)benzamid |
Mut3;R40 |
|
* |
|
|
| 6410-09-9 |
1-[(2-nitrophenyl)azo]-2-naphthol |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6413-10-1 |
ethyl-2-methyl-1,3-dioxolan-2-acetat |
N;R50/53 |
|
* |
|
|
| 6416-57-5 |
4-(1-naphthylazo)benzen-1,3-diamin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6419-33-6 |
1'(og 2')-(p-aminobenzyliden)isonicotinohydrazid |
Mut3;R40 R43 |
|
* |
|
|
| 6420-65-1 |
4,4'-(1-methylpropyliden)bis[o-cresol] |
R43 N;R50/53 |
|
* |
|
|
| 6434-57-7 |
1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthol |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6434-78-2 |
(E)-non-2-en |
N;R50/53 |
|
* |
|
|
| 6441-73-2 |
3,6-diamino-2,7,10-trimethylacridiniumchlorid |
Mut3;R40 |
|
* |
|
|
| 6442-08-6 |
4,4'-cyclohexylidendi-o-toluidin |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 6457-30-3 |
8-(isopropyl)quinolin |
Mut3;R40 R43 |
|
* |
|
|
| 6465-02-7 |
methyl-[4-[[4-[(4-hydroxyphenyl)azo]-2-methylphenyl]azo]phenyl]-carbamat |
Mut3;R40 |
|
* |
|
|
| 6465-03-8 |
methyl(4-aminophenyl)carbamat |
Mut3;R40 |
|
* |
|
|
| 6470-18-4 |
N-(7-hydroxy-1-naphthyl)acetamid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 6470-90-2 |
N,N'-(9,10-dihydro-9,10-dioxoanthracen-2,6-diyl)bisbenzamid |
R43 N;R50/53 |
|
* |
|
|
| 6471-02-9 |
N-(4-amino-9,10-dihydro-9,10-dioxo-1-anthryl)acetamid |
Mut3;R40 |
|
* |
|
|
| 6471-46-1 |
1-[(3-nitrophenyl)azo]-2-naphthol |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6471-66-5 |
benzylnonan-1-oat |
N;R50/53 |
|
* |
|
|
| 6471-78-9 |
5-methoxy-2-methylsulfanilsyre |
Mut3;R40 |
|
* |
|
|
| 6476-37-5 |
dicyclohexylphenylphosphin- |
N;R50/53 |
|
* |
|
|
| 6480-68-8 |
quinolin-3-carboxylsyre |
Mut3;R40 R43 |
|
* |
|
|
| 6492-50-8 |
4-[(4-nitrophenyl)azo]-2,5-xylidin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 6492-81-5 |
4,4'-dichlor-2,2'-dimethoxy-5,5'-dimethyl-alpha-alpha'-terephthaloyldiacetanilid |
R43 N;R50/53 |
|
* |
|
|
| 6493-58-9 |
2-(6-methyl-2-quinolyl)-1H-inden-1,3(2H)-dion |
N;R50/53 |
|
* |
|
|
| 6498-82-4 |
2-(aziridin-1-yl)ethylacrylat |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6500-50-1 |
octyl-p-nitrobenzoat |
N;R50/53 |
|
* |
|
|
| 6506-37-2 |
nimorazol- |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 6534-28-7 |
N,N'-(9,10-dihydro-9,10-dioxo-1,4-anthracendiyl)bisacetamid |
Mut3;R40 |
|
* |
|
|
| 6538-35-8 |
6,6'-methylendi-2,4-xylenol |
R43 N;R50/53 |
|
* |
|
|
| 6553-96-4 |
2,4,6-triisopropylbenzensulfonylchlorid |
R43 N;R50/53 |
|
* |
|
|
| 6554-98-9 |
p-styrylphenol |
R43 N;R50/53 |
|
* |
|
|
| 6574-15-8 |
1-(4-nitrophenyl)piperidin |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 6582-52-1 |
2,2'-methylendianilin |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 6621-47-2 |
perhexilin- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 6624-58-4 |
1-methylhexylhexanoat |
N;R50/53 |
|
* |
|
|
| 6626-23-9 |
1-chlormethyl-2-methylnaphthalen |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 6627-38-9 |
6,7-dimethyl-2,3-di-2-pyridylquinoxalin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 6627-53-8 |
5-chlor-2-nitroanisol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 6628-04-2 |
4-amino-2-methylquinolin |
Mut3;R40 R43 |
|
* |
|
|
| 6630-41-7 |
1-chlor-4-(3-chlor-1-methoxypropyl)benzen |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 6635-20-7 |
5-nitrovanillin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 6639-30-1 |
2,4,5-trichlortoluen |
R43 N;R50/53 |
|
* |
|
|
| 6640-24-0 |
1-(m-chlorphenyl)piperazin |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 6642-07-5 |
4-chlor-alpha,alpha'-bis(5-chlor-2-hydroxyphenyl)-2,6-xylenol |
R43 N;R50/53 |
|
* |
|
|
| 6657-00-7 |
4-[[2-methoxy-5-methyl-4-(phenylazo)phenyl]azo]phenol |
Mut3;R40 |
|
* |
|
|
| 6658-48-6 |
3-(p-cumenyl)-2-methylpropionaldehyd |
R43 N;R50/53 |
|
* |
|
|
| 6659-76-3 |
2,2'-[[4-[[2-chlor-4-(methylsulfonyl)phenyl]azo]-3-methylphenyl]imino]bisethanol |
Mut3;R40 R43 |
|
* |
|
|
| 6673-35-4 |
practolol- |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 6683-19-8 |
pentaerythritol tetrakis(3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate) |
|
|
* |
|
| 6709-39-3 |
2,6-dimethylhepta-1,5-dien |
N;R50/53 |
|
* |
|
|
| 6737-42-4 |
propan-1,3-diylbis(diphenylphosphin) |
N;R50/53 |
|
* |
|
|
| 6738-04-1 |
2-phenoxy-1,1'-biphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 6753-24-8 |
butyl-4-(2,4-dichlorphenoxy)butyrat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 6784-13-0 |
beta,4-dimethylcyclohex-3-en-1-propan-1-al |
N;R50/53 |
|
* |
|
|
| 6786-84-1 |
alpha,alpha-bis[4-(dimethylamino)phenyl]-4-(ethylamino)naphthalen-1-methanol |
R43 N;R50/53 |
|
* |
|
|
| 6789-88-4 |
hexylbenzoat- |
N;R50/53 |
|
* |
|
|
| 6804-07-5 |
carbadox eller 2-(methoxycarbonylhydrazonomethyl)quinoxalin-1,4-dioxid |
Carc2;R45 F;R11 Xn;R22 |
* |
|
|
|
| 6807-17-6 |
4,4'-isobutylethylidendiphenol |
Rep2;R60 Xi;R36 N;R50/53 |
* |
|
|
|
| 6833-06-3 |
sebacanilid- |
N;R50/53 |
|
* |
|
|
| 6836-42-6 |
tetradecan-6-on |
N;R50/53 |
|
* |
|
|
| 6848-13-1 |
3-chlor-N,N-dimethylanilin |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 6851-44-1 |
2,4,5-trichlorphenetol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 6876-13-7 |
(1alpha,2beta,5alpha)-2,6,6-trimethylbicyclo[3.1.1]heptan |
N;R50/53 |
|
* |
|
|
| 6877-73-2 |
acetat-(25R)-6-methylspirost-5-en-3beta-ol |
N;R50/53 |
|
* |
|
|
| 6893-02-3 |
liothyronin- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 6920-24-7 |
hexadecan-1,16-diol |
N;R50/53 |
|
* |
|
|
| 6923-22-4 |
monocrotophos eller dimethyl-1-methyl-2-(methylcarbamoyl)vinylphosphat |
T;R24 Tx;R26/28 Mut3;R68 N;R50/53 |
* |
|
|
|
| 6925-48-0 |
p-[(p-aminophenyl)azo]benzoesyre |
Mut3;R40 R43 |
|
* |
|
|
| 6936-40-9 |
1,2,4,5-tetrachlor-3-methoxybenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 6940-53-0 |
1-chlor-2,5-dimethoxy-4-nitrobenzen |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 6940-78-9 |
1-brom-4-chlorbutan |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 6940-83-6 |
1-chlor-4-(3-chlor-1-ethoxypropyl)benzen |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 6940-88-1 |
1-chlor-4-[3-chlor-1-(1-methylethoxy)propyl]benzen |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 6942-99-0 |
2,4-dibrom-1,3,5-trimethylbenzen |
R43 N;R50/53 |
|
* |
|
|
| 6948-88-5 |
4-hydroxy-alpha-(4-hydroxynaphthyl)-alpha-phenylnaphthalen-1-methanol |
R43 N;R50/53 |
|
* |
|
|
| 6949-73-1 |
2-hydroxyfluoren-9-on |
Mut3;R40 R43 |
|
* |
|
|
| 6950-88-5 |
4-(3-methoxy-4-nitrophenyl)morpholin |
Mut3;R40 R52/53 |
|
* |
|
|
| 6954-41-2 |
4,4'-[oxybis(ethylenoxy)]dianilin |
Carc3;R40 R43 R52/53 |
|
* |
|
|
| 6956-24-7 |
1-[4-(dimethylamino)phenyl]-3-methylurinstof |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 6957-25-1 |
2-methylnaphtho[2.3-d]thiazol |
R43 N;R50/53 |
|
* |
|
|
| 6959-47-3 |
2-(chlormethyl)pyridiniumchlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 6959-48-4 |
3-(chlormethyl)pyridiniumchlorid |
Xn;R22 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 6965-76-0 |
[3-chlor-1-(1-methylethoxy)propyl]benzen |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 6968-70-3 |
4-(3-chlor-1-methoxypropyl)toluen |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 6968-76-9 |
1-(3-methoxyphenyl)piperazindihydrochlorid |
Mut3;R40 R43 |
|
* |
|
|
| 6972-47-0 |
2,4,6-trichlor-3,5-dimethylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 6974-32-9 |
1-O-acetyl-2,3,5-tri-O-benzoyl-beta-D-ribofuranose |
R43 N;R50/53 |
|
* |
|
|
| 6974-85-2 |
ethyl-2-bromdecanoat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 6975-98-0 |
2-methyldecan |
N;R50/53 |
|
* |
|
|
| 6976-59-6 |
4-bromphenyl-4-bromoctanoat |
R43 N;R50/53 |
|
* |
|
|
| 6976-72-3 |
heptylhexanoat- |
N;R50/53 |
|
* |
|
|
| 6988-21-2 |
dioxacarb eller 2-(1,3-dioxolan-2-yl)phenylmethylcarbamat |
T;R25 N;R51/53 |
* |
|
|
|
| 6994-46-3 |
1,4-bis(ethylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 6994-51-0 |
phenyl-4-(2H-naphtho[1,2-d]triazol-2-yl)stilben-2-sulfonat |
N;R50/53 |
|
* |
|
|
| 7009-60-1 |
pheniodolnatrium- |
R43 N;R50/53 |
|
* |
|
|
| 7023-01-0 |
octadecan-1,9,10-triol |
N;R50/53 |
|
* |
|
|
| 7027-11-4 |
3-cyan-3,5,5-trimethylcyclohexanon |
Xn;R22-48/22 R43 R52/53 |
* |
|
|
|
| 7035-02-1 |
2-(chlormethyl)anisol |
Xn;R22 Mut3;R40 N;R50 |
|
* |
|
|
| 7042-93-5 |
oxiranylmethyl-alpha-oxiranyl-p-anisat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 7044-02-2 |
methyl-2-[3-cyan-4-oxo-4-(phenylmethoxy)but-2-enyliden]-2,3-dihydro-1,3,3-trimethyl-1H-indol-5-carboxylat |
N;R50/53 |
|
* |
|
|
| 7048-72-8 |
N-benzyl-3,4,5,6-tetrahydro-2H-azepin-7-amin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 7053-79-4 |
(1S-trans)-2-methyl-5-(1-methylvinyl)cyclohex-2-en-1-ylacetat |
N;R50/53 |
|
* |
|
|
| 7055-03-0 |
mebenil- |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 7059-49-6 |
12-hydroxyoctadecan-1-amid |
R43 N;R50/53 |
|
* |
|
|
| 7064-71-3 |
5-methyl-3-phenylpropyl-5-carboxylato-alpha-cyan-1,3,3-trimethylindolin-DELTA-{2}-,.-{gamma}-.-crotonat |
N;R50/53 |
|
* |
|
|
| 7067-44-9 |
butyltricyclohexylstannan |
Xn;R20/21/22 N;R50/53 |
* |
|
|
|
| 7069-41-2 |
(E)-tridecen-2-al |
N;R50/53 |
|
* |
|
|
| 7091-75-0 |
2,2'-(1,4-phenylen)bis[5-(4-methylphenyl)oxazol] |
N;R50/53 |
|
* |
|
|
| 7098-08-0 |
4,8-diamino-1,5-dihydroxy-2-(4-hydroxyphenyl)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 7109-27-5 |
4,4',4''-(1-vinyl-2-yliden)trianisol |
N;R50/53 |
|
* |
|
|
| 7111-29-7 |
(1R-cis)-2-methyl-5-(1-methylvinyl)cyclohex-2-en-1-ylacetat |
N;R50/53 |
|
* |
|
|
| 7116-95-2 |
4-isopropylbiphenyl |
N;R50/53 |
|
* |
|
|
| 7116-96-3 |
4-pentylbiphenyl |
N;R50/53 |
|
* |
|
|
| 7121-10-0 |
2-[N-(4-chlor-2,5-dimethoxyphenyl)carbamoyl]-3-naphthylacetat |
R43 N;R50/53 |
|
* |
|
|
| 7133-46-2 |
dicyclohexylsulfid- |
N;R50/53 |
|
* |
|
|
| 7137-55-5 |
1-butyl-2-nitrobenzen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 7143-69-3 |
linalylphenylacetat- |
N;R50/53 |
|
* |
|
|
| 7144-65-2 |
biphenyl-2-yl-2,3-epoxypropylether |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 7145-20-2 |
2,3-dimethylhex-2-en |
N;R50/53 |
|
* |
|
|
| 7149-24-8 |
1-(3,3-diethoxy-2-methylpropyl)-4-(isopropyl)benzen |
N;R50/53 |
|
* |
|
|
| 7149-26-0 |
linalylanthranilat- |
N;R50/53 |
|
* |
|
|
| 7149-27-1 |
1,5-dimethyl-1-vinyl-4-hexenyl-2-(methylamino)benzoat |
N;R50/53 |
|
* |
|
|
| 7149-34-0 |
3,7,11-trimethyldodeca-1,6,10-trien-3-ylpropionat |
N;R50/53 |
|
* |
|
|
| 7150-55-2 |
4-chlor-4'-hydroxybutyrophenon |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 7153-98-2 |
bis(3,5,5-trimethylhexyl)hydrogenphosphat |
N;R50/53 |
|
* |
|
|
| 7155-12-6 |
heptylbenzoat- |
N;R50/53 |
|
* |
|
|
| 7176-17-2 |
bis(2,3-epoxypropyl)cyclohexan-1,2-dicarboxylat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 7176-19-4 |
tris(oxiranylmethyl)benzen-1,3,5-tricarboxylat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 7191-46-0 |
1-(2-hydroxy-3,5-diiodphenyl)ethan-1-on |
R43 N;R50/53 |
|
* |
|
|
| 7195-43-9 |
bis(2,3-epoxypropyl)isophthalat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 7195-44-0 |
bis(2,3-epoxypropyl)terephthalat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 7205-63-2 |
1-(isopropylthio)-4-nitrobenzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 7212-99-9 |
2-(2,6-dimethylhepta-1,5-dienyl)-5-methyl-5-propyl-1,3-dioxan |
N;R50/53 |
|
* |
|
|
| 7218-02-2 |
2,6-dimethylbenzen-1,4-diamin |
Xn;R22 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 7226-88-2 |
2,6-dicyclohexyl-p-cresol |
R43 N;R50/53 |
|
* |
|
|
| 7227-91-0 |
3,3-dimethyl-1-phenyltriazen |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 7237-83-4 |
tris(oxiranylmethyl)benzen-1,2,4-tricarboxylat |
Mut3;R40 R43 |
|
* |
|
|
| 7244-77-1 |
1-nitro-4-propoxybenzen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 7246-21-1 |
natriumtyropanoat- |
R43 N;R50/53 |
|
* |
|
|
| 7248-16-0 |
2,3-bis(4-methoxyphenyl)quinoxalin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 7251-61-8 |
2-methylquinoxalin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 7252-83-7 |
2-brom-1,1-dimethoxyethan |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 7260-11-9 |
phenyl-3-hydroxy-2-naphthoat |
N;R50/53 |
|
* |
|
|
| 7261-97-4 |
dantrolen- |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 7299-89-0 |
bis(2-ethylbutyl)phthalat |
N;R50/53 |
|
* |
|
|
| 7300-59-6 |
N-(4-nitrophenyl)-L-glutamin |
Mut3;R40 R43 |
|
* |
|
|
| 7300-81-4 |
3,6,9,12,15,18,21,24,27-nonaoxahentetracontan-1-ol |
N;R50/53 |
|
* |
|
|
| 7306-46-9 |
4-(chlormethyl)-1,2-dimethoxybenzen |
Mut3;R40 |
|
* |
|
|
| 7311-27-5 |
2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethanol |
N;R50/53 |
|
* |
|
|
| 7311-30-0 |
N-methyldodecylamin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 7314-85-4 |
2-bromtricyclo[3.3.1.1-{3,7}-]decan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 7328-18-9 |
2-(2-methoxyethoxy)ethylacrylat |
Xn;R22 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 7328-34-9 |
ethyl-(2E,4E)-2,4-decadienoat |
N;R50/53 |
|
* |
|
|
| 7328-97-4 |
2,2',2'',2'''-[ethan-1,2-diylidentetrakis(p-phenylenoxymethylen)]tetraoxiran |
Mut3;R40 |
|
* |
|
|
| 7334-33-0 |
2,2'-dichlorazobenzen |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 7347-19-5 |
2-(2,4,6-tribromphenoxy)ethylacrylat |
R43 N;R50/53 |
|
* |
|
|
| 7356-11-8 |
methyl-3-nitro-p-toluat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 7359-19-5 |
bis(bicyclo[2.2.1]hept-5-en-2-ylmethyl)adipat |
N;R50/53 |
|
* |
|
|
| 7367-85-3 |
methyl-(E)-2-decenoat |
N;R50/53 |
|
* |
|
|
| 7367-88-6 |
ethyl-(E)-2-decenoat |
N;R50/53 |
|
* |
|
|
| 7370-44-7 |
tetrahydro-6-undecyl-2H-pyran-2-on |
N;R50/53 |
|
* |
|
|
| 7383-90-6 |
3,4'-dimethyl-1,1'-biphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 7383-98-4 |
N-(1-methylpropyl)-N'-phenylbenzen-1,2-diamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 7411-49-6 |
biphenyl-3,3',4,4'-tetrayltetraammoniumtetrachlorid |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 7413-36-7 |
nifenalol- |
Mut3;R40 |
|
* |
|
|
| 7415-86-3 |
bis(2,3-dibrompropyl)phthalat |
N;R50/53 |
|
* |
|
|
| 7425-15-2 |
2-ethylbutyl-2-ethylhexanoat |
N;R50/53 |
|
* |
|
|
| 7425-60-7 |
ethyl-2-bromnonan-1-oat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 7425-81-2 |
2-[(3-amino-4-methoxyphenyl)sulfonyl]ethanol |
Mut3;R40 |
|
* |
|
|
| 7432-44-2 |
methyl-(3alpha,5beta,7alpha,12alpha)-7-acetoxy-3,12-dihydroxycholan-24-oat |
N;R50/53 |
|
* |
|
|
| 7433-56-9 |
trans-dec-5-en |
N;R50/53 |
|
* |
|
|
| 7434-40-4 |
ethan-1,2-diylbis(oxyethan-2,1-diyl)bisheptanoat |
N;R50/53 |
|
* |
|
|
| 7435-83-8 |
3-(chlormethyl)-1,2,4,5-tetramethylbenzen |
R43 N;R50/53 |
|
* |
|
|
| 7439-97-6 |
kviksølv |
T;R23 R33 N;R50/53 |
* |
|
|
|
| 7440-02-0 |
nikkel |
Carc3;R40 R43 |
* |
|
|
|
| 7440-28-0 |
thallium |
Tx;R26/28 R33 R53 |
* |
|
|
|
| 7440-41-7 |
beryllium |
Carc2;R49 T;R25-48/23 Tx;R26 Xi;R36/37/38 R43 |
* |
|
|
|
| 7440-48-4 |
cobalt |
R42/43 R53 |
* |
|
|
|
| 7440-61-1 |
uran |
Tx;R26/28 R33 R53 |
* |
|
|
|
| 7446-18-6 |
dithalliumsulfat |
Tx;R28 Xi;R38 T;R48/25 N;R51/53 |
* |
|
|
|
| 7446-27-7 |
triblybis(orthophosphat) |
Rep1;R61 R33 Xn;R48/22 Rep3;R62 N;R50/53 |
* |
|
|
|
| 7451-01-6 |
2-(2-chlorethyl)-4-methyl-1,3-dioxolan |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 7462-24-0 |
1,3,3-trimethylbicyclo[2.2.1]hept-2-ylsalicylat |
N;R50/53 |
|
* |
|
|
| 7463-35-6 |
N-(3-chlor-2-methylphenyl)acetamid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 7467-29-0 |
5-(o-tolylazo)toluen-2,4-diamin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 7467-71-2 |
4,4'-pentamethylendioxydibenzonitril |
N;R50/53 |
|
* |
|
|
| 7478-69-5 |
4,4'-vinylidenbis(N,N-dimethylanilin) |
Xn;R22 N;R50/53 |
|
* |
|
|
| 7487-94-7 |
kviksølvdichlorid |
Tx;R28 C;R34 T;R48/24/25 N;R50/53 |
* |
|
|
|
| 7491-02-3 |
diisopropylsebacat- |
N;R50/53 |
|
* |
|
|
| 7493-76-7 |
allylundec-10-enoat |
N;R50/53 |
|
* |
|
|
| 7493-78-9 |
2-(phenylmethylen)heptylacetat |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 7493-95-0 |
p-nitrophenyl-alpha-D-galactopyranosid |
Mut3;R40 |
|
* |
|
|
| 7497-11-2 |
bis(2,4,6-trichlorphenyl)carbonat |
R43 N;R50/53 |
|
* |
|
|
| 7500-76-7 |
4,4'-benzylidendianisol |
N;R50/53 |
|
* |
|
|
| 7506-53-8 |
2-benzyl-5-ethyl-4-propyl-1,3-dioxan |
N;R50/53 |
|
* |
|
|
| 7507-48-4 |
2-tert-butyl-1,4-phenylendiacetat |
N;R50/53 |
|
* |
|
|
| 7510-28-3 |
1-(chlormethyl)-2-(phenylmethyl)benzen |
R43 N;R50/53 |
|
* |
|
|
| 7517-27-3 |
3-(hexadecylamino)propan-1,2-diol |
R43 N;R50/53 |
|
* |
|
|
| 7545-24-6 |
N,N-bis(2-hydroxyethyl)hexadecan-1-amid |
R43 N;R50/53 |
|
* |
|
|
| 7570-45-8 |
N-ethylcarbazol-3-carbaldehyd |
Xn;R22 N;R50/53 |
|
* |
|
|
| 7572-29-4 |
dichloracetylen |
E;R2 Carc3;R40 Xn;R48/20 |
* |
|
|
|
| 7580-46-3 |
4-octylpyrocatechol |
R43 N;R50/53 |
|
* |
|
|
| 7585-14-0 |
di-n-octylaluminiumiodid |
R14 F;R17 C;R34 N;R50/53 |
* |
|
|
|
| 7617-74-5 |
laurixamin- |
R43 N;R50/53 |
|
* |
|
|
| 7617-82-5 |
3-(tetradecyloxy)propylamin |
R43 N;R50/53 |
|
* |
|
|
| 7646-79-9 |
cobaltdichlorid |
Carc2;R49 Xn;R22 R42/43 N;R50/53 |
* |
|
|
|
| 7646-85-7 |
zinkchlorid |
C;R34 N;R50/53 |
* |
|
|
|
| 7647-18-9 |
antimonpentachlorid |
C;R34 N;R51/53 |
* |
|
|
|
| 7650-89-7 |
tribenzylphosphin- |
N;R50/53 |
|
* |
|
|
| 7658-80-2 |
o-toluohydrazid |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 7661-55-4 |
5-methylquinolin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 7664-41-7 |
ammoniak, vandfri |
R10 T;R23 C;R34 N;R50 |
* |
|
|
|
| 7665-72-7 |
(tert-butoxymethyl)oxiran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 7673-07-6 |
tribenzylaminhydrochlorid- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 7705-14-8 |
(?)-1-methyl-4-(1-methylvinyl)cyclohexen |
R10 Xi;R38 R43 N;R50/53 |
* |
|
|
|
| 7712-50-7 |
myrtecain- |
R43 N;R50/53 |
|
* |
|
|
| 7717-73-9 |
1,1'-oxybis(3,4-xylyl) |
Xn;R22 N;R50/53 |
|
* |
|
|
| 7719-12-2 |
phosphortrichlorid |
R14 Tx;R26/28 R29 C;R35 Xn;R48/20 |
* |
|
|
|
| 7722-64-7 |
kaliumpermanganat |
O;R8 Xn;R22 N;R50/53 |
* |
|
|
|
| 7727-21-1 |
dikaliumperoxodisulfat |
O;R8 Xn;R22 Xi;R36/37/38 R42/43 |
* |
|
|
|
| 7727-33-5 |
ethandiylidentetrakisphenol- |
R43 N;R50/53 |
|
* |
|
|
| 7727-54-0 |
ammoniumpersulfat |
O;R8 Xn;R22 Xi;R36/37/38 R42/43 |
* |
|
|
|
| 7733-02-0 |
zinksulfat |
Xi;R36/38 N;R50/53 |
* |
|
|
|
| 7758-01-2 |
kaliumbromat |
Carc2;R45 O;R9 T;R25 |
* |
|
|
|
| 7758-09-0 |
kaliumnitrit |
O;R8 T;R25 N;R50 |
* |
|
|
|
| 7758-89-6 |
kobber(I)chlorid |
Xn;R22 N;R50/53 |
* |
|
|
|
| 7758-97-6 |
blychromat |
Rep1;R61 R33 Carc3;R40 Rep3;R62 N;R50/53 |
* |
|
|
|
| 7758-98-7 |
kobbersulfat |
Xn;R22 Xi;R36/38 N;R50/53 |
* |
|
|
|
| 7761-88-8 |
sølvnitrat |
C;R34 N;R50/53 |
* |
|
|
|
| 7766-37-2 |
N-(4-methoxyphenyl)acrylamid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 7766-38-3 |
N-(4-nitrophenyl)acrylamid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 7773-34-4 |
3,4-bis(4-methoxyphenyl)hex-3-en |
N;R50/53 |
|
* |
|
|
| 7774-68-7 |
1,1'-oxybis[2,3-dichlorpropan] |
Xn;R22 Mut3;R40 Carc3;R40 R52/53 |
|
* |
|
|
| 7774-82-5 |
tridec-2-enal |
N;R50/53 |
|
* |
|
|
| 7775-11-3 |
natriumchromat |
Mut2;R46 Carc2;R49 Xn;R21 T;R25 Tx;R26 Xi;R37/38-41 R43
N;R50/53 |
* |
|
|
|
| 7778-50-9 |
kaliumdichromat |
Mut2;R46 Carc2;R49 Xn;R21 T;R25 Tx;R26 Xi;R37/38-41 R43
N;R50/53 |
* |
|
|
|
| 7778-73-6 |
kaliumpentachlorphenolat |
T;R24/25 Tx;R26 Xi;R36/37/38 Carc3;R40 N;R50/53 |
* |
|
|
|
| 7778-96-3 |
(S)-3,7-dimethyloct-7-enylisovalerat |
N;R50/53 |
|
* |
|
|
| 7779-17-1 |
cyclohexylcinnamat- |
N;R50/53 |
|
* |
|
|
| 7779-23-9 |
1,5-dimethyl-1-vinylhex-4-enylhexanoat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 7779-67-1 |
3-methylbutylfuran-2-propionat |
N;R50/53 |
|
* |
|
|
| 7779-70-6 |
isopentylnonanoat- |
N;R50/53 |
|
* |
|
|
| 7782-49-2 |
selen |
T;R23/25 R33 R53 |
* |
|
|
|
| 7784-40-9 |
blyhydrogenarsenat |
Carc1;R45 Rep1;R61 T;R23/25 R33 Rep3;R62 N;R50/53 |
* |
|
|
|
| 7784-42-1 |
arsin |
Fx;R12 Tx;R26 Xn;R48/20 N;R50/53 |
* |
|
|
|
| 7785-26-4 |
(-)-pin-2(3)-en |
N;R50/53 |
|
* |
|
|
| 7785-33-3 |
(E)-3,7-dimethyl-2,6-octadienyl-2-methylcrotonat |
N;R50/53 |
|
* |
|
|
| 7785-70-8 |
(+)-pin-2(3)-en |
N;R50/53 |
|
* |
|
|
| 7785-87-7 |
mangansulfat |
Xn;R48/20/22 N;R51/53 |
* |
|
|
|
| 7786-47-2 |
nonylisovalerat- |
N;R50/53 |
|
* |
|
|
| 7786-58-5 |
octylisovalerat- |
N;R50/53 |
|
* |
|
|
| 7786-81-4 |
nikkelsulfat |
Xn;R22 Carc3;R40 R42/43 N;R50/53 |
* |
|
|
|
| 7789-00-6 |
kaliumchromat |
Mut2;R46 Carc2;R49 Xi;R36/37/38 R43 N;R50/53 |
* |
|
|
|
| 7789-06-2 |
strontiumchromat |
Carc2;R45 Xn;R22 N;R50/53 |
* |
|
|
|
| 7789-09-5 |
ammoniumdichromat |
Mut2;R46 Carc2;R49 E;R1 O;R8 Xn;R21 T;R25 Tx;R26 Xi;R37/38-41
R43 N;R50/53 |
* |
|
|
|
| 7789-12-0 |
natriumdichromat, dihydrat |
Mut2;R46 Carc2;R49 Xn;R21 T;R25 Tx;R26 Xi;R37/38-41 R43
N;R50/53 |
* |
|
|
|
| 7790-79-6 |
cadmiumfluorid |
Carc2;R45 Mut2;R46 Rep2;R60-61 T;R25-48/23/25 Tx;R26 N;R50/53 |
* |
|
|
|
| 7790-80-9 |
cadmiumiodid |
T;R23/25 R33 Xn;R68 N;R50/53 |
* |
|
|
|
| 7803-49-8 |
hydroxylamin |
R5 Xn;R22-48/22 Xi;R37/38-41 R43 N;R50 |
* |
|
|
|
| 8001-35-2 |
toxaphen = camphechlor |
Xn;R21 T;R25 Xi;R37/38 Carc3;R40 N;R50/53 |
* |
|
|
* |
| 8003-05-2 |
phenylkviksølvhydroxid (1), phenylkviksølvnitrat
(2), blanding af (1) og (2) |
T;R25-48/24/25 C;R34 N;R50/53 |
* |
|
|
|
| 8007-45-2 |
tjære, stenkuls- |
Carc1;R45 |
* |
|
|
|
| 8052-41-3 |
mineralsk terpentin |
Carc2;R45 R10 Xn;R48/20-65 |
* |
|
|
|
| 8065-36-9 |
bufencarb |
T;R24/25 N;R50/53 |
* |
|
|
|
| 8069-76-9 |
dinocton-6 |
Xn;R22 N;R50/53 |
* |
|
|
|
| 9000-90-2 |
?-amylase |
R42 |
* |
|
|
|
| 9001-00-7 |
bromelain, saft |
Xi;R36/37/38 R42 |
* |
|
|
|
| 9001-22-3 |
?-glucosidase |
R42 |
* |
|
|
|
| 9001-33-6 |
ficin |
Xi;R36/37/38 R42 |
* |
|
|
|
| 9001-73-4 |
papain |
Xi;R36/37/38 R42 |
* |
|
|
|
| 9001-75-6 |
pepsin a |
Xi;R36/37/38 R42 |
* |
|
|
|
| 9001-98-3 |
rennin |
Xi;R36/37/38 R42 |
* |
|
|
|
| 9012-54-8 |
cellulase |
R42 |
* |
|
|
|
| 9004-07-3 |
chymotrypsin |
Xi;R36/37/38 R42 |
* |
|
|
|
| 9014-01-1 |
subtilisin |
Xi;R37/38-41 R42 |
* |
|
|
|
| 9068-59-1 |
proteinase, mikrobiel neutral |
Xi;R36/37/38 R42 |
* |
|
|
|
| 10000-42-7 |
p-[[2,5-dimethoxy-4-(phenylazo)phenyl]azo]phenol |
Mut3;R40 |
|
* |
|
|
| 10024-56-3 |
(Z)-1-methyl-1-(4-methyl-3-cyclohexen-1-yl)ethylcinnamat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 10025-87-3 |
phosphoryltrichlorid |
R14 Xn;R22 Tx;R26 R29 C;R35 T;R48/23 |
* |
|
|
|
| 10025-99-7 |
dikaliumtetrachloroplatinat |
T;R25 Xi;R38-41 R42/43 |
* |
|
|
|
| 10026-00-3 |
dinatriumtetrachlorplatinat |
T;R25 Xi;R38-41 R42/43 |
* |
|
|
|
| 10026-13-8 |
phosphorpentachlorid |
R14 Xn;R22-48/20 Tx;R26 R29 C;R34 |
* |
|
|
|
| 10029-24-0 |
dimethyl-N,N'-(methylendi-4,1-phenylen)bis[2-methyl-beta-alaninat] |
N;R50/53 |
|
* |
|
|
| 10032-02-7 |
geranylhexanoat- |
N;R50/53 |
|
* |
|
|
| 10039-54-0 |
bis(hydroxylammonium)sulfat |
Xn;R22-48/22 Xi;R36/38 R43 N;R50 |
* |
|
|
|
| 10046-00-1 |
hydroxylammoniumhydrogensulfat |
Xn;R22-48/22 Xi;R36/38 R43 N;R50 |
* |
|
|
|
| 10061-01-5 |
(Z)-1,3-dichlorpropen |
R10 Xn;R20/21 T;R25 Xi;R36/37/38 R43 N;R50/53 |
* |
|
|
|
| 10061-11-7 |
4,5-dihydro-2-(1-naphthylmethyl)-1H-imidazoliumnitrat |
N;R50/53 |
|
* |
|
|
| 10094-34-5 |
alpha-alpha-dimethylphenethylbutyrat |
N;R50/53 |
|
* |
|
|
| 10097-16-2 |
diethyl-(methylendi-4,1-phenylen)dicarbamat |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 10099-71-5 |
dipentylmaleat- |
R43 N;R50/53 |
|
* |
|
|
| 10108-22-2 |
3-hydroxypropyllaurat |
N;R50/53 |
|
* |
|
|
| 10108-64-2 |
cadmiumchlorid |
Carc2;R45 Mut2;R46 Rep2;R60-61 T;R25-48/23/25 Tx;R26 N;R50/53 |
* |
|
|
|
| 10112-91-1 |
dikviksølvdichlorid |
Xn;R22 Xi;R36/37/38 N;R50/53 |
* |
|
|
|
| 10114-58-6 |
1,3-bis(2,3-diaminophenylazo)benzenhydrochlorid |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 10124-36-4 |
cadmiumsulfat |
Carc2;R49 Xn;R22 T;R48/23/25 N;R50/53 |
* |
|
|
|
| 10124-43-3 |
cobaltsulfat |
Carc2;R49 Xn;R22 R42/43 N;R50/53 |
* |
|
|
|
| 10140-96-2 |
ethyl-6-chlorhexanoat |
Mut3;R40 R43 N;R50 |
|
* |
|
|
| 10143-07-4 |
natrium-5-(phenylazo)salicylat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 10183-49-0 |
6,7-dichloranthracen-1,4,9,10-tetrol |
R43 N;R50/53 |
|
* |
|
|
| 10187-52-7 |
natriumhydrogen-2,2'-methylenbis[4-chlorphenolat] |
N;R50/53 |
|
* |
|
|
| 10192-62-8 |
4,4'-isopropylidendiphenyldiacetat |
N;R50/53 |
|
* |
|
|
| 10192-93-5 |
1,1'-(1,2-diethyl-1,2-dimethylethylen)bisbenzen |
N;R50/53 |
|
* |
|
|
| 10218-57-2 |
1-[cyclohexyliden(4-methoxyphenyl)methyl]-4-methoxybenzen |
N;R50/53 |
|
* |
|
|
| 10222-95-4 |
5-isopropyl-1,2,4-trimethylbenzen |
N;R50/53 |
|
* |
|
|
| 10226-28-5 |
ethyl-3,4-dihydro-6-methyl-2H-pyran-5-carboxylat |
Mut3;R40 R52/53 |
|
* |
|
|
| 10228-03-2 |
2-[N-methyl-4-(methylamino)-3-nitroanilino]ethanol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 10231-84-2 |
p-nitrophenyl-6-deoxy-alpha-L-galactopyranosid |
Mut3;R40 |
|
* |
|
|
| 10238-27-4 |
o-nitrophenyl-beta-D-xylopyranosid |
Mut3;R40 |
|
* |
|
|
| 10238-28-5 |
p-nitrophenyl-alpha-D-xylopyranosid |
Mut3;R40 |
|
* |
|
|
| 10251-17-9 |
2-naphthyloctanoat |
N;R50/53 |
|
* |
|
|
| 10272-06-7 |
3-chlor-5-methoxyanilin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 10272-07-8 |
3,5-dimethoxyanilin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 10276-85-4 |
benzyloctanoat- |
N;R50/53 |
|
* |
|
|
| 10278-71-4 |
N,N-dimethyl-N'-o-tolylformamidin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 10281-53-5 |
[1S-(1alpha,2alpha,5alpha)]-2,6,6-trimethylbicyclo[3.1.1]heptan |
N;R50/53 |
|
* |
|
|
| 10298-80-3 |
4-chlor-3-nitroanisol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 10310-32-4 |
tribenosid- |
N;R50/53 |
|
* |
|
|
| 10311-84-9 |
dialifos eller 2-chlor-1-phthalimidoethyl-O,O-diethyldithiophosphat |
T;R24 Tx;R28 N;R50/53 |
* |
|
|
|
| 10312-45-5 |
17beta-hydroxyandrost-4-en-3-on hexanoat |
N;R50/53 |
|
* |
|
|
| 10331-57-4 |
niclofolan- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 10342-59-3 |
1-nitro-4-propylbenzen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 10342-60-6 |
1-isobutyl-4-nitrobenzen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 10355-53-0 |
4-nitro-1,1':4':1''-terphenyl |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 10357-27-4 |
p-nitrophenyl-alpha-D-mannopyranosid |
Mut3;R40 |
|
* |
|
|
| 10357-99-0 |
N,N-dimethyl-2-(3-(4-chlorphenyl)-4,5-dihydropyrazol-1-ylphenylsulfonyl)ethylamin |
R43 Xn;R48/22 N;R51/53 |
* |
|
|
|
| 10359-69-0 |
natrium-4-nitro-2-stilbensulfonat |
Mut3;R40 R43 |
|
* |
|
|
| 10368-25-9 |
N,N'-bis(phenylmethyl)benzen-1,4-diamin |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 10374-74-0 |
tetradec-7-en |
N;R50/53 |
|
* |
|
|
| 10386-84-2 |
4,4'-dibrom-2,2',3,3',5,5',6,6'-octafluor-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 10389-51-2 |
4-(4-nitrophenyl)morpholin |
Mut3;R40 Carc3;R40 R52/53 |
|
* |
|
|
| 10397-58-7 |
3-nitro-p-anisamid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 10402-47-8 |
geranylvalerat- |
N;R50/53 |
|
* |
|
|
| 10402-48-9 |
3,7-dimethyl-2,6-octadienyl-2,3-dimethylcrotonat |
N;R50/53 |
|
* |
|
|
| 10402-53-6 |
3-[4-(beta-ethoxyphenethyl)-1-piperazinyl]-2-methylpropiophenondihydrochlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 10402-90-1 |
eprazinon- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 10414-75-2 |
4-[(4-aminophenyl)methyl]-2-chloranilin |
Xn;R22 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 10453-86-8 |
resmethrin eller 5-benzyl-3-furylmethyl-(?)-cis-trans-chrysanthemat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 10457-90-6 |
bromperidol- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 10471-28-0 |
diethyldodecandioat- |
N;R50/53 |
|
* |
|
|
| 10479-25-1 |
N-ethyldibenzylamin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 10482-46-9 |
1,2,3,3a,4,5,6,8a-octahydro-2-isopropyliden-4,8-dimethylazulen |
N;R50/53 |
|
* |
|
|
| 10482-53-8 |
(Z,Z,Z)-heptadeca-1,8,11,14-tetraen |
N;R50/53 |
|
* |
|
|
| 10482-65-2 |
cinnamylvalerat- |
N;R50/53 |
|
* |
|
|
| 10482-77-6 |
citronellylbenzoat- |
N;R50/53 |
|
* |
|
|
| 10482-79-8 |
citronellylcinnamat- |
N;R50/53 |
|
* |
|
|
| 10484-36-3 |
2-pentyloxy-5-prop-1-enylanisol |
N;R50/53 |
|
* |
|
|
| 10486-12-1 |
(-)-3,7-dimethyloct-7-enylbenzoat |
N;R50/53 |
|
* |
|
|
| 10486-14-3 |
(S)-3,7-dimethyloct-7-enylphenylacetat |
N;R50/53 |
|
* |
|
|
| 10486-19-8 |
tridecanal- |
N;R50/53 |
|
* |
|
|
| 10486-26-7 |
1,2,3,3a,4,5,6,8a-octahydro-2-isopropyliden-4,8-dimethylazulen-6-ylpropionat |
N;R50/53 |
|
* |
|
|
| 10491-31-3 |
natriumbis(p-tert-butylphenyl)phosphat |
N;R50/53 |
|
* |
|
|
| 10496-51-2 |
2-(2-furfuryliden)cyclohexan-1-on |
Mut3;R40 |
|
* |
|
|
| 10517-50-7 |
2-amino-alpha-methylbenzylalkohol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 10522-20-0 |
3-methyldodecanal |
N;R50/53 |
|
* |
|
|
| 10522-32-4 |
(Z)-3,7-dimethylocta-2,6-dienylphenylacetat |
N;R50/53 |
|
* |
|
|
| 10522-33-5 |
(Z)-3,7-dimethylocta-2,6-dienylvalerat |
N;R50/53 |
|
* |
|
|
| 10522-37-9 |
undec-3-en-2-on |
N;R50/53 |
|
* |
|
|
| 10523-35-0 |
2-nonylpyridin |
N;R50/53 |
|
* |
|
|
| 10525-17-4 |
furfurylacrylat- |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 10534-92-6 |
natrium-7-benzamido-4-hydroxynaphthalen-2-sulfonat |
Mut3;R40 R43 |
|
* |
|
|
| 10538-58-6 |
methyl-12alpha-hydroxy-3-oxo-5beta-cholan-24-oat |
N;R50/53 |
|
* |
|
|
| 10540-29-1 |
tamoxifen- |
R43 N;R50/53 |
|
* |
|
|
| 10560-13-1 |
diethyl-5-nitroisophthalat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 10571-59-2 |
nicoclonat- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 10572-34-6 |
cicliomenol- |
N;R50/53 |
|
* |
|
|
| 10572-60-8 |
1-[(1-methylethyl)amino]-4-[(4-methylphenyl)amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 10573-17-8 |
3alpha-hydroxy-6-oxo-5alpha-cholan-24-syre |
N;R50/53 |
|
* |
|
|
| 10580-65-1 |
[(nonyloxy)methyl]oxiran |
Mut3;R40 R43 |
|
* |
|
|
| 10588-01-9 |
natriumdichromat |
Mut2;R46 Carc2;R49 O;R8 Xn;R21 T;R25 Tx;R26 Xi;R37/38-41
R43 N;R50/53 |
* |
|
|
|
| 10592-65-1 |
quingestanol- |
N;R50/53 |
|
* |
|
|
| 10595-60-5 |
N,N'-bis(1,3-dimethylbutyliden)-2,2'-iminobis(ethylamin) |
N;R50/53 |
|
* |
|
|
| 10605-21-7 |
carbendazim eller methylbenzimidazol-2-ylcarbamat |
Mut3;R68 |
* |
|
|
|
| 11005-63-3 |
K-strophantin |
T;R23/25 R33 |
* |
|
|
|
| 11028-42-5 |
cedren- |
N;R50/53 |
|
* |
|
|
| 11031-45-1 |
santalol- |
N;R50/53 |
|
* |
|
|
| 11070-44-3 |
tetrahydromethylphthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 11096-82-5 |
Aroclor 1260 |
|
|
|
|
* |
| 11097-69-1 |
Aroclor 1254 |
|
|
|
|
* |
| 12001-28-4 |
asbest |
Carc1;R45 T;R48/23 |
* |
|
|
|
| 12001-29-5 |
asbest |
Carc1;R45 T;R48/23 |
* |
|
|
|
| 12035-36-8 |
nikkeldioxid |
Carc1;R49 R43 R53 |
* |
|
|
|
| 12035-72-2 |
trinikkeldisulfid |
Carc1;R49 R43 N;R51/53 |
* |
|
|
|
| 12054-48-7 |
nikkeldihydroxid |
Xn;R20/22 Carc3;R40 R43 N;R50/53 |
* |
|
|
|
| 12122-67-7 |
Zineb |
R37-43 |
|
|
|
* |
| 12172-73-5 |
asbest |
Carc1;R45 T;R48/23 |
* |
|
|
|
| 12217-79-7 |
1,5-diaminochlor-4,8-dihydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 12223-91-5 |
5-[[4-[(2,4-dinitrophenyl)amino]phenyl]azo][1,1'-biphenyl]-2-ol |
Mut3;R40 R43 |
|
* |
|
|
| 12427-38-2 |
Maneb |
R37-43 |
|
|
|
* |
| 12510-42-8 |
erionit |
Carc1;R45 |
* |
|
|
|
| 12656-85-8 |
blychromatmolybdatsulfatrød (C.I. 77605) |
Rep1;R61 R33 Carc3;R40 Rep3;R62 N;R50/53 |
* |
|
|
|
| 12672-29-6 |
Aroclor 1248 |
|
|
|
|
* |
| 12789-03-6 |
Chlordane |
|
|
|
|
* |
| 13001-28-0 |
1-chlor-4-(2-chlorethoxy)benzen |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/5 |
|
* |
|
|
| 13001-38-2 |
2-[2-[4-[2-(4-cyanphenyl)vinyl]phenyl]vinyl]benzonitril |
N;R50/53 |
|
* |
|
|
| 13001-39-3 |
2,2'-(p-phenylendiethen-2,1-diyl)bisbenzonitril |
N;R50/53 |
|
* |
|
|
| 13001-40-6 |
4,4'-(p-phenylendiethen-2,1-diyl)bisbenzonitril |
N;R50/53 |
|
* |
|
|
| 13010-47-4 |
lomustin- |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 13027-28-6 |
4,5,6,7-tetrabrom-3,3-bis(4-hydroxyphenyl)phthalid |
N;R50/53 |
|
* |
|
|
| 13065-83-3 |
2-amino-N-phenyltoluen-4-sulfonamid |
Mut3;R40 |
|
* |
|
|
| 13067-93-1 |
cyanofenphos eller O-4-cyanophenyl-O-ethylphenylthiophosphonat |
Xn;R21 T;R25-39/25 Xi;R36 |
* |
|
|
|
| 13078-15-4 |
1-(3-chlorphenyl)piperaziniumchlorid |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 13078-45-0 |
1,1'-(ethylendioxy)bis(3-chlorpropan-2-ol) |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 13080-86-9 |
4,4'-[isopropylidenbis(4,1-phenylenoxy)]dianilin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 13080-89-2 |
4,4'-[sulfonylbis(4,1-phenylenoxy)]dianilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/5 |
|
* |
|
|
| 13120-77-9 |
methyl-5-nitro-o-tolylether |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 13121-70-5 |
cyhexatin eller tricyclohexylhydroxystannan |
Xn;R20/21/22 N;R50/53 |
* |
|
|
|
| 13145-01-2 |
N,N'-[(phenylmethylen)di-4,1-phenylen]bis(acetamid) |
R43 N;R50/53 |
|
* |
|
|
| 13149-00-3 |
cis-cyclohexan-1,2-dicarboxylsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 13159-80-3 |
N-[(4-chlorphenyl)methyl]pyridin-4-amin |
Mut3;R40 Carc3;R40 R52/53 |
|
* |
|
|
| 13162-41-9 |
hexahydro-2,4,4,7-tetramethyl-4H-1,3-benzodioxin |
N;R50/53 |
|
* |
|
|
| 13171-21-6 |
phosphamidon eller (2-chlor-3-diethylamino-1-methyl-3-oxoprop-1-enyl)dimethylphosphat |
T;R24 Tx;R28 Mut3;R68 N;R50/53 |
* |
|
|
|
| 13181-17-4 |
bromofenoxim eller 3,5-dibrom-4-hydroxybenzaldehyd-O-(2,4-dinitrophenyl)oxim |
Xn;R22 N;R50/53 |
* |
|
|
|
| 13209-15-9 |
alpha-alpha-alpha',alpha'-tetrabrom-o-xylen |
N;R50/53 |
|
* |
|
|
| 13214-53-4 |
2-oxoimidazolidin-1-carbonylchlorid |
Mut3;R40 R43 |
|
* |
|
|
| 13224-99-2 |
4,6-O-ethyliden-alpha-D-glucose |
N;R50/53 |
|
* |
|
|
| 13236-02-7 |
1,2,3-tris(2,3-epoxypropoxy)propan |
Mut3;R40 R43 |
|
* |
|
|
| 13244-35-4 |
2-chlor-4-mesylanilin |
Mut3;R40 R43 |
|
* |
|
|
| 13250-97-0 |
4-hydroxy-7-methyl-1,8-naphthyridin-3-carboxylsyre |
Mut3;R40 |
|
* |
|
|
| 13290-74-9 |
2-chlor-5-nitrotoluen |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 13290-96-5 |
dimethyl-5-nitroisophthalat |
Mut3;R40 |
|
* |
|
|
| 13297-07-9 |
2-(2-chlorethyl)-1,3-dioxan |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 13301-60-5 |
N-[2-[[2-chlor-4-(methylsulfonyl)phenyl]azo]-5-(diethylamino)phenyl]acetamid |
Mut3;R40 R43 |
|
* |
|
|
| 13311-72-3 |
4-brom-2,3,6-trichlorphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 13313-45-6 |
3-(methylthio)-N-phenylanilin |
R43 N;R50/53 |
|
* |
|
|
| 13324-11-3 |
methyl-2-chlor-4-nitrobenzoat |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 13348-41-9 |
N,N'-dicyclohexylhexan-1,6-diamin |
N;R50/53 |
|
* |
|
|
| 13356-08-6 |
fenbutatin-oxid eller bis(tris(2-methyl-2-phenylpropyl)tin)oxid |
Tx;R26 Xi;R36/38 N;R50/53 |
* |
|
|
|
| 13358-73-1 |
dibutylcarbamoylchlorid- |
Mut3;R40 R43 |
|
* |
|
|
| 13360-57-1 |
dimethylsulfamoylchlorid |
Carc2;R45 Xn;R21/22 Tx;R26 C;R34 |
* |
|
|
|
| 13364-32-4 |
clobenzorex- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 13371-73-8 |
2-(cyclohexylphenylamino)ethanol |
Mut3;R40 R43 |
|
* |
|
|
| 13393-93-6 |
tetradecahydro-7-isopropyl-1,4a-dimethylphenanthren-1-methanol |
N;R50/53 |
|
* |
|
|
| 13403-24-2 |
4,6-O-ethyliden-D-glucose |
N;R50/53 |
|
* |
|
|
| 13410-58-7 |
2,2'-[(1-methylethyliden)bis(cyclohexan-4,1-diyloxymethylen)]bisoxiran |
Mut3;R40 R43 |
|
* |
|
|
| 13416-97-2 |
1,4-bis(2,3-epoxypropoxy)but-2-en |
Mut3;R40 R43 |
|
* |
|
|
| 13424-46-9 |
blydiazid |
Rep1;R61 E;R3 Xn;R20/22 R33 Rep3;R62 N;R50/53 |
* |
|
|
|
| 13438-18-1 |
2-hydroxydodecylmethacrylat |
R43 N;R50/53 |
|
* |
|
|
| 13443-29-3 |
2,3-epoxypropylbenzoat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 13453-03-7 |
3,5,5-trimethylhexylmethacrylat |
R43 N;R50/53 |
|
* |
|
|
| 13457-18-6 |
pyrazophos eller O,O-diethyl-O-(6-ethoxycarbonyl-5-methylpyrazolo[2,3-a]pyrimidin-2-yl)thiophosphat |
Xn;R20/22 N;R50/53 |
* |
|
|
|
| 13463-39-3 |
nikkelcarbonyl eller tetracarbonylnikkel |
Rep2;R61 F;R11 Tx;R26 Carc3;R40 N;R50/53 |
* |
|
|
|
| 13474-64-1 |
4,4'-methylenbis(N,N'-dimethyl-cyclohexanamin) |
Xn;R22-48/22 C;R35 R52/53 |
* |
|
|
|
| 13482-10-5 |
N,N'-bis(1-methylpropyl)benzen-1,2-diamin |
R43 N;R50/53 |
|
* |
|
|
| 13492-21-2 |
3-(hexahydro-1H-azepin-1-yl)-3'-nitropropiophenonhydrochlorid |
R43 N;R50/53 |
|
* |
|
|
| 13495-09-5 |
piminodin- |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 13516-27-3 |
guazatin |
Xn;R21/22 Xi;R36/38 N;R50/53 |
* |
|
|
|
| 13544-07-5 |
methyl-(2-nitro-4-trifluorbenzyl)acetat |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 13551-87-6 |
misonidazol- |
Mut3;R40 |
|
* |
|
|
| 13552-09-5 |
2-aminooctadecan-1,3-diol |
R43 N;R50/53 |
|
* |
|
|
| 13552-44-8 |
4,4'-methylendianiliniumdichlorid |
Xn;R22 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 13552-96-0 |
(E,Z,Z)-trideca-2,4,7-trienal |
N;R50/53 |
|
* |
|
|
| 13561-08-5 |
2,2'-[[2-(oxiranylmethoxy)-1,3-phenylen]bis(methylen)]bisoxiran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 13616-83-6 |
di(2,4-xylyl)disulfid |
N;R50/53 |
|
* |
|
|
| 13643-37-3 |
1-amino-4,8-dihydroxy-5-(methylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 13663-23-5 |
hexahydro-1-(4-nitrophenyl)-1H-azepin |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 13673-53-5 |
perchlorphenyl-N-(benzyloxycarbonyl)-L-isoleucinat |
N;R50/53 |
|
* |
|
|
| 13678-60-9 |
furfurylisovalerat- |
Mut3;R40 |
|
* |
|
|
| 13680-35-8 |
4,4'-methylenbis[2,6-diethylanilin] |
R43 N;R50/53 |
|
* |
|
|
| 13698-89-0 |
1,5-diamino-4,8-dihydroxy-2-(4-methoxyphenyl)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 13707-88-5 |
alprenololhydrochlorid- |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 13708-12-8 |
5-methylquinoxalin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 13716-91-1 |
1,5-diamino-4,8-dihydroxy-2-(4-hydroxyphenyl)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 13741-18-9 |
xibornol- |
R43 N;R50/53 |
|
* |
|
|
| 13746-54-8 |
2-methoxy-4-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)phenol |
N;R50/53 |
|
* |
|
|
| 13746-56-0 |
(exo)-2-methoxy-4-(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl)phenol |
N;R50/53 |
|
* |
|
|
| 13746-57-1 |
(exo,exo)-2-methoxy-5-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)phenol |
N;R50/53 |
|
* |
|
|
| 13746-58-2 |
5-isobornyl-2-methoxyphenol |
N;R50/53 |
|
* |
|
|
| 13746-60-6 |
exo-2-methoxy-6-(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 13746-62-8 |
2-methoxy-6-(5,5,6-trimethyl-2-norbornyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 13756-20-2 |
phenethylvalerat- |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 13765-19-0 |
calciumchromat |
Carc2;R45 Xn;R22 N;R50/53 |
* |
|
|
|
| 13820-41-2 |
diammoniumtetrachloroplatinat |
T;R25 Xi;R38-41 R42/43 |
* |
|
|
|
| 13900-12-4 |
diethyl[2-(2-phenylbutyroyloxy)ethyl]ammoniumdihydrogencitrat |
R43 N;R50/53 |
|
* |
|
|
| 13911-02-9 |
alpha,2,3,4-tetrachlortoluen |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 13933-75-0 |
(20R)-5alpha-pregnan-3alpha,17,20-triol |
N;R50/53 |
|
* |
|
|
| 13945-59-0 |
ethyl[[4-(acetylamino)phenyl]sulfonyl]carbamat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 13988-32-4 |
1-(p-ethoxyphenyl)-N,N-diethyl-3-phenylbutylamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 13997-19-8 |
nequinat- |
N;R50/53 |
|
* |
|
|
| 14007-30-8 |
4,4'-(1-methylpentyliden)bisphenol |
R43 N;R50/53 |
|
* |
|
|
| 14007-64-8 |
butetamat- |
R43 N;R50/53 |
|
* |
|
|
| 14027-78-2 |
dipentyladipat- |
N;R50/53 |
|
* |
|
|
| 14031-86-8 |
2,4,4,6,6-pentamethylhept-1-en |
N;R50/53 |
|
* |
|
|
| 14088-98-3 |
1-(3-chlorphenyl)imidazolidin-2-on |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 14114-05-7 |
cyclopropyltriphenylphosphoniumbromid- |
N;R50/53 |
|
* |
|
|
| 14121-36-9 |
2,3,4,6-tetrachlorpyridin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 14147-07-0 |
N,N-dibenzylpyridin-4-methylamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 14166-03-1 |
[3S-(3alpha,5alpha,8alpha)]-1-methyl-1-(1,2,3,4,5,6,7,8-octahydro-3,8-dimethylazulen-5-yl)ethylphenylacetat |
N;R50/53 |
|
* |
|
|
| 14166-21-3 |
trans-cyclohexan-1,2-dicarboxylsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 14176-10-4 |
cetiedil- |
N;R50/53 |
|
* |
|
|
| 14189-85-6 |
2-methoxy-3-methylcyclopent-2-en-1-on |
Mut3;R40 R43 |
|
* |
|
|
| 14191-92-5 |
17-.beta.hydroxyandrost-4-en-3-onhexahydrobenzoat |
N;R50/53 |
|
* |
|
|
| 14198-24-4 |
trans-2,5-dimethoxy-4'-nitrostilben |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 14202-13-2 |
3-methyltricyclo[3.3.1.1-{3,7}-]decan-1-yleddikesyre |
N;R50/53 |
|
* |
|
|
| 14228-73-0 |
1,4-bis[(2,3-epoxypropoxy)methyl]cyclohexan |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 14233-37-5 |
1,4-bis(isopropylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 14255-88-0 |
fenazaflor eller phenyl-5,6-dichlor-2-trifluormethylbenzimidazol-1-carboxylat |
Xn;R21/22 N;R50/53 |
* |
|
|
|
| 14286-84-1 |
[3-[(1-benzylcycloheptyl)oxy]propyl]dimethylammoniumhydrogenfumarat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 14297-39-3 |
1-(chlormethyl)-4-(phenylmethyl)benzen |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 14309-92-3 |
N-benzyl-4-nitroanilin |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 14315-16-3 |
3-aminobenzanilid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 14318-66-2 |
N-methyl-m-anisidin |
Mut3;R40 R43 |
|
* |
|
|
| 14324-55-1 |
zinkbis(diethyldithiocarbamat) |
Xn;R22 Xi;R36/37/38 R43 N;R50/53 |
* |
|
|
|
| 14340-08-0 |
5.xi.,17alpha-pregn-2-en-20-yn-17-ylacetat |
N;R50/53 |
|
* |
|
|
| 14366-73-5 |
1-chlor-4-[(2-chlorethyl)thio]benzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 14374-45-9 |
1-heptynylbenzen |
N;R50/53 |
|
* |
|
|
| 14374-92-6 |
2-prop-1-enyl-p-cymen |
N;R50/53 |
|
* |
|
|
| 14387-17-8 |
3,5-di-tert-butyl-4-hydroxybenzylacetat |
R43 N;R50/53 |
|
* |
|
|
| 14426-16-5 |
N,N-diisopentylanilin |
R43 N;R50/53 |
|
* |
|
|
| 14427-53-3 |
methyl-3-oxohexadecanoat |
N;R50/53 |
|
* |
|
|
| 14434-10-7 |
2,4-dinitro-N-(2-nitrophenyl)anilin |
Mut3;R40 |
|
* |
|
|
| 14435-88-2 |
2,6-bis(p-tolyl)pyridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 14437-17-3 |
chlorfenprop-methyl eller methyl-2-chlor-3-(4-chlorphenyl)propionat |
Xn;R21/22 N;R50/53 |
* |
|
|
|
| 14437-41-3 |
clioxanid- |
R43 N;R50/53 |
|
* |
|
|
| 14449-97-9 |
1-amino-4-(2,4-dinitroanilino)anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 14484-64-1 |
ferbam eller jerntris(dimethyldithiocarbamat) |
Xi;R36/37/38 N;R50/53 |
* |
|
|
|
| 14501-64-5 |
2-hydroxycarbazol-3-carboxylsyre |
Mut3;R40 R43 |
|
* |
|
|
| 14507-49-4 |
13-ethyl-3-methoxygona-2,5(10)-dien-17beta-ol |
R43 N;R50/53 |
|
* |
|
|
| 14528-51-9 |
(8alpha)-6'-methoxycinchonan |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 14542-71-3 |
3,5-dibrom-4-methylanisol |
R43 N;R50/53 |
|
* |
|
|
| 14576-08-0 |
4-(1-methoxy-1-methylethyl)-1-methylcyclohexen |
N;R50/53 |
|
* |
|
|
| 14581-21-6 |
(4-chlorphenyl)hydraziniumsulfat (2:1) |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 14607-25-1 |
p-[[4-[bis(2-hydroxyethyl)amino]-o-tolyl]azo]-N-(2-chlorethyl)benzensulfonamid |
Mut3;R40 R43 |
|
* |
|
|
| 14628-90-1 |
2-methoxy-5-nitro-2,4,6-cycloheptatrien-1-on |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 14656-06-5 |
1,1,3,5-tetramethyl-1H-inden |
N;R50/53 |
|
* |
|
|
| 14667-59-5 |
natrium-2-chlor-5-nitrobenzoat |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 14676-61-0 |
3-(tridecyloxy)propylamin |
R43 N;R50/53 |
|
* |
|
|
| 14737-86-1 |
3,4,5,6-tetrachlor-N-hexylphthalimid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 14763-24-7 |
(2,6-dichlorphenyl)hydrazin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 14847-54-2 |
1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthol |
Carc3;R40 |
|
* |
|
|
| 14861-17-7 |
4-(2,4-dichlorophenoxy)aniline |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 14868-03-2 |
4,4'-(dichlorvinyliden)diphenol |
N;R50/53 |
|
* |
|
|
| 14929-11-4 |
simfibrat- |
R43 N;R50/53 |
|
* |
|
|
| 14936-67-5 |
1-methyldecylacetat |
N;R50/53 |
|
* |
|
|
| 14948-96-0 |
p-nitrophenyl-2-acetamido-2-deoxy-beta-D-galactopyranosid |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 14957-65-4 |
4,4',6,6'-tetrabrom[1,1'-biphenyl]-2,2'-diol |
R43 N;R50/53 |
|
* |
|
|
| 14959-86-5 |
(Z)-dodec-7-enylacetat |
N;R50/53 |
|
* |
|
|
| 14977-61-8 |
chromyldichlorid |
Mut2;R46 Carc2;R49 O;R8 C;R35 R43 N;R50/53 |
* |
|
|
|
| 15017-02-4 |
N,N'-bis(2-methylphenyl)benzen-1,4-diamin |
Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 15024-10-9 |
p-tolyl-4-chlorbenzoat |
R43 N;R50/53 |
* |
|
|
|
| 15077-57-3 |
bis(8-hydroxyquinolyl)sulfat, monokaliumsalt |
Mut3;R40 R43 |
|
* |
|
|
| 15096-52-3 |
cryolit eller trinatriumhexafluoroaluminat |
Xn;R20/22 T;R48/23/25 N;R51/53 |
* |
|
|
|
| 15110-74-4 |
2,5-dinitrofluoren |
Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 15114-15-5 |
4,8-diamino-2-(4-ethoxyphenyl)-1,5-dihydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 15121-84-3 |
2-nitrophenethylalkohol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 15121-89-8 |
(E)-ethyl-4-oxo-4-phenylcrotonat |
Xn;R21/22 Xi;R38-41 R43 N;R50/53 |
* |
|
|
|
| 15130-76-4 |
1-methoxy-3,7,11-trimethyldodeca-2,6,10-trien |
N;R50/53 |
|
* |
|
|
| 15159-40-7 |
morpholin-4-carbonylchlorid |
R14 Xi;R36/38 Carc3;R40 |
* |
|
|
|
| 15181-11-0 |
3,5-bis(tert-butyl)toluen |
N;R50/53 |
|
* |
|
|
| 15231-78-4 |
2,2-dimethyl-5-phenyl-1,3-dioxan-4,6-dion |
N;R50/53 |
|
* |
|
|
| 15233-47-3 |
N-1-methylheptyl-N'-phenyl-p-phenylendiamin |
R43 N;R50/53 |
|
* |
|
|
| 15245-44-0 |
blystyphnat eller bly-2,4,6-trinitro-m-phenylendioxid |
Rep1;R61 E;R3 Xn;R20/22 R33 Rep3;R62 N;R50/53 |
* |
|
|
|
| 15258-01-2 |
N-(2-chlorethyl)-p-fluorbenzamid |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 15262-86-9 |
17beta-hydroxyandrost-4-en-3-on-4-methylvalerat |
N;R50/53 |
|
* |
|
|
| 15263-52-2 |
cartaphydrochlorid |
Xn;R21/22 N;R50/53 |
* |
|
|
|
| 15307-93-4 |
2,6-dichlor-N-phenylanilin |
R43 N;R50/53 |
|
* |
|
|
| 15308-01-7 |
2-chlor-N-(2,6-dichlorphenyl)-N-phenylacetamid |
R43 N;R50/53 |
|
* |
|
|
| 15341-08-9 |
6-nitropiperonylalkohol |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 15396-36-8 |
2-chlor-3,5-diiodbenzoesyre |
R43 N;R50/53 |
|
* |
|
|
| 15403-44-8 |
diethyl-5,5'-methylendianthranilat |
N;R50/53 |
|
* |
|
|
| 15403-56-2 |
1-(methylamino)-4-[(1-methylethyl)amino]anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 15419-91-7 |
dipropylsebacat- |
N;R50/53 |
|
* |
|
|
| 15435-29-7 |
2,2'-methylenbis(6-brom-4-chlorphenol) |
R43 N;R50/53 |
|
* |
|
|
| 15457-05-3 |
fluordifen- |
N;R50/53 |
|
* |
|
|
| 15533-77-4 |
2-(diethylamino)ethyl-2-phenylbutyrathydrochlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 15571-58-1 |
2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate |
|
|
* |
|
| 15589-31-8 |
3-allyl-2-methyl-4-oxocyclopent-2-en-1-yl-2,2,3,3-tetramethylcyclopropancarboxylat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 15591-90-9 |
(3'alpha,4'alpha,7'alpha,7'aalpha)-octahydrospiro[1,3-dioxolan-2,5'-[4,7]methano[5H]inden] |
N;R50/53 |
|
* |
|
|
| 15646-96-5 |
2,4,4-trimethylhexamethylen-1,6-diisocyanat |
T;R23 Xi;R36/37/38 R42 |
* |
|
|
|
| 15647-08-2 |
2-ethylhexyldiphenylphosphit |
Xn;R22 N;R50/53 |
|
* |
|
|
| 15662-33-6 |
ryania eller 6-(1?,5a?,8a?,9-pentahydroxy-7?-isopropyl-2?,5?,8?-trimethylperhydro-8b?,9-epoxy-5,8-ethanocyclopenta[1,2-b]indenyl)pyrrol-2-carboxylat |
Xn;R21/22 N;R50/53 |
* |
|
|
|
| 15679-24-0 |
2,7-dimethylpyren |
N;R50/53 |
|
* |
|
|
| 15686-91-6 |
propiram- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 15687-08-8 |
dextrofemin- |
N;R50/53 |
|
* |
|
|
| 15717-40-5 |
N,N'-diphenylpropan-1,2-diamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 15720-98-6 |
octadecafluor-9-(trifluormethyl)decanoylfluorid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 15721-02-5 |
2,2',5,5'-tetrachlor[1,1'-biphenyl]-4,4'-diamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 15760-18-6 |
gamma,4-dimethylcyclohex-3-en-1-propan-1-ol |
N;R50/53 |
|
* |
|
|
| 15766-66-2 |
4-methyl-gamma-methylencyclohex-3-en-1-propan-1-ol |
N;R50/53 |
|
* |
|
|
| 15772-26-6 |
[2-[N-(2-hydroxyethyl)anilino]ethyl]hydrogenmaleat |
Mut3;R40 R43 |
|
* |
|
|
| 15805-75-1 |
dihexylsuccinat- |
N;R50/53 |
|
* |
|
|
| 15811-54-8 |
2,2'-(2,2',3,3',5,5',6,6'-octachlorbiphenyl-4,4'-ylendiimino)diethanol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 15840-96-7 |
cyclohexylcyclohexancarboxylat- |
N;R50/53 |
|
* |
|
|
| 15870-10-7 |
2-methylhept-1-en |
N;R50/53 |
|
* |
|
|
| 15901-19-6 |
20-hydroxy-3,6,9,12,15,18-hexaoxaicos-1-yllaurat |
N;R50/53 |
|
* |
|
|
| 15912-75-1 |
triphenylpropylphosphonium- |
N;R50/53 |
|
* |
|
|
| 15917-27-8 |
methyl-threo-beta-hydroxy-4-nitro-3-phenyl-DL-alaninat |
Mut3;R40 R43 |
|
* |
|
|
| 15958-61-9 |
1-[p-(phenylsulfonyl)anilino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 15965-97-6 |
[(isopentyloxy)methyl]oxiran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 15965-99-8 |
[(hexadecyloxy)methyl]oxiran |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 15972-60-8 |
Alachlor eller 2-chlor-2',6'-diethyl-N-(methoxymethyl)acetanilid |
R22-40-43-50/53 |
* |
|
|
* |
| 15980-11-7 |
3-azidosulfonylbenzoesyre |
E;R2 Xi;R41 R43 Xn;R48/22 |
* |
|
|
|
| 15986-92-2 |
2,3-dihydro-5,6-dimethylpyrazin |
N;R50/53 |
|
* |
|
|
| 15986-93-3 |
2-ethyl-5,6-dihydro-3-methylpyrazin |
N;R50/53 |
|
* |
|
|
| 15986-96-6 |
2-butyl-5,6-dihydro-3-methylpyrazin |
N;R50/53 |
|
* |
|
|
| 16013-44-8 |
4-[(5-chlor-4-methyl-2-sulfophenyl)azo]-3-hydroxy-2-naphthoesyre |
Mut3;R40 |
|
* |
|
|
| 16034-77-8 |
iocetaminsyre- |
N;R50/53 |
|
* |
|
|
| 16052-42-9 |
[1S-(1alpha,2beta,4beta)]-2-chlor-1-isopropyl-4-methylcyclohexan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 16069-32-2 |
biphenyl-2,4-ylendiamin |
Xn;R22 Mut3;R40 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 16070-12-5 |
2-(diethylamino)ethyllaurat |
R43 N;R50/53 |
|
* |
|
|
| 16071-86-6 |
direct brown 95 eller dinatrium-(5-((4'-((2,6-dihydroxy-3-((2-hydroxy-5-sulfophenyl)azo)phenyl)azo)(1,1'-biphenyl)-4-yl)azo)salicylato(4-))cuprat(2-) |
Carc2;R45 |
* |
|
|
|
| 16078-88-9 |
1-(N-ethylanilino)propan-2-ol |
Mut3;R40 |
|
* |
|
|
| 16088-62-3 |
(S)-1,2-epoxypropan |
Carc3;R40 |
|
* |
|
|
| 16090-14-5 |
1,1,2,2-tetrafluor-2-[1,2,2-trifluor-1-(trifluormethyl)-2-[(trifluorvinyl)oxy]ethoxy]ethansulfonylfluorid |
N;R50/53 |
|
* |
|
|
| 16090-77-0 |
dibutylsuberat- |
N;R50/53 |
|
* |
|
|
| 16091-26-2 |
3'-aminobenzanilid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 16096-30-3 |
2,2'-[(1-methylethylen)bis(oxymethylen)]bisoxiran |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 16096-31-4 |
1,6-bis(2,3-epoxypropoxy)hexan |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 16133-49-6 |
5-methoxy-2-nitroanilin |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 16143-15-0 |
2-[4-(2-[1,1'-biphenyl]-4-ylvinyl)phenyl]benzoxazol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 16191-84-7 |
1-chlor-4-[(2-chlorethyl)sulfonyl]benzen |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 16245-79-7 |
4-octylanilin |
R43 N;R50/53 |
|
* |
|
|
| 16245-97-9 |
[(octadecyloxy)methyl]oxiran |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 16264-05-4 |
1,4-bis(4-nitrophenyl)piperazin |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 16279-53-1 |
2-[(2-amino-1-naphthyl)azo]-5-nitrophenol |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 16302-35-5 |
3,6-dihydro-4-methyl-2H-pyran |
N;R50/53 |
|
* |
|
|
| 16339-07-4 |
1-methyl-4-nitrosopiperazin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 16356-11-9 |
undeca-1,3,5-trien |
N;R50/53 |
|
* |
|
|
| 16364-15-1 |
N-(1,3-dimethylbutyl)-N'-(p-tolyl)benzen-p-diamin |
R43 N;R50/53 |
|
* |
|
|
| 16365-27-8 |
2-(4-nitrophenoxy)ethanol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 16383-89-4 |
4-nitro-o-phenetidin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 16397-74-3 |
2-ethylhexylcyclohexancarboxylat |
N;R50/53 |
|
* |
|
|
| 16397-75-4 |
2-ethylhexylhexanoat |
N;R50/53 |
|
* |
|
|
| 16397-78-7 |
2-ethylhexylcinnamat |
N;R50/53 |
|
* |
|
|
| 16409-44-2 |
3,7-dimethylocta-2,6-dienylacetat |
N;R50/53 |
|
* |
|
|
| 16409-46-4 |
menthylisovalerat- |
N;R50/53 |
|
* |
|
|
| 16432-46-5 |
4'-[2-nitro-4-[(p-nitrophenyl)azo]anilino]acetanilid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 16432-81-8 |
2-(4-benzoyl-3-hydroxyphenoxy)ethylacrylat |
Mut3;R40 N;R50 |
|
* |
|
|
| 16434-97-2 |
5-brom[1,1'-biphenyl]-2-ol |
R43 N;R50/53 |
|
* |
|
|
| 16452-01-0 |
3-methoxy-4-methylanilin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 16472-23-4 |
1,8-bis[[4-(2-hydroxyethoxy)phenyl]amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 16472-24-5 |
1,4-bis[[4-(2-hydroxyethoxy)phenyl]amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 16510-49-9 |
1,1',1''-(1-cyclopropen-1,2,3-triyl)trisbenzen |
R43 N;R50/53 |
|
* |
|
|
| 16515-58-5 |
7-(5-butoxy-6-methyl-2H-benzotriazol-2-yl)-3-phenyl-2-benzopyron |
N;R50/53 |
|
* |
|
|
| 16554-45-3 |
6-nitro-o-anisidin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 16588-06-0 |
4-chlor-3-nitrobenzamid |
Mut3;R40 R52/53 |
|
* |
|
|
| 16588-34-4 |
4-chlor-3-nitrobenzaldehyd |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 16618-85-2 |
4-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-on |
N;R50/53 |
|
* |
|
|
| 16647-10-2 |
6,10,14-trimethylpentadeca-4,5-dien-2-on |
N;R50/53 |
|
* |
|
|
| 16663-87-9 |
N-octyl-p-anisidin |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 16676-96-3 |
(Z)-dodec-5-enylacetat |
N;R50/53 |
|
* |
|
|
| 16677-06-8 |
dodec-7-en-1-ylacetat |
N;R50/53 |
|
* |
|
|
| 16731-68-3 |
2-undecyl-1H-imidazol |
N;R50/53 |
|
* |
|
|
| 16747-25-4 |
2,2,3-trimethylhexan |
N;R50/53 |
|
* |
|
|
| 16747-31-2 |
3,3,4-trimethylhexan |
N;R50/53 |
|
* |
|
|
| 16747-42-5 |
2,2,4,5-tetramethylhexan |
N;R50/53 |
|
* |
|
|
| 16752-77-5 |
methomyl eller 1-methylthioethylidenamin-methylcarbamat |
Tx;R28 N;R50/53 |
* |
|
|
|
| 16803-97-7 |
4-amino-N-(4-aminophenyl)benzensulfonamid |
Mut3;R40 |
|
* |
|
|
| 16812-54-7 |
nikkelsulfid |
Carc1;R49 R43 N;R50/53 |
* |
|
|
|
| 16862-11-6 |
quinolin-8-olhydrochlorid |
Mut3;R40 R43 |
|
* |
|
|
| 16881-60-0 |
phenyl-3,5-diisopropylsalicylat |
N;R50/53 |
|
* |
|
|
| 16883-48-0 |
(1alpha,2beta,4alpha)-1,2,4-trimethylcyclopentan |
N;R50/53 |
|
* |
|
|
| 16883-83-3 |
benzyl-3-isobutyryloxy-1-isopropyl-2,2-dimethylpropylphthalat |
N;R50/53 |
|
* |
|
|
| 16888-75-8 |
N,N'-diisopropylidenethylendiamin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 16919-58-7 |
diammoniumhexachloroplatinat |
T;R25 Xi;R41 R42/43 |
* |
|
|
|
| 16921-30-5 |
dikaliumhexachloroplatinat |
T;R25 Xi;R41 R42/43 |
* |
|
|
|
| 16923-58-3 |
dinatriumhexachloroplatinat |
T;R25 Xi;R41 R42/43 |
* |
|
|
|
| 16930-96-4 |
hexylcrotonat- |
N;R50/53 |
|
* |
|
|
| 16930-99-7 |
heptyl-2-butenoat |
N;R50/53 |
|
* |
|
|
| 16938-22-0 |
2,2,4-trimethylhexamethylen-1,6-diisocyanat |
T;R23 Xi;R36/37/38 R42 |
* |
|
|
|
| 16941-12-1 |
hexachloroplatinsyre |
T;R25 C;R34 R42/43 |
* |
|
|
|
| 16968-19-7 |
o,o'-dinitrobibenzyl |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 16969-10-1 |
2-hydroxy-3-phenoxypropylacrylat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 16974-11-1 |
(Z)-dodec-9-enylacetat |
N;R50/53 |
|
* |
|
|
| 16982-00-6 |
(R)-(+)-p-(1,2,2-trimethylcyclopentyl)toluen |
N;R50/53 |
|
* |
|
|
| 17010-21-8 |
cadmiumhexafluorosilicat(2-) |
T;R23/25 R33 Xn;R68 N;R52/53 |
* |
|
|
|
| 17016-43-2 |
4-[3-[4-hydroxy-5-isopropyl-o-tolyl]-1-oxo-3H-isobenzofuran-3-yl]-6-isopropyl-m-tolyldihydrogenphosphat |
N;R50/53 |
|
* |
|
|
| 17026-81-2 |
N-(3-amino-4-ethoxyphenyl)acetamid |
Mut3;R40 |
|
* |
|
|
| 17057-88-4 |
3,5-dimethyl-1,1'-biphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 17057-91-9 |
1,3,8-trimethylnaphthalen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 17064-77-6 |
N-(2-nitrobenzyliden)anilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 17070-45-0 |
6-chlor-9-[[3-[(2-chlorethyl)amino]propyl]amino]-2-methoxyacridindihydrochlorid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 17088-28-7 |
diethyl-3,3'-(1,4-phenylen)bisacrylat |
N;R50/53 |
|
* |
|
|
| 17109-49-8 |
edifenphos eller ethyl-S,S-diphenyldithiophosphat |
Xn;R21 T;R23/25 R43 N;R50/53 |
* |
|
|
|
| 17135-49-8 |
4'-fluor-4-(4-fluorphenyl)butyrophenon |
N;R50/53 |
|
* |
|
|
| 17155-65-6 |
2-(sec-butyl)-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 17222-56-9 |
1,1-diphenyloctan-1-ol |
N;R50/53 |
|
* |
|
|
| 17223-66-4 |
2',4'-dichloracetoacetanilid |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 17243-57-1 |
mefenorex- |
Mut3;R40 R43 N;R50 |
|
* |
|
|
| 17293-03-7 |
1,3,5-trichlor-2-(chlormethyl)benzen |
R43 N;R50/53 |
|
* |
|
|
| 17301-94-9 |
4-methylnonan |
N;R50/53 |
|
* |
|
|
| 17302-46-4 |
methyl-5-nitrosalicylat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 17306-43-3 |
2-nitro-1-beta-D-ribofuranosyl-1H-imidazol |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 17308-90-6 |
allylundecanoat- |
N;R50/53 |
|
* |
|
|
| 17334-55-3 |
[1aR-(1aalpha,7alpha,7aalpha,7balpha)]-1a,2,3,5,6,7,7a,7b-octahydro-1,1,7,7a-tetramethyl-1H-cyclopropa[a]naphthalen |
N;R50/53 |
|
* |
|
|
| 17345-68-5 |
2-chlor-1-(2,3,4-trihydroxyphenyl)ethan-1-on |
Mut3;R40 R43 N;R50 |
|
* |
|
|
| 17354-14-2 |
1,4-bis(butylamino)anthraquinon |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 17373-29-4 |
N,N-dimethyltridecylamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 17404-44-3 |
o-(1-ethylhexyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 17404-66-9 |
p-(1-methyloctyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 17418-58-5 |
1-amino-4-hydroxy-2-phenoxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 17418-59-6 |
1-amino-4-hydroxy-2-(2-phenoxyethoxy)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 17449-92-2 |
16-alpha-brom-20-oxopregn-5-en-3-beta-ylacetat |
N;R50/53 |
|
* |
|
|
| 17451-67-1 |
ethyl-(S)-1,3-dihydro-alpha-[(4-nitrophenyl)methyl]-1,3-dioxo-2H-isoindol-2-acetat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 17463-01-3 |
ethylnon-2-enoat |
N;R50/53 |
|
* |
|
|
| 17474-44-1 |
4,4'-methylenbis[2-nitroanilin] |
Carc3;R40 N;R51/53 |
|
* |
|
|
| 17481-27-5 |
3-amino-4-methoxybenzamid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 17484-36-5 |
4-methyl-3-nitroanisol |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 17511-61-4 |
3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-ylbutyrat |
N;R50/53 |
|
* |
|
|
| 17527-28-5 |
4,4'-(vinylen-1,2-diyl)biscyclohexen |
N;R50/53 |
|
* |
|
|
| 17527-29-6 |
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctylacrylat |
N;R50/53 |
|
* |
|
|
| 17527-31-0 |
3,3,4,4,4-pentafluorbutylacrylat |
N;R50/53 |
|
* |
|
|
| 17540-75-9 |
4-sec-butyl-2,6-di-tert-butylphenol |
R43 N;R50/53 |
|
* |
|
|
| 17570-76-2 |
bly(II)methansulfonat |
Rep1;R61 Xn;R20/22-48/20/22 R33 Xi;R38-41 Rep3;R62 N;R58 |
* |
|
|
|
| 17606-31-4 |
bensultap eller di-S-benzensulfonyl-2-(dimethylamino)propan-1,3-dithiol |
Xn;R22 N;R50/53 |
* |
|
|
|
| 17625-83-1 |
4'-aminobenzanilid |
Mut3;R40 R43 |
|
* |
|
|
| 17627-41-7 |
hexyl-3-methyl-2-butenoat |
N;R50/53 |
|
* |
|
|
| 17627-44-0 |
6-methyl-2-(4-methylcyclohex-3-enyl)hept-2,5-dien |
N;R50/53 |
|
* |
|
|
| 17630-75-0 |
5-chlor-1,3-dihydro-2H-indol-2-on |
Xn;R22 R43 Rep3;R62 R52/53 |
* |
|
|
|
| 17676-33-4 |
spirosta-5,25(27)-dien-1beta,3beta-diol |
N;R50/53 |
|
* |
|
|
| 17677-15-5 |
1-chlor-3-(dodecyloxy)propan-2-ol |
R43 N;R50/53 |
|
* |
|
|
| 17687-74-0 |
tricyclohexylmethanol- |
N;R50/53 |
|
* |
|
|
| 17699-05-7 |
2,6-dimethyl-6-(4-methyl-3-pentenyl)bicyclo[3.1.1]hept-2-en |
N;R50/53 |
|
* |
|
|
| 17700-09-3 |
4-nitro-1,2,3-trichlorbenzen |
R43 N;R50/53 |
|
* |
|
|
| 17716-89-1 |
pranosal- |
N;R50/53 |
|
* |
|
|
| 17735-99-8 |
2-methoxy-6-(2,3,3-trimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-ol |
R43 N;R50/53 |
|
* |
|
|
| 17741-62-7 |
4-[4-[(2,6-dichlor-4-nitrophenyl)azo]phenyl]thiomorpholin-1,1-dioxid |
Mut3;R40 R43 |
|
* |
|
|
| 17780-75-5 |
N-[3-(2,4-dichlorphenoxy)propyl]-N-methyl-2-propynylaminhydrochlorid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 17781-31-6 |
alpha,alpha-bis(4-chlorphenyl)pyridin-3-methanol |
R43 N;R50/53 |
|
* |
|
|
| 17789-14-9 |
2-(m-bromphenyl)-1,3-dioxolan |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 17804-35-2 |
benomyl eller methyl-1-(butylcarbamoyl)benzimidazol-2-ylcarbamat |
Mut3;R68 |
* |
|
|
|
| 17832-16-5 |
triallylbenzen-1,3,5-tricarboxylat |
N;R50/53 |
|
* |
|
|
| 17869-07-7 |
1-amino-4-hydroxy-2-(2-hydroxyethoxy)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 17869-10-2 |
1-amino-4-hydroxy-2-(2-methoxyethoxy)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 17869-11-3 |
1-amino-4-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 17913-18-7 |
1-chlor-4-methoxybutan |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 17916-30-2 |
3beta-hydroxypregn-5-en-20-onoxim-3-acetat |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 18037-63-3 |
natrium-m-[[4-[(4-hydroxy-m-tolyl)azo]-3-methoxyphenyl]azo]benzensulfonat |
Mut3;R40 |
|
* |
|
|
| 18053-31-1 |
fominoben- |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 18053-44-6 |
4-[[[(2-amino-6-chlorphenyl)methyl]methylamino]acetyl]morpholin |
Mut3;R40 R43 |
|
* |
|
|
| 18097-52-4 |
2-amino-5-chlorbenzophenonoxim |
R43 N;R50/53 |
|
* |
|
|
| 18109-80-3 |
butamirat- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 18172-67-3 |
(-)-pin-2(10)-en |
N;R50/53 |
|
* |
|
|
| 18174-13-5 |
3,4,4a,5,8,8a-hexahydro-7,8a-dimethyl-3-(1-methylvinyl)naphthalen-1(2H)-on |
N;R50/53 |
|
* |
|
|
| 18181-70-9 |
iodofenphos- |
N;R50/53 |
|
* |
|
|
| 18217-00-0 |
4-(2-chlorethyl)phenylmethylether |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50 |
|
* |
|
|
| 18226-17-0 |
2,2'-[(4-nitrophenyl)imino]bisethanol |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 18254-13-2 |
2,4,6-tris(1-phenylethyl)phenol |
N;R50/53 |
|
* |
|
|
| 18266-33-6 |
bis(2,3-epoxypropyl)bicyclo[2.2.1]hept-5-en-2,3-dicarboxylat |
Mut3;R40 R43 |
|
* |
|
|
| 18266-52-9 |
2-nitrobenzen-1,4-diamindihydrochlorid |
Carc3;R40 R43 R52/53 |
|
* |
|
|
| 18268-70-7 |
3,6,9-trioxaundecamethylenbis(2-ethylhexanoat) |
N;R50/53 |
|
* |
|
|
| 18271-22-2 |
N-2-naphthylbenzamid |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 18282-59-2 |
4-brom-1,2-dichlorbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 18298-00-5 |
hexyldiphenylphosphin- |
N;R50/53 |
|
* |
|
|
| 18339-16-7 |
5alpha-androst-16-en-3-on |
N;R50/53 |
|
* |
|
|
| 18367-70-9 |
[1S-(1alpha,3abeta,4alpha,8abeta,9S*)]-decahydro-4,8,8-trimethyl-1,4-methanoazulen-9-methylacetat |
N;R50/53 |
|
* |
|
|
| 18371-74-9 |
1-chlor-3-(2-hydroxyethoxy)propan-2-ol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 18403-59-3 |
2,2,4-trimethyl-7-(1,1,3,3-tetramethylbutyl)chroman-6-ol |
N;R50/53 |
|
* |
|
|
| 18409-18-2 |
(E)-2-decenol |
N;R50/53 |
|
* |
|
|
| 18465-99-1 |
2,3-dihydroxypropyl-(9Z,12Z,15Z)-9,12,15-octadecatrienoat |
N;R50/53 |
|
* |
|
|
| 18470-94-5 |
17beta-hydroxyestr-4-en-3-on-17-(cyclohexancarboxylat) |
N;R50/53 |
|
* |
|
|
| 18480-23-4 |
allyltriphenylphosphoniumchlorid- |
N;R50/53 |
|
* |
|
|
| 18485-38-6 |
(2E,4E)-dodeca-2,4-dienol |
N;R50/53 |
|
* |
|
|
| 18495-77-7 |
1-brom-1,2,2-triphenylethan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 18508-59-3 |
phenylundec-10-enoat |
N;R50/53 |
|
* |
|
|
| 18515-14-5 |
alpha-chlor-3-methyl-4-nitrotoluen |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 18525-99-0 |
4,4'-thiobis[2,6-xylenol] |
R43 N;R50/53 |
|
* |
|
|
| 18600-42-5 |
4-nitrobenzylammoniumhydrochlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 18613-55-3 |
N,N-dibenzyl-p-anisidin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 18622-13-4 |
1-amino-4-hydroxy-2-(4-hydroxyphenoxy)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 18622-23-6 |
[1,1'-biphenyl]-4-carbohydrazid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 18626-98-7 |
o-(1-methylheptyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 18643-32-8 |
4,4'-methylenbis[N-(2,3-epoxypropyl)-N-methylanilin] |
Carc3;R40 R43 |
|
* |
|
|
| 18691-97-9 |
methabenzthiazuron |
N;R50/53 |
* |
|
|
|
| 18699-48-4 |
diisobutylterephthalat- |
N;R50/53 |
|
* |
|
|
| 18708-70-8 |
1,3,5-trichlor-2-nitrobenzen |
R43 N;R50/53 |
|
* |
|
|
| 18719-58-9 |
tris(2-chlorethyl)orthoformiat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 18720-11-1 |
1,1',1''-(1,3-butadien-1-yl-4-yliden)trisbenzen |
R43 N;R50/53 |
|
* |
|
|
| 18738-93-7 |
5-allyl-2-phenoxyanisol |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 18742-02-4 |
2-(2-bromethyl)-1,3-dioxolan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 18794-84-8 |
(E)-7,11-dimethyl-3-methylendodeca-1,6,10-trien |
N;R50/53 |
|
* |
|
|
| 18795-33-0 |
tris(2,3-epoxypropyl)phosphat |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 18795-58-9 |
dibutyl-2,2-dichlorvinylphosphat |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 18801-00-8 |
2-(tert-butyl)anthracen |
N;R50/53 |
|
* |
|
|
| 18829-55-5 |
(E)-hept-2-enal |
Xn;R22 R43 N;R50 |
|
* |
|
|
| 18908-07-1 |
3-methoxyphenylisocyanat |
Mut3;R40 R43 |
|
* |
|
|
| 18924-66-8 |
2,2'-(tetradecylimino)bisethanol |
R43 N;R50/53 |
|
* |
|
|
| 18924-67-9 |
2,2'-(hexadecylimino)bisethanol |
R43 N;R50/53 |
|
* |
|
|
| 18967-31-2 |
perbromphenylmethacrylat- |
R43 N;R50/53 |
|
* |
|
|
| 18977-36-1 |
2,6-bis(m-nitrobenzyliden)cyclohexan-1-on |
R43 N;R50/53 |
|
* |
|
|
| 18979-96-9 |
4-chlor-2-heptylphenol |
R43 N;R50/53 |
|
* |
|
|
| 18989-35-0 |
2,6-bis(p-methylbenzyliden)cyclohexan-1-on |
R43 N;R50/53 |
|
* |
|
|
| 19009-39-3 |
diisopropylcarbamoylchlorid- |
Mut3;R40 R43 |
|
* |
|
|
| 19010-26-5 |
[1,1'-biphenyl]-3,3',4,4'-tetraminhydrochlorid |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 19013-10-6 |
ethyl-4-hydroxy-3-nitrobenzoat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 19050-48-7 |
2,3,5,6-tetrachlor-4-(propylthio)pyridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 19070-63-4 |
2-[(2,3-epoxypropoxy)methyl]tetrahydrofuran |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 19125-99-6 |
2-butyl-6-(butylamino)-1H-benz[de]isoquinolin-1,3(2H)-dion |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 19198-75-5 |
decyl-3,4,5-trihydroxybenzoat |
R43 N;R50/53 |
|
* |
|
|
| 19201-38-8 |
ethyl-3-(3-isocyanatophenyl)acrylat |
Mut3;R40 R43 |
|
* |
|
|
| 19224-29-4 |
2,2'-[(1-methylethyliden)bis(4,1-phenylenoxy)]bisethyldiacetat |
N;R50/53 |
|
* |
|
|
| 19245-41-1 |
2,4-di-tert-butyl-5-ethylphenol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 19247-05-3 |
N,N-hydrazinodieddikesyre |
T;R25 R43 Xn;R48/22 R52/53 |
* |
|
|
|
| 19259-11-1 |
tetraiodthiophen- |
N;R50/53 |
|
* |
|
|
| 19281-29-9 |
aptocain- |
Mut3;R40 R43 |
|
* |
|
|
| 19286-75-0 |
1-anilino-4-hydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 19353-92-5 |
p-(dimethylamino)benzohydrazid |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 19387-83-8 |
2-(chlormethyl)-5-(1,1-dimethylethyl)-m-xylen |
R43 N;R50/53 |
|
* |
|
|
| 19393-92-1 |
1-brom-2,6-dichlorbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 19398-47-1 |
1,4-dibrombutan-2-ol |
Carc3;R40 |
|
* |
|
|
| 19398-89-1 |
(E)-dec-4-en |
N;R50/53 |
|
* |
|
|
| 19428-14-9 |
benproperinphosphat- |
N;R50/53 |
|
* |
|
|
| 19438-60-9 |
hexahydro-4-methylphthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 19487-61-7 |
2-decenylacetat |
N;R50/53 |
|
* |
|
|
| 19500-94-8 |
2-acetyl-1,4-diaminoanthraquinon |
Mut3;R40 |
|
* |
|
|
| 19525-20-3 |
tiabendazolhydrochlorid- |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 19578-81-5 |
6-benzyl-2,4-dichlorphenol |
R43 N;R50/53 |
|
* |
|
|
| 19614-67-6 |
N-(2,3-epoxypropyl)-N-ethylanilin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 19614-80-3 |
2,2'-dithiobis[4-tert-butylphenol] |
N;R50/53 |
|
* |
|
|
| 19617-84-6 |
4'-benzoylbenzanilid |
Mut3;R40 R43 |
|
* |
|
|
| 19660-16-3 |
2,3-dibrompropylacrylat |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 19666-30-9 |
3-[2,4-dichlor-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-on |
N;R50/53 |
* |
|
|
|
| 19670-51-0 |
(±)-2,3-dihydroxypropylpalmitat |
N;R50/53 |
|
* |
|
|
| 19689-19-1 |
dec-5-en |
N;R50/53 |
|
* |
|
|
| 19692-45-6 |
p-(tert-butyl)-alpha-chlortoluen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 19693-75-5 |
2-methoxy-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 19694-10-1 |
3-amino-4-chlorbenzamid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 19720-45-7 |
1,4-bis[(2-methylpropyl)amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 19721-24-5 |
1,4,5-triamino-2,3-dichlor-8-hydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 19727-38-9 |
2-morpholinoethylmethacrylat |
Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 19750-95-9 |
chlordimeformhydrochlorid eller N'-(4-chlor-o-tolyl)-N,N-dimethylformamidinmonohydrochlorid |
Xn;R22 Carc3;R40 N;R50/53 |
* |
|
|
|
| 19752-55-7 |
1-brom-3,5-dichlorbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 19780-56-4 |
1-ethyl-2-methylcyclopenten |
N;R50/53 |
|
* |
|
|
| 19789-35-6 |
o-tert-butylstyren |
N;R50/53 |
|
* |
|
|
| 19804-27-4 |
2-[(p-methyl-alpha-phenylbenzyl)oxy]ethyl(dimethyl)amin |
R43 N;R50/53 |
|
* |
|
|
| 19810-04-9 |
1-(2,4-dihydroxyphenyl)undecanon |
N;R50/53 |
|
* |
|
|
| 19811-05-3 |
2,4-dichlorbenzophenon |
R43 N;R50/53 |
|
* |
|
|
| 19812-92-1 |
4'-(1,1-dimethylethyl)[1,1'-biphenyl]-4-ol |
R43 N;R50/53 |
|
* |
|
|
| 19816-88-7 |
1,3-diphenylpropan-2-ontosylhydrazon |
N;R50/53 |
|
* |
|
|
| 19851-61-7 |
dibenzylterephthalat- |
N;R50/53 |
|
* |
|
|
| 19853-79-3 |
2,4-dichlor-m-toluidin |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 19878-61-6 |
2,5-bis[(1,1,3,3-tetramethylbutyl)dithio]-1,3,4-thiadiazol |
N;R50/53 |
|
* |
|
|
| 19881-36-8 |
diethyl[2-(4-nitrophenoxy)ethyl]amin |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 19883-26-2 |
(Z,Z)-undeca-1,3,5-trien |
N;R50/53 |
|
* |
|
|
| 19883-27-3 |
(Z,E)-undeca-1,3,5-trien |
N;R50/53 |
|
* |
|
|
| 19883-29-5 |
(E,E)-undeca-1,3,5-trien |
N;R50/53 |
|
* |
|
|
| 19889-13-5 |
3-methyl-5-(3,4,4a,5,6,7,8,8a-octahydro-2,5,5,8a-tetramethyl-1-naphthyl)pent-2-en-1-al |
N;R50/53 |
|
* |
|
|
| 19894-79-2 |
diethyl-(E)-(3,7-dimethyl-2,6-octadienyl)malonat |
N;R50/53 |
|
* |
|
|
| 19900-65-3 |
4,4'-methylenbis(2-ethylanilin) |
Xn;R22 Carc3;R40 N;R50/53 |
* |
|
|
|
| 19937-59-8 |
metoxuron eller N'-(3-chlor-4-methoxyphenyl)-N,N-dimethylurinstof |
N;R50/53 |
* |
|
|
|
| 19941-28-7 |
methyl-[1R-(1alpha,4abeta,4balpha,7beta,8abeta,10aalpha)]-tetradecahydro-7-isopropyl-1,4a-dimethylphenanthren-1-carboxylat |
N;R50/53 |
|
* |
|
|
| 19959-22-9 |
dodecyldimethylammoniumbromid- |
R43 N;R50/53 |
|
* |
|
|
| 20002-32-8 |
1,2-diphenyl-1,2-di(o-tolyl)ethan-1,2-diol |
N;R50/53 |
|
* |
|
|
| 20017-68-9 |
1,1'-(3-brompropyliden)bisbenzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 20034-29-1 |
N-(3-methoxypropyl)naphthalen-1-amin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 20034-71-3 |
o-(chlormethyl)cumen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 20062-22-0 |
2,2',4,4',6,6'-hexanitrostilben |
R43 N;R50/53 |
|
* |
|
|
| 20063-92-7 |
(E)-non-3-en |
N;R50/53 |
|
* |
|
|
| 20098-38-8 |
1,2,4,5-tetrachlor-3,6-dinitrobenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 20098-48-0 |
1,2,3-trichlor-5-nitrobenzen |
R43 N;R50/53 |
|
* |
|
|
| 20108-78-5 |
valinamid |
Xi;R36 R43 Rep3;R62 |
* |
|
|
|
| 20109-39-1 |
2-[2-(benzoyloxy)propoxy]propylbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 20133-93-1 |
1-chlor-3-(1-naphthyloxy)propan-2-ol |
Mut3;R40 R43 N;R50 |
|
* |
|
|
| 20139-55-3 |
4'-chlor-2'-methylacetoacetanilid |
Mut3;R40 R43 |
|
* |
|
|
| 20153-49-5 |
fluortripentylstannan |
Xn;R20/21/22 N;R50/53 |
* |
|
|
|
| 20153-50-8 |
fluortrihexylstannan |
Xn;R20/21/22 N;R50/53 |
* |
|
|
|
| 20170-32-5 |
3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionsyre |
N;R50/53 |
|
* |
|
|
| 20193-94-6 |
bis[(p-tolyl)methyl]disulfid |
N;R50/53 |
|
* |
|
|
| 20198-64-5 |
bis(3-phenylpropyl)phthalat |
N;R50/53 |
|
* |
|
|
| 20200-22-0 |
N-methyl-2-nitro-4-(trifluormethyl)anilin |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 20201-60-9 |
2-methoxy-4-(5,6,6-trimethylbicyclo[2.2.1]hept-2-yl)phenol |
N;R50/53 |
|
* |
|
|
| 20201-72-3 |
2-methoxy-5-(5,6,6-trimethyl-2-norbornyl)phenol |
N;R50/53 |
|
* |
|
|
| 20201-75-6 |
2-methoxy-6-(5,6,6-trimethyl-2-norbornyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 20210-97-3 |
ethylendisalicylat- |
N;R50/53 |
|
* |
|
|
| 20217-01-0 |
[(2,4-dibromphenoxy)methyl]oxiran |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 20237-46-1 |
(Z)-non-3-en |
N;R50/53 |
|
* |
|
|
| 20253-60-5 |
1,4-dihydroxy-2-[(3-methoxypropyl)amino]anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 20266-00-6 |
1-(chloracetyl)pyrrolidin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 20272-84-8 |
3beta-hydroxypregna-1,4-dien-20-on |
N;R50/53 |
|
* |
|
|
| 20273-27-2 |
[1,1'-bicyclohexyl]-4-ylbenzen |
N;R50/53 |
|
* |
|
|
| 20282-30-8 |
3-(1-methylethyl)-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 20291-75-2 |
1,2,8-trimethylphenanthren |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 20291-98-9 |
4-(methylamino)-2,6-dinitrophenol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 20349-42-2 |
2-(2-tert-butyl-5-methylphenoxy)anilin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 20405-60-1 |
p-menth-8-en-2-ylacetat |
N;R50/53 |
|
* |
|
|
| 20411-47-6 |
1-methylheptylchloracetat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 20416-12-0 |
ethyl-2-benzyl-1,3-dioxolan-2-propionat |
N;R50/53 |
|
* |
|
|
| 20440-95-3 |
N-phenyl-N-(p-tolyl)-p-toluidin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 20442-11-9 |
2-butoxyethylnonan-1-oat |
N;R50/53 |
|
* |
|
|
| 20442-79-9 |
3-iod-1,1'-biphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 20555-91-3 |
1,2-dichlor-4-iodbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 20651-75-6 |
1-butyl-4-nitrobenzen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 20662-52-6 |
4,4-bis(4-fluorphenyl)smorsyre |
N;R50/53 |
|
* |
|
|
| 20732-36-9 |
2-methoxy-1,4-dioxan |
N;R50/53 |
|
* |
|
|
| 20748-87-2 |
hexyl-2-ethylhexanoat |
N;R50/53 |
|
* |
|
|
| 20770-40-5 |
citronellyl-3-methylcrotonat |
N;R50/53 |
|
* |
|
|
| 20777-49-5 |
(1alpha,2beta,5alpha)-2-methyl-5-(1-methylvinyl)cyclohexylacetat |
N;R50/53 |
|
* |
|
|
| 20788-07-2 |
resorantel- |
R43 N;R50/53 |
|
* |
|
|
| 20815-27-4 |
2-heptylpyridin |
N;R50/53 |
|
* |
|
|
| 20821-91-4 |
N-(2-benzoyl-4-nitrophenyl)-2-chloracetamid |
Mut3;R40 R43 |
|
* |
|
|
| 20838-44-2 |
3-nitrophenyl-beta-D-glucopyranosid |
Mut3;R40 |
|
* |
|
|
| 20849-78-9 |
4-(2-chlorethyl)benzoesyre |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 20850-43-5 |
5-chlor-1,3-benzodioxol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 20892-46-0 |
N,N-dimethyl-1H-indol-1-propylamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 20927-98-4 |
2-(p-tolyloxy)anilin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 21037-25-2 |
1-deoxy-1-[2-(phenylazo)-3,4-xylidino]-D-ribitol |
Mut3;R40 R43 |
|
* |
|
|
| 21037-26-3 |
1-deoxy-1-(6-phenylazo-3,4-xylidino)-D-ribitol |
Mut3;R40 R43 |
|
* |
|
|
| 21078-83-1 |
tetradecan-5-ol |
N;R50/53 |
|
* |
|
|
| 21086-87-3 |
(4-methylphenyl)methyl-p-toluat |
R43 N;R50/53 |
|
* |
|
|
| 21087-64-9 |
metribuzin eller 4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5-on |
Xn;R22 N;R50/53 |
* |
|
|
|
| 21112-68-5 |
2-hydroxy-4-(2-phenoxyethoxy)benzophenon |
N;R50/53 |
|
* |
|
|
| 21132-81-0 |
2,6-bis(o-isocyanatobenzyl)phenylisocyanat |
R43 N;R50/53 |
|
* |
|
|
| 21136-70-9 |
benzidin, salte heraf |
Carc1;R45 Xn;R22 N;R50/53 |
* |
|
|
|
| 21150-89-0 |
bis(p-tert-butylphenyl)hydrogenphosphat |
N;R50/53 |
|
* |
|
|
| 21221-93-2 |
3,5-bis(trifluormethyl)benzophenon |
N;R50/53 |
|
* |
|
|
| 21245-02-3 |
2-ethylhexyl-4-(dimethylamino)benzoat |
N;R50/53 |
|
* |
|
|
| 21251-97-8 |
3-(phenylmethyl)[1,1'-biphenyl]-4-ol |
R43 N;R50/53 |
|
* |
|
|
| 21414-53-9 |
[1R-(1alpha,4abeta,10aalpha)]-1,2,3,4,4a,5,6,9,10,10a-decahydro-7-isopropyl-1,4a-dimethylphenanthren-1-methanol |
N;R50/53 |
|
* |
|
|
| 21544-03-6 |
bis(2,3-epoxypropyl)cyclohex-4-en-1,2-dicarboxylat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 21564-17-0 |
TCMTB eller (benzothiazol-2-ylthio)methylthiocyanat |
Xn;R22 Tx;R26 Xi;R36/38 R43 N;R50/53 |
* |
|
|
|
| 21578-97-2 |
2-ethoxyethyl-7-hydroxynaphthalen-1-carbamat |
Mut3;R40 |
|
* |
|
|
| 21609-90-5 |
leptophos eller O-4-brom-2,5-dichlorphenyl-O-methylphenylthiophosphonat |
Xn;R21 T;R25-39/25 N;R50/53 |
* |
|
|
|
| 21614-17-5 |
2,4-dichlor-6-(4-ethoxy-1-naphthyl)-s-triazin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 21662-13-5 |
(2E,6Z)-dodeca-2,6-dienal |
N;R50/53 |
|
* |
|
|
| 21662-15-7 |
(2E,4Z)-dodeca-2,4-dienal |
N;R50/53 |
|
* |
|
|
| 21662-16-8 |
(2E,4E)-dodeca-2,4-dienal |
N;R50/53 |
|
* |
|
|
| 21681-47-0 |
1,2,3,4,4a,5,8,8a-octahydro-2-methyl-1,4:5,8-dimethanonaphthalen |
N;R50/53 |
|
* |
|
|
| 21702-27-2 |
N-(o-tolyl)ethylendiamin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 21721-92-6 |
nitrefazol- |
Mut3;R40 |
|
* |
|
|
| 21725-46-2 |
cyanazin eller 2-(4-chlor-6-ethylamino-1,3,5-triazin-2-ylamino)-2-methylpropionitril |
Xn;R22 N;R50/53 |
* |
|
|
|
| 21742-00-7 |
1-(chlormethyl)-2-(trifluormethyl)benzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 21747-46-6 |
[1aR-(1aalpha,7alpha,7abeta,7balpha)]-1a,2,3,5,6,7,7a,7b-octahydro-1,1,4,7-tetramethyl-1H-cycloprop[e]azulen |
N;R50/53 |
|
* |
|
|
| 21825-03-6 |
4,4'-methylenbis[2,6-dibromphenol] |
R43 N;R50/53 |
|
* |
|
|
| 21894-06-4 |
1-hydroxy-4-(4-nitrophenoxy)-2-naphthoesyre |
Mut3;R40 R43 N;R50 |
|
* |
|
|
| 21905-92-0 |
N,N,N',N'-tetraphenylmethylendiamin |
N;R50/53 |
|
* |
|
|
| 21958-34-9 |
ethyl-2-[[2-hydroxy-3,5-bis(1-methylethyl)benzoyl]amino]benzoat |
R43 N;R50/53 |
|
* |
|
|
| 21988-87-4 |
2,4,6-tris(brommethyl)mesitylen |
R43 N;R50/53 |
|
* |
|
|
| 22023-23-0 |
N-[3-(tridecyloxy)propyl]propan-1,3-diamin |
R43 N;R50/53 |
|
* |
|
|
| 22089-22-1 |
trofosfamid- |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 22091-92-5 |
3,3-bis(1-ethyl-2-methyl-1H-indol-3-yl)phthalid |
N;R50/53 |
|
* |
|
|
| 22104-80-9 |
2-decenol |
N;R50/53 |
|
* |
|
|
| 22122-18-5 |
2-hydroxyethylmyristat |
N;R50/53 |
|
* |
|
|
| 22153-71-5 |
p-nitrophenyl-6-deoxy-beta-L-galactopyranosid |
Mut3;R40 |
|
* |
|
|
| 22156-48-5 |
4,4-diphenylbutyronitril |
N;R50/53 |
|
* |
|
|
| 22159-33-7 |
4-[4-(2-chlorphenyl)-2-vinyloxazol-5-yl]-N,N-diethylanilin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 22173-83-7 |
dimethyl(1-methyl-3,3-diphenylpropyl)ammoniumchlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 22198-42-1 |
1,4-bis(4-chlorbenzoyl)benzen |
R43 N;R50/53 |
|
* |
|
|
| 22212-55-1 |
benzoylprop-ethyl eller ethyl-N-benzoyl-N-(3,4-dichlorphenyl)-DL-alaninat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 22232-25-3 |
dinatrium-2,2'-methylenbis(4-chlorphenolat) |
N;R50/53 |
|
* |
|
|
| 22239-54-9 |
4'-(1-methylethyl)[1,1'-biphenyl]-4-ol |
R43 N;R50/53 |
|
* |
|
|
| 22259-30-9 |
formetanat |
Tx;R26/28 R43 N;R50/53 |
* |
|
|
|
| 22302-65-4 |
N-(5-hydroxy-1-naphthyl)acetamid |
Mut3;R40 R43 |
|
* |
|
|
| 22346-43-6 |
4-hydroxy-7-(methylamino)naphthalen-2-sulfonsyre |
Mut3;R40 R43 |
|
* |
|
|
| 22366-99-0 |
1-[(3-aminopropyl)amino]-4-(methylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 22409-83-2 |
(2-phenoxyethyl)triphenylphosphoniumbromid |
N;R50/53 |
|
* |
|
|
| 22421-56-3 |
[(o-bromphenoxy)methyl]oxiran |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 22421-59-6 |
[(2,6-dibrom-4-methylphenoxy)methyl]oxiran |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 22424-58-4 |
5-(benzyloxy)-2-nitrotoluen |
Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 22438-39-7 |
decylmethylsulfid- |
N;R50/53 |
|
* |
|
|
| 22488-23-9 |
exo-6-(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl)-m-cresol |
R43 N;R50/53 |
|
* |
|
|
| 22494-42-4 |
diflunisal- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 22525-95-7 |
2'-(oxiranylmethoxy)-3-phenylpropiophenon |
Mut3;R40 |
|
* |
|
|
| 22532-68-9 |
1,2,4-trichlor-5-(4-nitrophenoxy)benzen |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 22544-07-6 |
2-chlor-1-(4-chlorphenoxy)-4-nitrobenzen |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 22564-43-8 |
N-(2-chlorethyl)-N-ethylanilin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 22567-17-5 |
[1R-(1alpha,3abeta,4alpha,7beta)]-1,2,3,3a,4,5,6,7-octahydro-7-isopropenyl-1,4-dimethylazulen |
N;R50/53 |
|
* |
|
|
| 22567-36-8 |
[3S-[3alpha,6alpha(R*)]-tetrahydro-2,2,6-trimethyl-6-(4-methyl-3-cyclohexen-1-yl)-2H-pyran-3-ol |
N;R50/53 |
|
* |
|
|
| 22568-64-5 |
(±)-N-[3-acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]acetamid |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 22570-84-9 |
1-(chlormethyl)-2-vinylbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 22616-19-9 |
1-ethyl-1-methylheptylacetat |
N;R50/53 |
|
* |
|
|
| 22618-51-5 |
cyclohexen-1-yltoluen |
R43 N;R50/53 |
|
* |
|
|
| 22627-70-9 |
3-ethoxycyclopent-2-en-1-on |
Mut3;R40 |
|
* |
|
|
| 22633-33-6 |
methyl-3,5-dinitrosalicylat |
Mut3;R40 R43 |
|
* |
|
|
| 22679-54-5 |
4-tert-butylbenzophenon |
R43 N;R50/53 |
|
* |
|
|
| 22781-23-3 |
bendiocarb eller 2,2-dimethyl-1,3-benzodioxol-4-ylmethylcarbamat |
Xn;R21 T;R23/25 N;R50/53 |
* |
|
|
|
| 22802-40-0 |
2,6-dibrom-3,4-xylenol |
R43 N;R50/53 |
|
* |
|
|
| 22813-31-6 |
methyl-2-nitroimidazol-1-acetat |
Mut3;R40 |
|
* |
|
|
| 22813-58-7 |
4-chlor-N,N-dimethylbutyramid |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 22819-70-1 |
(1alpha,3beta,5beta,7alpha)-8,8-dichlor-1,4,4-trimethyltricyclo[5.1.0.03,5]octan |
N;R50/53 |
|
* |
|
|
| 22863-79-2 |
phenanthren-4-methanol |
Mut3;R40 R43 |
|
* |
|
|
| 22865-48-1 |
p-[(p-nitrophenyl)thio]toluen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 22871-56-3 |
3-[[(2-hydroxyethyl)amino]carbonyl]-5-nitrobenzoesyre |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 22873-89-8 |
N-[7-hydroxy-8-[(2-hydroxy-5-nitrophenyl)azo]-1-naphthyl]acetamid |
Mut3;R40 |
|
* |
|
|
| 22882-89-9 |
(Z)1-ethoxy-3,7-dimethylocta-2,6-dien |
N;R50/53 |
|
* |
|
|
| 22882-91-3 |
(E)-1-ethoxy-3,7-dimethylocta-2,6-dien |
N;R50/53 |
|
* |
|
|
| 22883-85-8 |
ethyl-6-quinolylether |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 22916-47-8 |
miconazol- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 22939-93-1 |
4-methoxy-3-nitrobenzensulfonamid |
Mut3;R40 R43 |
|
* |
|
|
| 22948-06-7 |
4-(triphenylmethyl)anilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 22961-45-1 |
N-phenylpyridin-4-amin |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 22963-62-8 |
2,3,5,6-tetrachlor-4-(methylthio)pyridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 22996-18-5 |
4-chlor-3-nitrobenzylalkohol |
Mut3;R40 R43 |
|
* |
|
|
| 23043-41-6 |
1-methylacridin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 23060-42-6 |
1-amino-4-[(4-methoxyphenyl)amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 23074-59-1 |
3-isobutoxycyclohex-2-en-1-on |
Mut3;R40 |
|
* |
|
|
| 23082-50-0 |
1-(2-chlor-5-nitrophenyl)ethan-1-on |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 23085-60-1 |
benzyl-2,4-dibrombutanoat |
Xi;R38 R43 Rep3;R62 N;R50/53 |
* |
|
|
|
| 23089-32-9 |
(±)-6,6-dimethyl-2-methylenbicyclo[3.1.1]heptan |
N;R50/53 |
|
* |
|
|
| 23103-98-2 |
pirimicarb eller 2-dimethylamino-5,6-dimethylpyrimidin-4-yldimethylcarbamat |
T;R25 N;R50/53 |
* |
|
|
|
| 23119-35-9 |
4,8-diamino-2-[p-(2-ethoxyethoxy)phenyl]-1,5-dihydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 23142-01-0 |
diethyl[2-[2-[(1-phenylcyclopentyl)formyloxy]ethoxy]ethyl]ammoniumdihydrogen-2-hydroxypropan-1,2,3-tricarboxylat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 23184-66-9 |
N-(butoxymethyl)-2-chlor-2',6'-diethylacetanilid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 23257-56-9 |
(R*,R*)-(-)-2-(alpha-acetoxybenzyl)piperidiniumchlorid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 23307-95-1 |
ethyl-2,3-epoxy-3,7,11-trimethyldodec-10-enoat |
N;R50/53 |
|
* |
|
|
| 23328-60-1 |
2-[2-(2-hydroxyethoxy)ethoxy]ethyllaurat |
N;R50/53 |
|
* |
|
|
| 23399-88-4 |
2,4,6-trichlorphenetol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 23422-53-9 |
formetanathydrochlorid |
Tx;R26/28 R43 N;R50/53 |
* |
|
|
|
| 23454-33-3 |
cyclohexylmethyl-17-beta-hydroxyestra-4,9,11-trien-3-oncarbonat |
N;R50/53 |
|
* |
|
|
| 23482-34-0 |
ethyl-4-hydroxy-4-[3-(trifluormethyl)phenyl]piperidin-1-carboxylat |
N;R50/53 |
|
* |
|
|
| 23488-38-2 |
2,3,5,6-tetrabrom-p-xylen |
R43 N;R50/53 |
|
* |
|
|
| 23491-44-3 |
p-(5-(5-(4-methylpiperazin-1-yl)benzimidazol-2-yl)benzimidazol-2-yl)phenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 23491-45-4 |
p-[5-(4-methyl-1-piperazinyl)[2,5'-bi-1H-benzimidazol]-2'-yl]phenoltrihydrochlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 23500-79-0 |
6-tert-butyl-3-(chlormethyl)-2,4-xylenol |
R43 N;R50/53 |
|
* |
|
|
| 23505-41-1 |
pirimiphos-ethyl eller O,O-diethyl-O-2-diethylamino-6-methylpyrimidin-4-ylthiophosphat |
Xn;R21 T;R25 N;R50/53 |
* |
|
|
|
| 23545-77-9 |
N-[3-(m-tolylamino)allyliden]-m-toluidin |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 23549-24-8 |
(20E)-3beta-hydroxypregna-5,16-dien-20-onoxim-3-acetat |
N;R50/53 |
|
* |
|
|
| 23552-76-3 |
1-hydroxy-4-[(4-methoxyphenyl)amino]anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 23559-40-2 |
exo-2-(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl)-p-cresol |
R43 N;R50/53 |
|
* |
|
|
| 23564-05-8 |
thiophanat-methyl |
Xn;R20 R43 Mut3;R68 N;R50/53 |
* |
|
|
|
| 23593-75-1 |
clotrimazol- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 23602-78-0 |
benfluorex- |
N;R50/53 |
|
* |
|
|
| 23646-68-6 |
p-nitrophenyl-2-acetamido-2-deoxy-alpha-D-galactopyranosid |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 23677-62-5 |
1,4-diamino-2-nitroanthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 23743-30-8 |
dimethyl-2,2'-(naphthalen-1,4-diyl)bis(benzoxazol-5-carboxylat) |
R43 N;R50/53 |
|
* |
|
|
| 23747-14-0 |
1,2,3,4,5,6-hexahydro-1,1,5,5-tetramethyl-7H-2,4a-methanonaphthalen-7-on |
N;R50/53 |
|
* |
|
|
| 23761-52-6 |
N-cyclohexylnaphthalen-2-amin |
Mut3;R40 R43 |
|
* |
|
|
| 23779-96-6 |
8-(trifluormethyl)quinolin-4-ol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 23783-26-8 |
hydroxyphosphonoeddikesyre |
Xn;R22-48/22 C;R34 R43 |
* |
|
|
|
| 23838-75-7 |
2-(4-isopentylphenoxy)anilin |
Mut3;R40 |
|
* |
|
|
| 23843-88-1 |
4-(4-aminophenoxy)benzen-1,3-diamin |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 23873-81-6 |
diphenylethandiondioxim- |
R43 N;R50/53 |
|
* |
|
|
| 23894-12-4 |
6-aminonaphthol |
Mut3;R40 R43 |
|
* |
|
|
| 23950-58-5 |
propyzamid eller 3,5-dichlor-N-(1,1-dimethylprop-2-ynyl)benzamid |
Carc3;R40 N;R50/53 |
* |
|
|
|
| 23983-43-9 |
3beta-hydroxyandrost-5-en-17-onheptanoat |
N;R50/53 |
|
* |
|
|
| 24017-47-8 |
triazophos eller O,O-diethyl-O-1-phenyl-1,2,4-triazol-3-ylthiophosphat |
Xn;R21 T;R23/25 N;R50/53 |
* |
|
|
|
| 24032-35-7 |
(S)-4-amino-5-[(4-nitrophenyl)amino]-5-oxovaleriansyre |
Mut3;R40 R43 |
|
* |
|
|
| 24048-14-4 |
2,6,10-trimethylundeca-5,9-dienol |
N;R50/53 |
|
* |
|
|
| 24083-13-4 |
p-(octyloxy)benzaldehyd |
N;R50/53 |
|
* |
|
|
| 24124-25-2 |
Stannane, tributyl[(1-oxo-9,12-octadecad |
|
|
|
|
* |
| 24133-73-1 |
4-(1-methyl-1-phenylethyl)phenylacetat |
R43 N;R50/53 |
|
* |
|
|
| 24143-52-0 |
6alpha-tert-butyl-3,4,4abeta,5,6,7,8,8abeta-octahydronaphthalen-2(1H)-on |
N;R50/53 |
|
* |
|
|
| 24157-79-7 |
1,4-bis(isopropyl)naphthalen |
N;R50/53 |
|
* |
|
|
| 24157-81-1 |
2,6-diisopropylnaphthalen |
N;R50/53 |
|
* |
|
|
| 24162-63-8 |
2,4-dibromstyren |
R43 N;R50/53 |
|
* |
|
|
| 24192-58-3 |
1,8-diisopropylnaphthalen |
N;R50/53 |
|
* |
|
|
| 24197-34-0 |
4,4'-thiodi-o-cresol |
Xi;R41 N;R50/53 |
* |
|
|
|
| 24238-82-2 |
6,10-dimethylundeca-1,5,9-trien |
N;R50/53 |
|
* |
|
|
| 24261-19-6 |
butylhydrogentetrachlorphthalat- |
R43 N;R50/53 |
|
* |
|
|
| 24293-41-2 |
(1-methylethyliden)di-4,1-cyclohexandiylbis(mercaptoacetat) |
R43 N;R50/53 |
|
* |
|
|
| 24295-35-0 |
1,2-diphenylethylacetat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 24313-88-0 |
3,4,5-trimethoxyanilin |
Mut3;R40 R43 |
|
* |
|
|
| 24317-95-1 |
ethyl-2-acetyldecanoat |
N;R50/53 |
|
* |
|
|
| 24344-21-6 |
2,6-bis(1-cyclohexen-1-yl)cyclohexan-1-on |
N;R50/53 |
|
* |
|
|
| 24362-98-9 |
4,4'-hexylidenbisphenol |
R43 N;R50/53 |
|
* |
|
|
| 24403-04-1 |
2-brom-2-nitropropanol |
Xn;R22-48/22 T;R24 C;R34 R43 N;R50/53 |
* |
|
|
|
| 24447-72-1 |
(1-methylethyliden)bis[4,1-phenylenoxy(1-methyl-2,1-ethandiyl)]bismethacrylat |
N;R50/53 |
|
* |
|
|
| 24447-78-7 |
(1-methylethyliden)bis(4,1-phenylenoxy-2,1-ethandiyl)diacrylat |
N;R50/53 |
|
* |
|
|
| 24448-09-7 |
heptadecafluor-N-(2-hydroxyethyl)-N-methyloctansulfonamid |
N;R50/53 |
|
* |
|
|
| 24448-20-2 |
(1-methylethyliden)bis(4,1-phenylenoxy-2,1-ethandiyl)bismethacrylat |
N;R50/53 |
|
* |
|
|
| 24463-19-2 |
9-(chlormethyl)anthracen |
Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 24464-64-0 |
3-[[4-(cyclohexylamino)-9,10-dihydro-9,10-dioxoanthryl]amino]-N-phenylpropionamid |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 24470-78-8 |
isopropyltriphenylphosphoniumiodid- |
N;R50/53 |
|
* |
|
|
| 24556-64-7 |
4,5-dibromsalicylanilid |
R43 N;R50/53 |
|
* |
|
|
| 24556-65-8 |
3,4,5-tribromsalicylanilid |
R43 N;R50/53 |
|
* |
|
|
| 24589-77-3 |
4-hydrazinobenzoesyremonohydrochlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 24602-86-6 |
tridemorph eller 2,6-dimethyl-4-tridecylmorpholin |
Rep2;R61 Xn;R20/22 Xi;R38 N;R50/53 |
* |
|
|
|
| 24613-89-6 |
dichromtris(chromat) |
Carc2;R45 O;R8 C;R35 R43 N;R50/53 |
* |
|
|
|
| 24623-25-4 |
4-nitroindan-1-on |
Xn;R22 Mut3;R40 Carc3;R40 R52/53 |
|
* |
|
|
| 24632-44-8 |
4-methylpiperazin-1-acetohydrazid |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 24678-13-5 |
lenperon- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 24691-15-4 |
cis-3-ethoxy-1,1,5-trimethylcyclohexan |
N;R50/53 |
|
* |
|
|
| 24691-17-6 |
trans-3-ethoxy-1,1,5-trimethylcyclohexan |
N;R50/53 |
|
* |
|
|
| 24717-85-9 |
3,7-dimethyl-6-octenyl-2-methylcrotonat |
N;R50/53 |
|
* |
|
|
| 24731-66-6 |
aluminiumtri(quinolin-8-olat) |
Mut3;R40 R43 |
|
* |
|
|
| 24781-13-3 |
3-phenylpropylsalicylat |
N;R50/53 |
|
* |
|
|
| 24817-24-1 |
cis,cis-6-tert-butyloctahydronaphthalen-2(1H)-on |
N;R50/53 |
|
* |
|
|
| 24817-28-5 |
6alpha-tert-butyl-3,4,4abeta,5,6,7,8,8aalpha-octahydronaphthalen-2(1H)-on |
N;R50/53 |
|
* |
|
|
| 24824-27-9 |
2,7-dinitronaphthalen |
Carc3;R40 N;R51/53 |
|
* |
|
|
| 24827-78-9 |
1,3-diethyl-1-(4-nitrophenyl)-3-phenylurinstof |
Mut3;R40 |
|
* |
|
|
| 24856-00-6 |
5-brom-8-naphtholactam |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| 24900-79-6 |
3-chlor-4-(4-chlorphenoxy)anilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R51/5 |
|
* |
|
|
| 24910-84-7 |
2,3-dichlorpropylacrylat |
Carc3;R40 |
|
* |
|
|
| 24973-59-9 |
1,3,5-tri(tert-butyl)-2-nitrosobenzen |
N;R50/53 |
|
* |
|
|
| 25029-11-2 |
trans-1,4-bis(2-isothiocyanatoethyl)cyclohexan |
N;R50/53 |
|
* |
|
|
| 25088-69-1 |
dikalium-4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethyliden]diphenolat |
N;R50/53 |
|
* |
|
|
| 25109-28-8 |
1-brom-4-cyclohexylbenzen |
R43 N;R50/53 |
|
* |
|
|
| 25148-68-9 |
N-methylbenzen-1,2-diamindihydrochlorid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 25154-52-3 |
nonylphenol |
Xn;R22 C;R34 N;R50/53 |
* |
|
|
* |
| 25154-54-5 |
dinitrobenzen |
Tx;R26/27/28 R33 N;R50/53 |
* |
|
|
|
| 25167-94-6 |
diphenylpropan- |
N;R50/53 |
|
* |
|
|
| 25186-43-0 |
N-isopropyl-4-nitroanilin |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 25187-06-8 |
2,2',5-trichlorbenzophenon |
R43 N;R50/53 |
|
* |
|
|
| 25252-92-0 |
N-(4-chlor-2,5-dimethoxyphenyl)-3-hydroxy-7-methoxynaphthalen-2-carboxamid |
R43 N;R50/53 |
|
* |
|
|
| 25291-17-2 |
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroct-1-en |
N;R50/53 |
|
* |
|
|
| 25321-14-6 |
dinitrotoluen, teknisk |
Carc2;R45 T;R23/24/25 Xn;R48/22 Rep3;R62 Mut3;R68 N;R51/53 |
* |
|
|
|
| 25333-49-7 |
endo-8-methyl-8-azabicyclo[3.2.1]oct-3-yl-2-propylvalerat |
N;R50/53 |
|
* |
|
|
| 25338-51-6 |
tert-butylstyren |
R43 N;R50/53 |
|
* |
|
|
| 25339-53-1 |
decen- |
N;R50/53 |
|
* |
|
|
| 25340-17-4 |
diethylbenzen- |
N;R50/53 |
|
* |
|
|
| 25340-18-5 |
triethylbenzen- |
N;R50/53 |
|
* |
|
|
| 25351-57-9 |
N,N'-bis(3-phenylallyliden)propan-1,3-diamin |
N;R50/53 |
|
* |
|
|
| 25360-09-2 |
tert-hexadecanthiol |
N;R50/53 |
|
* |
|
|
| 25366-23-8 |
1,3-dimethyl-1-(5-trifluormethyl-1,3,4-thiadiazol-2-yl)urinstof
eller thiazfluron |
Xn;R22 N;R50/53 |
* |
|
|
|
| 25376-45-8 |
diaminotoluen eller ar-methylphenylendiamin |
Carc2;R45 Xn;R20/21 T;R25 Xi;R36 R43 N;R51/53 |
* |
|
|
|
| 25377-21-3 |
di-tert-butyl-p-cresol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 25379-26-4 |
tetrahydro-alpha-(1-naphthylmethyl)furan-2-propionsyre |
N;R50/53 |
|
* |
|
|
| 25383-07-7 |
(R)-?-phenylethylammonium-(-)-(1R,2S)-(1,2-epoxypropyl)phosphonatmonohydrat |
Rep3;R62 N;R51/53 |
* |
|
|
|
| 25387-93-3 |
(quinolin-8-olato)lithium |
Mut3;R40 R43 |
|
* |
|
|
| 25393-98-0 |
1,4-bis(1,2-dibromethyl)benzen |
N;R50/53 |
|
* |
|
|
| 25402-06-6 |
cinerin eller 3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropancarboxylat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 25430-52-8 |
5,10-diethyltetradec-7-yn-6,9-diol |
N;R50/53 |
|
* |
|
|
| 25431-45-2 |
3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluornon-1-en |
N;R50/53 |
|
* |
|
|
| 25464-95-3 |
4,4'-methylenbis[2,6-dichloranilin] |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 25523-97-1 |
dexchlorpheniramin- |
R43 N;R50/53 |
|
* |
|
|
| 25550-51-0 |
hexahydromethylphthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 25550-58-7 |
dinitrophenol |
T;R23/24/25 R33 N;R50/53 |
* |
|
|
|
| 25567-67-3 |
chlordinitrobenzen |
T;R23/24/25 R33 N;R50/53 |
* |
|
|
|
| 25594-47-2 |
N-[5-[bis(2-methoxyethyl)amino]-2-[(2-brom-4,6-dinitrophenyl)azo]phenyl]acetamid |
Mut3;R40 R43 |
|
* |
|
|
| 25637-27-8 |
hexapentyldistannoxan |
Xn;R20/21/22 N;R50/53 |
* |
|
|
|
| 25637-99-4 |
hexabromocyclododecane |
|
|
|
* |
|
| 25640-70-4 |
bis(1-phenylethyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 25640-78-2 |
(1-methylethyl)-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 25646-71-3 |
N-(2-(4-amino-N-ethyl-m-toluidino)ethyl)methansulfo-namidsesquisulfat |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| 25646-77-9 |
(4-ammonio-m-tolyl)ethyl(2-hydroxyethyl)ammoniumsulfat |
T;R25 R43 Xn;R48/22 N;R50/53 |
* |
|
|
|
| 25677-83-2 |
bis(oxiranylmethyl)-2,4,4-trimethyladipat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 25677-88-7 |
bis(2,3-epoxypropyl)-2,2-dimethylglutarat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 25737-87-5 |
2-(tetradecylamino)ethanol |
N;R50/53 |
|
* |
|
|
| 25808-74-6 |
blyhexafluorosilicat |
Rep1;R61 Xn;R20/22 R33 Rep3;R62 N;R50/53 |
* |
|
|
|
| 25814-36-2 |
diethyl-(4-amino-3-chlorphenyl)methylmalonat |
Mut3;R40 R43 |
|
* |
|
|
| 25834-80-4 |
2,4-bis(p-aminobenzyl)anilin |
Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 25850-49-1 |
1,3-bis(1,2-dibromethyl)benzen |
N;R50/53 |
|
* |
|
|
| 25905-16-2 |
3,6,7-trimethyloct-6-en-1-ol |
N;R50/53 |
|
* |
|
|
| 25910-57-0 |
4-[(4-nitrophenyl)azo]benzen-1,3-diamin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 25920-18-7 |
2,4-bis(benzyl)pyridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 25973-55-1 |
2-(2H-benzotriazol-2-yl)-4,6-ditertpentylphenol |
N;R50/53 |
|
* |
|
|
| 26116-56-3 |
(9S)-9-amino-9-deoxyerythromycin |
Xi;R41 N;R50/53 |
* |
|
|
|
| 26140-60-3 |
terphenyl |
N;R50/53 |
|
* |
|
|
| 26171-78-8 |
[1R-(1alpha,2beta,5alpha)]-p-menthylphenylacetat |
N;R50/53 |
|
* |
|
|
| 26186-02-7 |
tridec-1-yn |
N;R50/53 |
|
* |
|
|
| 26219-05-6 |
1-amino-4-hydroxy-2-[2-(4-methylphenoxy)ethoxy]anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 26239-64-5 |
Stannane, tributyl[[[1,2,3,4,4a,4b,5,6,1 |
|
|
|
|
* |
| 26249-20-7 |
epoxybutan- |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 26259-45-0 |
secbumeton eller 2-sec-butylamino-4-ethylamino-6-methoxy-1,3,5-triazin |
Xn;R22 Xi;R36 N;R50/53 |
* |
|
|
|
| 26266-63-7 |
tetrahydrophthalsyreanhydrid |
Xi;R41 R42/43 R52/53 |
* |
|
|
|
| 26266-77-3 |
[1R-(1alpha,4abeta,4balpha,10aalpha)]-dodecahydro-7-isopropyl-1,4a-dimethylphenanthren-1-methanol |
N;R50/53 |
|
* |
|
|
| 26306-64-9 |
2-(2,4-dichlorphenoxy)anilin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 26311-09-1 |
N-[5-amino-2-[(p-nitrophenyl)azo]phenyl]acetamid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 26354-18-7 |
2-propenoic acid, 2-methyl-, methyl ester = Stannane, tributylmeacrylate |
|
|
|
|
* |
| 26399-36-0 |
profluralin |
Xi;R36 N;R50/53 |
* |
|
|
|
| 26401-27-4 |
isooctyldiphenylphosphit- |
N;R50/53 |
|
* |
|
|
| 26401-38-7 |
diisooctyl-2,2'-tetrathiodiacetat |
N;R50/53 |
|
* |
|
|
| 26446-73-1 |
bis(methylphenyl)phenylphosphat |
N;R50/53 |
|
* |
|
|
| 26447-14-3 |
cresylglycidylether |
Xi;R38 R43 Mut3;R68 N;R51/53 |
* |
|
|
|
| 26447-40-5 |
methylendiphenyldiisocyanat |
Xn;R20 Xi;R36/37/38 R42/43 |
* |
|
|
|
| 26471-62-5 |
m-tolylidendiisocyanat |
Tx;R26 Xi;R36/37/38 Carc3;R40 R42/43 R52/53 |
* |
|
|
|
| 26496-20-8 |
tetradecan-4-on |
N;R50/53 |
|
* |
|
|
| 26530-20-1 |
octhilinon eller 2-octyl-2H-isothiazol-3-on |
Xn;R22 T;R23/24 C;R34 R43 N;R50/53 |
* |
|
|
|
| 26590-20-5 |
1,2,3,6-tetrahydromethylphthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 26603-40-7 |
(2,4,6-trioxotriazin-1,3,5(2H,4H,6H)-triyl)tris(methyl-m-phenylen)isocyanat |
N;R50/53 |
|
* |
|
|
| 26628-22-8 |
natriumazid |
Tx;R28 R32 N;R50/53 |
* |
|
|
|
| 26635-64-3 |
octan [og octanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 26636-32-8 |
Tributyltinnaphthalate |
|
|
|
|
* |
| 26655-40-3 |
diisooctyl-3,3'-thiobispropionat |
N;R50/53 |
|
* |
|
|
| 26657-96-5 |
glycerolpalmitat, kemisk rent |
N;R50/53 |
|
* |
|
|
| 26692-46-6 |
2,2'-[(3-chlorphenyl)imino]bisethyldiacetat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 26761-45-5 |
2,3-epoxypropylneodecanoat |
Mut3;R40 R43 |
|
* |
|
|
| 26834-32-2 |
2-methoxy(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl)phenol |
N;R50/53 |
|
* |
|
|
| 26864-56-2 |
penfluridol- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 26898-17-9 |
dibenzyltoluene |
N;R50/53 |
|
* |
|
|
| 26952-23-8 |
dichlorpropen- |
Carc3;R40 N;R50/53 |
|
* |
|
|
| 26968-58-1 |
(chlormethyl)ethylbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 26999-29-1 |
O,O-diisooctylhydrogendithiophosphat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 27080-90-6 |
dixylyldisulfid- |
N;R50/53 |
|
* |
|
|
| 27138-31-4 |
oxydipropyldibenzoat- |
N;R50/53 |
|
* |
|
|
| 27140-08-5 |
phenylhydrazin-hydrochlorid |
Carc2;R45 T;R23/24/25-48/23/24/25 Xi;R36/38 R43 Mut3;R68
N;R50 |
* |
|
|
|
| 27153-54-4 |
4-(1-ethoxy-1-methylethyl)-1-methylcyclohexen |
N;R50/53 |
|
* |
|
|
| 27193-28-8 |
(1,1,3,3-tetramethylbutyl)phenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 27193-86-8 |
dodecylphenol |
|
|
|
* |
|
| 27196-00-5 |
tetradecanol- |
N;R50/53 |
|
* |
|
|
| 27215-22-1 |
benzylisooctylphthalat- |
N;R50/53 |
|
* |
|
|
| 27215-95-8 |
nonen- |
N;R50/53 |
|
* |
|
|
| 27220-47-9 |
econazol- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 27312-17-0 |
1-5-diamino-2-brom-4,8-dihydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 27312-18-1 |
4,8-diamino-2-brom-1,5-dihydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 27322-34-5 |
triisopropylbenzen- |
N;R50/53 |
|
* |
|
|
| 27341-33-9 |
1-amino-4-[(methoxyphenyl)amino]anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 27351-96-8 |
1,5-bis(isopropyl)naphthalen |
N;R50/53 |
|
* |
|
|
| 27354-18-3 |
1-[(1-methylethyl)amino]anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 27530-63-8 |
[1S-(1alpha,3abeta,4alpha,8abeta)]-2-(decahydro-4,8,8-trimethyl-1,4-methanoazulen-9-yliden)ethylacetat |
N;R50/53 |
|
* |
|
|
| 27550-64-7 |
N-[3-[[(2,5-dioxo-1-pyrrolidinyl)ethyl]ethylamino]phenyl]acetamid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 27576-86-9 |
(1-methyl-1-phenylethyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 27599-04-8 |
bis(alpha-chlortolyl)ether |
R43 N;R50/53 |
|
* |
|
|
| 27607-36-9 |
2,2'-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)imino]bisethanol |
N;R50/53 |
|
* |
|
|
| 27607-42-7 |
2-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)amino]ethanol |
N;R50/53 |
|
* |
|
|
| 27619-89-2 |
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctansulfonylchlorid |
N;R50/53 |
|
* |
|
|
| 27686-84-6 |
(R*,S*)-4,4'-(2,3-dimethylbutan-1,4-diyl)bispyrocatechol |
R43 N;R50/53 |
|
* |
|
|
| 27689-12-9 |
(1-methylethyliden)bis(4,1-phenylenoxy-3,1-propandiyl)bismethacrylat |
N;R50/53 |
|
* |
|
|
| 27692-35-9 |
4-(chlorethoxy)anilin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 27733-08-0 |
1,8-diaminobrom-4,5-dihydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 27776-01-8 |
benzyltoluen- |
R43 N;R50/53 |
|
* |
|
|
| 27817-35-2 |
hexahydro-1H-azepin-1-carbonylchlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 27883-12-1 |
(6Z,9Z)-N,N-bis(2-hydroxyethyl)octadeca-6,9-dien-1-amid |
R43 N;R50/53 |
|
* |
|
|
| 27885-92-3 |
imidocarb- |
N;R50/53 |
|
* |
|
|
| 27893-41-0 |
p-(heptyloxy)benzaldehyd |
N;R50/53 |
|
* |
|
|
| 27938-31-4 |
o-isononylphenol |
R43 N;R50/53 |
|
* |
|
|
| 27942-27-4 |
20-(4-nonylphenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol |
N;R50/53 |
|
* |
|
|
| 27985-70-2 |
(1-methylheptyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 27985-87-1 |
cyclohexyl-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 28059-64-5 |
2-benzylanilin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 28075-29-8 |
N-methyl-3,3-diphenylpropylamin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 28079-04-1 |
(Z)-dodec-8-enylacetat |
N;R50/53 |
|
* |
|
|
| 28106-30-1 |
ethylstyren- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 28141-00-6 |
1-[(4-methylphenyl)amino]-4-(phenylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 28150-30-3 |
[[p-(benzyloxy)phenoxy]methyl]oxiran |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 28197-66-2 |
N-[3-acetyl-4-(oxiranylmethoxy)phenyl]butyramid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 28221-20-7 |
[1R-(1alpha,2beta,5alpha)]-2-isopropenyl-5-methylcyclohexylisovalerat |
N;R50/53 |
|
* |
|
|
| 28249-77-6 |
thiobencarb eller S-4-chlorbenzyldiethylthiocarbamat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 28279-27-8 |
5-[2-(1-ethylnaphtho[1,2-d]thiazol-2(3H)-yliden)-1-[(1-ethylnaphtho[1,2-d]thiazol-2(3H)-yliden)methyl]ethyliden]-1,3-bis(2-methoxyethyl)barbitursyre |
N;R50/53 |
|
* |
|
|
| 28316-62-3 |
propyl-(2E,4Z)-2,4-decadienoat |
N;R50/53 |
|
* |
|
|
| 28347-13-9 |
bis(chlormethyl)benzen |
Xn;R22 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 28361-43-5 |
di-3,4-xylylsulfon |
N;R50/53 |
|
* |
|
|
| 28369-22-4 |
methyl-(2E,6Z)-dodeca-2,6-dienoat |
N;R50/53 |
|
* |
|
|
| 28369-24-6 |
butyl-(2E,4Z)-2,4-decadienoat |
N;R50/53 |
|
* |
|
|
| 28380-08-7 |
ethyl-(2E,6Z)-dodeca-2,6-dienoat |
N;R50/53 |
|
* |
|
|
| 28380-12-3 |
ethyl-(E,E,Z)-tetradeca-2,4,8-trienoat |
N;R50/53 |
|
* |
|
|
| 28434-00-6 |
S-bioallethrin |
Xn;R20/22 N;R50/53 |
* |
|
|
|
| 28434-01-7 |
bioresmethrin |
N;R50/53 |
* |
|
|
|
| 28443-50-7 |
2-amino-5-chlorphenol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 28469-92-3 |
2,6-dichlorstyren |
R43 N;R50/53 |
|
* |
|
|
| 28489-52-3 |
3-methyl-2,6-diphenylpyridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 28535-81-1 |
methyl-3-alpha-7-alpha-diacetoxy-12-oxo-5-beta-cholan-24-oat |
N;R50/53 |
|
* |
|
|
| 28631-35-8 |
isooctyl-2-(2,4-dichlorphenoxy)propionat |
R43 N;R50/53 |
|
* |
|
|
| 28652-72-4 |
methyl-1,1'-biphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 28727-50-6 |
N-(1,3-dimethylbutyl)-N'-(methylphenyl)benzen-1,4-diamin |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 28768-32-3 |
4,4'-methylenbis[N,N-bis(2,3-epoxypropyl)anilin] |
Carc3;R40 R43 |
|
* |
|
|
| 28795-33-7 |
1-[2-(ethylthio)ethyl]-2-methyl-5-nitro-1H-imidazol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 28804-88-8 |
dimethylnaphthalen- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 28818-24-8 |
isopropyl-2-[(3,5-dibrom-4-hydroxyphenyl)(3,5-dibrom-4-oxo-2,5-cyclohexadien-1-yliden)methyl]benzoat |
N;R50/53 |
|
* |
|
|
| 28818-70-4 |
(20S)-pregnan-3alpha,20-diol |
N;R50/53 |
|
* |
|
|
| 28839-13-6 |
beta,4-dimethylcyclohex-3-en-1-ethylacetat |
N;R50/53 |
|
* |
|
|
| 28878-99-1 |
diphenylisononylphosphinat- |
N;R50/53 |
|
* |
|
|
| 28907-84-8 |
natrium-5-aminonaphthalen-2-sulfonat |
Mut3;R40 |
|
* |
|
|
| 28924-18-7 |
1-[3,5-bis(phenylmethoxy)phenyl]-2-bromethan-1-on |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 28924-21-2 |
3,5-bis(benzyloxy)acetophenon |
R43 N;R50/53 |
|
* |
|
|
| 28953-96-0 |
1-chlor-2-isopropyl-5-methylcyclohexan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 28965-88-0 |
[(isononyloxy)methyl]oxiran |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 28983-26-8 |
2-isononyl-p-cresol |
R43 N;R50/53 |
|
* |
|
|
| 28983-37-1 |
tert-tetradecanthiol |
N;R50/53 |
|
* |
|
|
| 28984-89-6 |
phenoxy-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 28997-31-1 |
N-[2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl]phthalimid |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 29021-37-2 |
2-pinen-10-ylisobutyrat |
N;R50/53 |
|
* |
|
|
| 29026-74-2 |
2-isopropoxyanilin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 29036-02-0 |
quaterphenyl- |
N;R50/53 |
|
* |
|
|
| 29059-24-3 |
myristinsyre, monoester med propan-1,2-diol |
N;R50/53 |
|
* |
|
|
| 29084-76-2 |
2,4-dichloraniliniumchlorid |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 29091-09-6 |
2,4-dichlor-1,3-dinitro-5-(trifluormethyl)benzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 29092-34-0 |
3-amino-4-chlorbenzensulfonamid |
Mut3;R40 R43 |
|
* |
|
|
| 29098-15-5 |
terofenamat- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 29103-58-0 |
N-[3-[ethyl(phenylmethyl)amino]phenyl]acetamid |
Mut3;R40 R43 |
|
* |
|
|
| 29103-59-1 |
N-[3-[(phenylmethyl)amino]phenyl]acetamid |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 29103-60-4 |
N-[3-[bis(phenylmethyl)amino]phenyl]acetamid |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 29122-69-8 |
2-[4-(2,3-epoxypropoxy)phenyl]acetamid |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 29134-54-1 |
[methylidyntris(oxymethylen)]trisbenzen |
N;R50/53 |
|
* |
|
|
| 29170-08-9 |
4-iod-4'-nitro-1,1'-biphenyl |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 29171-27-5 |
7-(3,3,5,5-tetramethyl-1-vinylhexyl)quinolin-8-ol |
R43 N;R50/53 |
|
* |
|
|
| 29184-39-2 |
bis(2-chlorphenethyl)disulfid |
N;R50/53 |
|
* |
|
|
| 29228-93-1 |
4-(diethylamino)benzaldehyd-[[4-(diethylamino)phenyl]methylen]hydrazon |
N;R50/53 |
|
* |
|
|
| 29253-36-9 |
isopropylnaphthalen- |
N;R50/53 |
|
* |
|
|
| 29263-94-3 |
diethylbrommethylmalonat- |
Mut3;R40 |
|
* |
|
|
| 29312-59-2 |
4-(2,6-diphenyl-4-pyridyl)-N,N-dimethylanilin |
N;R50/53 |
|
* |
|
|
| 29316-05-0 |
sec-pentylbenzen |
N;R50/53 |
|
* |
|
|
| 29350-67-2 |
menthan, didehydroderivat |
N;R50/53 |
|
* |
|
|
| 29385-40-8 |
(1-phenylethyl)anisol |
N;R50/53 |
|
* |
|
|
| 29398-96-7 |
N,N'-bis(2,4-dinitrophenyl)-3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diamin |
N;R50/53 |
|
* |
|
|
| 29426-52-6 |
2,2'-[[4-[[2-(methylsulfonyl)-4-nitrophenyl]azo]-m-tolyl]imino]bisethyldiacetat |
Mut3;R40 R43 |
|
* |
|
|
| 29430-22-6 |
17beta-hydroxyandrost-4-en-3-onoctanoat |
N;R50/53 |
|
* |
|
|
| 29472-96-6 |
2,6-bis(1-methylpropyl)-m-cresol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 29548-30-9 |
3,7,11-trimethyldodeca-2,6,10-trienylacetat |
N;R50/53 |
|
* |
|
|
| 29590-42-9 |
isooctylacrylat |
Xi;R36/37/38 N;R50/53 |
* |
|
|
|
| 29649-48-7 |
N-[5-[[2-(2,5-dioxo-1-pyrrolidinyl)ethyl]ethylamino]-2-[(4-nitrophenyl)azo]phenyl]acetamid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 29682-41-5 |
1,4-dichlor-2-iodobenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 29682-44-8 |
1-brom-2,4,5-trichlorbenzen |
R43 N;R50/53 |
|
* |
|
|
| 29706-46-5 |
2,5-diamino-1,8-dihydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 29707-60-6 |
(1alpha,2beta,4beta)-2-chlor-1-(isopropyl)-4-methylcyclohexan |
Xn;R22 N;R50/53 |
|
* |
|
|
| 29765-00-2 |
3-benzamido-4-[(p-nitrophenyl)azo]phenyliminodiethyldiacetat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 29811-50-5 |
octyl-2-methylbutyrat |
N;R50/53 |
|
* |
|
|
| 29837-19-2 |
(Z,E,Z)-undeca-1,3,5,8-tetraen |
N;R50/53 |
|
* |
|
|
| 29864-31-1 |
2-(2-chlorphenyl)-4,5-bis(3-methoxyphenyl)-1H-imidazol |
N;R50/53 |
|
* |
|
|
| 29869-78-1 |
N,1-dimethyl-3,3-diphenylpropylamin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 29882-07-3 |
4-chlor-1,1-dimethoxybutan |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 29898-32-6 |
2,4-dichlor-1-iodbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 29949-19-7 |
3-nitrobenzylidendi(acetat) |
Mut3;R40 |
|
* |
|
|
| 29968-78-3 |
4-nitrophenethylaminhydrochlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 29973-13-5 |
ethiofencarb eller 2-ethylthiomethylphenylmethyl-carbamat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 30043-49-3 |
ethidimuron |
R43 N;R50/53 |
* |
|
|
|
| 30069-74-0 |
7-nitro-3-phenyl-1-naphthol |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 30085-34-8 |
1-(4-chlorphenyl)-3-hydroxyurinstof |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 30091-01-1 |
4,6-dibenzyl-m-cresol |
R43 N;R50/53 |
|
* |
|
|
| 30091-02-2 |
4-benzyl-m-cresol |
R43 N;R50/53 |
|
* |
|
|
| 30157-74-5 |
2,3,4-tribromstyren |
R43 N;R50/53 |
|
* |
|
|
| 30168-23-1 |
4-(tricyclo[5.2.1.0-{2,6}-]dec-8-yliden)butyraldehyd |
N;R50/53 |
|
* |
|
|
| 30199-26-9 |
(R)-5-(1,5-dimethyl-4-hexenyl)-o-cresol |
R43 N;R50/53 |
|
* |
|
|
| 30203-11-3 |
3,3'-[sulfonylbis(4,1-phenylenoxy)]dianilin |
Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 30320-26-4 |
1,1,1,4,5,5,5-heptafluor-3-(pentafluorethyl)-2,4-bis(trifluormethyl)pent-2-en |
N;R50/53 |
|
* |
|
|
| 30320-27-5 |
1,1,1,2,4,5,5,5-octafluor-3-[1,2,2,2-tetrafluor-1-(trifluormethyl)ethyl]-4-(trifluormethyl)pent-2-en |
N;R50/53 |
|
* |
|
|
| 30348-72-2 |
(phenylmethyl)[1,1'-biphenyl]ol |
R43 N;R50/53 |
|
* |
|
|
| 30361-29-6 |
(2E,4E)-undeca-2,4-dienal |
N;R50/53 |
|
* |
|
|
| 30385-25-2 |
2,6-dimethyloct-6-en-2-ol |
N;R50/53 |
|
* |
|
|
| 30387-70-3 |
2-butoxyethyl-3-(2,4,5-trichlorphenoxy)propionat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 30388-44-4 |
4-mesyl-N-methyl-2-nitroanilin |
Mut3;R40 R43 |
|
* |
|
|
| 30418-89-4 |
(E)-non-2-enylacetat |
N;R50/53 |
|
* |
|
|
| 30431-53-9 |
pentyl-3,5,6-trichlorsalicylat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 30544-61-7 |
clanobutin- |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 30673-36-0 |
butyldecanoat- |
N;R50/53 |
|
* |
|
|
| 30673-38-2 |
isobutyldecanoat- |
N;R50/53 |
|
* |
|
|
| 30673-60-0 |
propyldecanoat- |
N;R50/53 |
|
* |
|
|
| 30723-78-5 |
3-(tert-butyldioxy)-3-(4-chlorphenyl)phthalid |
N;R50/53 |
|
* |
|
|
| 30746-54-4 |
2-methyl-5-nitro-1H-imidazol-1-ethylmethansulfonat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 30784-30-6 |
p-(1,1-dimethylheptyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 30796-92-0 |
phenanthro[4,5-bcd]thiophen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 30864-28-9 |
methyl-3-[(dimethoxyphosphinothioyl)oxy]methacrylat |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| 30897-76-8 |
2-(chlormethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-en |
N;R50/53 |
|
* |
|
|
| 30899-62-8 |
lauriinsyre, ester med hydroxypropandiyldiacetat |
N;R50/53 |
|
* |
|
|
| 30982-03-7 |
isobutylnonan-1-oat |
N;R50/53 |
|
* |
|
|
| 30982-35-5 |
2-(6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl)ethylphenylacetat |
N;R50/53 |
|
* |
|
|
| 30982-36-6 |
2-(6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl)ethylcinnamat |
N;R50/53 |
|
* |
|
|
| 31030-27-0 |
4-[(2-chlor-4-nitrophenyl)azo]-N-ethyl-N-(2-phenoxyethyl)anilin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 31065-89-1 |
[2-(diphenylmethoxy)ethyl]trimethylammoniumbromid |
R43 N;R50/53 |
|
* |
|
|
| 31089-49-3 |
4-benzyl-2-chlorphenol |
R43 N;R50/53 |
|
* |
|
|
| 31180-93-5 |
2-(3,7-dimethylocta-2,6-dienyl)-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 31215-04-0 |
heptyl-2-naphthol |
R43 N;R50/53 |
|
* |
|
|
| 31225-17-9 |
1-(3,4-dichlorphenyl)-3-hydroxyurinstof |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 31265-39-1 |
4,4'-[(5-chlor-2-hydroxy-1,3-phenylen)bis(methylen)]bisresorcinol |
R43 N;R50/53 |
|
* |
|
|
| 31288-44-5 |
1,5-diamino-4,8-dihydroxy(4-methoxyphenyl)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 31307-59-2 |
(phenylmethyl)-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 31329-57-4 |
naftidrofuryl- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 31383-81-0 |
dimethyl-5,5'-methylendianthranilat |
N;R50/53 |
|
* |
|
|
| 31394-54-4 |
heptan [og heptanisomere] |
F;R11 Xi;R38 Xn;R65 R67 N;R50/53 |
* |
|
|
|
| 31426-72-9 |
(chlormethyl)phenoxybenzen |
Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 31431-23-9 |
(4-amino-3-nitrophenyl)cyclopropylketon |
Carc3;R40 R52/53 |
|
* |
|
|
| 31434-97-6 |
N-(2,3,4-trimethoxybenzyliden)anilin |
Mut3;R40 |
|
* |
|
|
| 31465-36-8 |
4-(4-methoxyphenoxy)anilin |
Mut3;R40 R43 |
|
* |
|
|
| 31522-24-4 |
3-(m-aminophenyl)-N-(4-chlor-2,5-dimethoxyphenyl)-3-oxopropionamid |
Mut3;R40 R43 |
|
* |
|
|
| 31529-83-6 |
1,5-diamino-4,8-dihydroxy(4-hydroxyphenyl)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 31543-75-6 |
2,4-dibromtoluen |
R43 N;R50/53 |
|
* |
|
|
| 31545-26-3 |
(4-chlor-3-nitrophenyl)(cyclopropyl)keton |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 31551-45-8 |
2,7-dinitro-9H-fluoren-9-on |
Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 31565-23-8 |
di(tert-dodecyl) pentasulphide |
|
|
|
* |
|
| 31601-41-9 |
N-(4-methoxy-2-methylphenyl)acetamid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 31611-18-4 |
2,2'-[[3-(dodecyloxy)propyl]imino]bisethanol |
R43 N;R50/53 |
|
* |
|
|
| 31651-04-4 |
2,8-diamino-1,5-dihydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 31659-42-4 |
4,5-dihydro-2-(3-nitrophenyl)-1H-imidazol |
N;R50/53 |
|
* |
|
|
| 31718-58-8 |
[1-methyl-2-[(1-oxoallyl)oxy]ethyl]hydrogenmaleat |
Mut3;R40 R43 |
|
* |
|
|
| 31736-73-9 |
4'-brom-3-chlorpropiophenon |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/5 |
|
* |
|
|
| 31807-55-3 |
isododecan- |
N;R50/53 |
|
* |
|
|
| 31810-89-6 |
1,5-diaminobrom-4,8-dihydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 31848-01-8 |
morclofon- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 31895-22-4 |
thiocyclamhydrogenoxalat |
Xn;R21/22 N;R50/53 |
* |
|
|
|
| 32089-69-3 |
ethyl[4-formyl-3-methylphenyl][2-hydroxy-3-phenoxypropyl]ammoniumcarbanilat |
N;R50/53 |
|
* |
|
|
| 32089-70-6 |
2-[4-(2,2-dicyanvinyl)-N-ethyl-3-methylanilino]-1-(phenoxymethyl)ethylcarbanilat |
N;R50/53 |
|
* |
|
|
| 32180-65-7 |
4-[2-(2,5-dimethoxyphenyl)vinyl]anilin |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 32222-06-3 |
calcitriol- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 32241-08-0 |
heptachlornaphthalen- |
R43 N;R50/53 |
|
* |
|
|
| 32349-41-0 |
N-(3,4,5-trimethoxybenzyliden)anilin |
Mut3;R40 |
|
* |
|
|
| 32349-98-7 |
ethyl-3,3,5-trimethylcyclohexanacetat |
N;R50/53 |
|
* |
|
|
| 32357-46-3 |
2-butoxyethyl-4-(2,4-dichlorphenoxy)butyrat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 32362-97-3 |
2-pentylcyclohexan-1-on |
N;R50/53 |
|
* |
|
|
| 32388-55-9 |
[3R-(3alpha,3abeta,7beta,8aalpha)]-1-(2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-1H-3a,7-methanoazulen-5-yl)ethan-1-on |
N;R50/53 |
|
* |
|
|
| 32497-38-4 |
N,N'-(9,9',10,10'-tetrahydro-9,9',10',10'-tetraoxo[1,1'-bianthracen]-2,2'-diyl)bisacetamid |
Mut3;R40 R43 |
|
* |
|
|
| 32534-81-9 |
diphenylether, pentabromderivat |
Xn;R48/21/22 R64 N;R50/53 |
* |
|
|
|
| 32536-52-0 |
diphenyl ether, octabromo derivative |
|
|
|
* |
|
| 32580-69-1 |
ethyl-p-isopropylcinnamat |
N;R50/53 |
|
* |
|
|
| 32580-72-6 |
ethyl-3-[2,4-bis(1-methylethyl)phenyl]acrylat |
N;R50/53 |
|
* |
|
|
| 32598-13-3 |
PCB77 |
|
|
|
|
* |
| 32685-16-8 |
kaliumbenzohydroxamat- |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 32695-20-8 |
2-chlor-4-(chlormethyl)-1-(1-methylethoxy)benzen |
R43 N;R50/53 |
|
* |
|
|
| 32742-88-4 |
20-(4-octylphenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol |
N;R50/53 |
|
* |
|
|
| 32774-16-6 |
PCB169 |
|
|
|
|
* |
| 32785-08-3 |
(alpha-methoxybenzyl)oxiran |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 32795-85-0 |
o-(p-nitrophenoxy)anisol |
Mut3;R40 |
|
* |
|
|
| 32809-81-7 |
ethyl-4-chlor-3-ethoxy-2-butenoat |
Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 32861-85-1 |
2,4-dichlorphenyl-3-methoxy-4-nitrophenylether |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 32899-41-5 |
(S)-2,3-dihydroxypropylpalmitat |
N;R50/53 |
|
* |
|
|
| 32961-44-7 |
isobutyl-4-chlor-3,5-diaminobenzoat |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 33059-05-1 |
2-hydroxy-4-(isooctoxy)benzophenon |
N;R50/53 |
|
* |
|
|
| 33145-10-7 |
2,2'-(2-methylpropyliden)bis[4,6-xylenol] |
R43 N;R50/53 |
|
* |
|
|
| 33228-45-4 |
4-hexylanilin |
R43 N;R50/53 |
|
* |
|
|
| 33237-20-6 |
6-(4-pyridyl)-1,3,5-triazin-2,4-diamin |
Mut3;R40 R43 |
|
* |
|
|
| 33304-48-2 |
1,4-diamino-2-(2-methoxyethoxy)anthraquinon |
Carc3;R40 |
|
* |
|
|
| 33421-53-3 |
2,3-diphenylpyridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 33529-02-1 |
1-decyl-1H-imidazol |
R43 N;R50/53 |
|
* |
|
|
| 33610-13-8 |
tert-butyl-(5S,6R,7R)-3-brommethyl-5,8-dioxo-7-(2-phenylacetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-carboxylat |
R42/43 R52/53 |
* |
|
|
|
| 33637-20-6 |
tetraethylbenzen- |
N;R50/53 |
|
* |
|
|
| 33693-04-8 |
terbumeton eller 2-tert-butylamino-4-ethylamino-6-methoxy-1,3,5-triazin |
Xn;R22 N;R50/53 |
* |
|
|
|
| 33696-00-3 |
4-brom-2-nitroanisol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 33704-59-5 |
2,3,4,5,6,7-hexahydro-1,1,2,3,3-pentamethyl-1H-inden |
N;R50/53 |
|
* |
|
|
| 33721-54-9 |
N-(2-methoxy-5-nitrophenyl)acetamid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 33758-39-3 |
ethyl(phenyl)carbamoylchlorid |
Mut3;R40 R43 |
|
* |
|
|
| 33798-02-6 |
4,4'-isopropylidenbis[2,6-dibromphenyl]diacetat |
N;R50/53 |
|
* |
|
|
| 33813-20-6 |
etem eller 5,6-dihydro-3H-imidazol[2,1-c]-1,2,4-dithiazol-3-thion |
Xn;R22 N;R50/53 |
* |
|
|
|
| 33880-83-0 |
(1alpha,2beta,4beta)-1-methyl-2,4-bis(methylvinyl)-1-vinylcyclohexan |
N;R50/53 |
|
* |
|
|
| 33889-85-9 |
(1alpha,2beta,5alpha)-2',2'-dichlor-6,6-dimethylspiro[bicyclo[3.1.1]heptan-2,1'-cyclopropan] |
N;R50/53 |
|
* |
|
|
| 34010-15-6 |
(Z)-tetradec-11-enol |
N;R50/53 |
|
* |
|
|
| 34014-18-1 |
tebuthiuron |
Xn;R22 N;R50/53 |
* |
|
|
|
| 34090-76-1 |
tetrahydro-4-methylphthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 34123-59-6 |
isoproturon eller 3-(4-isopropylphenyl)-1,1-dimethylurinstof |
Xn;R22 Carc3;R40 N;R50/53 |
* |
|
|
|
| 34191-31-6 |
4-(o-tolylazo)resorcinol |
Carc3;R40 R43 |
|
* |
|
|
| 34199-87-6 |
2-brom-6-(1,3-dioxolan-2-yl)pyridin |
N;R50/53 |
|
* |
|
|
| 34256-82-1 |
Acetochlor = 2-chlor-N-(ethoxymethyl-N-(2-ethyl-6-methylphenyl)acetamid
|
Xn;R20 Xi;R37/38 R43 N;R50/53 |
* |
|
|
* |
| 34265-58-2 |
ethyl-5-methylsalicylat |
R43 N;R50/53 |
|
* |
|
|
| 34364-42-6 |
(1-methyl-1-phenylethyl)phenyldiphenylphosphat |
N;R50/53 |
|
* |
|
|
| 34386-60-2 |
2-methyldodec-11-en-2-ol |
N;R50/53 |
|
* |
|
|
| 34432-91-2 |
2-(3-hydroxy-2-quinolyl)-5-phenyl-1H-inden-1,3(2H)-dion |
N;R50/53 |
|
* |
|
|
| 34464-38-5 |
isodecan- |
N;R50/53 |
|
* |
|
|
| 34464-40-9 |
isononan- |
N;R50/53 |
|
* |
|
|
| 34472-48-5 |
1-(1-methylethyliden)-1H-inden |
N;R50/53 |
|
* |
|
|
| 34681-10-2 |
butocarboxim |
R10 T;R23/24/25 Xi;R36 N;R50/53 |
* |
|
|
|
| 35000-38-5 |
tert-butyl-(triphenylphosphoranyliden)acetat |
T;R25 Xi;R36 R43 Xn;R48/22 N;R51/53 |
* |
|
|
|
| 35001-51-5 |
N-[5-(1,1-dimethylethyl)-2-ethoxyphenyl]-N'-[4-(1,1-dimethylethyl)-2-ethylphenyl]oxamid |
N;R50/53 |
|
* |
|
|
| 35065-27-1 |
PCB153 |
|
|
|
|
* |
| 35109-60-5 |
1,3,5-tribrom-2-(2,3-dibrompropoxy)benzen |
Carc3;R40 N;R50/53 |
|
* |
|
|
| 35148-19-7 |
(E)-dodec-9-enylacetat |
N;R50/53 |
|
* |
|
|
| 35153-09-4 |
(E)-dodec-10-enylacetat |
N;R50/53 |
|
* |
|
|
| 35153-15-2 |
(Z)-tetradec-9-enol |
N;R50/53 |
|
* |
|
|
| 35153-18-5 |
(E)-tetradec-11-enol |
N;R50/53 |
|
* |
|
|
| 35171-26-7 |
3,3'-pyridin-2,4-diylbis[5,6-diphenyl-1,2,4-triazin] |
N;R50/53 |
|
* |
|
|
| 35237-64-0 |
(Z)-tetradec-11-enal |
N;R50/53 |
|
* |
|
|
| 35271-57-9 |
bis[(4-hydroxy-m-tolyl)(methyl)ammonium]sulfat |
Mut3;R40 R43 |
|
* |
|
|
| 35400-43-2 |
O-ethyl-O-(4-methylthiophenyl)-S-propyldithiophosphat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 35400-55-6 |
5-amino-4-hydroxynaphthalen-2-sulfonsyre |
Mut3;R40 |
|
* |
|
|
| 35471-49-9 |
kalium-2-benzyl-4-chlorphenolat |
R43 N;R50/53 |
|
* |
|
|
| 35554-44-0 |
1-[2-(allyloxy)-2-(2,4-dichlorphenyl)ethyl]-1H-imidazol |
Xn;R20/22 Xi;R41 N;R50/53 |
* |
|
|
|
| 35573-93-4 |
3-chlor-1,1-diethoxypropan |
Mut3;R40 R43 |
|
* |
|
|
| 35589-32-3 |
3,4-dimethoxyaniliniumchlorid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 35723-81-0 |
isotridecylamin- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 35732-94-6 |
[R-(Z)]-12-hydroxy-9-octadecenamid |
R43 N;R50/53 |
|
* |
|
|
| 35746-21-5 |
(E)-tetradec-11-enal |
N;R50/53 |
|
* |
|
|
| 35835-94-0 |
ethyltriphenylphosphoniumacetat- |
N;R50/53 |
|
* |
|
|
| 35843-74-4 |
2-methyl-N-(triphenylphosphoranyliden)anilin |
N;R50/53 |
|
* |
|
|
| 35843-75-5 |
N-(triphenylphosphoranyliden)-m-toluidin |
N;R50/53 |
|
* |
|
|
| 35946-91-9 |
2,5-diisopropylphenol |
R43 N;R50/53 |
|
* |
|
|
| 35950-52-8 |
2-(2-brom-2-nitroethenyl)furan |
Xn;R22-48/22 C;R34 R43 N;R50/53 |
* |
|
|
|
| 35975-00-9 |
6-nitroquinolin-5-ylamin |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 36065-30-2 |
1,3,5-tribrom-2-(2,3-dibrom-2-methylpropoxy)benzen |
N;R50/53 |
|
* |
|
|
| 36116-84-4 |
diisooctylphosphonat- |
N;R50/53 |
|
* |
|
|
| 36215-07-3 |
1-chlor-3-methoxypropan |
Mut3;R40 R43 |
|
* |
|
|
| 36268-65-2 |
4-[2,4-bis(tert-pentyl)phenoxy]butyronitril |
N;R50/53 |
|
* |
|
|
| 36294-24-3 |
ethyl-3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionat |
N;R50/53 |
|
* |
|
|
| 36318-77-1 |
[1-(dichlormethyl)-1-methylpropyl]benzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 36327-34-1 |
2,4,6-tribromstyren |
R43 N;R50/53 |
|
* |
|
|
| 36341-27-2 |
benzidin, salte heraf |
Carc1;R45 Xn;R22 N;R50/53 |
* |
|
|
|
| 36354-80-0 |
dioctansyre, diester med glycerol |
N;R50/53 |
|
* |
|
|
| 36362-09-1 |
2-(decylthio)ethylammoniumchlorid |
Xi;R38-41 Xn;R48/22 N;R50/53 |
* |
|
|
|
| 36381-62-1 |
2-(2-hydroxyethoxy)ethylpalmitat |
N;R50/53 |
|
* |
|
|
| 36437-37-3 |
2-(2H-benzotriazol-2-yl)-4-(tert-butyl)-6-(sec-butyl)phenol |
N;R50/53 |
|
* |
|
|
| 36557-18-3 |
hexestroldibutyrat- |
N;R50/53 |
|
* |
|
|
| 36616-28-1 |
N-[4-(2-chlorethoxy)phenyl]acetamid |
Xn;R22 Carc3;R40 R43 N;R50 |
|
* |
|
|
| 36631-23-9 |
Stannane, tributyl = Tributyltin naphtalate |
|
|
|
|
* |
| 36701-01-6 |
furfurylvalerat- |
Mut3;R40 |
|
* |
|
|
| 36711-69-0 |
1,4-dibrom-2,5-bis(dibrommethyl)benzen |
N;R50/53 |
|
* |
|
|
| 36734-19-7 |
iprodion |
Carc3;R40 N;R50/53 |
* |
|
|
|
| 36747-99-6 |
(2-chlor-1-ethoxyethyl)benzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 36756-72-6 |
di-sec-butylcarbamoylchlorid |
Mut3;R40 R43 |
|
* |
|
|
| 36768-48-6 |
4,5'-dichlor-2'-hydroxychalcon |
R43 N;R50/53 |
|
* |
|
|
| 36770-74-8 |
N-(3-chlorpropyl)-3,4-dimethoxy-N-methylphenethylamin |
Mut3;R40 N;R50 |
|
* |
|
|
| 36796-46-0 |
N-(1-methyl-4-piperidyliden)anilin |
Mut3;R40 R43 |
|
* |
|
|
| 36837-97-5 |
dithiodi-2,1-ethandiylbismethacrylat |
N;R50/53 |
|
* |
|
|
| 36876-13-8 |
isopropyl(isopropylphenyl)benzen |
N;R50/53 |
|
* |
|
|
| 36904-62-8 |
natrium-3-[ethyl[3-methyl-4-[[4-(phenylazo)phenyl]azo]phenyl]amino]propansulfonat |
Mut3;R40 R43 |
|
* |
|
|
| 36904-99-1 |
(tetrachlor-1,3-phenylen)bismethylendiacrylat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 37111-25-4 |
2,3-epoxypropylpropionat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 37329-65-0 |
exo-cellobiohydrolase |
R42 |
* |
|
|
|
| 37338-40-2 |
dodec-8-enylacetat |
N;R50/53 |
|
* |
|
|
| 37486-72-9 |
ethyl-2-decenoat |
N;R50/53 |
|
* |
|
|
| 37492-26-5 |
ethyl-2-methylheptanoat |
N;R50/53 |
|
* |
|
|
| 37529-30-9 |
4-decylanilin |
R43 N;R50/53 |
|
* |
|
|
| 37551-43-2 |
5-chlor-N,2-dihydroxybenzamid |
Mut3;R40 |
|
* |
|
|
| 37593-03-6 |
1-(4-heptylphenyl)ethan-1-on |
N;R50/53 |
|
* |
|
|
| 37596-36-4 |
2-methyldodecanal |
N;R50/53 |
|
* |
|
|
| 37631-10-0 |
o-(1-propylpentyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 37656-66-9 |
ethyl-4-[(4-chlorphenyl)amino]piperidin-1-carboxylat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 37682-29-4 |
1-nitro-2-(octyloxy)benzen |
N;R50/53 |
|
* |
|
|
| 37721-71-4 |
2,4,6-tribromphenylmethacrylat |
R43 N;R50/53 |
|
* |
|
|
| 37723-78-7 |
ioproninsyre- |
N;R50/53 |
|
* |
|
|
| 37893-02-0 |
flubenzimin |
Xi;R36 N;R50/53 |
* |
|
|
|
| 37894-46-5 |
etacelasil |
Rep2;R61 Xn;R22-48/22 |
* |
|
|
|
| 37943-54-7 |
8-benzyl-1,4-dioxa-8-azaspiro[4.5]decan |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 38004-08-9 |
N-(2-ethoxyethyl)anilin |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 38020-69-8 |
4-amino-N-methylbenzylamin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 38049-28-4 |
6,6-dimethylbicyclo[3.1.1]hept-2-en-2-butyraldehyd |
Xn;R22 N;R50/53 |
|
* |
|
|
| 38133-90-3 |
N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-hydroxy-4-[(2-nitrophenyl)azo]naphthalen-2-carboxamid |
Mut3;R40 |
|
* |
|
|
| 38160-52-0 |
3-(dodecylthio)propionaldehyd |
N;R50/53 |
|
* |
|
|
| 38229-29-7 |
2,4,6-trinitro-N-(2-nitrophenyl)anilin |
Mut3;R40 |
|
* |
|
|
| 38237-68-2 |
endo-2-(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl)-4,5-xylenol |
R43 N;R50/53 |
|
* |
|
|
| 38264-80-1 |
N'-ethyl-N'-(2-methoxyethyl)-2-methylbenzen-1,4-diamin |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 38303-36-5 |
1,3,6-tribrompyren |
Xn;R22 N;R50/53 |
|
* |
|
|
| 38353-82-1 |
1-[(3-aminophenyl)amino]-3-phenoxypropan-2-ol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 38363-23-4 |
dodec-2-enylacetat |
N;R50/53 |
|
* |
|
|
| 38363-29-0 |
(E)-dodec-8-enylacetat |
N;R50/53 |
|
* |
|
|
| 38411-13-1 |
natrium-2-ethylhexanolat |
F;R11 C;R34 R52/53 |
* |
|
|
|
| 38417-97-9 |
2,4,6-trinitro-N-(4-nitrophenyl)anilin |
Mut3;R40 R43 |
|
* |
|
|
| 38425-26-2 |
4-chlor-4'-methylbutyrophenon |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 38444-13-2 |
p-pentylphenyl-p-anisat |
N;R50/53 |
|
* |
|
|
| 38461-29-9 |
2,4-dichlor-1-(2-nitrophenoxy)benzen |
N;R50/53 |
|
* |
|
|
| 38462-26-9 |
(E)-4-(1,4,8-trimethyl-3,7-nonadienyl)pyridin |
R43 N;R50/53 |
|
* |
|
|
| 38462-27-0 |
(Z)-4-(1,4,8-trimethyl-3,7-nonadienyl)pyridin |
R43 N;R50/53 |
|
* |
|
|
| 38471-49-7 |
2-(tridecyloxy)ethanol |
N;R50/53 |
|
* |
|
|
| 38492-84-1 |
1,3-dichlor-6-(trifluormethyl)phenanthren-9-carboxaldehyd |
N;R50/53 |
|
* |
|
|
| 38512-82-2 |
5-methyl-2-nitroanisol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 38521-51-6 |
2,3,4,5,6,alpha-hexabromtoluen |
R43 N;R50/53 |
|
* |
|
|
| 38527-73-0 |
3-ethyl-3-(4-nitrophenyl)piperidin-2,6-dion |
Mut3;R40 Carc3;R40 R52/53 |
|
* |
|
|
| 38540-90-8 |
2-(N-ethyl-p-methoxyanilino)ethanol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 38552-36-2 |
1-[4-(dimethylamino)phenyl]-5-(4-methylphenyl)penta-1,4-dien-3-on |
Xn;R22 N;R50/53 |
|
* |
|
|
| 38565-52-5 |
(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluorheptyl)oxiran |
N;R50/53 |
|
* |
|
|
| 38622-35-4 |
di-tert-nonylpentasulfid |
N;R50/53 |
|
* |
|
|
| 38640-62-9 |
bis(isopropyl)naphthalen |
N;R50/53 |
|
* |
|
|
| 38649-18-2 |
(±)-(1alpha,2beta,5alpha)-2-(isopropyl)-5-methylcyclohexylbenzoat |
N;R50/53 |
|
* |
|
|
| 38663-85-3 |
2-methoxyethylisothiocyanat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 38690-76-5 |
p-cyanophenyl-p-heptylbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 38690-77-6 |
p-cyanophenyl-p-butylbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 38690-78-7 |
4-[(4-hexylbenzyliden)amino]benzonitril |
N;R50/53 |
|
* |
|
|
| 38721-71-0 |
dichlorbenzylchlorid- |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 38778-78-8 |
ethyl-2-[(benzyl)amino]cyclohexen-1-carboxylat |
N;R50/53 |
|
* |
|
|
| 38875-47-7 |
4-(1-phenylethyl)-o-cresol |
R43 N;R50/53 |
|
* |
|
|
| 38880-20-5 |
3-[4-(diethylamino)-2-ethoxyphenyl]-3-(1,2-dimethyl-1H-indol-3-yl)phthalid |
N;R50/53 |
|
* |
|
|
| 38888-98-1 |
(phenylethyl)benzen |
N;R50/53 |
|
* |
|
|
| 38895-96-4 |
2,3-dibrom-3-(4-nitrophenyl)propiophenon |
N;R50/53 |
|
* |
|
|
| 38932-56-8 |
6-benzyl-2-chlorphenol |
R43 N;R50/53 |
|
* |
|
|
| 38932-58-0 |
4-benzyl-2,6-dichlorphenol |
R43 N;R50/53 |
|
* |
|
|
| 38933-95-8 |
1-hydroxy-4-[(2-hydroxyethyl)amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 38952-42-0 |
diisobutylcarbamoylchlorid- |
Mut3;R40 R43 |
|
* |
|
|
| 38954-40-4 |
2-(ethylphenylamino)ethylacetat |
Mut3;R40 R43 |
|
* |
|
|
| 38954-75-5 |
[(tetradecyloxy)methyl]oxiran |
Mut3;R40 R43 |
|
* |
|
|
| 38965-27-4 |
17beta-hydroxyandrost-4-en-3-on-3,3-dimethylbutyrat |
N;R50/53 |
|
* |
|
|
| 38982-12-6 |
3-(9-anthryl)acrylaldehyd |
Xn;R22 N;R50/53 |
|
* |
|
|
| 38986-44-6 |
2-methyl-2-nonyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 39036-71-0 |
2-butyl-1-methylnaphthalen |
N;R50/53 |
|
* |
|
|
| 39036-72-1 |
1-butyl-2-methylnaphthalen |
N;R50/53 |
|
* |
|
|
| 39070-63-8 |
3,4-diaminobenzophenon |
Mut3;R40 R43 |
|
* |
|
|
| 39086-61-8 |
2-chlor-N-ethylacetanilid |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 39123-58-5 |
2-(2-hydroxyanilino)ethanol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 39138-90-4 |
o-(p-nitrophenoxy)phenol |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 39145-47-6 |
1-(4-chlorphenoxy)-2-nitrobenzen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 39145-48-7 |
1,4-dichlor-2-(4-nitrophenoxy)benzen |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 39145-59-0 |
benzen-o-diaminmonohydrochlorid |
Mut3;R40 R43 |
|
* |
|
|
| 39156-41-7 |
4-methoxy-m-phenylendiammoniumsulfat |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 39189-74-7 |
2-heptylidencyclopentan-1-on |
N;R50/53 |
|
* |
|
|
| 39196-18-4 |
thiofanox |
Tx;R27/28 N;R50/53 |
* |
|
|
|
| 39252-03-4 |
furfuryloctanoat- |
N;R50/53 |
|
* |
|
|
| 39258-30-5 |
2-methylbenzo[f]quinolin |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 39264-02-3 |
dibutyl-2,2'-dithiobisbenzoat |
N;R50/53 |
|
* |
|
|
| 39489-75-3 |
bis(2,4-dichloro-5-nitrophenyl) carbonate |
|
|
|
* |
|
| 39515-40-7 |
alpha-cyan-3-phenoxybenzyl-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropancarboxylat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 39515-41-8 |
fenpropathrin |
Xn;R21 T;R25 Tx;R26 N;R50/53 |
* |
|
|
|
| 39538-68-6 |
2-methoxy-p-toluidin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 39562-17-9 |
methyl-2-(3-nitrobenzyliden)acetoacetat |
R43 N;R50/53 |
* |
|
|
|
| 39568-98-4 |
1,2,4,5-tetrabrom-3,6-bis(chlormethyl)benzen |
R43 N;R50/53 |
|
* |
|
|
| 39568-99-5 |
3,6-bis(brommethyl)-1,2,4,5-tetrabrombenzen |
R43 N;R50/53 |
|
* |
|
|
| 39569-21-6 |
2,3,4,5-tetrabrom-6-chlortoluen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 39577-43-0 |
1-(3-chlorphenyl)-4-(3-chlorpropyl)piperazin |
Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 39590-62-0 |
3-chlor-N-(6-chlor-o-tolyl)propionamid |
Mut3;R40 Carc3;R40 R43 N;R50 |
|
* |
|
|
| 39627-84-4 |
2-naphthohydrazid |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 39635-79-5 |
4,4'-sulfonylbis[2,6-dibromphenol] |
R43 N;R50/53 |
|
* |
|
|
| 39648-47-0 |
(-)-2-(2,2-dicyclohexylethyl)piperidin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 39648-48-1 |
(+)-2-(2,2-dicyclohexylethyl)piperidin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 39761-68-7 |
2,4,4,6,6-pentamethylhept-2-en |
N;R50/53 |
|
* |
|
|
| 39770-05-3 |
9-decenal |
N;R50/53 |
|
* |
|
|
| 39811-17-1 |
5-phenyl-o-anisidin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 39817-09-9 |
2,2'-[methylenbis(phenylenoxymethylen)]bisoxiran |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 39833-65-3 |
1-(chlormethyl)-3-vinylbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 39864-10-3 |
4-(1-chlor-1-methylethyl)-1-methylcyclohexen |
N;R50/53 |
|
* |
|
|
| 39924-40-8 |
ethyl-(2E,4Z)-undeca-2,4-dienoat |
N;R50/53 |
|
* |
|
|
| 40027-50-7 |
N,N-bis(2,3-epoxypropyl)-o-toluidin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 40034-44-4 |
3-(4-pyridyl)anilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 40034-49-9 |
ethyl-7-(2,6-dimethyl-4-pyridyl)-1,4-dihydro-4-oxoquinolin-3-carboxylat |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 40034-51-3 |
3-(2,6-dimethyl-4-pyridyl)anilin |
Xn;R22 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 40034-60-4 |
2,6-dimethyl-4-(3-nitrophenyl)pyridin |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 40070-59-5 |
4,4'-(3H-2,1-benzoxathiol-3-yliden)bis[3-brom-2,5-dimethylphenol]S,S-dioxid |
N;R50/53 |
|
* |
|
|
| 40098-44-0 |
ethyl-5-oxocyclopent-1-en-1-heptanoat |
N;R50/53 |
|
* |
|
|
| 40130-25-4 |
2-ethoxy-4-nitrophenol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 40137-60-8 |
1-methyl-2-(2-methylpropoxy)ethylchloracetat |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 40188-41-8 |
3,7-dimethyloctannitril |
Xi;R38 R43 N;R51/53 |
* |
|
|
|
| 40220-08-4 |
(2,4,6-trioxo-1,3,5-triazin-1,3,5(2H,4H,6H)-triyl)tri-2,1-ethandiyltriacrylat |
Mut3;R40 |
|
* |
|
|
| 40267-72-9 |
1-ethoxy-3,7-dimethylocta-2,6-dien |
N;R50/53 |
|
* |
|
|
| 40292-01-1 |
N,N-dimethyl-4-[[4-(phenylazo)phenyl]azo]anilin |
Mut3;R40 |
|
* |
|
|
| 40306-75-0 |
3-acetamido-5-amino-4-hydroxybenzensulfonsyre |
Mut3;R40 R43 |
|
* |
|
|
| 40321-76-4 |
1,2,3,7,8 Pentachlorodibenzodioxin |
|
|
|
|
* |
| 40358-51-8 |
1-(1-cyclohexen-1-yl)naphthalen |
R43 N;R50/53 |
|
* |
|
|
| 40371-64-0 |
2-brom-4-chlor-5-nitrotoluen |
R43 N;R50/53 |
|
* |
|
|
| 40398-00-3 |
3-chlor-4-isocyanatotoluen |
Carc3;R40 R43 |
|
* |
|
|
| 40447-04-9 |
N-(3-chlor-o-tolyl)benzamid |
Mut3;R40 R43 |
|
* |
|
|
| 40454-19-1 |
(5-methoxy-1,5-dimethylhexyl)oxiran |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 40458-98-8 |
2,7-diisopropylnaphthalen |
N;R50/53 |
|
* |
|
|
| 40487-42-1 |
N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidin |
R43 N;R50/53 |
* |
|
|
|
| 40523-01-1 |
5,6-dimethoxy-2-methyl-3-[2-(4-phenyl-1-piperazinyl)ethyl]-1H-indolhydrochlorid |
N;R50/53 |
|
* |
|
|
| 40529-66-6 |
ethyl-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 40567-16-6 |
2-[2,4-bis(1,1-dimethylpropyl)phenoxy]butyrylchlorid |
N;R50/53 |
|
* |
|
|
| 40580-83-4 |
1-methyl-beta-carbolin-7-olhydrochloridmonohydrat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 40590-42-9 |
4,6-bis(1-phenylethyl)-o-cresol |
R43 N;R50/53 |
|
* |
|
|
| 40596-69-8 |
isopropyl-(2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoat |
N;R50/53 |
|
* |
|
|
| 40607-48-5 |
3,7-dimethyloct-2-en-1-ol |
R43 N;R50/53 |
|
* |
|
|
| 40615-35-8 |
4,4'-dimethoxytritylalkohol |
N;R50/53 |
|
* |
|
|
| 40630-61-3 |
heptadecafluor-N,N-bis(2-hydroxyethyl)octansulfonamid |
N;R50/53 |
|
* |
|
|
| 40632-70-0 |
2-methyl-2-(6-methylhept-6-enyl)-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 40763-98-2 |
2-amino-5-(4-aminophenoxy)benzamid |
Carc3;R40 |
|
* |
|
|
| 40786-25-2 |
1-tert-butyl-2-(2,3-epoxypropoxy)benzen |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 40817-08-1 |
4'-pentyl[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 40843-73-0 |
4-(2,4-dichlorphenoxy)phenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 40877-09-6 |
4,4'-dichlorbutyrophenon |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 40877-19-8 |
4-chlor-4'-methoxybutyrophenon |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 40882-89-1 |
5-(isopropyl)-2-methylcyclohex-2-en-1-methylacetat |
N;R50/53 |
|
* |
|
|
| 40893-04-7 |
2-methoxyphenyl-2-phenylbutyrat |
N;R50/53 |
|
* |
|
|
| 40932-60-3 |
3,5,6-trichlorsalicylsyre |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 40941-53-5 |
7-chlor-4-methylquinolin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 40941-54-6 |
4,7-dimethylquinolin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 41052-75-9 |
o-chlorphenylhydrazinhydrochlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 41083-11-8 |
azocyclotin eller 1-(tricyclohexylstannyl)-1H-1,2,4-triazol |
T;R25 Tx;R26 Xi;R37/38-41 N;R50/53 |
* |
|
|
|
| 41107-56-6 |
5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin)-3-fluor-2-hydroxymethyltetrahydrofuran |
Mut3;R68 |
* |
|
|
|
| 41122-70-7 |
4'-hexyl[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 41122-71-8 |
4'-heptyl[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 41200-97-9 |
1,5-dichlor-2-(1-methylethoxy)-4-nitrobenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 41212-96-8 |
1-(2-chlorethyl)pyrrolidin-2,5-dion |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 41283-72-1 |
ethyl-2-(4-isobutylphenyl)propionat |
N;R50/53 |
|
* |
|
|
| 41284-39-3 |
2-(N-ethyl-m-toluidino)ethylbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 41295-20-9 |
4-(p-tolyloxy)anilin |
Xn;R22 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 41302-05-0 |
2-(4-chlorbutoxy)tetrahydro-2H-pyran |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 41317-15-1 |
4-methoxy-N-phenyl-o-toluidin |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 41359-72-2 |
2-(diethylamino)ethyltetrahydro-alpha-(2-naphthylmethyl)furan-2-propionat |
R43 N;R50/53 |
|
* |
|
|
| 41365-24-6 |
N,N'-diethyl-N,N'-diphenylthioperoxydicarbamiinsyre |
N;R50/53 |
|
* |
|
|
| 41378-27-2 |
N-[3-(ethylamino)phenyl]acetamid |
Carc3;R40 R43 |
|
* |
|
|
| 41394-05-2 |
metamitron eller 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-on |
Xn;R22 N;R50/53 |
* |
|
|
|
| 41424-11-7 |
4'-(hexyloxy)[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 41425-46-1 |
3-hydroxy-4-[[2-(methoxycarbonyl)phenyl]azo]-2-naphthoesyre |
Mut3;R40 |
|
* |
|
|
| 41427-13-8 |
natrium-4-aminostilben-2-sulfonat |
Mut3;R40 R43 |
|
* |
|
|
| 41453-57-0 |
(Z)-non-2-enylacetat |
N;R50/53 |
|
* |
|
|
| 41481-20-3 |
2-cyclohexyliden-6-(1-cyclohexen-1-yl)cyclohexan-1-on |
N;R50/53 |
|
* |
|
|
| 41544-42-7 |
bis(4-methylcyclohexyl)adipat |
N;R50/53 |
|
* |
|
|
| 41570-56-3 |
4-ethoxy-N-phenyl-o-toluidin |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 41573-36-8 |
4,4'-(2-chlorbenzyliden)bis[N,N-dimethylanilin] |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 41576-40-3 |
2(og 3)-methyl-4-(tolylazo)anilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 41604-19-7 |
4-brom-2-fluor-1,1'-biphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 41611-98-7 |
3-hydroxy-7-methoxy-N-phenylnaphthalen-2-carboxamid |
R43 N;R50/53 |
|
* |
|
|
| 41614-16-8 |
4-chlor-3-nitrobenzanilid |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 41620-33-1 |
2-[[2-(acetyloxy)-3-(1,1-dimethylethyl)-5-methylphenyl]methyl]-6-(1,1-dimethylethyl)-4-methylphenol |
N;R50/53 |
* |
|
|
|
| 41638-55-5 |
butyl-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 41663-84-7 |
N-methyl-4-nitrophthalimid |
Xn;R22 Mut3;R40 Carc3;R40 R52/53 |
|
* |
|
|
| 41678-36-8 |
3,7-dimethylocten-2-ol |
R43 N;R50/53 |
|
* |
|
|
| 41692-90-4 |
1-(triphenylphosphoranyliden)octan-2-on |
N;R50/53 |
|
* |
|
|
| 41710-89-8 |
2-tetradecyloxyanilin |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 41755-73-1 |
phenyl-3-methylsalicylat |
R43 N;R50/53 |
|
* |
|
|
| 41771-35-1 |
1-(2-chlorethoxy)-2-ethoxyethan |
Mut3;R40 R43 |
|
* |
|
|
| 41790-27-6 |
diethyl-(1-naphthylmethyl)tetrahydrofurfurylmalonat |
N;R50/53 |
|
* |
|
|
| 41865-30-9 |
3,7-dimethylnona-2,6-dien-1-ol |
N;R50/53 |
|
* |
|
|
| 41945-72-6 |
1,1'-[isopropylidenbis(p-phenylenoxy)]bis[3-phenoxypropan-2-ol] |
N;R50/53 |
|
* |
|
|
| 42074-68-0 |
1-chlor-2-(chlordiphenylmethyl)benzen |
N;R50/53 |
|
* |
|
|
| 42115-15-1 |
(allyloxy)pentachlorbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 42115-16-2 |
pentachlor(2,3-dibrompropoxy)benzen |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 42135-22-8 |
3-nitrofluoren-9-on |
Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 42152-47-6 |
7-methylocta-1,6-dien |
R10 N;R50/53 |
* |
|
|
|
| 42173-90-0 |
26-(nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol |
N;R50/53 |
|
* |
|
|
| 42196-97-4 |
(E)9-(2-phenylvinyl)anthracen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 42314-08-9 |
1-chlor-3-(2-methylpropoxy)propan-2-ol |
Mut3;R40 R43 |
|
* |
|
|
| 42405-40-3 |
bis(3,5-di-tert-butylsalicylato-O1,O2)zink |
F;R11 Xn;R22 N;R50/53 |
* |
|
|
|
| 42413-23-0 |
dibenzylsuberat- |
N;R50/53 |
|
* |
|
|
| 42450-33-9 |
4,5-dichlor-2-(methylamino)anilin |
Mut3;R40 R43 |
|
* |
|
|
| 42471-28-3 |
nimustin- |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 42479-87-8 |
3-(1,1-dimethylethyl)[1,1'-biphenyl]-4-ol |
N;R50/53 |
|
* |
|
|
| 42479-88-9 |
3,4'-bis(1,1-dimethylethyl)[1,1'-biphenyl]-4-ol |
N;R50/53 |
|
* |
|
|
| 42498-58-8 |
2,3,5,6-tetrahydro-2-methylphthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 42509-80-8 |
isazofos |
T;R24/25 Tx;R26 R43 Xn;R48/20 N;R50/53 |
* |
|
|
|
| 42513-36-0 |
12-chlordodec-5-yn |
R43 N;R50/53 |
|
* |
|
|
| 42573-57-9 |
2-(p-methoxystyryl)-4,6-bis(trichlormethyl)-1,3,5-triazin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 42576-02-3 |
methyl-5-(2,4-dichlorphenoxy)-2-nitrobenzoat |
N;R50/53 |
|
* |
|
|
| 42588-37-4 |
kinopren- |
N;R50/53 |
|
* |
|
|
| 42721-99-3 |
2-(diphenylacetyl)-1H-inden-1,3(2H)-dion, mononatriumsalt |
N;R50/53 |
|
* |
|
|
| 42769-38-0 |
1,1,3,4-tetrachlorbuta-1,3-dien |
Xn;R22 N;R50/53 |
|
* |
|
|
| 42771-77-7 |
1-(2-nitro[1,1'-biphenyl]-4-yl)ethan-1-on |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 42771-78-8 |
1-(2-amino[1,1'-biphenyl]-4-yl)ethan-1-on |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 42874-03-3 |
2-chlor-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluormethyl)benzen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 42874-63-5 |
5-[2-chlor-4-(trifluormethyl)phenoxy]-2-nitrophenol |
N;R50/53 |
|
* |
|
|
| 42903-59-3 |
bis[2,2-bis[(2-allyloxy)methyl]butyl]-(4-methyl-1,3-phenylen)dicarbamat |
N;R50/53 |
|
* |
|
|
| 42906-19-4 |
4-[bis(p-tolyl)amino]benzaldehyd |
N;R50/53 |
|
* |
|
|
| 42908-15-6 |
2-ethylhexyl-3,5-diamino-4-methylbenzoat |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 42909-29-5 |
2-methoxybenzen-1,4-diammoniumsulfat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 42933-32-4 |
3,6,7-trimethyl-2,6-octadien-1-ol |
N;R50/53 |
|
* |
|
|
| 42986-15-2 |
5-[[4-(methylamino)phenyl]azo]-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzensulfonsyre |
Mut3;R40 R43 |
|
* |
|
|
| 42987-34-8 |
1-amino-2-(4-chlorphenoxy)-4-hydroxyanthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 43016-78-0 |
2-(dimethylamino)ethylmyristat |
R43 N;R50/53 |
|
* |
|
|
| 43047-20-7 |
2-[[2-chlor-4-[(4-nitrophenyl)azo]phenyl]amino]ethanol |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 43051-43-0 |
m-benzamidophenyliminodiethyldiacetat |
Mut3;R40 R43 |
|
* |
|
|
| 43051-46-3 |
N-[3-[bis(2-hydroxyethyl)amino]phenyl]benzamid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 43076-61-5 |
4'-tert-butyl-4-chlorbutyrophenon |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 43095-98-3 |
N-[4-[(3-chlorphenyl)amino]-9,10-dihydro-9,10-dioxo-1-anthryl]benzamid |
Mut3;R40 R52/53 |
|
* |
|
|
| 43151-99-1 |
3-methyl-4,4'-azodianilin |
T;R25 R43 Xn;R48/22 N;R50/53 |
* |
|
|
|
| 43156-47-4 |
2-nitro-5-(phenylthio)anilin |
N;R50/53 |
|
* |
|
|
| 43222-48-6 |
1,2-dimethyl-3,5-diphenylpyrazoliummethylsulfat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 43229-65-8 |
N-benzyl-4-methoxy-alpha-methylphenethylamin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 46190-62-9 |
2,4-dichlor-N-isopropylbenzylamin |
N;R50/53 |
|
* |
|
|
| 46498-17-3 |
9-methyl-9H-carbazol-3,6-diamin |
R43 N;R50/53 |
|
* |
|
|
| 47073-92-7 |
4,4'-ethylidendiphenyldicyanat |
Xn;R20/22-48/22 Xi;R41 N;R50/53 |
* |
|
|
|
| 47593-10-2 |
dimethyl-4,4'-[1,2-ethandiylbis(oxy)]bis[3,5-dichlorbenzoat] |
R43 N;R50/53 |
|
* |
|
|
| 47676-48-2 |
ethyl-3alpha,7alpha,12alpha-trihydroxy-5beta-cholan-24-oat |
N;R50/53 |
|
* |
|
|
| 47749-96-2 |
4-[[(1,1-dimethylethyl)amino]acetyl]-1,2-phenylendi-p-toluat |
R43 N;R50/53 |
|
* |
|
|
| 47750-79-8 |
2,2',2''-nitrilotriethyltribenzoat |
N;R50/53 |
|
* |
|
|
| 48076-44-4 |
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluorheptylmethacrylat |
N;R50/53 |
|
* |
|
|
| 48122-14-1 |
hexahydro-1-methylphthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 48145-04-6 |
2-phenoxyethylacrylat |
Mut3;R40 |
|
* |
|
|
| 49553-64-2 |
isononylanthranilat- |
N;R50/53 |
|
* |
|
|
| 49553-76-6 |
oliesyre, monoester med oxybis(propandiol) |
N;R50/53 |
|
* |
|
|
| 49571-04-2 |
bepridil- |
R43 N;R50/53 |
|
* |
|
|
| 49594-70-9 |
2-nitrobenzylacrylat |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 49609-90-7 |
dimethyl-4,4'-methylenbis[3-methoxy-2-naphthoat] |
N;R50/53 |
|
* |
|
|
| 49673-70-3 |
7-(1,1-dimethylethyl)-1,4-dioxaspiro[4.5]decan |
N;R50/53 |
|
* |
|
|
| 49701-19-1 |
3-amino-N-[4-(aminocarbonyl)phenyl]-4-methoxybenzamid |
Mut3;R40 |
|
* |
|
|
| 49742-56-5 |
methyl-4'-methyl[1,1'-biphenyl]-4-carboxylat |
N;R50/53 |
|
* |
|
|
| 49744-28-7 |
1-[(4-methoxy-2-nitrophenyl)azo]-2-naphthol |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 49763-64-6 |
p-cyanphenyl-p-pentylbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 49763-69-1 |
p-hexylbenzaldehyd |
R43 N;R50/53 |
|
* |
|
|
| 49791-98-2 |
2,4,4'-tris(2,3-epoxypropoxy)biphenyl |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 49859-70-3 |
2-[methyl[(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)sulfonyl]amino]ethylacrylat |
N;R50/53 |
|
* |
|
|
| 50274-64-1 |
4-chlorphenyl-2-chlor-4-nitrophenylketon |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 50274-95-8 |
alpha-2-dichlor-4-nitrotoluen |
R43 N;R50/53 |
|
* |
|
|
| 50274-96-9 |
2-chlor-1-[(2,4-dichlorphenyl)methyl]-4-nitrobenzen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 50277-31-1 |
(E,E,Z)-undeca-1,3,5,8-tetraen |
N;R50/53 |
|
* |
|
|
| 50285-18-2 |
1,1,1,2,2,3,4,5,5,5-decafluor-3-[1,2,2,2-tetrafluor-1-(trifluormethyl)ethyl]-4-(trifluormethyl)pentan |
N;R50/53 |
|
* |
|
|
| 50321-23-8 |
[[2-[2-(isobutoxy)ethoxy]ethoxy]methyl]oxiran |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 50328-50-2 |
N-[3-(phenylamino)allyliden]anilinhydrochlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 50337-75-2 |
1-(tert-butoxy)naphthalen |
N;R50/53 |
|
* |
|
|
| 50467-20-4 |
4-[(4-amino-3,5-diisopropylphenyl)methyl]-2,6-diethylanilin |
R43 N;R50/53 |
|
* |
|
|
| 50471-44-8 |
Vinclozolin eller N-(3,5-dichlorphenyl)-5-methyl-5-vinyl-1,3-oxazolidin-2,4-dion |
Rep2;R60-61 Carc3;R40 R43 N;R51/53 |
* |
|
|
* |
| 50563-36-5 |
dimethachlor eller 2-chlor-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)acetamid |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| 50594-44-0 |
5-[2-chlor-4-(trifluormethyl)phenoxy]-2-nitrophenyl acetat |
N;R50/53 |
|
* |
|
|
| 50594-66-6 |
acifluorfen eller 5-[2-chlor-4-(trifluormethyl)phenoxy]-2-nitrobenzoesyre |
Xn;R22 Xi;R38-41 N;R50/53 |
* |
|
|
|
| 50594-77-9 |
3-[2-chlor-4-(trifluormethyl)phenoxy]phenylacetat |
N;R50/53 |
|
* |
|
|
| 50594-82-6 |
1,2,3-trichlor-5-(trifluormethyl)benzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 50598-28-2 |
N-[3-(dimethylamino)propyl]tridecafluorhexansulfonamid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 50618-92-3 |
4,4'-difluor-2,2'-dinitrobibenzyl |
N;R50/53 |
|
* |
|
|
| 50623-57-9 |
butylnonan-1-oat |
N;R50/53 |
|
* |
|
|
| 50637-63-3 |
2,8-dibromchrysen |
R43 N;R50/53 |
|
* |
|
|
| 50649-28-0 |
4-propylphenyl-p-anisat |
N;R50/53 |
|
* |
|
|
| 50649-59-7 |
4-pentylphenyl-p-toluat |
N;R50/53 |
|
* |
|
|
| 50649-60-0 |
4-pentylphenyl-4-propylbenzoat |
N;R50/53 |
|
* |
|
|
| 50651-39-3 |
N-(4-methoxy-3-nitrophenyl)acetamid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 50670-50-3 |
4'-methyl[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 50671-00-6 |
N-(3-amino-4-chlorphenyl)-2-(2,4-di-tert-pentylphenoxy)acetamid |
R43 N;R50/53 |
|
* |
|
|
| 50678-52-9 |
16-alpha-chlor-20-oxopregn-5-en-3-beta-ylacetat |
N;R50/53 |
|
* |
|
|
| 50696-42-9 |
bis(1,1-dimethylpropyl)naphthalen |
N;R50/53 |
|
* |
|
|
| 50715-28-1 |
cyclopentylchlorformiat |
R10 Xn;R22-48/22 T;R23 Xi;R41 R43 |
* |
|
|
|
| 50741-92-9 |
2-methyl-4-nitroanisol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 50767-78-7 |
(E)-dodeca-9,11-dienylacetat |
N;R50/53 |
|
* |
|
|
| 50772-29-7 |
4-[2,4-bis(1,1-dimethylpropyl)phenoxy]butyrylchlorid |
N;R50/53 |
|
* |
|
|
| 50793-85-6 |
4-cyanphenyl-4-hexylbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 50841-46-8 |
ethyl-3,5-bis(benzyloxy)benzoat |
N;R50/53 |
|
* |
|
|
| 50849-47-3 |
5-nonylsalicylaldehydoxim |
N;R50/53 |
|
* |
* |
|
| 50864-67-0 |
bariumpolysulfider |
R31 Xi;R36/37/38 N;R50 |
* |
|
|
|
| 50868-72-9 |
5-methoxy-o-toluidin |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 50928-80-8 |
4-(ethyl(2-methoxyethyl)ammonio)-o-toluidiniumdi(toluen-4-sulfonat) |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 51113-41-8 |
1,6-bis(isopropyl)naphthalen |
N;R50/53 |
|
* |
|
|
| 51117-19-2 |
(Z)-3,7-dimethylocta-2,6-dienyl-2-methylbutyrat |
N;R50/53 |
|
* |
|
|
| 51160-59-9 |
2-[[[[[3-[[[(2-ethylhexyl)oxy]carbonyl]amino]methylphenyl]amino]carbonyl]oxy]methyl]-2-[[(1-oxoallyl)oxy]methyl]-1,3-propandiyldiacrylat |
N;R50/53 |
|
* |
|
|
| 51183-44-9 |
octyl-(S)-2-methylvalerat |
N;R50/53 |
|
* |
|
|
| 51218-45-2 |
2-chlor-2'-ethyl-N-(2-methoxy-1-methylethyl)-6'-methylacetanilid |
R43 N;R50/53 |
|
* |
|
|
| 51235-04-2 |
hexazinon eller 3-cyclohexyl-6-dimethylamino-1-methyl-1,2,3,4-tetrahydro-1,3,5-triazin-2,4-dion |
Xn;R22 Xi;R36 N;R50/53 |
* |
|
|
|
| 51251-96-8 |
bis(phenylmethyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 51264-14-3 |
amsacrin- |
Mut3;R40 |
|
* |
|
|
| 51308-54-4 |
butyl-p-tert-butylbenzyl-3-pyridylimidodithiocarbonat |
N;R50/53 |
|
* |
|
|
| 51338-27-3 |
methyl-2-(4-(2,4-dichlorphenoxy)phenoxy)propionat |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| 51418-86-1 |
ethyl-6-brom-2,7-dihydro-4-methyl-2,7-dioxo-3H-dibenz[f,ij]isoquinolin-1-carboxylat |
N;R50/53 |
|
* |
|
|
| 51424-66-9 |
(3beta)-3-acetoxyandrost-5-en-17-carboxylsyre |
N;R50/53 |
|
* |
|
|
| 51447-08-6 |
(E,Z)-undeca-1,3,5-trien |
N;R50/53 |
|
* |
|
|
| 51461-11-1 |
N-(3-amino-4-chlorphenyl)-4-[2,4-bis(tert-pentyl)phenoxy]butyramid |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 51487-69-5 |
o-(2-chlor-1-methoxyethoxy)phenylmethylcarbamat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 51550-63-1 |
isopropyl-4-(2,4-dichlorphenoxy)butyrat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 51550-64-2 |
isobutyl-4-(2,4-dichlorphenoxy)butyrat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 51555-08-9 |
p-[1-(p-pentylphenyl)vinyl]anisol |
N;R50/53 |
|
* |
|
|
| 51557-09-6 |
(E)-4-(1-naphthyl)-3-buten-2-on |
Mut3;R40 |
|
* |
|
|
| 51580-86-0 |
troclosennatrium, dihydrat |
Xn;R22 R31 Xi;R36/37 N;R50/53 |
* |
|
|
|
| 51580-93-9 |
4,5-bis(1-phenylethyl)-o-xylen |
N;R50/53 |
|
* |
|
|
| 51594-55-9 |
(R)-1-chlor-2,3-epoxypropan |
Carc2;R45 R10 T;R23/24/25 C;R34 R43 |
* |
|
|
|
| 51601-57-1 |
4-(4-tolyloxy)biphenyl |
Xn;R48/22 R53 |
* |
|
|
|
| 51608-13-0 |
cis-1,2,3,5,6,7,8,8a-octahydro-1,8a-dimethyl-7-(1-methylethyliden)naphthalen |
N;R50/53 |
|
* |
|
|
| 51630-58-1 |
cyan(3-phenoxybenzyl)methyl-2-(4-chlorphenyl)-3-methylbutyrat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 51637-95-7 |
N-(2-aminoethyl)-N,N'-dioctylethylendiamin |
R43 N;R50/53 |
|
* |
|
|
| 51699-89-9 |
2,6-dibrom-4-methylanisol |
R43 N;R50/53 |
|
* |
|
|
| 51728-14-4 |
alpha,alpha-bis(p-hydroxyphenyl)-o-cresol |
R43 N;R50/53 |
|
* |
|
|
| 51760-35-1 |
(Z)-dodeca-9,11-dienylacetat |
N;R50/53 |
|
* |
|
|
| 51787-75-8 |
4,4'-dinitrobiphenyl-2-ylamin |
Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 51787-77-0 |
ethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-carboxylat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 51787-79-2 |
1,1'-(4-iodbutyliden)bis[4-fluorbenzen] |
Xn;R22 N;R50/53 |
|
* |
|
|
| 51839-50-0 |
4-[(4-aminophenyl)methyl]-2-ethylanilin |
Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 51867-83-5 |
N-(3-amino-4-chlorphenyl)acetamid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 51877-44-2 |
N,N',N''-phosphoryltris[N-phenylpropan-2-sulfenamid] |
N;R50/53 |
|
* |
|
|
| 51937-00-9 |
(Z,E)-tetradeca-9,12-dienol |
N;R50/53 |
|
* |
|
|
| 51937-18-9 |
N,N'-bis(2,4,6-tribromphenyl)adipamid |
N;R50/53 |
|
* |
|
|
| 51947-46-7 |
4-(4-aminobenzyl)-N-ethylanilin |
Xn;R22 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 51947-52-5 |
methyl-5-[(4-aminophenyl)methyl]anthranilat |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 51955-66-9 |
natrium-[3-(4-chlor-2-methylphenyl)-1-methyltriazen-2-yl]acetat |
Mut3;R40 |
|
* |
|
|
| 51959-14-9 |
4-(2,4-di-tert-pentylphenoxy)butylamin |
R43 N;R50/53 |
|
* |
|
|
| 51988-28-4 |
N,N-diethyl-2'-methylspiro[2H-1-benzopyran-2,3'-[3H]naphtho[2,1-b]pyran]-7-amin |
N;R50/53 |
|
* |
|
|
| 51989-01-6 |
(1-methylethyliden)bis(4,1-phenylenoxy-3,1-propandiyl)diacrylat |
N;R50/53 |
|
* |
|
|
| 52009-64-0 |
3,8-diamino-6-phenylphenanthridin |
Mut3;R40 R43 |
|
* |
|
|
| 52033-74-6 |
phenylhydraziniumsulfat (2:1) |
Carc2;R45 T;R23/24/25-48/23/24/25 Xi;R36/38 R43 Mut3;R68
N;R50 |
* |
|
|
|
| 52119-38-7 |
ethyl-3-(m-nitrophenyl)-3-oxopropionat |
Mut3;R40 |
|
* |
|
|
| 52136-23-9 |
2-[(4-amino-2-methoxyphenyl)amino]-5-[(2-hydroxyethyl)amino]-2,5-cyclohexa-2,5-dien-1,4-dion |
Mut3;R40 |
|
* |
|
|
| 52188-20-2 |
2-(3,3-diethoxy-2-methylpropyl)bicyclo[2.2.1]heptan |
N;R50/53 |
|
* |
|
|
| 52251-71-5 |
2-ethylanthracen |
N;R50/53 |
|
* |
|
|
| 52301-18-5 |
tri(isopropenyloxy)phenylsilan |
N;R50/53 |
* |
|
|
|
| 52364-70-2 |
4'-(2-methylbutoxy)[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 52364-71-3 |
4'-(pentyloxy)[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 52364-72-4 |
4'-(heptyloxy)[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 52365-48-7 |
1,5(og 1,8)-diamino-4,8(og 4,5)-dihydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 52427-13-1 |
4-(1-ethyl-1-methylhexyl)phenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 52432-72-1 |
oxeladindihydrogencitrat- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 52434-90-9 |
1,3,5-tris(2,3-dibrompropyl)-1,3,5-triazin-2,4,6(1H,3H,5H)-trion |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 52435-87-7 |
methyl-4-[1-(acetoxy)-3-oxo-1H,3H-naphtho[1,8-cd]pyran-1-yl]-1-hydroxy-2-naphthoat |
N;R50/53 |
|
* |
|
|
| 52514-66-6 |
2-methoxy-4-(4,4,6-trimethyl-1,3-dioxan-2-yl)phenol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 52514-67-7 |
2-ethoxy-4-(4,4,6-trimethyl-1,3-dioxan-2-yl)phenol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 52548-96-6 |
2-phenylthio-5-trifluormethylbenzoesyre |
R43 N;R50/53 |
|
* |
|
|
| 52562-19-3 |
2-isopropenylanilin |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 52567-96-1 |
3,6,7-trimethyloct-6-en-1-yn-3-ol |
N;R50/53 |
|
* |
|
|
| 52661-56-0 |
(E)-3-(5-nitro-2-furyl)acrylaldehyd |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 52664-35-4 |
tris(4-aminophenyl)thiophosphat |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 52695-54-2 |
3-[[4-[(2-ethoxy-5-methylphenyl)azo]-1-naphthyl]azo]benzensulfonsyre |
Mut3;R40 |
|
* |
|
|
| 52709-83-8 |
4'-butyl[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 52709-86-1 |
4'-propoxy[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 52709-87-2 |
4'-butoxy[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 52718-49-7 |
ethyl-3,7,12-trioxo-5betacholan-24-oat |
N;R50/53 |
|
* |
|
|
| 52718-76-0 |
1-butyl-4-methylnaphthalen |
N;R50/53 |
|
* |
|
|
| 52723-96-3 |
(4-methyl-1,3-phenylen)bis[iminocarbonyloxy(2-methyl-2,1-ethandiyl)]diacrylat |
Xn;R22 Mut3;R40 N;R50 |
|
* |
|
|
| 52729-03-0 |
2,4-dichlor-3,5-dinitrobenzoesyre |
R43 N;R50/53 |
|
* |
|
|
| 52735-98-5 |
4-[(2-chlor-4-nitrophenyl)azo]anilin |
Carc3;R40 R43 |
|
* |
|
|
| 52740-90-6 |
1-amino-N-(3-brom-9,10-dihydro-9,10-dioxo-2-anthryl)-9,10-dihydro-9,10-dioxoanthracen-2-carboxamid |
N;R50/53 |
|
* |
|
|
| 52762-69-3 |
4-[4-(tert-butyl)-2-cyclopentylphenoxy]butylamin |
R43 N;R50/53 |
|
* |
|
|
| 52794-34-0 |
tetradecahydro-1,4:5,8:9,10-trimethylanthracen-2-methylamin |
R43 N;R50/53 |
|
* |
|
|
| 52794-79-3 |
N,N-bis(2-hydroxyethyl)isooctadecan-1-amid |
R43 N;R50/53 |
|
* |
|
|
| 52811-80-0 |
4-propylphenyl-4-[(1-oxohexyl)oxy]benzoat |
N;R50/53 |
|
* |
|
|
| 52821-24-6 |
2-(3-hydroxypropyl)-6-[(3-hydroxypropyl)amino]-1H-benz[de]isoquinolin-1,3(2H)-dion |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 52830-80-5 |
3-[2,4-bis(dimethylamino)phenyl]-3-[4-(diethylamino)-o-tolyl]phthalid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 52849-47-5 |
2-(2-hydroxyethoxy)ethylmyristat |
N;R50/53 |
|
* |
|
|
| 52857-30-4 |
benzyl-p-cresol |
R43 N;R50/53 |
|
* |
|
|
| 52869-31-5 |
1-[[4-(dimethylamino)phenyl]amino]-4-hydroxyanthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 52888-80-9 |
S-benzyl-N,N-dipropylthiocarbamat |
Xn;R22-48/22 N;R51/53 |
* |
|
|
|
| 52898-18-7 |
N-[3-(dodecyloxy)propyl]propan-1,3-diamin |
R43 N;R50/53 |
|
* |
|
|
| 52918-63-5 |
deltamethrin |
T;R23/25 N;R50/53 |
* |
|
|
|
| 52936-64-8 |
(3beta,4alpha,16alpha)-3,16,23-trihydroxyolean-12-en-28-syre |
N;R50/53 |
|
* |
|
|
| 52938-91-7 |
2,4-dicyclopentylphenol |
R43 N;R50/53 |
|
* |
|
|
| 53004-93-6 |
2-(isopropyl)-5-methylcyclohexyl-2-methylbutyrat |
N;R50/53 |
|
* |
|
|
| 53061-21-5 |
14-(p-isooctylphenoxy)-3,6,9,12-tetraoxatetradecan-1-ol |
N;R50/53 |
|
* |
|
|
| 53067-74-6 |
5-ethyl-3,4-dihydro-4,4-diphenyl-2H-pyrrol |
N;R50/53 |
|
* |
|
|
| 53075-50-6 |
(bicyclo[2.2.1]hept-2-yl)methylbenzoat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 53092-64-1 |
2,2''-dimethyl-p-terphenyl |
N;R50/53 |
|
* |
|
|
| 53097-59-9 |
2,3,4,5,6-pentabromstyren |
R43 N;R50/53 |
|
* |
|
|
| 53097-60-2 |
pentabrom(2-bromethyl)benzen |
N;R50/53 |
|
* |
|
|
| 53172-03-5 |
1-(4-hydroxy-3-methoxyphenyl)nonan-3-on |
N;R50/53 |
|
* |
|
|
| 53304-43-1 |
4,11-diamino-2-(2,3-diphenylpropyl)-1H-naphth[2,3-f]isoindol-1,3,5,10(2H)-tetron |
N;R50/53 |
|
* |
|
|
| 53348-04-2 |
9,10-phenanthrendiamin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 53384-42-2 |
dimethyl-4,4'-[1,2-ethandiylbis(oxy)]bis[3-chlorbenzoat] |
R43 N;R50/53 |
|
* |
|
|
| 53398-86-0 |
(E)hex-2-enylhexanoat |
N;R50/53 |
|
* |
|
|
| 53404-10-7 |
2-ethyl-4-methylpentyl-2-(2,4,5-trichlorphenoxy)propionat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 53404-14-1 |
1-methylheptyl-2-(2,4,5-trichlorphenoxy)propionat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 53404-76-5 |
2-ethylhexyl-2-(2,4,5-trichlorphenoxy)propionat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 53405-97-3 |
1,1-diethoxyundecan |
N;R50/53 |
|
* |
|
|
| 53445-36-6 |
bis(oxiranylmethyl)-2,2,4(og 2,4,4)-trimethyladipat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 53449-58-4 |
ciclonicat- |
R43 N;R50/53 |
|
* |
|
|
| 53464-72-5 |
diethyl[8-(3,4,5-trimethoxybenzoyloxy)octyl]ammoniumchlorid |
R43 N;R50/53 |
|
* |
|
|
| 53469-21-9 |
Aroclor 1242 |
|
|
|
|
* |
| 53512-10-0 |
4-hydroxy-1,5-naphthyridin-3-carboxylsyre |
Mut3;R40 R43 |
|
* |
|
|
| 53531-57-0 |
4-methyl-2,6-diphenylpyridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 53537-62-5 |
3(og-5)-chlor[1,1'-biphenyl]-2-ol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 53542-36-2 |
2-[(3-fluorphenyl)thio]-5-(trifluormethyl)benzoesyre |
N;R50/53 |
|
* |
|
|
| 53558-25-1 |
1-(4-nitrophenyl)-3-(3-pyridylmethyl)urinstof |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 53591-98-3 |
2-brom-4-fluor-1,1'-biphenyl |
Xn;R22 N;R50/53 |
|
* |
|
|
| 53622-39-2 |
N-(isopropyl)naphthalen-2-amin |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 53714-39-9 |
2,2'-[sulfonylbis[(2,6-dibrom-4,1-phenylen)oxy]]bisethanol |
R43 N;R50/53 |
|
* |
|
|
| 53733-94-1 |
methyl-N-(3-methoxy-3-oxopropyl)-N-phenyl-beta-alaninat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 53735-50-5 |
2-propyl-2-heptenylacetat |
N;R50/53 |
|
* |
|
|
| 53815-85-3 |
2-[2-(1-naphthylamino)ethoxy]ethanol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 53816-99-2 |
4,6-bis(1-phenylethyl)-m-xylen |
N;R50/53 |
|
* |
|
|
| 53817-39-3 |
N-butyl-N-(2-chlorethyl)anilin |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 53837-34-6 |
6,10-dimethylundeca-5,9-dien-2-ol |
N;R50/53 |
|
* |
|
|
| 53859-10-2 |
4-(4-chlorbenzhydryl)-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]piperazindiyliummaleat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 53874-66-1 |
1-(chlormethyl)-3-phenoxybenzen |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R51/5 |
|
* |
|
|
| 53874-67-2 |
1-(dibrommethyl)-3-phenoxybenzen |
N;R50/53 |
|
* |
|
|
| 53880-51-6 |
(8E,10E)-dodeca-8,10-dienylacetat |
N;R50/53 |
|
* |
|
|
| 53892-69-6 |
4-methyl-6-(2,6,6-trimethylcyclohex-1-en-1-yl)hexa-2,4-dienal |
R43 N;R50/53 |
|
* |
|
|
| 53892-71-0 |
2,6-dimethyl-8-(2,6,6-trimethyl-1-cyclohexen-1-yl)octa-2,4,6-trienal |
N;R50/53 |
|
* |
|
|
| 53911-35-6 |
3-phenyl-4-propylpyridin |
N;R50/53 |
|
* |
|
|
| 53939-27-8 |
(Z)-tetradec-9-enal |
N;R50/53 |
|
* |
|
|
| 53940-49-1 |
2-methoxy-4-(oxiranylmethyl)phenol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 54004-34-1 |
3,4-dihydro-2,5-dimethyl-2H-pyran-2-methanol |
N;R50/53 |
|
* |
|
|
| 54009-73-3 |
4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-2-hydroxy-10-(trifluormethyl)undecyldihydrogenphosphat |
N;R50/53 |
|
* |
|
|
| 54024-22-5 |
desogestrel- |
N;R50/53 |
|
* |
|
|
| 54060-31-0 |
1,3-bis(3-nitrophenoxy)benzen |
N;R50/53 |
|
* |
|
|
| 54079-53-7 |
[[4-[[2-(4-cyclohexylphenoxy)ethyl]ethylamino]-2-methylphenyl]methylen]malononitril |
N;R50/53 |
|
* |
|
|
| 54079-60-6 |
[[4-[[2-(2-cyclohexylphenoxy)ethyl]ethylamino]-2-methylphenyl]methylen]malononitril |
N;R50/53 |
|
* |
|
|
| 54106-40-0 |
o-(o-nitrophenoxy)toluen |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 54112-23-1 |
N,N'-(methylendi-p-phenylen)bis[hexahydro-2-oxo-1H-azepin-1-carboxamid] |
N;R50/53 |
|
* |
|
|
| 54200-50-9 |
[1R-(1alpha,4abeta,4balpha,10aalpha)]-1,2,3,4,4a,4b,5,6,10,10a-decahydro-7-isopropyl-1,4a-dimethylphenanthren-1-methanolacetat |
N;R50/53 |
|
* |
|
|
| 54208-63-8 |
2,2'-[methylenbis(o-phenylenoxymethylen)]bisoxiran |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 54211-46-0 |
4''-pentyl-p-terphenyl-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 54236-98-5 |
2,4-diamino-5-(methoxymethyl)pyrimidin |
Xn;R22-48/22 Xi;R36 |
* |
|
|
|
| 54243-60-6 |
1-amino-4-hydroxy-2-(4-methoxyphenoxy)anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 54253-62-2 |
kobber(II)methansulfonat |
Xn;R22 Xi;R41 N;R50/53 |
* |
|
|
|
| 54275-93-3 |
(1S,3S,5R,6R)-(4-nitrophenylmethyl)-1-dioxo-6-phenylacetamido-penam-3-carboxylat |
R42 |
* |
|
|
|
| 54288-96-9 |
N-(1,3-dibrom-2-naphthyl)-p-toluensulfonamid |
N;R50/53 |
|
* |
|
|
| 54350-48-0 |
etretinat- |
N;R50/53 |
|
* |
|
|
| 54364-62-4 |
(7Z,9E)-dodeca-7,9-dienylacetat |
N;R50/53 |
|
* |
|
|
| 54395-52-7 |
4,4'-[(isopropyliden)bis(p-phenylenoxy)]bis[N-methylphthalimid] |
R43 N;R50/53 |
|
* |
|
|
| 54914-37-3 |
1,3,3-trimethyl-N-(2-methylpropyliden)-5-[(2-methylpropyliden)amino]cyclohexanmethylamin |
N;R50/53 |
|
* |
|
|
| 54914-85-1 |
1,2-bis(3-methylphenoxy)ethan |
N;R50/53 |
* |
|
|
|
| 54942-74-4 |
2-(4,4-dimethyl-2,5-dioxooxazolidin-1-yl)-2'-chlor-5'-(2-(2,4-di-tert-pentylphenoxy)butyramido)-4,4-dimethyl-3-oxovaleranilid |
E;R2 R53 |
* |
|
|
|
| 54982-76-2 |
4-ethoxy-4-(isopropyl)-1-methylcyclohexen |
N;R50/53 |
|
* |
|
|
| 55066-43-8 |
3,7-dimethyl-2,6-octadienyl-3-methylcrotonat |
N;R50/53 |
|
* |
|
|
| 55117-15-2 |
alpha-2-dichlor-6-fluortoluen |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 55117-80-1 |
1-(p-chlorphenyl)-2-methylpiperazin |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 55162-34-0 |
1-brom-4-(2-chlorethoxy)benzen |
Xn;R22 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 55195-24-9 |
sec-butyldecanoat |
N;R50/53 |
|
* |
|
|
| 55203-76-4 |
4-[[1-ethyl-1,3-dihydro-3,3-dimethyl-5-(phenylsulfonyl)-2H-indol-2-yliden]ethyliden]-3-phenyl-4H-isoxazol-5-on |
N;R50/53 |
|
* |
|
|
| 55285-14-8 |
carbosulfan |
T;R23/25 R43 N;R50/53 |
* |
|
|
|
| 55290-05-6 |
4,4'-ethylenbis[N-(4-methoxybenzyliden)anilin] |
N;R50/53 |
|
* |
|
|
| 55512-33-9 |
pyridat |
Xi;R38 R43 N;R50/53 |
* |
|
|
|
| 55525-54-7 |
3,3'-(ureylendimethylen)bis(3,5,5-trimethylcyclohexyl)diisocyanat |
N;R50/53 |
|
* |
|
|
| 55619-06-2 |
N-(2-chlorethyl)-N-ethyl-4-[(4-nitrophenyl)azo]anilin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 55751-54-7 |
2-sec-butylanilin |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 55912-20-4 |
4-chlor-3-nitrobenzylalkohol |
Mut3;R40 R43 |
|
* |
|
|
| 55937-99-0 |
beclobrat- |
R43 N;R50/53 |
|
* |
|
|
| 55940-73-3 |
oxydipropylendisalicylat- |
R43 N;R50/53 |
|
* |
|
|
| 55965-84-9 |
5-chlor-2-methyl-2H-isothiazol-3-on [EF-nr. 247-500-7],
blanding (3:1) med 2-methyl-2H-isothiazol-3-on [EF-nr. 220-239-6] |
T;R23/24/25 C;R34 R43 N;R50/53 |
* |
|
|
|
| 55990-91-5 |
di(2,3-xylyl)disulfid |
N;R50/53 |
|
* |
|
|
| 55994-13-3 |
m-[(4-amino-m-tolyl)azo]benzensulfonsyre |
Carc3;R40 R43 |
|
* |
|
|
| 56001-43-5 |
(+-)-nerolidylacetat |
N;R50/53 |
|
* |
|
|
| 56073-07-5 |
difenacoum |
Tx;R28 T;R48/25 N;R50/53 |
* |
|
|
|
| 56073-10-0 |
brodifacoum |
Tx;R27/28 T;R48/24/25 N;R50/53 |
* |
|
|
|
| 56148-88-0 |
2-(2-ethylhexyl)-6,7-dimethoxy-1H-benz[de]isoquinolin-1,3(2H)-dion |
Xn;R22 N;R50/53 |
|
* |
|
|
| 56172-46-4 |
(,E)-3,7-dimethyl-2,6-octadienyl-2-butenoat |
N;R50/53 |
|
* |
|
|
| 56181-61-4 |
4-(1-brom-2-phenylethyl)-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 56185-25-2 |
2,5-diethoxy-4-nitroanilin |
Mut3;R40 |
|
* |
|
|
| 56187-92-9 |
2-(1,1-dimethylethyl)-4-(1-methyl-1-phenylethyl)phenol |
N;R50/53 |
|
* |
|
|
| 56219-57-9 |
arildon- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 56219-58-0 |
4-[(6-bromhexyl)oxy]-3-chloranisol |
N;R50/53 |
|
* |
|
|
| 56277-00-0 |
2-hexylcyclopent-2-enylacetat |
N;R50/53 |
|
* |
|
|
| 56281-36-8 |
motretinid- |
N;R50/53 |
|
* |
|
|
| 56296-78-7 |
methyl[3-phenyl-3-[4-(trifluormethyl)phenoxy]propyl]ammoniumchlorid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 56338-00-2 |
4,5-dibrom-2-phenyl-1H-imidazol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 56343-98-7 |
gamma-(4-chlorphenyl)-N,N-dimethyl-2-propylaminpyridinhydrochlorid |
R43 N;R50/53 |
|
* |
|
|
| 56358-17-9 |
N-(2-ethylhexyl)naphthalen-2-amin |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 56358-18-0 |
N-tridecylnaphthalen-2-amin |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 56361-55-8 |
(1-methylethyliden)bis(4,1-phenylenoxy-2,1-ethandiyloxy-2,1-ethandiyl)diacrylat |
N;R50/53 |
|
* |
|
|
| 56416-12-7 |
[(4-nitrophenyl)methyl]ravsyre |
Mut3;R40 |
|
* |
|
|
| 56423-43-9 |
heptylisovalerat- |
N;R50/53 |
|
* |
|
|
| 56428-00-3 |
1,1'-[oxybis(methylen)]bis(4-chlorbenzen) |
R43 N;R50/53 |
|
* |
|
|
| 56430-99-0 |
flumecinol- |
N;R50/53 |
|
* |
|
|
| 56431-19-7 |
alpha-ethyl-2,5-dimethylbenzhydrylalkohol |
N;R50/53 |
|
* |
|
|
| 56442-22-9 |
benzyl-p-(benzyloxy)benzoat |
N;R50/53 |
|
* |
|
|
| 56469-10-4 |
5-(1,1-dimethylheptyl)resorcinol |
R43 N;R50/53 |
|
* |
|
|
| 56471-44-4 |
N-tert-butyl-2-isopropylcycloheptancarboxamid |
N;R50/53 |
|
* |
|
|
| 56471-69-3 |
1-(isopropyl)-N-(4-methoxy-2-methylphenyl)cycloheptancarboxamid |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 56504-94-0 |
1-[(3-hydroxypropyl)amino]-4-(methylamino)anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 56524-76-6 |
1,8-dihydroxy-4,5-bis(methylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 56524-77-7 |
1-amino-4,5-dihydroxy-8-(methylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 56525-86-1 |
4-(1,3-diphenylbutyl)-o-xylen |
N;R50/53 |
|
* |
|
|
| 56558-21-5 |
methylenbis[(2-methyl-4,1-cyclohexandiyl)iminocarbonyloxy(1-methyl-2,1-ethandiyl)]diacrylat |
N;R50/53 |
|
* |
|
|
| 56564-72-8 |
2-methyl-6-(1-methylpropyl)naphthalen |
N;R50/53 |
|
* |
|
|
| 56564-73-9 |
2-methyl-7-(1-methylpropyl)naphthalen |
N;R50/53 |
|
* |
|
|
| 56577-33-4 |
(Z,Z)-trideca-7,11-dien-1-ylacetat |
N;R50/53 |
|
* |
|
|
| 56600-56-7 |
1,6-diamino-7H-benz[de]anthracen-7-on |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 56634-95-8 |
2,6-dibrom-4-cyanphenylheptanoat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 56634-96-9 |
4-cyan-2,6-diiodphenylheptanoat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 56699-32-2 |
(2E,4Z)-deca-2,4-dienylisovalerat |
N;R50/53 |
|
* |
|
|
| 56705-79-4 |
4-(2-cyclohexylphenoxy)anilin |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 56705-83-0 |
4-(o-tolyloxy)anilin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 56718-70-8 |
[[p-(2-methoxyethyl)phenoxy]methyl]oxiran |
Mut3;R40 R43 |
|
* |
|
|
| 56759-60-5 |
2,4,6-tribrom-3,5-dimethylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 56762-23-3 |
(1,2,3-tribrompropyl)benzen |
N;R50/53 |
|
* |
|
|
| 56773-61-6 |
N-ethyl-N-(2-methoxyethyl)-m-toluidin |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 56803-37-3 |
tert-butylphenyldiphenylphosphat |
N;R50/53 |
|
* |
|
|
| 56863-02-6 |
(9Z,12Z)-N,N-bis(2-hydroxyethyl)octadeca-9,12-dien-1-amid |
R43 N;R50/53 |
|
* |
|
|
| 56922-56-6 |
1-(1-phenylethyl)-4-[1-(3,4-xylyl)ethyl]benzen |
N;R50/53 |
|
* |
|
|
| 56922-79-3 |
(Z)-hex-2-enylhexanoat |
N;R50/53 |
|
* |
|
|
| 56943-67-0 |
chlor-7H-benz[de]anthracen-7-on |
Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 56961-77-4 |
1-brom-2,3-dichlorbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 56966-48-4 |
5-chlor-2-(2-chlorphenoxy)anilin |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 56966-52-0 |
5-chlor-2-(2,4-dichlorphenoxy)anilin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 56966-69-9 |
2-chlor-4-nitro-1-phenoxybenzen |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 56975-11-2 |
1,1'-(tetradecylimino)dipropan-2-ol |
R43 N;R50/53 |
|
* |
|
|
| 56983-10-9 |
6-nitro-2-phenylquinolin-4-ol |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 57018-04-9 |
O-(2,6-dichloro-p-tolyl)-O,O-dimethylthiophosphat |
N;R50/53 |
|
* |
|
|
| 57018-12-9 |
2,6-dibrom-4-ethylphenol |
R43 N;R50/53 |
|
* |
|
|
| 57022-74-9 |
(2E,4E)-deca-2,4-dienylisovalerat |
N;R50/53 |
|
* |
|
|
| 57044-25-4 |
(R)-2,3-epoxypropan-1-ol |
Carc2;R45 Rep2;R60 E;R2 Xn;R21/22 T;R23 C;R34 Mut3;R68 |
* |
|
|
|
| 57077-34-6 |
1-(2-hydroxy-p-tolyl)isononan-1-onoxim |
R43 N;R50/53 |
|
* |
|
|
| 57090-94-5 |
6-(1-cyclohexen-1-yl)-1,4-dioxaspiro[4.5]decan |
N;R50/53 |
|
* |
|
|
| 57110-29-9 |
hexahydro-3-methylphthalsyreanhydrid |
Xi;R41 R42/43 |
* |
|
|
|
| 57117-31-4 |
4 2,3,4,7,8 Pentachlorodibenzofuran |
|
|
|
|
* |
| 57122-16-4 |
1,3-bis(isopropyl)naphthalen |
N;R50/53 |
|
* |
|
|
| 57137-50-5 |
N-[2-[(1-methylethyliden)amino]ethyl]-N'-[2-[[2-[(1-methylethyliden)amino]ethyl]amino]ethyl]ethylendiamin |
N;R50/53 |
|
* |
|
|
| 57144-06-6 |
3-methoxyandrosta-3,5-dien-17-on |
N;R50/53 |
|
* |
|
|
| 57147-05-4 |
2,3,5,6-tetrabrom-p-xylen-alpha,alpha'-diyldiacetat |
R43 N;R50/53 |
|
* |
|
|
| 57213-94-2 |
(1-phenylethyl)[1-(3,4-xylyl)ethyl]benzen |
N;R50/53 |
|
* |
|
|
| 57258-90-9 |
ethyl-2,3-dihydro-2-(3-hydroxy-2-quinolyl)-1,3-dioxo-1H-inden-5-carboxylat |
N;R50/53 |
|
* |
|
|
| 57307-46-7 |
dihydro-3-(1,3,5,7-tetramethyl-2-octenyl)furan-2,5-dion |
N;R50/53 |
|
* |
|
|
| 57310-75-5 |
8,8'-[oxybis(ethylenoxyethylenoxy)]diquinolin |
Mut3;R40 |
|
* |
|
|
| 57342-02-6 |
2-ethyl-3-[3-ethyl-5-(4-ethylphenoxy)pentyl]-2-methyloxiran |
N;R50/53 |
|
* |
|
|
| 57356-18-0 |
4-(hexahydro-1H-azepin-1-yl)anilin |
R43 N;R50/53 |
|
* |
|
|
| 57365-08-9 |
2-amino-N-cyclohexyl-N-methylbenzylamin |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 57371-42-3 |
4-allyl-2-methoxyphenylbenzylether |
N;R50/53 |
|
* |
|
|
| 57403-35-7 |
1-chlor-4-(chlormethyl)-2-nitrobenzen |
R43 N;R50/53 |
|
* |
|
|
| 57413-95-3 |
N-octyl-N'-[2-(octylamino)ethyl]ethylendiamin |
N;R50/53 |
|
* |
|
|
| 57417-94-4 |
diacrylsyre, diester med 3,3'-(isopropyliden)bis(p-phenylenoxy)]di(propan-1,2-diol) |
Mut3;R40 N;R50 |
|
* |
|
|
| 57468-27-6 |
N,N'-[oxybis(methylen)]bis[N-phenylanilin] |
Xn;R22 N;R50/53 |
|
* |
|
|
| 57469-07-5 |
[[2-[p-(oxiranylmethoxy)benzyl]phenoxy]methyl]oxiran |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 57477-12-0 |
diethyl-(3-pyridylmethyl)malonat |
Mut3;R40 R43 |
|
* |
|
|
| 57512-44-4 |
7-tert-butyloxepan-2-on |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 57518-95-3 |
2,3,7,8-tetrabrom-1-ethoxyoctan |
Mut3;R40 |
|
* |
|
|
| 57576-09-7 |
isopulegylacetat- |
N;R50/53 |
|
* |
|
|
| 57663-68-0 |
4-tert-butylcyclohexylphenylacetat |
N;R50/53 |
|
* |
|
|
| 57668-61-8 |
1,1'-(4-brombutyliden)bis[4-fluorbenzen] |
Xn;R22 N;R50/53 |
|
* |
|
|
| 57856-81-2 |
allyldecanoat- |
N;R50/53 |
|
* |
|
|
| 57863-93-1 |
2,2'-methylenbis[4,6-dibromphenol] |
R43 N;R50/53 |
|
* |
|
|
| 57908-43-7 |
2,2'-azobis(1,3-dimethylbutyl)diacetat |
N;R50/53 |
|
* |
|
|
| 57913-35-6 |
bis(p-isopropylphenyl)sulfon |
N;R50/53 |
|
* |
|
|
| 57943-75-6 |
N,N-diethyl-4-[[2,5-dimethoxy-4-[(4-nitrophenyl)azo]phenyl]azo]anilin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 57946-56-2 |
4-chlor-2-fluoranilin |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 57966-95-7 |
cymoxanil eller 2-cyan-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamid |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| 57981-60-9 |
(Z,E)-trideca-4,7-dien-1-ylacetat |
N;R50/53 |
|
* |
|
|
| 57981-61-0 |
(Z,E)-trideca-4,7-dien-1-ol |
N;R50/53 |
|
* |
|
|
| 57981-99-4 |
2-chlor-1,4-phenylendiacetat |
Xn;R22 R43 N;R50 |
|
* |
|
|
| 58001-88-0 |
(E)-2,6,10-trimethylundeca-5,9-dienol |
N;R50/53 |
|
* |
|
|
| 58067-54-2 |
tetraethyl-2,2'-[methylenbis(4,1-phenyleniminocarbonyl)]bismalonat |
Mut3;R40 |
|
* |
|
|
| 58077-66-0 |
4,4'-methylenbis(6-chlor-o-cresol) |
R43 N;R50/53 |
|
* |
|
|
| 58090-28-1 |
[[p-(methylsulfonyl)phenoxy]methyl]oxiran |
Mut3;R40 R43 |
|
* |
|
|
| 58104-46-4 |
2,2'-[[3-chlor-4-[(2-chlor-4-nitrophenyl)azo]phenyl]imino]bisethanol |
Carc3;R40 R43 |
|
* |
|
|
| 58105-49-0 |
allyl-2-ethylhexanoat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 58109-32-3 |
2',3-dimethyl[1,1'-biphenyl]-4-aminhydrochlorid |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 58169-99-6 |
2,3,4,6-tetrabrom-m-cresol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 58404-89-0 |
(1alpha,2alpha,5beta,8beta)-4,4,8-trimethyltricyclo[6.3.1.02,5]dodecan-1-ol |
N;R50/53 |
|
* |
|
|
| 58436-15-0 |
1-[(2-aminoethyl)amino]octadecan-2-ol |
R43 N;R50/53 |
|
* |
|
|
| 58437-68-6 |
tetrahydro-2,2,6-trimethyl-6-(4-methyl-3-cyclohexen-1-yl)-2H-pyran-3-ol |
N;R50/53 |
|
* |
|
|
| 58470-12-5 |
4-nitro-2-[[(2,4,6-tripropoxyphenyl)methylen]amino]phenol |
N;R50/53 |
|
* |
|
|
| 58528-60-2 |
2,2'-[[4-[(2,6-dichlor-4-nitrophenyl)azo]-3-methylphenyl]imino]bisethanol |
Carc3;R40 R43 |
|
* |
|
|
| 58535-01-6 |
ethyl-3-ethyl-4,7-dimethyl-2,6-octadienoat |
N;R50/53 |
|
* |
|
|
| 58594-72-2 |
1-[2-(allyloxy)ethyl-2-(2,4-dichlorphenyl)]-1H-imidazoliumhydrogensulfat |
Xn;R20/22 Xi;R41 N;R50/53 |
* |
|
|
|
| 58599-60-3 |
(tetrachlor-1,4-phenylen)bismethylendiacrylat |
R43 N;R50/53 |
|
* |
|
|
| 58599-62-5 |
(tetrachlor-1,3-phenylen)bis(methylen)bismethacrylat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 58599-63-6 |
(tetrachlor-1,4-phenylen)bis(methylen)bismethacrylat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 58600-86-5 |
(+)-4'-(2-methylbutoxy)[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 58641-29-5 |
[1S-(1alpha,2beta,5alpha)]-2-(isopropyl)-5-methylcyclohexylbenzoat |
N;R50/53 |
|
* |
|
|
| 58683-70-8 |
2,4,5-tribromcumen |
R43 N;R50/53 |
|
* |
|
|
| 58683-72-0 |
2,4,5-tribrom-alpha-methylstyren |
R43 N;R50/53 |
|
* |
|
|
| 58743-75-2 |
4'-ethyl[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 58743-76-3 |
4'-propyl[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 58743-78-5 |
4'-ethoxy[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 58763-67-0 |
(E)-12-(1-ethoxyethoxy)dodec-5-en-3-yn |
N;R50/53 |
|
* |
|
|
| 58828-53-8 |
brompentakis(brommethyl)benzen |
R43 N;R50/53 |
|
* |
|
|
| 58834-75-6 |
vanadylpyrophosphat |
Xi;R36 R43 R52/53 |
* |
|
|
|
| 58930-32-8 |
2'-[3-(tert-butylamino)-2-hydroxypropoxy]-5'-fluorbutyrophenon |
Xn;R22 N;R50/53 |
|
* |
|
|
| 58934-46-6 |
N-(4-chlorphenyl)-N-(1-isopropyl-4-piperidyl)phenylacetamidmonohydrochlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 58948-24-6 |
2,2'-oxybis[5,5-dimethyl-4-propyl-1,3,2-dioxaphosphorinan]-2,2'-disulfid |
N;R50/53 |
|
* |
|
|
| 58948-25-7 |
2,2'-oxybis(4-isopropyl-5,5-dimethyl-1,3,2-dioxaphosphorinan)-2,2'-disulfid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 59089-67-7 |
2',4'-difluor[1,1'-biphenyl]-4-ylacetat |
N;R50/53 |
|
* |
|
|
| 59154-46-0 |
ethyl-3-brom-2-methylpropionat |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 59191-99-0 |
N-(5-amino-2-chlorphenyl)-4,4-dimethyl-3-oxovaleramid |
Mut3;R40 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 59192-05-1 |
N-(2,5-dichlorphenyl)-3-hydroxynaphthalen-2-carboxamid |
R43 N;R50/53 |
|
* |
|
|
| 59216-17-0 |
1-(2-bromethyl)-2,4-dibrombenzen |
N;R50/53 |
|
* |
|
|
| 59219-71-5 |
3,5,5-trimethylhexyl-3,5,5-trimethylhexanoat |
N;R50/53 |
|
* |
|
|
| 59227-89-3 |
laurocapram- |
R43 N;R50/53 |
|
* |
|
|
| 59229-75-3 |
4-nitro-2,6-toluendiamin |
Xn;R22 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 59333-65-2 |
1,1'-methylenbis[4-(2,3-epoxypropoxy)cyclohexan] |
Mut3;R40 R43 |
|
* |
|
|
| 59365-30-9 |
4-[([1,1'-biphenyl]-4-yloxy)methyl]-2-(brommethyl)-2-(2,4-dichlorphenyl)-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 59376-58-8 |
undeca-2,4-dienol |
N;R50/53 |
|
* |
|
|
| 59415-01-9 |
ethyl-2,2-dimethyloctanoat |
N;R50/53 |
|
* |
|
|
| 59440-90-3 |
1,2-dichlor-3-[2-chlor-1-(chlormethyl)ethoxy]propan |
Xn;R22 Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 59447-51-7 |
(tetrabrom-1,4-phenylen)bismethylendiacrylat |
R43 N;R50/53 |
|
* |
|
|
| 59447-55-1 |
(pentabromphenyl)methylacrylat |
R43 N;R50/53 |
|
* |
|
|
| 59473-45-9 |
1-(chlormethyl)-2-iodbenzen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 59485-34-6 |
o,o'-dibrombibenzyl |
R43 N;R50/53 |
|
* |
|
|
| 59528-04-0 |
4-[(2,5-dimethoxyphenyl)azo]-N,N-dimethylanilin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 59536-65-1 |
PBBs = Brominated Biphenyls (mixed group of 209 Congeners) |
|
|
|
* |
| 59548-39-9 |
4-methoxybenzen-1,2-diamindihydrochlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 59558-23-5 |
p-tolyloctanoat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 59583-77-6 |
2-[butyl[4-(2,2-dicyanvinyl)-3-methylphenyl]amino]ethyl-(3,4-dichlorphenyl)carbamat |
N;R50/53 |
|
* |
|
|
| 59609-49-3 |
ethyl-3-(2,2-dichlorvinyl)-2,2-dimethyl-1-cyclopropancarboxylat |
Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 59637-41-1 |
2-methyl-4-[(3-methyl-2-butenyl)oxy]but-1-en |
N;R50/53 |
|
* |
|
|
| 59653-74-6 |
1,3,5-tris[(2S og 2R)-2,3-epoxypropyl]-1,3,5-triazin-2,4,6-(1H,3H,5H)-trion |
Mut2;R46 Xn;R22-48/22 T;R23 Xi;R41 R43 |
* |
|
|
|
| 59662-31-6 |
4-hexylbiphenyl |
N;R50/53 |
|
* |
|
|
| 59778-15-3 |
3-(2,3-dibrompropoxy)propan-1,2-diol |
Mut3;R40 |
|
* |
|
|
| 59820-63-2 |
2-[3-(methylamino)-4-nitrophenoxy]ethanol |
Mut3;R40 |
|
* |
|
|
| 59846-11-6 |
(9Z,12Z,15Z)-N,N-bis(2-hydroxyethyl)-9,12,15-octadecatrienamid |
R43 N;R50/53 |
|
* |
|
|
| 59854-97-6 |
4-(5-heptylpyrimidin-2-yl)benzonitril |
N;R50/53 |
|
* |
|
|
| 59855-05-9 |
4-(5-pentylpyrimidin-2-yl)benzonitril |
Xn;R22 N;R50/53 |
|
* |
|
|
| 59897-93-7 |
methyl-cis-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
Carc3;R40 N;R51/53 |
|
* |
|
|
| 59897-94-8 |
methyl-trans-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
Carc3;R40 N;R51/53 |
|
* |
|
|
| 59917-57-6 |
2,2'-methylenbis[4,6-bis[(dimethylamino)methyl]phenol] |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 60045-27-4 |
3-phenylpropyl-3-phenylpropionat |
N;R50/53 |
|
* |
|
|
| 60066-53-7 |
ethyl-4,6,6,6-tetrachlor-3,3-dimethylhexanoat |
N;R50/53 |
|
* |
|
|
| 60078-97-9 |
4,5-dihydro-1-phenyl-3-(2,4,6-trimethylphenyl)-1H-pyrazol |
R43 N;R50/53 |
|
* |
|
|
| 60143-59-1 |
4-(2-chlorphenylazo)-2,5-dimethoxyanilin |
Carc3;R40 R43 |
|
* |
|
|
| 60160-25-0 |
4-(1-phenylethyl)-N-[4-(1-phenylethyl)phenyl]anilin |
N;R50/53 |
|
* |
|
|
| 60160-75-0 |
N,N-dimethylbenzen-1,4-diammoniumsulfat |
Xn;R22 Mut3;R40 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 60168-88-9 |
fenarimol eller 2,4'-dichlor-?-(pyrimidin-5-yl)benzhydrylalkohol |
Rep3;R62-63 R64 N;R51/53 |
* |
|
|
|
| 60241-55-6 |
alpha,beta,2,2,6-pentamethylcyclohexylpropylacetat |
N;R50/53 |
|
* |
|
|
| 60254-15-1 |
ethyl-trans-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 60313-31-7 |
4-brom-4'-(1-brom-2-phenylethyl)-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 60316-43-0 |
1,8-bis(methylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 60354-42-9 |
methyl-(5beta,7alpha)-7-acetoxy-3,12-dioxocholan-24-oat |
N;R50/53 |
|
* |
|
|
| 60459-10-1 |
4,4'-[(2-chlorphenyl)methoxymethylen]bis[N-ethyl-o-toluidin] |
Xn;R22 N;R50/53 |
|
* |
|
|
| 60468-47-5 |
bis(oxiranylmethyl)oxalat |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 60468-48-6 |
bis(2,3-epoxypropyl)malonat |
Mut3;R40 R43 |
|
* |
|
|
| 60487-81-2 |
[bis[(3-phenylallyl)oxy]methyl]vinylbenzen |
R43 N;R50/53 |
|
* |
|
|
| 60501-41-9 |
(Z)-[(octadec-9-enyloxy)methyl]oxiran |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 60526-81-0 |
5-(1,1-dimethylheptyl)-1,3-dimethoxybenzen |
R43 N;R50/53 |
|
* |
|
|
| 60568-05-0 |
furmecyclox eller N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamid |
Carc3;R40 N;R50/53 |
* |
|
|
|
| 60568-54-9 |
4-[[2-acetamido-4-(diethylamino)phenyl]azo]benzoesyre |
Mut3;R40 R43 |
|
* |
|
|
| 60593-02-4 |
2-(pentabromphenoxy)ethanol |
R43 N;R50/53 |
|
* |
|
|
| 60613-17-4 |
2,3,5-trichlor-4-(propylthio)pyridin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 60618-05-5 |
1,5-bis[4-(2,3-epoxypropyloxy)phenyl]penta-1,4-dien-3-on |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 60628-96-8 |
bifonazol- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 60640-92-8 |
N-[4,6-bis(allyloxy)-1,3,5-triazin-2-yl]-N'-phenylbenzen-1,4-diamin |
R43 N;R50/53 |
|
* |
|
|
| 60671-78-5 |
tetradec-9-enal |
N;R50/53 |
|
* |
|
|
| 60682-94-2 |
2-ethoxyethylchloracetat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 60683-03-6 |
diethyl-3,3'-(vinylendi-4,1-phenylen)bisacrylat |
N;R50/53 |
|
* |
|
|
| 60741-51-7 |
2,4-dichlor-6-methyl-3-(1-methylethyl)phenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 60763-41-9 |
2-diethoxymethyl-1-phenylhept-1-en |
N;R50/53 |
|
* |
|
|
| 60784-46-5 |
elmustin- |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 60811-21-4 |
4-brom-2-chlorfluorbenzen |
Xn;R22 Xi;R38 N;R50/53 |
* |
|
|
|
| 60998-24-5 |
trideca-2,4-dienal |
N;R50/53 |
|
* |
|
|
| 61002-53-7 |
(2,6-dichlorphenyl)(4-hydroxyphenyl)keton |
R43 N;R50/53 |
|
* |
|
|
| 61099-36-3 |
dihydro-5-(5-methoxy-1,5-dimethylhexyl)furan-2(3H)-on |
Xn;R22 Mut3;R40 R52/53 |
|
* |
|
|
| 61203-99-4 |
trans-4-(4-propylcyclohexyl)benzonitril |
N;R50/53 |
|
* |
|
|
| 61204-00-0 |
trans-4-(4-butylcyclohexyl)benzonitril |
N;R50/53 |
|
* |
|
|
| 61204-01-1 |
trans-4-(4-pentylcyclohexyl)benzonitril |
N;R50/53 |
|
* |
|
|
| 61204-03-3 |
trans-4-(4-heptylcyclohexyl)benzonitril |
N;R50/53 |
|
* |
|
|
| 61355-92-8 |
methyl-N-[3-(acetylamino)-4-[(4-nitrophenyl)azo]phenyl]-N-(3-methoxy-3-oxopropyl)-beta-alaninat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 61389-12-6 |
(E,Z)-trideca-4,7-dien-1-ylacetat |
N;R50/53 |
|
* |
|
|
| 61432-55-1 |
S-(1-methyl-1-phenylethyl)piperidin-1-carbothioat |
Xn;R22 N;R51/53 |
* |
|
|
|
| 61444-39-1 |
(Z)-hex-3-enylheptanoat |
N;R50/53 |
|
* |
|
|
| 61531-45-1 |
pentylnonan-1-oat |
N;R50/53 |
|
* |
|
|
| 61565-21-7 |
(E)-6-(1-ethoxyethoxy)hex-2-en-1-ol |
N;R50/53 |
|
* |
|
|
| 61565-22-8 |
(E)-1-chlor-6-(1-ethoxyethoxy)hex-2-en |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 61565-23-9 |
(E)-(1-ethoxyethoxy)tridec-4-en-7-yn |
N;R50/53 |
|
* |
|
|
| 61578-04-9 |
[[4-(alpha,alpha-dimethylbenzyl)phenoxy]methyl]oxiran |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 61585-90-8 |
benzhydryl-2-(benzothiazol-2-yldithio)-alpha-(isopropenyl)-4-oxo-3-[(phenoxyacetyl)amino]azetidin-1-acetat |
N;R50/53 |
|
* |
|
|
| 61702-43-0 |
natrium-2-amino-4-nitrophenoxid |
Carc3;R40 R43 |
|
* |
|
|
| 61702-45-2 |
natrium-2-hydroxy-9H-carbazol-3-carboxylat |
Mut3;R40 R43 |
|
* |
|
|
| 61702-91-8 |
(tert-butyl)quinolin |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 61747-35-1 |
2,2'-dithiobis(4-tert-butyl-1-isopropyl-1H-imidazol) |
N;R50/53 |
|
* |
|
|
| 61788-44-1 |
Phenol, styrenated |
|
|
|
* |
|
| 61792-12-9 |
cinnamyl-2-methylcrotonat |
N;R50/53 |
|
* |
|
|
| 61813-46-5 |
5-amino-8-(phenylazo)naphthol |
Carc3;R40 |
|
* |
|
|
| 61827-64-3 |
2-ethylhexyl-2-methylpropylphthalat |
N;R50/53 |
|
* |
|
|
| 61827-75-6 |
3-[(4-amino-5-methoxy-o-tolyl)azo]naphthalen-1,5-disulfonsyre |
Mut3;R40 |
|
* |
|
|
| 61898-95-1 |
methyl-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
Carc3;R40 N;R51/53 |
|
* |
|
|
| 61931-64-4 |
3-(acetylamino)-N-(7-hydroxy-1-naphthyl)benzamid |
Mut3;R40 R43 |
|
* |
|
|
| 61931-72-4 |
4-(2,5-xylylazo)-o-toluidin |
Carc3;R40 R43 |
|
* |
|
|
| 61931-78-0 |
(E)-2,6-dimethylocta-1,5,7-trien-3-ylacetat |
N;R50/53 |
|
* |
|
|
| 61931-82-6 |
N-(1,3-dimethylbutyl)-N-phenylbenzen-1,4-diamin |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 61994-66-9 |
2-[ethyl[3-methyl-4-[(4-nitrophenyl)azo]phenyl]amino]ethanol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 62047-27-2 |
1-[(2-chlorethyl)thio]-2-nitrobenzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 62103-09-7 |
1,1,1,3-tetrachlor-4-methylpentan |
N;R50/53 |
|
* |
|
|
| 62199-62-6 |
2,2,4,4,6-pentamethylheptan |
N;R50/53 |
|
* |
|
|
| 62257-17-4 |
N-[5-[bis(2-hydroxyethyl)amino]-2-[(2-chlor-4-nitrophenyl)azo]phenyl]acetamid |
Carc3;R40 R43 |
|
* |
|
|
| 62265-99-0 |
2,6-dibrom-3-methyl-4-nitroanisol |
R43 N;R50/53 |
|
* |
|
|
| 62268-71-7 |
1-cyclohexyl-4-hexylbenzen |
N;R50/53 |
|
* |
|
|
| 62418-35-3 |
1,4-dihydroxy-2-[(2-methoxyethyl)amino]anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 62433-26-5 |
4'-chlor-5-fluor-2-hydroxybenzophenon |
N;R50/53 |
|
* |
|
|
| 62439-33-2 |
p-cyanphenyl-trans-4-propylcyclohexancarboxylat |
N;R50/53 |
|
* |
|
|
| 62439-35-4 |
p-cyanphenyl-trans-4-pentylcyclohexancarboxylat |
N;R50/53 |
|
* |
|
|
| 62476-59-9 |
acifluorfen-natrium eller natrium-5-[2-chlor-4-(trifluormethyl)phenoxy]-2-nitrobenzoat |
Xn;R22 Xi;R38-41 N;R50/53 |
* |
|
|
|
| 62478-82-4 |
N,N-diethyl-,N',N'-dimethylpropan-1,3-diamin |
R10 Xn;R20/22-48/20 C;R35 R52/53 |
* |
|
|
|
| 62554-36-3 |
phenyl-1-hydroxy-4-(4-nitrophenoxy)-2-naphthoat |
N;R50/53 |
|
* |
|
|
| 62601-17-6 |
pentachlor[(chlormethyl)thio]benzen |
N;R50/53 |
|
* |
|
|
| 62610-77-9 |
methacrifos eller methyl-(E)-3-[(dimethoxyphosphinothioyl)oxy]methacrylat |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| 62637-91-6 |
kalium ethyl-2-[(3,5-dibrom-4-oxidophenyl)(3,5-dibrom-4-oxo-2,5-cyclohexadien-1-yliden)methyl]benzoat |
N;R50/53 |
|
* |
|
|
| 62924-70-3 |
flumetralin |
Xi;R36/38 R43 N;R50/53 |
* |
|
|
|
| 63021-23-8 |
bis(2-butoxyethyl)azelat |
N;R50/53 |
|
* |
|
|
| 63025-02-5 |
(Z,E)-tetradeca-9,11-dien-1-ol |
N;R50/53 |
|
* |
|
|
| 63059-55-2 |
2-[2,4-di-tert-pentylphenoxy]hexanoylchlorid |
N;R50/53 |
|
* |
|
|
| 63133-78-8 |
5-(acetylamino)-1-hydroxy-2-naphthoesyre |
Mut3;R40 R43 |
|
* |
|
|
| 63133-91-5 |
4-hydroxyphenyloctanoat |
R43 N;R50/53 |
|
* |
|
|
| 63133-94-8 |
N-[2-[[4-[(2-chlor-4-nitrophenyl)azo]-m-tolyl]ethylamino]ethyl]phthalimid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 63134-04-3 |
N-[3-(ethylamino)-4-methylphenyl]acetamid |
Carc3;R40 R43 |
|
* |
|
|
| 63134-14-5 |
2-ethylamino-4-aminotoluen |
Carc3;R40 R43 |
|
* |
|
|
| 63134-28-1 |
N-(o-methoxyphenyl)-3-(m-nitrophenyl)-3-oxopropionamid |
Mut3;R40 |
|
* |
|
|
| 63134-33-8 |
p-[[p-benzyloxyphenyl]sulfonyl]phenol |
R43 N;R50/53 |
|
* |
|
|
| 63134-34-9 |
N-(2,4-dichlorphenyl)-4,4-dimethyl-3-oxovaleramid |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 63142-56-3 |
ethyl-cis-(±)-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 63142-57-4 |
ethyl-trans-(±)-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
Mut3;R40 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 63163-95-1 |
5-amino-1-hydroxy-2-naphthoesyrehydrochlorid |
Mut3;R40 |
|
* |
|
|
| 63163-96-2 |
N-(2-chlor-5-nitrophenyl)-4,4-dimethyl-3-oxovaleramid |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 63216-89-7 |
2-benzo[f]quinolin-3-yl-1H-inden-1,3(2H)-dion |
N;R50/53 |
|
* |
|
|
| 63216-98-8 |
4-[(p-aminophenyl)azo]-m-cresol |
Carc3;R40 R43 |
|
* |
|
|
| 63405-85-6 |
natrium-3-[[3-methoxy-4-[(4-methoxyphenyl)azo]phenyl]azo]benzensulfonat |
Mut3;R40 |
|
* |
|
|
| 63449-41-2 |
kvaternære ammoniumforbindelser, benzyl-C8-18-alkyldimethyl-,
chlorider |
Xn;R21/22 C;R34 N;R50 |
* |
|
|
|
| 63449-52-5 |
stilben-4,4'-diyldiacetat |
N;R50/53 |
|
* |
|
|
| 63449-89-8 |
4,4,6-trimethyl-2-pentyl-1,3-dioxan |
N;R50/53 |
|
* |
|
|
| 63450-78-2 |
ethyl-2-[bis(4-hydroxyphenyl)methyl]benzoat |
R43 N;R50/53 |
|
* |
|
|
| 63451-40-1 |
4-(phenylimino)cyclohexa-2,5-dien-1-onoxim, natriumsalt |
Mut3;R40 R43 |
|
* |
|
|
| 63466-98-8 |
1,4-bis[(2-methoxyethyl)amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 63466-99-9 |
1-[(2-hydroxyethyl)amino]-4-[(2-methoxyethyl)amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 63467-05-0 |
2-[[2-methyl-4-[(4-nitrophenyl)azo]phenyl]amino]ethanol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 63467-07-2 |
2,2'-[[4-[(2,6-dichlor-4-nitrophenyl)azo]phenyl]imino]bisethanol |
Carc3;R40 R43 |
|
* |
|
|
| 63467-18-5 |
N-[2-[(3-chlor-4-nitrophenyl)azo]-5-[[2-(2,5-dioxo-1-pyrrolidinyl)ethyl]ethylamino]phenyl]acetamid |
Carc3;R40 R43 |
|
* |
|
|
| 63617-61-8 |
4-[5-(4-butylphenyl)pyrimidin-2-yl]benzonitril |
Xn;R22 N;R50/53 |
|
* |
|
|
| 63734-62-3 |
3-[2-chlor-4-(trifluormethyl)phenoxy]benzoesyre |
Xn;R22 N;R50/53 |
|
* |
|
|
| 63738-22-7 |
N,N,N',N'-tetrakis(2,3-epoxypropyl)-m-xylen-alpha,alpha'-diamin |
Carc3;R40 R43 |
|
* |
|
|
| 63799-11-1 |
(S)-4'-(2-methylbutyl)[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 63905-29-3 |
bis(cyclohex-3-enylmethyl)adipat |
N;R50/53 |
|
* |
|
|
| 63919-26-6 |
dinocton eller (4-isooctyl-2,6-dinitrophenyl)methylcarbonat,
isomerblanding med (6-isooctyl-2,4-dinitrophenyl)methylcarbonat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 64022-61-3 |
tetrakis(2,2,6,6-tetramethyl-4-piperidyl)butan-1,2,3,4-tetracarboxylat |
N;R50/53 |
|
* |
|
|
| 64050-16-4 |
2-[2,4-bis(1,1-dimethylpropyl)phenoxy]ethylacrylat |
N;R50/53 |
|
* |
|
|
| 64071-87-0 |
3-[(2-chlor-4-nitrophenyl)azo]-9H-carbazol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 64123-46-2 |
1-ethyl-2-(methoxymethyl)-4-nitrobenzen |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 64123-64-4 |
2-(chlormethyl)-1-(1-methylethyl)-4-nitrobenzen |
R43 N;R50/53 |
|
* |
|
|
| 64131-85-7 |
O,O,O-tris(4-nitrophenyl)thiophosphat |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 64240-65-9 |
4-[(2-methylbutoxy)carbonyl]phenyl-4-(hexyloxy)benzoat |
N;R50/53 |
|
* |
|
|
| 64346-07-2 |
di(3,4-xylyl)disulfid |
N;R50/53 |
|
* |
|
|
| 64346-28-7 |
4,4'-diamino-2''-chlor-3,3'-dimethyltritylalkohol |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 64346-55-0 |
2,2'-[cyclohexan-1,2-diylbis(nitrilomethylidyn)]bisphenol |
N;R50/53 |
|
* |
|
|
| 64346-56-1 |
2,3-xylyl-2,5-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 64346-57-2 |
2,5-xylyl-3,4-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 64365-65-7 |
4,4'-diamino-2'',6''-dichlor-3,3',5,5'-tetramethyltritylalkohol |
R43 N;R50/53 |
|
* |
|
|
| 64381-97-1 |
N,N,N'-tris(1-methylpropyl)benzen-1,4-diamin |
R43 N;R50/53 |
|
* |
|
|
| 64408-93-1 |
(S)-(4-cyanphenyl)-4-pentylthiobenzoat |
N;R50/53 |
|
* |
|
|
| 64641-84-5 |
4-(1-methyl-1-phenylethyl)phenylbenzoat |
N;R50/53 |
|
* |
|
|
| 64653-59-4 |
2-ethyl-N-(2-ethylphenyl)anilin |
R43 N;R50/53 |
|
* |
|
|
| 64654-00-8 |
bis[2-[bis(2-hydroxyethyl)amino]ethyl]icosenylsuccinat |
R43 N;R50/53 |
|
* |
|
|
| 64667-33-0 |
methyl-4,6,6,6-tetrachlor-3,3-dimethylhexanoat |
N;R50/53 |
|
* |
|
|
| 64683-27-8 |
bis[2-[bis(2-hydroxyethyl)amino]ethyl]-2-octadecenylsuccinat |
R43 N;R50/53 |
|
* |
|
|
| 64741-45-3 |
rester (råolie), atmosfærisk tårn |
Carc2;R45 |
* |
|
|
|
| 64741-50-0 |
destillater (råolie), lette paraffin- |
Carc1;R45 |
* |
|
|
|
| 64741-51-1 |
destillater (råolie), tunge paraffin- |
Carc1;R45 |
* |
|
|
|
| 64741-52-2 |
destillater (råolie), lette naphthen- |
Carc1;R45 |
* |
|
|
|
| 64741-53-3 |
destillater (råolie), tunge naphthen- |
Carc1;R45 |
* |
|
|
|
| 64741-57-7 |
gasolier (råolie), tunge vakuum |
Carc2;R45 |
* |
|
|
|
| 64741-59-9 |
destillater (råolie), lette katalytisk krakkede |
Carc2;R45 |
* |
|
|
|
| 64741-60-2 |
destillater (råolie), intermediære katalytisk
krakkede |
Carc2;R45 |
* |
|
|
|
| 64741-61-3 |
destillater (råolie), tunge katalytisk krakkede |
Carc2;R45 |
* |
|
|
|
| 64741-62-4 |
klarede olier (råolie), katalytisk krakkede |
Carc2;R45 |
* |
|
|
|
| 64741-67-9 |
rester (råolie), katalytisk reformer-fraktionator |
Carc2;R45 |
* |
|
|
|
| 64741-75-9 |
rester (råolie), hydrokrakkede |
Carc2;R45 |
* |
|
|
|
| 64741-80-6 |
rester (råolie), termiske krakkede |
Carc2;R45 |
* |
|
|
|
| 64741-81-7 |
destillater (råolie), tunge termisk krakkede |
Carc2;R45 |
* |
|
|
|
| 64741-82-8 |
destillater (råolie), lette termisk krakkede |
Carc2;R45 |
* |
|
|
|
| 64742-03-6 |
ekstrakter (råolie), let naphthendestillat solvent |
Carc2;R45 |
* |
|
|
|
| 64742-04-7 |
ekstrakter (råolie), tungt paraffindestillat solvent |
Carc2;R45 |
* |
|
|
|
| 64742-05-8 |
ekstrakter (råolie), let paraffindestillat solvent |
Carc2;R45 |
* |
|
|
|
| 64742-11-6 |
ekstrakter (råolie), tungt naphthendestillat solvent |
Carc2;R45 |
* |
|
|
|
| 64742-18-3 |
destillater (råolie), syrebehandlede tunge naphthen- |
Carc1;R45 |
* |
|
|
|
| 64742-19-4 |
destillater (råolie), syrebehandlede lette naphthen- |
Carc1;R45 |
* |
|
|
|
| 64742-20-7 |
destillater (råolie), syrebehandlede tunge paraffin- |
Carc1;R45 |
* |
|
|
|
| 64742-21-8 |
destillater (råolie), syrebehandelde lette paraffin- |
Carc1;R45 |
* |
|
|
|
| 64742-27-4 |
destillater (råolie), kemisk neutraliserede tunge
paraffin- |
Carc1;R45 |
* |
|
|
|
| 64742-28-5 |
destillater (råolie), kemisk neutraliserede lette
paraffin- |
Carc1;R45 |
* |
|
|
|
| 64742-34-3 |
destillater (råolie), kemisk neutraliserede tunge
naphthen- |
Carc1;R45 |
* |
|
|
|
| 64742-35-4 |
destillater (råolie), kemisk neutraliserede lette
naphthen- |
Carc1;R45 |
* |
|
|
|
| 64742-59-2 |
gasolier (råolie), hydrogenbehandlede vakuum- |
Carc2;R45 |
* |
|
|
|
| 64742-78-5 |
rester (råolie), hydroafsvovlede atmosfærisk
tårn |
Carc2;R45 |
* |
|
|
|
| 64742-86-5 |
gasolier (råolie), hydroafsvovlede tunge vakuum- |
Carc2;R45 |
* |
|
|
|
| 64742-88-7 |
solventnaphtha (råolie), middeltung aliphatisk |
R10 Xn;R48/20-65 |
* |
|
|
|
| 64742-90-1 |
rester (råolie), dampkrakkede |
Carc2;R45 |
* |
|
|
|
| 64800-83-5 |
ethyl(phenylethyl)benzen |
N;R50/53 |
|
* |
|
|
| 64835-63-8 |
4-methyl-4'-pentyl-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 64862-95-9 |
methyl-1-amino-9,10-dihydro-4-[(4-methylphenyl)amino]-9,10-dioxoanthracen-2-carboxylat |
R43 N;R50/53 |
|
* |
|
|
| 64902-72-3 |
chlorsulfuron eller 2-chlor-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]benzensulfonamid |
N;R50/53 |
* |
|
|
|
| 64924-62-5 |
4-heptyl-N-phenylanilin |
R43 N;R50/53 |
|
* |
|
|
| 64969-34-2 |
3,3'-dichlorbenzidin, salte heraf |
Carc2;R45 Xn;R21 R43 N;R50/53 |
* |
|
|
|
| 64969-36-4 |
4,4'-bi-o-toluidin, salte heraf |
Carc2;R45 Xn;R22 N;R51/53 |
* |
|
|
|
| 65000-36-4 |
1-(ethylamino)-4-(methylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 65059-84-9 |
N-[2-[[4-[(2,6-dichlor-4-nitrophenyl)azo]-2-methoxy-5-methylphenyl]azo]-5-(diethylamino)phenyl]acetamid |
Mut3;R40 R43 |
|
* |
|
|
| 65072-55-1 |
2-brom-7H-benz[de]anthracen-7-on |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 65086-99-9 |
4,4'-methylenbis[2-[(4-aminophenyl)methyl]anilin] |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 65087-03-8 |
2,4-xylyl-2,5-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65087-04-9 |
2,4-xylyl-2,6-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65087-05-0 |
2,4-xylyl-3,4-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65087-14-1 |
2,3-xylyl-2,4-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65087-15-2 |
2,3-xylyl-2,6-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65087-16-3 |
2,3-xylyl-3,4-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65087-17-4 |
2,3-xylyl-3,5-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65104-30-5 |
2,4-xylyl-3,5-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65104-31-6 |
2,5-xylyl-2,6-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65104-32-7 |
2,5-xylyl-3,5-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65104-33-8 |
2,6-xylyl-3,4-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65104-34-9 |
2,6-xylyl-3,5-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65104-35-0 |
3,4-xylyl-3,5-xylyldisulfid |
N;R50/53 |
|
* |
|
|
| 65105-01-3 |
1-methylpropan-1,3-diylbis[3-[[[[(sec-butyliden)amino]oxy]carbonyl]amino]tolyl]carbamat] |
N;R50/53 |
|
* |
|
|
| 65122-41-0 |
4,4'-diamino-2''-chlor-2,2'-dimethyltritylalkohol |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 65122-44-3 |
4-[(3-aminophenyl)azo]benzen-1,3-diaminmonoacetat |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 65151-59-9 |
4,4'-[(2,6-dichlorphenyl)methylen]bis[2,6-xylidin] |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 65151-60-2 |
di(3,5-xylyl)disulfid |
N;R50/53 |
|
* |
|
|
| 65208-25-5 |
N-[2-[ethyl[4-[(4-nitrophenyl)azo]phenyl]amino]ethyl]phthalimid |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 65208-34-6 |
phenyl-1-hydroxy-4-nitro-2-naphthoat |
N;R50/53 |
|
* |
|
|
| 65293-90-5 |
2-(3-tert-butyl-4-hydroxyphenoxy)-N-[4-chlor-3-[[4-[(3,4-dimethoxyphenyl)azo]-4,5-dihydro-5-oxo-1-(2,4,6-trichlorphenyl)-1H-pyrazol-3-yl]amino]phenyl]myristamid |
Mut3;R40 |
|
* |
|
|
| 65294-20-4 |
1,1'-[2,2,2-trifluor-1-(trifluormethyl)ethyliden]bis[3,4-dimethylbenzen] |
N;R50/53 |
|
* |
|
|
| 65321-67-7 |
toluen-2,4-diammoniumsulfat |
Carc2;R45 Xn;R21 T;R25 Xi;R36 R43 N;R51/53 |
* |
|
|
|
| 65355-35-3 |
[trans(trans)]-4'-propyl[1,1'-bicyclohexyl]-4-carbonitril |
Xn;R22 N;R50/53 |
|
* |
|
|
| 65355-36-4 |
[trans(trans)]-4'-pentyl[1,1'-bicyclohexyl]-4-carbonitril |
Xn;R22 N;R50/53 |
|
* |
|
|
| 65369-95-1 |
N-[3-[(2-hydroxyethyl)sulfonyl]phenyl]-4-nitrobenzamid |
Mut3;R40 R43 |
|
* |
|
|
| 65405-66-5 |
11,11-dimethoxyundec-1-en |
N;R50/53 |
|
* |
|
|
| 65405-69-8 |
cyclohexylcyclopent-2-en-1-acetat |
N;R50/53 |
|
* |
|
|
| 65405-77-8 |
(Z)-3-hexenylsalicylat |
N;R50/53 |
|
* |
|
|
| 65416-15-1 |
3-methyl-3-pentenylsalicylat |
N;R50/53 |
|
* |
|
|
| 65520-42-5 |
bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl]hydrogenglutarat |
N;R50/53 |
|
* |
|
|
| 65520-46-9 |
bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl]adipat |
N;R50/53 |
|
* |
|
|
| 65652-33-7 |
hexyl-2-methylisocrotonat |
N;R50/53 |
|
* |
|
|
| 65652-42-8 |
dichlor(benzyl)benzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 65652-43-9 |
benzyltrichlorbenzen- |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 65702-23-0 |
3,3,4,4,5,5,6,6,7,7,7-undecafluorheptan-1-sulfonylchlorid |
N;R50/53 |
|
* |
|
|
| 65756-41-4 |
1-ethyl-1-methylmorpholiniumbromid |
Mut3;R68 |
* |
|
|
|
| 65879-43-8 |
1-chlor-2,5-bis(1-methylethoxy)-4-nitrobenzen |
R43 N;R50/53 |
|
* |
|
|
| 65907-30-4 |
furathiocarb eller 2,3-dihydro-2,2-dimethyl-7-benzofuryl-2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4-diazadecanoat |
T;R25 Tx;R26 Xi;R36/38 R43 Xn;R48/22 N;R50/53 |
* |
|
|
|
| 65916-16-7 |
5-aminonaphthylsulfat |
Mut3;R40 |
|
* |
|
|
| 65925-28-2 |
1-[2-(2-chlorethoxy)ethoxy]-4-(1,1,3,3-tetramethylbutyl)benzen |
R43 N;R50/53 |
|
* |
|
|
| 65954-87-2 |
ethyl-N-[3-(acetylamino)-4-[(4-nitrophenyl)azo]phenyl]-N-(3-ethoxy-3-oxopropyl)-.beta.-alaninat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 65983-31-5 |
2-[(3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-yl)oxy]ethylacrylat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 65996-89-6 |
tjære, stenkuls-, højtemperaturs- |
Carc1;R45 |
* |
|
|
|
| 65996-90-9 |
tjære, stenkuls-, lavtemperaturs- |
Carc1;R45 |
* |
|
|
|
| 65996-93-2 |
beg, kultjære-, højtemperaturs- |
Carc2;R45 |
* |
|
|
|
| 65996-96-5 |
Terpenes and Terpenoids, turpentine-oil, alpha-pinene fraction |
|
|
* |
|
| 66008-69-3 |
2-[[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluornonyl)sulfonyl]methylamino]ethylacrylat |
N;R50/53 |
|
* |
|
|
| 66027-97-2 |
dimethyl[2-[2-[methylbis(2-methylpropyl)phenoxy]ethoxy]ethyl]amin |
R43 N;R50/53 |
|
* |
|
|
| 66027-98-3 |
bis(2-methylpropyl)-o-cresol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 66027-99-4 |
N-[2-[2-[bis(2-methylpropyl)phenoxy]ethoxy]ethyl]-N,N-dimethylamin |
R43 N;R50/53 |
|
* |
|
|
| 66028-00-0 |
[2-(2-chlorethoxy)ethoxy]bis(2-methylpropyl)benzen |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 66037-55-6 |
ethyl-5-[(4-aminophenyl)methyl]anthranilat |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 66063-05-6 |
1-[(4-chlorphenyl)methyl]-1-cyclopentyl-3-phenylurinstof |
N;R50/53 |
|
* |
|
|
| 66068-84-6 |
4-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-ol |
N;R50/53 |
|
* |
|
|
| 66072-32-0 |
4-((1R,2R,4R)-born-2-yl)cyclohexanol |
N;R50/53 |
|
* |
|
|
| 66104-36-7 |
3-[(4-methoxyphenyl)azo]pyridin-2,6-diaminmonohydrochlorid |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 66104-46-9 |
3-[(3,4-dimethylphenyl)azo]pyridin-2,6-diaminmonohydrochlorid |
Carc3;R40 |
|
* |
|
|
| 66142-16-3 |
N-(4-amino-5-chlor-2-hydroxyphenyl)benzamidmonohydrochlorid |
Mut3;R40 R43 |
|
* |
|
|
| 66214-48-0 |
natrium-3-[[4-[(4-ethoxyphenyl)azo]-3-methoxyphenyl]azo]benzensulfonat |
Mut3;R40 |
|
* |
|
|
| 66214-53-7 |
2,2'-[[3-acetamido-4-[(2-chlor-5-nitrophenyl)azo]phenyl]imino]diethyldiacetat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 66214-54-8 |
2,2'-[[4-[(4-nitrophenyl)azo]phenyl]imino]bisethyldiacetat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 66214-56-0 |
N,N'-(9,10-dihydro-9,10-dioxo-2,6-anthracendiyl)bisbenzencarbothioamid |
N;R50/53 |
|
* |
|
|
| 66230-04-4 |
esfenvalerat |
T;R23/25 R43 N;R50/53 |
* |
|
|
|
| 66310-72-3 |
1-allyl-4-(4-methyl-3-pentenyl)cyclohex-3-en-1-carbaldehyd |
N;R50/53 |
|
* |
|
|
| 66353-71-7 |
[4-(methylamino)-3-nitrophenyl]phenylketon |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 66441-23-4 |
fenoxaprop-ethyl eller ethyl-2[4-[(6-chlorbenzoxazol-2-yl)oxy]phenoxy]propionat |
R43 N;R50/53 |
* |
|
|
|
| 66671-82-7 |
2-methoxybenzen-1,4-diammoniumsulfat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 66794-75-0 |
benzylneodecanoat- |
N;R50/53 |
|
* |
|
|
| 66938-41-8 |
(3-chlorphenyl)-(4-methoxy-3-nitrophenyl)methanon |
Mut3;R68 N;R50/53 |
* |
|
|
|
| 67169-91-9 |
N-(2-amino-4-ethoxyphenyl)acetamid |
Mut3;R40 R43 |
|
* |
|
|
| 67338-58-3 |
N-[3-[[2-(2-ethoxyethoxy)ethyl]ethylamino]phenyl]acetamid |
Xn;R22 Mut3;R40 R43 R52/53 |
|
* |
|
|
| 67338-60-7 |
5-amino-1-hydroxy-2-naphthoesyre |
Mut3;R40 |
|
* |
|
|
| 67583-77-1 |
3-ethoxy-1,1,5-trimethylcyclohexan |
N;R50/53 |
|
* |
|
|
| 67584-48-9 |
N-allyltridecafluorhexansulfonamid |
N;R50/53 |
|
* |
|
|
| 67584-54-7 |
N-[3-(dimethylamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluorheptan-1-sulfonamid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 67584-57-0 |
2-[methyl[(tridecafluorhexyl)sulfonyl]amino]ethylacrylat |
N;R50/53 |
|
* |
|
|
| 67584-60-5 |
2-[methyl[(undecafluorpentyl)sulfonyl]amino]ethylmethacrylat |
N;R50/53 |
|
* |
|
|
| 67584-61-6 |
2-[methyl[(tridecafluorhexyl)sulfonyl]amino]ethylmethacrylat |
N;R50/53 |
|
* |
|
|
| 67589-39-3 |
4-ethoxyphenyl-trans-4-propylcyclohexancarboxylat |
N;R50/53 |
|
* |
|
|
| 67589-47-3 |
4-ethoxyphenyl-trans-4-butylcyclohexanoat |
N;R50/53 |
|
* |
|
|
| 67589-52-0 |
4-methoxyphenyl-trans-4-pentylcyclohexanoat |
R43 N;R50/53 |
|
* |
|
|
| 67589-54-2 |
p-propoxyphenyl-trans-4-pentylcyclohexancarboxylat |
N;R50/53 |
|
* |
|
|
| 67599-10-4 |
natrium-2-[3-(4-chlor-2-methylphenyl)-1-methyltriazen-2-yl]ethansulfonat |
Mut3;R40 |
|
* |
|
|
| 67599-13-7 |
natrium-[3-(5-chlor-2-methylphenyl)-1-methyltriazen-2-yl]acetat |
Mut3;R40 |
|
* |
|
|
| 67633-92-5 |
5-(diethoxymethyl)-3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden |
N;R50/53 |
|
* |
|
|
| 67633-93-6 |
6-(diethoxymethyl)-3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden |
N;R50/53 |
|
* |
|
|
| 67633-98-1 |
2-methyl-5-(2-methyl-3-methylenbicyclo[2.2.1]hept-2-yl)pent-2-enylbutyrat |
N;R50/53 |
|
* |
|
|
| 67633-99-2 |
5-(2,3-dimethyltricyclo[2.2.1.02,6]hept-3-yl)-2-methylpent-2-enylbutyrat |
N;R50/53 |
|
* |
|
|
| 67634-05-3 |
2,4,6-trimethylcyclohexylmethylacetat |
N;R50/53 |
|
* |
|
|
| 67634-06-4 |
8-(sec-butyl)quinolin |
Mut3;R40 |
|
* |
|
|
| 67634-09-7 |
2-methyloctan-1,3-diyldiacetat |
N;R50/53 |
|
* |
|
|
| 67634-20-2 |
3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-5-ylisobutyrat |
N;R50/53 |
|
* |
|
|
| 67634-26-8 |
2,4-dimethylcyclohex-3-en-1-methylacetat |
N;R50/53 |
|
* |
|
|
| 67663-00-7 |
alpha,alpha,.epsilon.,3-tetramethyl-eta-(3-methyl-3H-indol-3-yl)-3H-indol-3-heptanol |
N;R50/53 |
|
* |
|
|
| 67663-04-1 |
pentylnon-2-enoat |
N;R50/53 |
|
* |
|
|
| 67674-23-1 |
2-[[4-[(2,5-dichlorphenyl)azo]-3-methylphenyl]ethylamino]ethanol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 67697-69-2 |
3-[4-(dimethylamino)phenyl]-3-(diphenylamino)phthalid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 67712-20-3 |
natrium-5-[(4-aminophenyl)azo]salicylat |
Carc3;R40 R43 |
|
* |
|
|
| 67728-26-1 |
N-(4-amino-2-chlorphenyl)-1-hydroxynaphthalen-2-carboxamid |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 67747-09-5 |
prochloraz eller N-propyl-N-[-2(2,4,6-trichlorphenoxy)ethyl]-1H-imidazol-1-carboxamid |
Xn;R22 N;R50/53 |
* |
|
|
|
| 67786-03-2 |
2,2'-[[o-(oxiranylmethoxy)benzyliden]bis(p-phenylenoxymethylen)]bisoxiran |
Mut3;R40 |
|
* |
|
|
| 67801-06-3 |
4-ethoxybenzen-1,3-diammoniumdichlorid |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 67801-23-4 |
2-isopropyl-5-methylcyclohexyl-2-methylbut-2-enoat |
N;R50/53 |
|
* |
|
|
| 67801-24-5 |
2-isopropyl-5-methylcyclohexyl-2-ethylacrylat |
R43 N;R50/53 |
|
* |
|
|
| 67801-53-0 |
dimethyl-4'-methyl[1,1'-biphenyl]-2,5-dicarboxylat |
N;R50/53 |
|
* |
|
|
| 67801-55-2 |
methyl-(4-methylphenyl)methylterephthalat |
R43 N;R50/53 |
|
* |
|
|
| 67827-57-0 |
N-(3,5-dihydroxyphenyl)benzamid |
Mut3;R40 R43 |
|
* |
|
|
| 67828-17-5 |
diethyldibutylphosphoramidat- |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 67828-30-2 |
4,4'-(2-chlorbenzyliden)bis[N-ethyl-o-toluidin] |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 67828-40-4 |
5-chlor-4-ethoxy-2-nitrotoluen |
Mut3;R40 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 67845-36-7 |
2-methoxy-6-(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-ol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 67845-40-3 |
26-(4-nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ylacetat |
N;R50/53 |
|
* |
|
|
| 67845-50-5 |
4,8-dimethylnona-3,7-dien-2-ol |
N;R50/53 |
|
* |
|
|
| 67845-54-9 |
5,9-dimethyl-4,8-decadien-3-ol |
N;R50/53 |
|
* |
|
|
| 67845-59-4 |
[2-(diethoxymethyl)-1-octenyl]benzen |
N;R50/53 |
|
* |
|
|
| 67845-77-6 |
1,3,4-trimethyl-5-(1-methylvinyl)cyclohexen |
N;R50/53 |
|
* |
|
|
| 67845-79-8 |
bis[(2-hydroxyphenyl)ammonium]sulfat |
Mut3;R40 R43 |
|
* |
|
|
| 67845-91-4 |
[4-[(3,5-dimethylhexyl)oxy]-2-hydroxyphenyl]phenylketon |
N;R50/53 |
|
* |
|
|
| 67845-96-9 |
[4-[(4,5-dimethylhexyl)oxy]-2-hydroxyphenyl]phenylketon |
N;R50/53 |
|
* |
|
|
| 67845-97-0 |
2-hydroxy-4-[(3-methylheptyl)oxy]phenylphenylketon |
N;R50/53 |
|
* |
|
|
| 67845-98-1 |
[4-[(3,4-dimethylhexyl)oxy]-2-hydroxyphenyl]phenylketon |
N;R50/53 |
|
* |
|
|
| 67846-02-0 |
3,4,5,6-tetrachlor-N-(tricyclo[3.3.1.13,7]dec-2-yl)phthalimid |
N;R50/53 |
|
* |
|
|
| 67846-42-8 |
tetraethyl-4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethyliden]bis(phthalat) |
N;R50/53 |
|
* |
|
|
| 67846-65-5 |
methyl-4-[(4-chlorphenyl)methylamino]benzoat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 67859-99-8 |
(Z)-3,7-dimethylocta-2,6-dienylanthranilat |
N;R50/53 |
|
* |
|
|
| 67874-24-2 |
6'-methylspiro[cyclohexan-1,2'-[1,3]dioxol[4,5-f]benzothiazol] |
N;R50/53 |
|
* |
|
|
| 67874-69-5 |
(E)-3,7-dimethylocta-2,6-dienylanthranilat |
N;R50/53 |
|
* |
|
|
| 67874-77-5 |
3,7-dimethyloctylphenylacetat |
N;R50/53 |
|
* |
|
|
| 67874-78-6 |
decahydro-2-naphthylisobutyrat |
N;R50/53 |
|
* |
|
|
| 67874-80-0 |
3,7-dimethyloctylbutyrat |
N;R50/53 |
|
* |
|
|
| 67874-83-3 |
benzyl-2-ethylhexanoat |
N;R50/53 |
|
* |
|
|
| 67875-30-3 |
dinatrium-3-[(4-amino-5-methoxy-o-tolyl)azo]naphthalen-1,5-disulfonat |
Mut3;R40 |
|
* |
|
|
| 67883-77-6 |
3-phenylallyl-2-methylbutyrat |
N;R50/53 |
|
* |
|
|
| 67892-99-3 |
16-(tetrahydro-2-furyl)-3,6,9,12,15-pentaoxahexadecylacrylat |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 67893-02-1 |
methyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-7-isopropyl-1,4a-dimethylphenanthren-1-carboxylat |
N;R50/53 |
|
* |
|
|
| 67893-06-5 |
decahydro-6,9,9-trimethyl-1,4-methanonaphthalen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 67905-11-7 |
1-amino-5,8-dihydroxy-4-[(2-hydroxyethyl)amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 67905-17-3 |
N-[4-[(9,10-dihydro-4-hydroxy-9,10-dioxo-1-anthryl)amino]phenyl]acetamid |
Mut3;R40 |
|
* |
|
|
| 67905-32-2 |
tetradecanolataluminium- |
N;R50/53 |
|
* |
|
|
| 67905-36-6 |
3,4,5,6-tetrachlor-N-cycloheptylphthalimid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 67905-37-7 |
3,4,5,6-tetrachlor-N-heptylphthalimid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 67905-51-5 |
(3,3,4,5,6,6-hexachlor-4-cyclohexen-1,2-diyl)bismethylenbismethacrylat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 67905-62-8 |
methyl[4-[[4-amino-(o-tolyl)]azo]phenyl]carbamat |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 67906-39-2 |
4-[methyl[(nonafluorbutyl)sulfonyl]amino]butylmethacrylat |
N;R50/53 |
|
* |
|
|
| 67906-40-5 |
4-[methyl[(undecafluorpentyl)sulfonyl]amino]butylmethacrylat |
N;R50/53 |
|
* |
|
|
| 67906-59-6 |
2-[4-[(4-amino-5-methoxy-2-methylphenyl)azo]phenoxy]ethanol |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 67906-70-1 |
2-[ethyl[(tridecafluorhexyl)sulfonyl]amino]ethylmethacrylat |
N;R50/53 |
|
* |
|
|
| 67906-73-4 |
2-[ethyl[(undecafluorpentyl)sulfonyl]amino]ethylmethacrylat |
N;R50/53 |
|
* |
|
|
| 67907-33-9 |
5-(1,1-dimethylethyl)-2-methoxy-4-(1-propenyl)phenol |
N;R50/53 |
|
* |
|
|
| 67923-44-8 |
2,2'-[[3-chlor-4-[(4-nitrophenyl)azo]phenyl]imino]bisethyldiacetat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 67923-57-3 |
[1-(1-methoxy-2-phenylethoxy)ethyl]benzen |
N;R50/53 |
|
* |
|
|
| 67923-61-9 |
2-[ethyl[(pentadecafluoroheptyl)sulfonyl]amino]ethyldihydrogenphosphat |
N;R50/53 |
|
* |
|
|
| 67923-62-0 |
dikalium-2,2'-methylenbis[3,4,6-trichlorphenolat] |
R43 N;R50/53 |
|
* |
|
|
| 67924-13-4 |
methyl-2-[[2-(phenylmethylen)octyliden]amino]benzoat |
N;R50/53 |
|
* |
|
|
| 67939-84-8 |
N,N'-[(5-methyl-2-oxo-1,3-cyclohexandiyliden)bis(methylidyn-4,1-phenylen)]bis(acetamid) |
R43 N;R50/53 |
|
* |
|
|
| 67939-85-9 |
1,3-bis[(4-aminophenyl)methylen]-5-methylcyclohexan-1-ondihydrochlorid |
R43 N;R50/53 |
|
* |
|
|
| 67939-98-4 |
diammonium-2-[ethyl[(pentadecafluoroheptyl)sulfonyl]ethylamino]phosphat |
N;R50/53 |
|
* |
|
|
| 67940-02-7 |
N-[3-(dimethylamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluorheptan-1-sulfonamidmonohydrochlorid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 67952-50-5 |
(1-methylethyliden)bis[4,1-phenylenoxy(1-methyl-2,1-ethandiyl)]diacrylat |
N;R50/53 |
|
* |
|
|
| 67953-19-9 |
bis(1,3-dimethylbutyl)-2-butendioat |
R43 N;R50/53 |
|
* |
|
|
| 67969-69-1 |
diammonium-N-ethylheptadecafluor-N-[2-(phosphonatooxy)ethyl]octansulfonamidat |
N;R50/53 |
|
* |
|
|
| 67990-31-2 |
(exo,exo)-2-methoxy-4-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)phenol |
N;R50/53 |
|
* |
|
|
| 68003-41-8 |
1-cyclohexyl-4-(4-nitrophenoxy)benzen |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 68015-83-8 |
tribenzylammoniumacetat- |
Xn;R22 N;R50/53 |
|
* |
|
|
| 68015-94-1 |
1-sec-butyl-2-(methoxymethyl)-4-nitrobenzen |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 68015-95-2 |
2-(chlormethyl)-1-(1-methylpropyl)-4-nitrobenzen |
R43 N;R50/53 |
|
* |
|
|
| 68015-98-5 |
4-ethoxybenzen-1,3-diammoniumsulfat |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 68025-32-1 |
natrium-3-hydroxy-N-(2-naphthyl)naphthalen-2-carboxamidat |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 68025-33-2 |
natrium-N-(5-chlor-2-methoxyphenyl)-3-hydroxynaphthalen-2-carboxamidat |
N;R50/53 |
|
* |
|
|
| 68036-94-2 |
2-methyl(1,7,7-trimethylbicyclo[2.2.1]heptyl)cyclohexan-1-on |
N;R50/53 |
|
* |
|
|
| 68039-35-0 |
1-(2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-1H-3a,7-methanoazulen-5-yl)ethan-1-on |
N;R50/53 |
|
* |
|
|
| 68039-38-3 |
3,7-dimethyl-6-octenyl-2-butenoat |
N;R50/53 |
|
* |
|
|
| 68039-39-4 |
3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-ylisobutyrat |
N;R50/53 |
|
* |
|
|
| 68039-44-1 |
3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-ylpivalat |
N;R50/53 |
|
* |
|
|
| 68039-45-2 |
3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-5-ylpivalat |
N;R50/53 |
|
* |
|
|
| 68039-51-0 |
4,4'-diamino-4''-anilinotritylalkohol |
R43 N;R50/53 |
|
* |
|
|
| 68039-52-1 |
4,4'-[(4-iminocyclohexa-2,5-dien-1-yliden)methylen]bis[N-phenylanilin]monohydrochlorid |
Mut3;R40 |
|
* |
|
|
| 68039-72-5 |
2-methyl-1,3-dioxolan-2-ylethylacetat |
N;R50/53 |
|
* |
|
|
| 68052-10-8 |
1,4-dibutoxy-2-chlorbenzen |
R43 N;R50/53 |
|
* |
|
|
| 68052-14-2 |
1,4-dibutoxy-2,5-dichlorbenzen |
R43 N;R50/53 |
|
* |
|
|
| 68083-99-8 |
2-hydroxyethyl-2-benzyl-1,3-dioxolan-2-propionat |
N;R50/53 |
|
* |
|
|
| 68084-00-4 |
methyl-2-benzyl-1,3-dioxolan-2-propionat |
N;R50/53 |
|
* |
|
|
| 68084-17-3 |
ethyl-2,4-dinitrophenylacetat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 68084-54-8 |
2,4(og 2,6)-dibenzylphenol |
R43 N;R50/53 |
|
* |
|
|
| 68084-62-8 |
2-[methyl[(pentadecafluorheptyl)sulfonyl]amino]ethylacrylat |
N;R50/53 |
|
* |
|
|
| 68109-80-8 |
6-methylheptylbenzoat |
N;R50/53 |
|
* |
|
|
| 68109-90-0 |
methyl-4-heptylbenzoat |
N;R50/53 |
|
* |
|
|
| 68109-99-9 |
cyclohexyl 2-methylpropylmaleat |
R43 N;R50/53 |
|
* |
|
|
| 68123-05-7 |
3-(dodecyloxy)propylammoniumacetat |
R43 N;R50/53 |
|
* |
|
|
| 68123-49-9 |
1,1'-[[[2-(3-chlor-2-hydroxypropoxy)phenyl]methylen]bis(4,1-phenylenoxy)]bis[3-chlorpropan-2-ol] |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 68131-73-7 |
HEPA eller aminer, polyethylenpoly- |
Xn;R21/22 C;R34 R43 N;R50/53 |
* |
|
|
|
| 68132-19-4 |
C8-18-alkylbis(2-hydroxyethyl)ammoniumbis(2-ethylhexyl)phosphat |
T;R23 C;R34 R43 N;R50/53 |
* |
|
|
|
| 68132-80-9 |
allyltrimethylhexanoat- |
N;R50/53 |
|
* |
|
|
| 68133-73-3 |
3-methylbutyl-(E)-3,7-dimethylocta-2,6-dienoat |
N;R50/53 |
|
* |
|
|
| 68133-75-5 |
(Z)-3-hexenylcinnamat |
N;R50/53 |
|
* |
|
|
| 68133-77-7 |
(E)-2-hexenylsalicylat |
N;R50/53 |
|
* |
|
|
| 68133-79-9 |
2-(3,7-dimethylocta-2,6-dienyl)cyclopentan-1-on |
N;R50/53 |
|
* |
|
|
| 68140-57-8 |
methyl-2-[[4-(6,6-dimethyl-2-cyclohexen-1-yl)-2-methyl-3-butenyliden]amino]benzoat |
N;R50/53 |
|
* |
|
|
| 68140-60-3 |
2-butyl-2-ethyl-5,7-dimethyl-3,4-octadienal |
N;R50/53 |
|
* |
|
|
| 68141-18-4 |
8,12-dimethyltridec-11-en-6-on |
N;R50/53 |
|
* |
|
|
| 68141-22-0 |
(E)-3-hexenylsalicylat |
N;R50/53 |
|
* |
|
|
| 68141-24-2 |
3-(5,5-dimethyl-6-methylenbicyclo[2.2.1]hept-2-yl)cyclohexan-1-ol |
N;R50/53 |
|
* |
|
|
| 68155-64-6 |
1-[6-methyl-3-(4-methyl-3-pentenyl)-3-cyclohexen-1-yl]propan-1-on |
N;R50/53 |
|
* |
|
|
| 68155-65-7 |
1-[6-methyl-4-(4-methyl-3-pentenyl)-3-cyclohexen-1-yl]propan-1-on |
N;R50/53 |
|
* |
|
|
| 68155-69-1 |
1-brom-3-ethoxytoluen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 68189-23-1 |
4-(diethylamino)benzaldehyddiphenylhydrazon |
N;R50/53 |
|
* |
|
|
| 68189-45-7 |
N-[3-(tetradecyloxy)propyl]propan-1,3-diaminacetat |
R43 N;R50/53 |
|
* |
|
|
| 68213-89-8 |
natrium-4-hydroxy-7-(phenylamino)naphthalen-2-sulfonat |
Mut3;R40 R43 |
|
* |
|
|
| 68214-01-7 |
natrium-m-[(p-aminophenyl)azo]benzensulfonat |
Carc3;R40 R43 |
|
* |
|
|
| 68214-42-6 |
1,4,5,8-tetraamino-ar,ar'-dibromanthraquinon |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 68214-68-6 |
29-(2,4-dipentylphenoxy)-3,6,9,12,15,18,21,24,27-nonaoxanonacosanol |
N;R50/53 |
|
* |
|
|
| 68214-72-2 |
ethyl-(7-hydroxy-1-naphthyl)-carbamat |
Mut3;R40 |
|
* |
|
|
| 68227-27-0 |
1,4,5-triamino-8-(methylamino)anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 68227-28-1 |
1-(butylamino)-4-(methylamino)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 68227-98-5 |
4-[methyl[(tridecafluorhexyl)sulfonyl]amino]butylacrylat |
N;R50/53 |
|
* |
|
|
| 68227-99-6 |
4-[methyl[(undecafluorpentyl)sulfonyl]amino]butylacrylat |
N;R50/53 |
|
* |
|
|
| 68228-09-1 |
ethyl-2-[[[2,4(og 3,5)-dimethyl-3-cyclohexen-1-yl]methyl]amino]benzoat |
R43 N;R50/53 |
|
* |
|
|
| 68239-20-3 |
3-[[3-(tridecyloxy)propyl]amino]propiononitril |
N;R50/53 |
|
* |
|
|
| 68239-21-4 |
3-chlor-4-(phenylazo)anilin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 68239-74-7 |
tridecafluor-N-(4-hydroxybutyl)-N-methylhexansulfonamid |
N;R50/53 |
|
* |
|
|
| 68239-80-5 |
4-chlorbenzen-1,3-diammoniumsulfat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 68239-82-7 |
4-nitrobenzen-1,2-diammoniumsulfat |
Xn;R22 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 68239-83-8 |
2-nitrobenzen-1,4-diammoniumsulfat |
Carc3;R40 R43 R52/53 |
|
* |
|
|
| 68259-14-3 |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluor-N-methylheptan-1-sulfonamid |
N;R50/53 |
|
* |
|
|
| 68259-15-4 |
tridecafluor-N-methylhexansulfonamid |
N;R50/53 |
|
* |
|
|
| 68298-06-6 |
2-[ethyl[(undecafluorpentyl)sulfonyl]amino]ethylacrylat |
N;R50/53 |
|
* |
|
|
| 68298-48-6 |
2-hexyl-2-methyl-1,3-benzodioxol |
N;R50/53 |
|
* |
|
|
| 68298-76-0 |
2-[[[[5-[[[2-[ethyl[(nonafluorbutyl)sulfonyl]amino]ethoxy]carbonyl]amino]-2-methylphenyl]amino]carbonyl]oxy]propylmethacrylat |
N;R50/53 |
|
* |
|
|
| 68298-89-5 |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluor-N-(4-hydroxybutyl)-N-methylheptan-1-sulfonamid |
N;R50/53 |
|
* |
|
|
| 68299-18-3 |
p,p'-(1,1,3-trimethylpropan-1,3-diyl)diphenol, didehydroderivat |
R43 N;R50/53 |
|
* |
|
|
| 68310-02-1 |
N-butyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluor-N-(2-hydroxyethyl)heptan-1-sulfonamid |
N;R50/53 |
|
* |
|
|
| 68310-06-5 |
N-[5-[bis(2-hydroxyethyl)amino]-2-[(2-chlor-4-nitrophenyl)azo]phenyl]benzamid |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 68310-48-5 |
1,5-diamino-4,8-dihydroxy-2-(hydroxytolyl)anthraquinon |
Mut3;R40 |
|
* |
|
|
| 68310-54-3 |
2(og 3)-methylbutyl-3,7-dimethyl-2,6-octadienoat |
N;R50/53 |
|
* |
|
|
| 68310-59-8 |
nerylhexanoat- |
N;R50/53 |
|
* |
|
|
| 68310-87-2 |
4,4'-[ethylenbis(oxy)]bis[N-(1,3-dimethylbutyl)anilin] |
R43 N;R50/53 |
|
* |
|
|
| 68311-10-4 |
2-isoheptyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 68311-13-7 |
3,7-dimethyloctylacetat, tetradehydroderivat |
N;R50/53 |
|
* |
|
|
| 68333-22-2 |
rester (råolie), atmosfæriske |
Carc2;R45 |
* |
|
|
|
| 68333-25-5 |
destillater (råolie), hydroafsvovlede lette katalytisk
krakkede |
Carc2;R45 |
* |
|
|
|
| 68333-26-6 |
klarede olier (råolie), hydroafsvovlede katalytisk
krakkede |
Carc2;R45 |
* |
|
|
|
| 68333-27-7 |
destillater (råolie), hydroafsvovlede intermediære
katalytisk krakkede |
Carc2;R45 |
* |
|
|
|
| 68333-28-8 |
destillater (råolie), hydroafsvovlede tunge katalytisk
krakkede |
Carc2;R45 |
* |
|
|
|
| 68334-56-5 |
1-chlor-3-(tridecyloxy)propan-2-ol |
R43 N;R50/53 |
|
* |
|
|
| 68345-22-2 |
[2,2-bis(2-methylpropoxy)ethyl]benzen |
N;R50/53 |
|
* |
|
|
| 68359-37-5 |
beta-cyfluthrin |
Tx;R26/28 N;R50/53 |
* |
|
|
|
| 68359-37-5 |
cyfluthrin eller ?-cyan-4-fluor-3-phenoxybenzyl-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
T;R23 Tx;R28 N;R50/53 |
* |
|
|
|
| 68366-65-4 |
[1R-(1alpha,2beta,5alpha)]-5-methyl-2-(1-methylethyl)cyclohexylisobutyrat |
N;R50/53 |
|
* |
|
|
| 68391-25-3 |
1-[[4-[(4-aminophenyl)methyl]phenyl]amino]-3-phenoxypropan-2-ol |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50 |
|
* |
|
|
| 68391-40-2 |
1,4-dioxan-2-methylacetat |
N;R50/53 |
|
* |
|
|
| 68391-47-9 |
2,2'-[[3-acetamido-4-[(2,4-dinitrophenyl)azo]phenyl]imino]diethyldiacetat |
Carc3;R40 R43 |
|
* |
|
|
| 68399-95-1 |
N-(4-brom-2,6-dichlor-3-methylphenyl)acetamid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 68413-56-9 |
4-ethoxy-4'-pentyl-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 68413-71-8 |
1,3,5-tribrom-2-(2-bromethoxy)benzen |
N;R50/53 |
|
* |
|
|
| 68425-99-0 |
N-[3-[[[(4,5-dihydro-2-phenyl-1H-imidazol-1-yl)carbonyl]amino]methyl]-3,5,5-trimethylcyclohexyl]-4,5-dihydro-2-phenyl-1H-imidazol-1-carboxamid |
N;R50/53 |
|
* |
|
|
| 68426-05-1 |
[2-methoxy-2-[(3-phenylallyl)oxy]ethyl]benzen |
N;R50/53 |
|
* |
|
|
| 68442-68-2 |
Benzenamine, N-phenyl-, styrenated |
|
|
|
* |
|
| 68443-34-5 |
1-benzyloxy-4-(1-methyl-1-phenylethyl)benzen |
N;R50/53 |
|
* |
|
|
| 68443-36-7 |
1-(allyloxy)-4-(1-methyl-1-phenylethyl)benzen |
N;R50/53 |
|
* |
|
|
| 68444-35-9 |
2,2'-oxybis(methylethyl)bisheptanoat |
N;R50/53 |
|
* |
|
|
| 68459-98-3 |
4-chlorbenzen-1,2-diammoniumsulfat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 68475-80-9 |
destillater (råolie), let dampkrakket naphtha |
Carc2;R45 |
* |
|
|
|
| 68476-32-4 |
brændselsolie, rester-straight-run gasolier, med
højt indhold af svovl |
Carc2;R45 |
* |
|
|
|
| 68476-33-5 |
brændselsolie, rest- |
Carc2;R45 |
* |
|
|
|
| 68477-38-3 |
destillater (råolie), krakkede dampkrakkede råoliedestillater |
Carc2;R45 |
* |
|
|
|
| 68478-13-7 |
rester (råolie), katalytisk reformer fraktioneringskolonnerest,
destillations- |
Carc2;R45 |
* |
|
|
|
| 68478-17-1 |
rester (råolie), tung coker-gasolie og vakuumgasolie |
Carc2;R45 |
* |
|
|
|
| 68479-79-8 |
bis(2-methoxyethyl)-N,N'-(9,10-dihydro-4,8-dihydroxy-9,10-dioxo-1,5-anthracendiyl)bis-beta-alaninat |
Mut3;R40 |
|
* |
|
|
| 68479-98-1 |
diethylmethylbenzendiamin |
Xn;R21/22-48/22 Xi;R36 N;R50/53 |
* |
|
|
|
| 68480-06-8 |
9-decenylpropionat |
N;R50/53 |
|
* |
|
|
| 68480-19-3 |
2,4-dimethyl-2-[2-(2,6,6-trimethyl-2-cyclohexen-1-yl)ethyl]-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 68480-25-1 |
tridec-2-en-1-ol |
N;R50/53 |
|
* |
|
|
| 68480-27-3 |
undec-2-enylacetat |
N;R50/53 |
|
* |
|
|
| 68512-61-8 |
rester (råolie), tunge coker- og lette vakuum- |
Carc2;R45 |
* |
|
|
|
| 68512-62-9 |
rester (råolie), lette vakuum- |
Carc2;R45 |
* |
|
|
|
| 68513-69-9 |
rester (råolie), dampkrakkede lette |
Carc2;R45 |
* |
|
|
|
| 68516-59-6 |
natrium-m-[(4-amino-m-tolyl)azo]benzensulfonat |
Carc3;R40 R43 |
|
* |
|
|
| 68517-02-2 |
2,2',2''-[propylidyntris(p-phenylenoxymethylen)]trioxiran |
Mut3;R40 R43 |
|
* |
|
|
| 68517-09-9 |
1-(2-hydroxy-5-tert-nonylphenyl)ethan-1-onoxim |
R43 N;R50/53 |
|
* |
|
|
| 68517-11-3 |
4-[(o-tolyl)azo]xylidin |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 68527-69-5 |
5,6-dimethylquinolin-8-amin |
Carc3;R40 |
|
* |
|
|
| 68527-76-4 |
2-ethoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 68527-78-6 |
methyl-2-[[2-(phenylmethylen)heptyliden]amino]benzoat |
N;R50/53 |
|
* |
|
|
| 68527-83-3 |
3-(tetradecyloxy)propannitril |
N;R50/53 |
|
* |
|
|
| 68527-98-0 |
tris(4-nitro-m-tolyl)phosphat |
N;R50/53 |
|
* |
|
|
| 68539-56-0 |
[1S-(1alpha,2beta,5beta)]-2-(isopropyl)-5-methylcyclohexylpropionat |
N;R50/53 |
|
* |
|
|
| 68540-85-2 |
natrium-3-hydroxy-N-(o-tolyl)naphthalen-2-carboxamidat |
R43 N;R50/53 |
|
* |
|
|
| 68540-86-3 |
natrium-N-(4-chlorphenyl)-3-hydroxynaphthalen-2-carboxamidat |
R43 N;R50/53 |
|
* |
|
|
| 68540-87-4 |
natrium-N-(5-chlor-2-methylphenyl)-3-hydroxynaphthalen-2-carboxamidat |
R43 N;R50/53 |
|
* |
|
|
| 68540-94-3 |
N,N'-(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis[3-oxobutyramid],
dinatriumsalt |
Mut3;R40 R43 |
|
* |
|
|
| 68541-19-5 |
2,2'-[(1-methylethyliden)bis[(3,5-dibrom-4,1-phenylen)oxymethylen]]bisoxiran |
N;R50/53 |
|
* |
|
|
| 68553-00-4 |
brændselsolie, nr. 6 |
Carc2;R45 |
* |
|
|
|
| 68555-28-2 |
[2,2-bis(3-methylbutoxy)ethyl]benzen |
N;R50/53 |
|
* |
|
|
| 68555-33-9 |
4,4,6-trimethyl-2-[4-(1-methylethyl)phenyl]-1,3-dioxan |
N;R50/53 |
|
* |
|
|
| 68555-34-0 |
bis[(6-methylcyclohex-3-enyl)methyl]adipat |
N;R50/53 |
|
* |
|
|
| 68555-57-7 |
3,7-dimethyloct-6-enyl-2-aminobenzoat |
N;R50/53 |
|
* |
|
|
| 68555-58-8 |
3-methyl-2-butenylsalicylat |
N;R50/53 |
|
* |
|
|
| 68555-61-3 |
1,2-dimethyl-3-(2,6,6-trimethyl-2-cyclohexen-1-yl)propen-1-ylacetat |
R43 N;R50/53 |
|
* |
|
|
| 68555-67-9 |
natriumheptadecafluoroctansulfinat- |
N;R50/53 |
|
* |
|
|
| 68555-73-7 |
N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluor-N-(2-hydroxyethyl)heptan-1-sulfonamid |
N;R50/53 |
|
* |
|
|
| 68555-76-0 |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluor-N-(2-hydroxyethyl)-N-methylheptan-1-sulfonamid |
N;R50/53 |
|
* |
|
|
| 68556-00-3 |
natrium-3-hydroxy-N-[4-methoxy-o-tolylphenyl]naphthalen-2-carboxamidat |
R43 N;R50/53 |
|
* |
|
|
| 68556-01-4 |
natrium-N-(o-anisyl)-3-hydroxynaphthalen-2-carboxamidat |
N;R50/53 |
|
* |
|
|
| 68556-04-7 |
natrium-N-(4-chlor-2-methylphenyl)-3-hydroxynaphthalen-2-carboxamidat |
R43 N;R50/53 |
|
* |
|
|
| 68556-06-9 |
natrium-3-hydroxy-N-phenylnaphthalen-2-carboxamidat |
R43 N;R50/53 |
|
* |
|
|
| 68556-08-1 |
natrium-3-hydroxy-N-(3-nitrophenyl)naphthalen-2-carboxamidat |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 68556-12-7 |
natrium-N-(5-chlor-2,4-dimethoxyphenyl)-3-hydroxynaphthalen-2-carboxamidat |
R43 N;R50/53 |
|
* |
|
|
| 68556-13-8 |
natrium-N-(4-chlorphenyl)-2-hydroxy-9H-carbazol-3-carboxamidat |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 68556-14-9 |
natrium-3-hydroxy-N-(2-methoxy-3-dibenzofuryl)naphthalen-2-carboxamidat |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 68556-17-2 |
natrium-N-(2-ethoxyphenyl)-3-hydroxynaphthalen-2-carboxamidat |
N;R50/53 |
|
* |
|
|
| 68568-81-0 |
2-(3,7-dimethyloct-6-enyl)-4,4,6-trimethyl-1,3-dioxan |
N;R50/53 |
|
* |
|
|
| 68575-36-0 |
3,5-dichlor-alpha-methylstyren |
R43 N;R50/53 |
|
* |
|
|
| 68607-30-7 |
rester (råolie), topanlægs-, svovl-fattige |
Carc2;R45 |
* |
|
|
|
| 68671-90-9 |
1,2,4,5-tetrachlor-3-(methylthio)benzen |
N;R50/53 |
|
* |
|
|
| 68683-38-5 |
dihydro-3-(4,6,8-trimethyl-2-nonenyl)furan-2,5-dion |
N;R50/53 |
|
* |
|
|
| 68705-63-5 |
(E)-3,7-dimethylocta-2,6-dienyl-2-methylbutyrat |
N;R50/53 |
|
* |
|
|
| 68738-99-8 |
methyl-2-[[[2,4(og 3,5)-dimethyl-3-cyclohexen-1-yl]methylen]amino]benzoat |
R43 N;R50/53 |
|
* |
|
|
| 68758-85-0 |
p-(tert-butyl)[(2-hydroxy-1-naphthyl)methylen]benzohydrazid |
Mut3;R40 |
|
* |
|
|
| 68761-20-6 |
trans-1-methyl-4-methylvinyl)cyclohexen |
R10 Xi;R38 R43 N;R50/53 |
* |
|
|
|
| 68783-08-4 |
gasolier (råolie), tunge atmosfæriske |
Carc2;R45 |
* |
|
|
|
| 68783-13-1 |
rester (råolie), coker skrubber, indeholder kondenserede
aromater |
Carc2;R45 |
* |
|
|
|
| 68797-72-8 |
ethyl-4-methyl-2-oxo-3-pentylcyclopent-3-encarboxylat |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 68797-74-0 |
4-(isobutyl)cyclohexylhexanoat |
N;R50/53 |
|
* |
|
|
| 68818-86-0 |
9,10-diethoxyanthracen |
N;R50/53 |
|
* |
|
|
| 68833-92-1 |
7-ethyl-2-methylundec-2-en-4-on |
N;R50/53 |
|
* |
|
|
| 68844-77-9 |
astemizol- |
N;R50/53 |
|
* |
|
|
| 68845-21-6 |
1,3,5-triazin-2,4,6-triyltri-2,1-ethandiyltrimethacrylat |
R43 N;R50/53 |
|
* |
|
|
| 68845-33-0 |
2-isopropenyl-4-isopropyl-1-methyl-1-vinylcyclohexan, didehydroderivat |
N;R50/53 |
|
* |
|
|
| 68891-89-4 |
2-methyl-2-(3,7,7-trimethylbicyclo[4.1.0]hept-3-en-2-yl)-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 68891-91-8 |
decahydro-2-isopropenyl-8-methylazulen-4-methylacetat |
N;R50/53 |
|
* |
|
|
| 68892-27-3 |
(Z)-tetradec-3-enol |
N;R50/53 |
|
* |
|
|
| 68900-66-3 |
2,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-5(og 6)-ylisobutyrat |
N;R50/53 |
|
* |
|
|
| 68900-86-7 |
(E)-tetradec-3-enol |
N;R50/53 |
|
* |
|
|
| 68901-18-8 |
1-chlor-3-[1-(chlormethyl)-2-(2-pyridylamino)ethoxy]propan-2-ol |
Mut3;R40 R43 |
|
* |
|
|
| 68901-22-4 |
4-[(3,3-dimethylbicyclo[2.2.1]hept-2-yl)methyl]-2-methylcyclohexan-1-on |
N;R50/53 |
|
* |
|
|
| 68911-98-8 |
N-(2-ethylphenyl)-3-hydroxynaphthalen-2-carboxamid |
R43 N;R50/53 |
|
* |
|
|
| 68922-00-9 |
non-2-enylbutyrat |
N;R50/53 |
|
* |
|
|
| 68922-03-2 |
5-decyltetrahydro-2H-pyran-2-on |
N;R50/53 |
|
* |
|
|
| 68922-09-8 |
2-methoxy-4-(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-ol |
N;R50/53 |
|
* |
|
|
| 68922-10-1 |
3,7-dimethyloct-6-enylisovalerat |
N;R50/53 |
|
* |
|
|
| 68922-13-4 |
3-methyl-2-(pentyloxy)cyclopent-2-en-1-on |
Mut3;R40 |
|
* |
|
|
| 68938-61-4 |
2-ethylhexyl-(5-isocyanato-2-methylphenyl)-carbamat |
N;R50/53 |
|
* |
|
|
| 68938-63-6 |
2-[[3-chlor-4-[(4-nitrophenyl)azo]phenyl]ethylamino]ethanol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 68954-04-1 |
hexahydrodimethyl-1H-benzinden |
N;R50/53 |
|
* |
|
|
| 68955-27-1 |
destillater (råolie), råolierester vakuum- |
Carc2;R45 |
* |
|
|
|
| 68955-36-2 |
rester (råolie), dampkrakket, harpiksholdige |
Carc2;R45 |
* |
|
|
|
| 68957-53-9 |
ethyl-N-ethyl-N-[(tridecafluorhexyl)sulfonyl]glycinat |
N;R50/53 |
|
* |
|
|
| 68957-54-0 |
ethyl-N-ethyl-N-[(pentadecafluorheptyl)sulfonyl]glycinat |
N;R50/53 |
|
* |
|
|
| 68957-61-9 |
N-[3-(dimethylamino)propyl]tridecafluorhexansulfonamidmonohydrochlorid |
Xn;R22 N;R50/53 |
|
* |
|
|
| 68957-62-0 |
N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluorheptan-1-sulfonamid |
N;R50/53 |
|
* |
|
|
| 68957-70-0 |
dinatrium-2,2'-methylenbis[4,6-dichlorphenolat] |
R43 N;R50/53 |
|
* |
|
|
| 68958-53-2 |
1-isooctyl-4-(4-nitrophenoxy)benzen |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 68959-23-9 |
1,2,6-tris(2,3-epoxypropoxy)hexan |
Mut3;R40 R43 |
|
* |
|
|
| 68959-32-0 |
3-hydroxy-4-[(2-methyl-5-nitrophenyl)azo]-2-naphthoesyre |
Carc3;R40 |
|
* |
|
|
| 68966-31-4 |
4-[(4-aminophenyl)(4-iminocyclohexa-2,5-dien-1-yliden)methyl]-N-phenylanilinmonohydrochlorid |
Mut3;R40 |
|
* |
|
|
| 68966-33-6 |
4-amino-4',4''-dianilinotritylalkohol |
R43 N;R50/53 |
|
* |
|
|
| 68966-79-0 |
ar-nitrophenethylacetat |
Mut3;R40 |
|
* |
|
|
| 68966-80-3 |
ar-nitrophenethylalkohol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 68975-84-8 |
oxydiethylenbis[[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamat] |
N;R50/53 |
|
* |
|
|
| 69009-90-1 |
diisopropyl-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 69013-34-9 |
N-methyl-4-[[4,4,5,5,5-pentafluor-3-(pentafluorethyl)-1,2,3-tris(trifluormethyl)pent-1-enyl]oxy]-N-[2-(phosphonooxy)ethyl]benzensulfonamid |
N;R50/53 |
|
* |
|
|
| 69093-18-1 |
1-amino-4,8-dihydroxy-5-[(1-methylethyl)amino]anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 69094-18-4 |
2,2-dibrom-2-nitroethanol |
E;R2 Xn;R22-48/22 C;R35 Carc3;R40 R43 N;R50/53 |
* |
|
|
|
| 69121-13-7 |
decahydro-2-isopropenyl-4,7-methanoazulen-8-methylacetat |
N;R50/53 |
|
* |
|
|
| 69205-08-9 |
2-methylbutylnonan-1-oat |
N;R50/53 |
|
* |
|
|
| 69227-51-6 |
1-ethyl-1-methylpyrrolidiniumbromid |
Mut3;R68 |
* |
|
|
|
| 69581-33-5 |
cyprofuram |
Xn;R21 T;R25 N;R50/53 |
* |
|
|
|
| 69770-23-6 |
3-[4-(tert-butyl)phenoxy]benzaldehyd |
R43 N;R50/53 |
|
* |
|
|
| 69777-64-6 |
(S)-p-(2-methylbutyl)phenyl-p-pentylbenzoat |
N;R50/53 |
|
* |
|
|
| 69806-50-4 |
fluazifop-butyl |
Rep2;R61 N;R50/53 |
* |
|
|
|
| 69834-10-2 |
2(3 og 4)-(7,7-dimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-ol |
N;R50/53 |
|
* |
|
|
| 69856-10-6 |
pentyl-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 69868-13-9 |
N-(o-tolyl)-N'-phenylethylendiamin |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 69898-40-4 |
7-[4-(diethylamino)-2-ethoxyphenyl]-7-(1-ethyl-2-methyl-1H-indol-3-yl)furo[3,4-b]pyridin-5(7H)-on |
N;R50/53 |
|
* |
|
|
| 69898-48-2 |
2-methoxy-3,5-dimethylcyclopent-2-en-1-on |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 70124-77-5 |
cyan(3-phenoxyphenyl)methyl-2-[4-(difluormethoxy)phenyl]-3-methylbutyrat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 70146-05-3 |
(1-methylethyliden)bis[(2-methyl-4,1-phenylen)oxy(1-methyl-2,1-ethandiyl)]diacrylat |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 70264-94-7 |
methyl-4-brommethyl-3-methoxybenzoat |
Xi;R38-41 R43 N;R50/53 |
* |
|
|
|
| 70289-38-2 |
4-chlor-4'-isopropylbutyrophenon |
Xn;R22 Mut3;R40 R43 N;R50 |
|
* |
|
|
| 70476-82-3 |
1,4-dihydroxy-5,8-bis[[2-[(2-hydroxyethyl)amino]ethyl]amino]anthraquinondihydrochlorid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 70495-39-5 |
methylenbis[2,1-phenylenoxy(1-methyl-2,1-ethandiyl)]diacrylat |
N;R50/53 |
|
* |
|
|
| 70592-76-6 |
destillater (råolie), intermediære vakuum |
Carc2;R45 |
* |
|
|
|
| 70592-77-7 |
destillater (råolie), lette vakuum |
Carc2;R45 |
* |
|
|
|
| 70592-78-8 |
destillater (råolie), vakuum |
Carc2;R45 |
* |
|
|
|
| 70597-89-6 |
(4-chlorphenyl)hydraziniumhydrogensulfat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 70609-95-9 |
N-[2-[(2-chlor-4-nitrophenyl)azo]-5-(diethylamino)phenyl]acetamid |
Carc3;R40 R43 |
|
* |
|
|
| 70657-70-4 |
2-methoxypropylacetat |
Rep2;R61 R10 Xi;R37 |
* |
|
|
|
| 70660-48-9 |
2-[butyl(3-methylphenyl)amino]ethyl-(3,4-dichlorphenyl)carbamat |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 70660-54-7 |
N-[4-[(4-hydroxy[1,1'-biphenyl]-3-yl)azo]phenyl]acetamid |
Mut3;R40 R43 |
|
* |
|
|
| 70682-64-3 |
4-(4-cyclohexylphenoxy)anilin |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 70729-65-6 |
methyl-N-[3-(acetylamino)-4-[(2,4-dinitrophenyl)azo]phenyl]-N-(3-methoxy-3-oxopropyl)-beta-alaninat |
Mut3;R40 R43 |
|
* |
|
|
| 70729-68-9 |
oxybis(ethan-2,1-diyloxyethan-2,1-diyl)bisheptanoat |
N;R50/53 |
|
* |
|
|
| 70766-54-0 |
4,6-di-tert-butyl-2,3-xylenol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 70776-89-5 |
4-(1,1-dibut-2-enylpent-3-enyl)pyridin |
R43 N;R50/53 |
|
* |
|
|
| 70900-43-5 |
2,2'-[[3-methyl-4-[(4-nitrophenyl)azo]phenyl]imino]bisethyldiacetat |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 70918-74-0 |
1-(1,4-benzodioxan-2-ylcarbonyl)piperazinhydrochlorid |
T;R23/24/25 Xn;R48/22 N;R51/53 |
* |
|
|
|
| 70969-70-9 |
2-ethylhexyl-3,5,5-trimethylhexanoat |
N;R50/53 |
|
* |
|
|
| 71033-08-4 |
2,2'-[(1-methylethyliden)bis[4,1-phenylenoxy[1-(butoxymethyl)ethylen]oxymethylen]]bisoxiran |
Mut3;R40 |
|
* |
|
|
| 71046-96-3 |
heptadeca-1,8,11,14-tetraen |
N;R50/53 |
|
* |
|
|
| 71077-30-0 |
8-butoxy-2,6-dimethyloct-2-en |
N;R50/53 |
|
* |
|
|
| 71077-33-3 |
butylbis(4-hydroxyphenyl)acetat |
N;R50/53 |
|
* |
|
|
| 71172-35-5 |
N-phenyl-4-(2,4,4-trimethylpentyl)anilin |
R43 N;R50/53 |
|
* |
|
|
| 71172-61-7 |
4-[3-chlor-1-(1-methylethoxy)propyl]toluen |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 71173-71-2 |
1,3-bis[bis[4-(dimethylamino)phenyl]methyl]urinstof |
N;R50/53 |
|
* |
|
|
| 71383-07-8 |
3,7-dimethyloctyl-3-methyl-2-butenoat |
N;R50/53 |
|
* |
|
|
| 71412-25-4 |
4-cyan-2,6-diiodphenylbutyrat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 71463-36-0 |
[1R-(1alpha,4abeta,4balpha,10aalpha)]-1,2,3,4,4a,4b,5,6,10,10a-decahydro-7-isopropyl-1,4a-dimethylphenanthren-1-methylaminhydrochlorid |
N;R50/53 |
|
* |
|
|
| 71463-48-4 |
bis(2,5-dichloranilinium)sulfat |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 71463-49-5 |
2,6-dichlorphenyl-2,6-dichlorbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 71463-54-2 |
4'-chlor-4-(4-chlorphenyl)butyrophenon |
R43 N;R50/53 |
|
* |
|
|
| 71463-59-7 |
2,6-dichlorphenylvalerat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 71486-48-1 |
cyclohexylisooctylphthalat- |
N;R50/53 |
|
* |
|
|
| 71501-27-4 |
1-chlor-2-[(2-chlorethyl)thio]benzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 71501-45-6 |
4-chlorbenzen-1,3-diammoniumsulfat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 71519-95-4 |
2-[2,4-bis(tert-butyl)phenoxy]-5,5-dimethyl-1,3,2-dioxaphosphorinan |
N;R50/53 |
|
* |
|
|
| 71526-83-5 |
4-chlor-4'-ethylbutyrophenon |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 71605-84-0 |
( ,6E)-3,7-dimethyl-2,6-octadienylcinnamat |
N;R50/53 |
|
* |
|
|
| 71605-87-3 |
[2-(dimethoxymethyl)-1-octenyl]benzen |
N;R50/53 |
|
* |
|
|
| 71605-88-4 |
hexyl-o-anisat |
N;R50/53 |
|
* |
|
|
| 71607-33-5 |
4'-methyl-4-(p-tolyl)butyrophenon |
N;R50/53 |
|
* |
|
|
| 71607-43-7 |
5-(1-methylheptyl)-2,4-dinitrophenyl-2-butenoat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 71607-51-7 |
(4-methoxyphenyl)methylheptanoat |
N;R50/53 |
|
* |
|
|
| 71607-52-8 |
3-phenylallylheptanoat |
N;R50/53 |
|
* |
|
|
| 71607-53-9 |
cinnamylsalicylat- |
N;R50/53 |
|
* |
|
|
| 71617-10-2 |
isopentyl-p-methoxycinnamat |
N;R50/53 |
|
* |
|
|
| 71617-12-4 |
1,5-dimethyl-1-vinylhex-4-enyl-3-phenylpropionat |
N;R50/53 |
|
* |
|
|
| 71617-13-5 |
1-[2-methyl-5-(1-methylethyl)cyclohexyl]propan-1-on |
N;R50/53 |
|
* |
|
|
| 71617-14-6 |
2-(isopropyl)-5-methylcyclohexylbenzoat |
N;R50/53 |
|
* |
|
|
| 71617-17-9 |
1,1-bis(allyloxy)octan |
N;R50/53 |
|
* |
|
|
| 71617-23-7 |
3,3'-(1,2-ethandiyl)biscyclohexen |
N;R50/53 |
|
* |
|
|
| 71629-74-8 |
2,4(eller 2,6)-dinitrophenol |
T;R23/24/25 R33 N;R50/53 |
* |
|
|
|
| 71648-23-2 |
3-ethoxy-N-phenyl-p-toluidin |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 71648-38-9 |
2-(phenylmethylen)heptylbutyrat |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 71662-18-5 |
3,7-dimethyloct-6-enyl-4-methylvalerat |
N;R50/53 |
|
* |
|
|
| 71662-19-6 |
4-methylphenylheptanoat |
R43 N;R50/53 |
|
* |
|
|
| 71662-20-9 |
cyclohexyl-4-methylvalerat |
N;R50/53 |
|
* |
|
|
| 71662-21-0 |
1,1-bis(allyloxy)decan |
N;R50/53 |
|
* |
|
|
| 71662-25-4 |
3,7-dimethyloctylisobutyrat |
N;R50/53 |
|
* |
|
|
| 71662-26-5 |
3,7-dimethyloctylisovalerat |
N;R50/53 |
|
* |
|
|
| 71662-30-1 |
9-aminophenazin-2-ol |
Mut3;R40 |
|
* |
|
|
| 71662-33-4 |
1-methoxydecen |
N;R50/53 |
|
* |
|
|
| 71662-38-9 |
N-[2-hydroxy-4-[(methylsulfonyl)amino]phenyl]acetamid |
Mut3;R40 |
|
* |
|
|
| 71672-79-2 |
N-ethyl-4'-methoxy[1,1'-biphenyl]-2-amin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 71701-26-3 |
N-[4-[(2-hydroxy-5-methylphenyl)azo]phenyl]benzamid |
Carc3;R40 R43 |
|
* |
|
|
| 71701-32-1 |
3-[4-[ethyl[2-[[(phenylamino)carbonyl]oxy]ethyl]amino]-2-methylphenyl]-2-[(4-methylphenyl)sulfonyl]acrylonitril |
Xn;R22 N;R50/53 |
|
* |
|
|
| 71720-44-0 |
1-(4-chlorbutoxy)-4-methylbenzen |
Xn;R22 Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 71720-46-2 |
4-(3-nitrophenyl)-6-phenyl-2-(p-tolyl)pyridin |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 71720-49-5 |
2-methoxy-4-nitroaniliniumchlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 71720-57-5 |
[2-(2-benzylphenoxy)ethyl]dimethylammoniumdihydrogencitrathydrochlorid |
N;R50/53 |
|
* |
|
|
| 71735-28-9 |
3-methoxy-2-nitrodibenzofuran |
Xn;R22 Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 71735-37-0 |
1-naphthylammoniumacetat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 71750-37-3 |
lithium-2,3,6-trichlorbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 71776-05-1 |
2-nitrobenzen-1,4-diaminhydrochlorid |
Carc3;R40 R43 R52/53 |
|
* |
|
|
| 71786-70-4 |
bis(4-dodecylphenyl)iodoniumhexafluorantimonat |
R43 R52/53 |
* |
|
|
|
| 71799-75-2 |
1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 71820-46-7 |
p-(1-octenyl)anisol |
N;R50/53 |
|
* |
|
|
| 71849-98-4 |
phenyl-2,6-dichlorbenzoat |
R43 N;R50/53 |
|
* |
|
|
| 71850-09-4 |
diisohexylphthalat- |
N;R50/53 |
|
* |
|
|
| 71965-20-3 |
2,4-dibutyl-6-ethylphenol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 71965-26-9 |
2-methyl(1,7,7-trimethylbicyclo[2.2.1]heptyl)cyclohexan-1-ol |
N;R50/53 |
|
* |
|
|
| 72187-23-6 |
dimethyl-(3-hexyl-2-oxo-3-cyclopenten-1-yl)malonat |
Mut3;R40 N;R50 |
|
* |
|
|
| 72214-23-4 |
1,1,5-trimethylhepta-4,6-dienylacetat |
N;R50/53 |
|
* |
|
|
| 72269-52-4 |
oxydiethylenbis(2-ethylhexanoat) |
N;R50/53 |
|
* |
|
|
| 72395-46-1 |
N,N-diethyl-1H-indol-1-ethylamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 72490-01-8 |
fenoxycarb eller ethyl-[2-(4-phenoxyphenoxy)ethyl]carbamat |
N;R50/53 |
* |
|
|
|
| 72619-32-0 |
methyl-(R)-2-(4-(3-chlor-5-trifluormethyl-2-pyridyloxy)phenoxy)propionat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 72727-55-0 |
2-methylpropyl-1-methyl-4-(4-methyl-3-pentenyl)cyclohex-3-en-1-carboxylat |
N;R50/53 |
|
* |
|
|
| 72727-56-1 |
2-methylpropyl-1-methyl-3-(4-methyl-3-pentenyl)cyclohex-3-en-1-carboxylat |
N;R50/53 |
|
* |
|
|
| 72727-57-2 |
ethyl-2-methyl-alpha-pentyl-1,3-dioxolan-2-acetat |
N;R50/53 |
|
* |
|
|
| 72727-68-5 |
methyl-2-[(3-bicyclo[2.2.1]hept-2-yl-2-methylpropyliden)amino]benzoat |
R43 N;R50/53 |
|
* |
|
|
| 72727-69-6 |
[(2,4-dibrom-5-methylphenoxy)methyl]oxiran |
Mut3;R40 R43 |
|
* |
|
|
| 72727-71-0 |
butyl-3-hydroxy-3-methyl-5-(2,6,6-trimethyl-2-cyclohexen-1-yl)pent-4-en-1-oat |
N;R50/53 |
|
* |
|
|
| 72785-10-5 |
trans-4-[5-(4-heptylcyclohexyl)-2-pyrimidyl]benzonitril |
N;R50/53 |
|
* |
|
|
| 72785-11-6 |
trans-4-[5-(4-ethylcyclohexyl)-2-pyrimidyl]benzonitril |
N;R50/53 |
|
* |
|
|
| 72845-85-3 |
2-[2-[4-isopropylphenyl]-1-methylethyl]-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 72894-15-6 |
trideca-2,12-dienal |
N;R50/53 |
|
* |
|
|
| 72927-86-7 |
2-octylidencyclohexan-1-on |
N;R50/53 |
|
* |
|
|
| 72927-87-8 |
2-heptylidencyclohexan-1-on |
N;R50/53 |
|
* |
|
|
| 72927-94-7 |
4-[(2,6-dichlor-4-nitrophenyl)azo]-N-(4-nitrophenyl)anilin |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 72928-23-5 |
1-[4-methyl-5-(3-methyl-2-butenyl)-3-cyclohexen-1-yl]ethan-1-on |
N;R50/53 |
|
* |
|
|
| 72928-24-6 |
undec-10-enylpropionat |
N;R50/53 |
|
* |
|
|
| 72928-25-7 |
3-(4-methyl-3-cyclohexen-1-yl)but-3-enyl-2-methylbutyrat |
N;R50/53 |
|
* |
|
|
| 72928-28-0 |
alpha,2-dimethyl-5-(1-methylvinyl)cyclohex-2-en-1-acetaldehyd |
R43 N;R50/53 |
|
* |
|
|
| 72928-32-6 |
trans-4-(4-propylcyclohexyl)phenylbutyrat |
N;R50/53 |
|
* |
|
|
| 72928-55-3 |
p-cyanphenyl-trans-p-(4-pentylcyclohexyl)benzoat |
N;R50/53 |
|
* |
|
|
| 72983-68-7 |
2-methyl-5-(1-methylvinyl)-2-cyclohexen-1-acetaldehyd |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 73003-91-5 |
[3S-(3alpha,5alpha,8alpha)]-1-methyl-1-(1,2,3,4,5,6,7,8-octahydro-3,8-dimethylazulen-5-yl)ethylbutyrat |
N;R50/53 |
|
* |
|
|
| 73019-14-4 |
(E)-3,7-dimethylocta-2,6-dienyl-2-ethylbutyrat |
N;R50/53 |
|
* |
|
|
| 73179-35-8 |
11,15-dimethyl-7,10,13,16,19-pentaoxapentacosan-9,17-diol |
N;R50/53 |
|
* |
|
|
| 73246-45-4 |
(S)-methyl-2-chlorpropionat |
R10 Xi;R36 Xn;R48/22 |
* |
|
|
|
| 73276-70-7 |
N-ethylcarbazol-3-carbaldehyddiphenylhydrazon |
N;R50/53 |
|
* |
|
|
| 73287-53-3 |
6-[(1-oxoallyl)oxy]hexyl-N,N-diethyl-beta-alaninat |
R43 N;R50 |
|
* |
|
|
| 73545-11-6 |
7-(4-ethyl-1-methyloctyl)quinolin-8-ol |
R43 N;R50/53 |
|
* |
|
|
| 73545-19-4 |
(Z)-1,1-diethoxy-4-decen |
N;R50/53 |
|
* |
|
|
| 74070-46-5 |
2-chlor-6-nitro-3-phenoxyanilin |
N;R50/53 |
* |
|
|
|
| 74144-49-3 |
N-DL-alanyl-2-naphthylaminhydrochlorid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 74220-10-3 |
dikalium-O,O'-(4,4'-diaminobiphenyl-3,3'-ylen)diglycolat |
Mut3;R40 |
|
* |
|
|
| 74223-64-6 |
metsulfuron-methyl |
N;R50/53 |
* |
|
|
|
| 74332-73-3 |
3,3'-dichlorbenzidin, salte heraf |
Carc2;R45 Xn;R21 R43 N;R50/53 |
* |
|
|
|
| 74663-98-2 |
1,1-bis(cinnamyloxy)-2-phenylethan |
N;R50/53 |
|
* |
|
|
| 74743-23-0 |
ethyl-(S)-alpha-[(4-aminophenyl)methyl]-1,3-dihydro-1,3-dioxo-2H-isoindol-2-acetat |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 74753-17-6 |
4,4'-bi-m-toluidindihydrogenbis(sulfat) |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R51/5 |
|
* |
|
|
| 74753-18-7 |
4,4'-bi-o-toluidin, salte heraf |
Carc2;R45 Xn;R22 N;R51/53 |
* |
|
|
|
| 75113-37-0 |
dibutyltinhydrogenborat |
Xn;R21/22 Xi;R41 R43 T;R48/25 N;R50/53 |
* |
|
|
|
| 75150-13-9 |
[(2,4-dibrom-6-methylphenoxy)methyl]oxiran |
Mut3;R40 R43 |
|
* |
|
|
| 75790-83-9 |
5-[(4-aminophenyl)methyl]-o-toluidin |
Carc3;R40 R43 N;R51/53 |
|
* |
|
|
| 76109-32-5 |
(1S,4R,6R,7R)-(4-nitrophenylmethyl)-3-methylen-1-oxo-7-phenylacetamido-cepham-4-carboxylat |
R42 |
* |
|
|
|
| 76253-60-6 |
dichlor((dichlorphenyl)methyl)methyl-benzen, blanding af
isomerer |
N;R50/53 |
* |
|
|
|
| 76649-19-9 |
1,2-dimethyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)propen-1-ylacetat |
R43 N;R50/53 |
|
* |
|
|
| 76649-21-3 |
3-methyl-2-pentylcyclopentylacetat |
N;R50/53 |
|
* |
|
|
| 76649-22-4 |
3-methylbut-2-enylhexanoat |
N;R50/53 |
|
* |
|
|
| 77227-99-7 |
3-chlor-4,5,alpfa,alpfa,alpfa-pentafluortoluen |
R10 Xn;R20/22 N;R50-58 |
* |
|
|
|
| 77337-82-7 |
2-brom-5-nitroanisol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 77375-79-2 |
ethyl-2-(isocyanatosulfonyl)benzoat |
E;R2 R14 Xn;R22-48/22 Xi;R41 R42/43 |
* |
|
|
|
| 77536-66-4 |
asbest |
Carc1;R45 T;R48/23 |
* |
|
|
|
| 77536-67-5 |
asbest |
Carc1;R45 T;R48/23 |
* |
|
|
|
| 77536-68-6 |
asbest |
Carc1;R45 T;R48/23 |
* |
|
|
|
| 78587-05-0 |
hexythiazox |
N;R50/53 |
* |
|
|
|
| 78899-79-3 |
natrium-p-octylphenolat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 79026-03-2 |
2-[2-[4-[2-(3-cyanphenyl)vinyl]phenyl]vinyl]benzonitril |
N;R50/53 |
|
* |
|
|
| 79124-76-8 |
m-(3,4-dichlorphenoxy)benzaldehyd |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 79241-46-6 |
fluazifop-P-butyl |
Rep3;R63 N;R50/53 |
* |
|
|
|
| 79277-18-2 |
methyl-3-isocyanatosulfonylthiophen-2-carboxylat |
E;R2 R14 R42/43 Xn;R48/22 |
* |
|
|
|
| 79815-20-6 |
(S)-2,3-dihydro-1H-indol-2-carboxylsyre eller (S)-indolin-2-carboxylsyre |
R43 Xn;R48/22 Rep3;R62 |
* |
|
|
|
| 79881-89-3 |
3-(3-acetyl-4-hydroxyphenyl)-1,1-diethylurinstof |
Xn;R22-48/22 |
* |
|
|
|
| 8002-05-9 |
råolie |
Carc2;R45 |
* |
|
|
|
| 80269-97-2 |
4-chlor-2',4'-dimethoxybutyrophenon |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 80387-97-9 |
2-ethylhexyl-[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]acetat |
Rep2;R61 R43 R52/53 |
* |
|
|
|
| 8052-10-6 |
Tall-oil rosin |
|
|
|
* |
|
| 80789-70-4 |
6-amino-2-phenylquinolin-4-ol |
Mut3;R40 R43 |
|
* |
|
|
| 80858-47-5 |
[2-(cyclohexyloxy)ethyl]benzen |
N;R50/53 |
|
* |
|
|
| 81406-37-3 |
fluroxypyr-meptyl |
N;R50/53 |
* |
|
|
|
| 81880-96-8 |
(4-hydrazinophenyl)-N-methylmethansulfonamidhydrochlorid |
T;R25-48/25 R43 Mut3;R68 N;R50/53 |
* |
|
|
|
| 82097-50-5 |
triasulfuron |
N;R50/53 |
* |
|
|
|
| 82560-54-1 |
benfuracarb |
T;R23/25 N;R50/53 |
* |
|
|
|
| 82760-43-8 |
ethyl-4-[[4-[bis(2-hydroxyethyl)amino]-2-tolyl]azo]-3-brom-5-nitrobenzoat |
Mut3;R40 R43 |
|
* |
|
|
| 82991-47-7 |
trans-1-ethyl-4-(4-propylcyclohexyl)benzen |
N;R50/53 |
|
* |
|
|
| 83056-32-0 |
2-(isocyanatosulfonylmethyl)benzoesyremethylester |
R10 R14 Xn;R20-48/22 Xi;R41 R42 Mut3;R68 |
* |
|
|
|
| 83623-61-4 |
((4-phenylbutyl)hydroxyphosphory)eddikesyre |
Xi;R41 R43 Xn;R48/22 |
* |
|
|
|
| 83657-24-3 |
diniconazol |
Xn;R22 N;R50/53 |
* |
|
|
|
| 83732-48-3 |
1-(4-chlorbutoxy)-2-methylbenzen |
Xn;R22 Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 83732-49-4 |
(3-chlor-1-ethoxypropyl)benzen |
Xn;R22 Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 83846-43-9 |
Benzoic acid, 2-hydroxy-, mono-C>13-alkyl derivs., calcium salts
(2:1) |
|
|
* |
|
| 83846-85-9 |
4-(4-methylphenylthio)benzophenon |
N;R50/53 |
|
* |
|
|
| 83898-26-4 |
1-benzyl-4-(p-tolyl)piperidin-4-olhydrochlorid |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 83918-57-4 |
(?)-1-[2-(allyloxy)ethyl-2-(2,4-dichlorphenyl)]-1H-imidazoliumhydrogensulfat |
Xn;R20/22 Xi;R41 N;R50/53 |
* |
|
|
|
| 83949-36-4 |
4-(3-chlor-1-ethoxypropyl)toluen |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50/5 |
|
* |
|
|
| 84083-16-9 |
p-[(p-anilinophenyl)azo]phenol |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 84100-59-4 |
5-chlor-2-methyl-1-phenyl-1H-benzimidazol |
Mut3;R40 |
|
* |
|
|
| 84332-86-5 |
chlozolinat |
Carc3;R40 N;R51/53 |
* |
|
|
|
| 84563-49-5 |
1,4-bis[2-(vinyloxy)ethoxy]benzen |
N;R50/53 |
* |
|
|
|
| 84604-98-8 |
phenyl-4-phenyl-1-(phenylmethyl)-4-piperidylketon |
N;R50/53 |
|
* |
|
|
| 84650-02-2 |
destillater (stenkulstjære), benzenfraktion |
Carc2;R45 |
* |
|
|
|
| 84852-15-3 |
4-nonylphenol, forgrenet |
Xn;R22 C;R34 N;R50/53 |
* |
|
|
|
| 84929-98-6 |
Magnesium, bis(2-hydroxybenzoato-O1,O2)-, ar,ar'-di-C>13-alkyl
derivs. |
|
|
* |
|
| 85116-53-6 |
destillater (råolie), hydroafsvovlede termisk krakkede
middeltunge |
Carc2;R45 |
* |
|
|
|
| 85117-03-9 |
gasolier (råolie), hydroafsvovlede tunge coker vakuum- |
Carc2;R45 |
* |
|
|
|
| 85136-74-9 |
1,2-dihydro-6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(phenylazo)phenylazo]pyridin-3-carbonitril |
Carc2;R45 R53 |
* |
|
|
|
| 85153-92-0 |
hexanatrium-6,13-dichlor-3,10-bis((4-(2,5-disulfonatoanilino)-6-fluor-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacen-4,11-disulfonat |
R42/43 |
* |
|
|
|
| 85169-04-6 |
N-[2-(diethylamino)ethyl]-2-methoxy-4-nitrobenzamidmonohydrochlorid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 85204-27-9 |
3-phenylpropylcyclohexanpropionat |
N;R50/53 |
|
* |
|
|
| 85409-17-2 |
Stannane, tributyl-, mono(naphthenoyloxy |
|
|
|
|
* |
| 85509-19-9 |
flusilazol |
Rep2;R61 Xn;R22 Carc3;R40 N;R51/53 |
* |
|
|
|
| 85535-84-8 |
alkaner, C10-13-, chlor- |
Carc3;R40 N;R50/53 |
* |
|
* |
|
| 85665-54-9 |
3,5-bis(benzyl)pyridin |
Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 85702-90-5 |
S-(3-trimethoxysilyl)propyl-19-isocyanoato-11-(6-isocyantohexyl)-10,12-dioxo-2,9,11,13-tetraazanonadecanthioat |
R10 R42/43 |
* |
|
|
|
| 85721-08-0 |
2-chlor-4'-fluor-5-(trifluormethyl)benzophenon |
N;R50/53 |
|
* |
|
|
| 85750-13-6 |
4-[(2-chlor-4-nitrophenyl)azo]-N-ethyl-N-[2-[1-(2-methylpropoxy)ethoxy]ethyl]anilin |
Mut3;R40 R43 |
|
* |
|
|
| 85828-82-6 |
ethyl-3,5-diiod-4-(4-methoxyphenoxy)phenylacetat |
R43 N;R50/53 |
|
* |
|
|
| 85851-87-2 |
3,7-dimethyloct-2-enylacetat |
N;R50/53 |
|
* |
|
|
| 85866-11-1 |
3-allyldecahydro-7-methyl-1,4-methanonaphthalen-6-ol |
N;R50/53 |
|
* |
|
|
| 85895-82-5 |
(1,2,3-trimethylbut-3-enyl)benzen |
N;R50/53 |
|
* |
|
|
| 85896-09-9 |
N-(2-ethoxy-4-nitrophenyl)dibenzylamin |
N;R50/53 |
|
* |
|
|
| 85896-20-4 |
bis(oxiranylmethyl)(methylendi-p-phenylen)biscarbamat |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 85896-24-8 |
6-isopropoxy-4,6-bis(oxiranylmethoxy)-1,3,5-triazin |
Mut3;R40 R43 |
|
* |
|
|
| 85896-31-7 |
tetradec-13-enal |
N;R50/53 |
|
* |
|
|
| 85909-36-0 |
1-(2-chlorpropoxy)-2-(phenylmethyl)benzen |
N;R50/53 |
|
* |
|
|
| 85909-38-2 |
2-[(1-ethyl-3-methylpentyliden)amino]ethanol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 85946-14-1 |
1-amino-4-hydroxy-2-[2-(3-methylphenoxy)ethoxy]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 85954-11-6 |
2,2'-((3,3',5,5'-tetramethyl(1,1'-biphenyl)-4,4'-diyl)bis(oxymethylen))bisoxiran |
Mut3;R68 |
* |
|
|
|
| 85959-13-3 |
4-(phenylmethyl)[1,1'-biphenyl]-2-ol |
R43 N;R50/53 |
|
* |
|
|
| 85959-14-4 |
2-(phenylmethyl)[1,1'-biphenyl]-4-ol |
R43 N;R50/53 |
|
* |
|
|
| 86014-82-6 |
menthylpropionat- |
N;R50/53 |
|
* |
|
|
| 86022-41-5 |
methyl-threo-beta-hydroxy-4-nitro-3-phenyl-L-alaninat |
Mut3;R40 R43 |
|
* |
|
|
| 86089-17-0 |
tridecylamine, branched and linear |
|
|
|
* |
|
| 86282-42-0 |
12-hydroxydodecylmethacrylat |
R43 N;R50/53 |
|
* |
|
|
| 86393-33-1 |
7-chlor-1-cyclopropyl-6-fluor-1,4-dihydro-4-oxochinolin-3-carboxylsyre |
Xn;R22 R52/53 |
* |
|
|
|
| 86579-35-3 |
N-phenyl-N'-[4-(1,1,3,3-tetramethylbutyl)phenyl]benzen-1,4-diamin |
R43 N;R50/53 |
|
* |
|
|
| 86579-36-4 |
N-[4-(1,1-dimethylpropyl)phenyl]-N'-phenylbenzen-1,4-diamin |
R43 N;R50/53 |
|
* |
|
|
| 86579-42-2 |
N-(4-cyclohexylphenyl)-N'-phenylbenzen-1,4-diamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 86579-44-4 |
N-phenyl-N'-[4-(1-phenylethyl)phenyl]benzen-1,4-diamin |
R43 N;R50/53 |
|
* |
|
|
| 86606-44-2 |
5,7,7-trimethyl-1-octylpropionat |
N;R50/53 |
|
* |
|
|
| 86608-70-0 |
(2-(1,3-dioxolan-2-yl)ethyl)triphenylphosphoniumbromid |
Xn;R22 R33 Xi;R41 R52/53 |
* |
|
|
|
| 86626-71-3 |
2-[ethyl(3-methylphenyl)amino]ethyl-4-(trichlormethyl)benzoat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 86626-72-4 |
2-[ethyl(4-formyl-3-methylphenyl)amino]ethyl-3-(trichlormethyl)benzoat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 86626-73-5 |
2-[[4-(2,2-dicyanvinyl)-3-methylphenyl]ethylamino]ethyl-3-(trichlormethyl)benzoat |
N;R50/53 |
|
* |
|
|
| 86626-74-6 |
2-[ethyl(4-formyl-3-methylphenyl)amino]ethyl-4-(trichlormethyl)benzoat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 86626-75-7 |
2-[[4-(2,2-dicyanvinyl)-3-methylphenyl]ethylamino]ethyl-4-(trichlormethyl)benzoat |
N;R50/53 |
|
* |
|
|
| 86674-90-0 |
4-(chlormethyl)-2-(2,4-dichlorphenyl)-1,3-dioxolan |
R43 N;R50/53 |
|
* |
|
|
| 86722-66-9 |
1-[(2-hydroxyethyl)amino]-4-(methylamino)anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 86914-72-9 |
4',5-dichlor-2-hydroxy-3-methylbenzophenon |
R43 N;R50/53 |
|
* |
|
|
| 87086-01-9 |
2-ethylhexyl-3,3-dimethylbutyrat |
N;R50/53 |
|
* |
|
|
| 87237-48-7 |
2-ethoxyethyl-2-(4-(3-chlor-5-trifluormethyl-2-pyridyloxy)phenoxy)propionat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 87619-90-7 |
(E)-3-hexenyloctanoat |
N;R50/53 |
|
* |
|
|
| 87750-59-2 |
6'-fluor-3'-methyl-2-(trifluormethyl)benzophenon |
N;R50/53 |
|
* |
|
|
| 87750-61-6 |
2-chlor-4,4'-difluorbenzophenon |
N;R50/53 |
|
* |
|
|
| 88351-61-5 |
methyl-N-[3-(acetylamino)-4-[(2-brom-4,6-dinitrophenyl)azo]phenyl]-N-ethyl-beta-alaninat |
Mut3;R40 R43 |
|
* |
|
|
| 88351-63-7 |
methyl-N-[3-(acetylamino)phenyl]-N-ethyl-beta-alaninat |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 88377-66-6 |
tetradecylammoniumbis(1-(5-chlor-2-oxidophenylazo)-2-naphtholato)chromat(1-) |
Xn;R48/22 R53 |
* |
|
|
|
| 88671-89-0 |
myclobutanil |
Xn;R22 Xi;R36 Rep3;R63 N;R51/53 |
* |
|
|
|
| 89544-48-9 |
2-(2,4-dichlorphenyl)-2-(2-propenyl)oxiran |
Xi;R38 R43 N;R50/53 |
* |
|
|
|
| 90035-08-8 |
cis-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluormethylbenzyloxy)phenyl)-1-naphthyl)cumarin,
blanding med trans-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluormethylbenzyloxy)phenyl)-1-naphthyl)cumrain |
Tx;R26/27/28 T;R48/23/24/25 N;R50/53 |
* |
|
|
|
| 90481-05-3 |
Phenol, nonyl-, manuf. of, by-products from, high-boiling |
|
|
* |
|
| 90622-57-4 |
Alkanes, C9-12-iso- |
|
|
|
* |
|
| 90640-80-5 |
anthracenolie |
R45 |
|
|
* |
|
| 90640-81-6 |
anthracenolie, anthracenpasta |
R45 |
|
|
* |
|
| 90640-82-7 |
anthracenolie, med lavt indhold af anthracen |
R45 |
|
|
* |
|
| 90640-86-1 |
destillater (stenkulstjære), tunge olier |
R45 |
|
|
* |
|
| 90657-55-9 |
trans-4-cyclohexyl-L-prolinmonohydrochlorid |
Xn;R22 Xi;R38-41 R43 Rep3;R62 |
* |
|
|
|
| 90669-75-3 |
rester (råolie), dampkrakkede, destillater |
Carc2;R45 |
* |
|
|
|
| 90669-76-4 |
rester (råolie), vakuum-, lette |
Carc2;R45 |
* |
|
|
|
| 91082-17-6 |
Sulfonic acids, C10-21-alkane, Ph esyers |
|
|
|
* |
|
| 91082-32-5 |
Sulfonyl chlorides, C16-34-alkane, chloro |
|
|
|
* |
|
| 91465-08-6 |
lambda-cyhalothrin |
Xn;R21 T;R25 Tx;R26 N;R50/53 |
* |
|
|
|
| 91696-73-0 |
Benzenesulfonic acid, C14-44-branched and linear alkyl derivs.,
calcium salts |
|
|
* |
|
| 91770-80-8 |
Terpenes and Terpenoids, turpentine-oil, 3-carene fraction |
|
|
* |
|
| 91853-67-7 |
4,8,12-trimethyltrideca-3,7,11-triensyre, blanding af isomerer |
Xi;R38 N;R50/53 |
* |
|
|
|
| 91995-15-2 |
anthracenolie, anthracenpasta, anthracenfraktion |
R45 |
|
|
* |
|
| 91995-17-4 |
anthracenolie, anthracenpasta, lette destillationsfraktioner |
R45 |
|
|
* |
|
| 91995-42-5 |
destillater (stenkulstjære), tunge olier, pyrenfraktion |
R45 |
|
|
* |
|
| 91995-52-7 |
destillater (stenkulstjære), beg-, pyrenfraktion |
R45 |
|
|
* |
|
| 91995-78-7 |
ekstrakter (råolie), let vakuumgasolie solvent |
Carc2;R45 |
* |
|
|
|
| 92045-14-2 |
brændselsolie, tung, højt svovlindhold |
Carc2;R45 |
* |
|
|
|
| 92045-29-9 |
gasolier (råolie), termisk krakkede, hydrogenafsvovlede |
Carc2;R45 |
* |
|
|
|
| 92061-94-4 |
rester (stenkulstjære), begdestillations |
R45 |
|
|
* |
|
| 92061-97-7 |
rester (råolie), katalytisk kraknings- |
Carc2;R45 |
* |
|
|
|
| 92062-00-5 |
rester (råolie), hydrogeneret dampkrakket naphtha |
Carc2;R45 |
* |
|
|
|
| 92062-04-9 |
rester (råolie), dampkrakkede naphthadestillations- |
Carc2;R45 |
* |
|
|
|
| 92201-59-7 |
destillater (råolie), intermediære katalytisk
krakkede, termisk nedbrudte |
Carc2;R45 |
* |
|
|
|
| 92201-60-0 |
destillater (råolie), lette katalytisk krakkede,
termisk nedbrudte |
Carc2;R45 |
* |
|
|
|
| 92552-31-3 |
5-benzyl-2-methylbenzoxazol |
R43 N;R50/53 |
|
* |
|
|
| 92836-10-7 |
1-(2,3-dihydro-1,3,3,6-tetramethyl-1-(1-methylethyl)-1H-inden-5-yl)ethanon |
Xn;R22-48/22 N;R51/53 |
* |
|
|
|
| 93107-30-3 |
1-cyclopropyl-6,7-difluor-1,4-dihydro-4-oxoquinolin-3-carboxylsyre |
Rep3;R62 R52/53 |
* |
|
|
|
| 93685-81-5 |
Hydrocarbons, C4, 1,3-butadiene-free, polymd., triisobutylene fraction,
hydrogenated |
|
|
* |
|
| 93763-85-0 |
rester (råolie), dampkrakket varmeudblødt
naphtha |
Carc2;R45 |
* |
|
|
|
| 93803-41-9 |
octahydro-4,7-methano-1H-inden-5-methylpropionat |
N;R50/53 |
|
* |
|
|
| 93803-42-0 |
(octahydro-4,7-methano-1H-inden-5-yl)methylbutyrat |
N;R50/53 |
|
* |
|
|
| 93803-69-1 |
N-[2-(2-methoxyethoxy)ethyl]benzen-1,4-diamin |
Mut3;R40 R43 R52/53 |
|
* |
|
|
| 93804-02-5 |
octahydro-4,7-methano-1H-indenmethylpropionat |
N;R50/53 |
|
* |
|
|
| 93804-13-8 |
ethyl-2-hexyl-4-oxocyclohexancarboxylat |
N;R50/53 |
|
* |
|
|
| 93804-60-5 |
[2-(pentyloxy)ethyl]benzen |
N;R50/53 |
|
* |
|
|
| 93805-15-3 |
methyl-N-[3-(acetylamino)phenyl]-beta-alaninat |
Mut3;R40 R43 |
|
* |
|
|
| 93805-46-0 |
1-isocyanato-3-[(4-isocyanatocyclohexyl)methyl]-2-methylcyclohexan |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 93805-52-8 |
2-[(2-isocyanatocyclohexyl)methyl]-p-tolylisocyanat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 93805-53-9 |
2-isocyanato-4-[(2-isocyanatocyclohexyl)methyl]-1-methylcyclohexan |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 93805-68-6 |
ethyl-3-methyl-3-[2-(2,6,6-trimethylcyclohex-2-en-1-yl)vinyl]oxiran-2-carboxylat |
N;R50/53 |
|
* |
|
|
| 93805-74-4 |
octahydro-5-isobutyl-4,7-methano-1H-inden-5-ylacetat |
N;R50/53 |
|
* |
|
|
| 93805-75-5 |
1-methyl-3-(2,6,6-trimethyl-2-cyclohexen-1-yl)allylphenylacetat |
N;R50/53 |
|
* |
|
|
| 93805-76-6 |
4-cyclopentyl-2-methylcyclohexylacetat |
N;R50/53 |
|
* |
|
|
| 93819-97-7 |
N,N-bis(2-hydroxyethyl)-4-[[4,4,5,5,5-pentafluor-3-(pentafluorethyl)-1,2,3-tris(trifluormethyl)pent-1-enyl]oxy]benzensulfonamid |
N;R50/53 |
|
* |
|
|
| 93821-66-0 |
restolier (råolie), |
Carc2;R45 |
* |
|
|
|
| 93839-20-4 |
N-[4-(aminocarbonyl)phenyl]-4-methoxy-3-nitrobenzamid |
Mut3;R40 |
|
* |
|
|
| 93839-21-5 |
N-[4-(aminocarbonyl)phenyl]-4-nitrobenzamid |
Mut3;R40 |
|
* |
|
|
| 93839-37-3 |
N'-(2-aminoethyl)-N,N-dioctylethylendiamin |
R43 N;R50/53 |
|
* |
|
|
| 93839-70-4 |
4-[(2-aminobenzyl)amino]cyclohexan-1-ol |
Mut3;R40 |
|
* |
|
|
| 93840-38-1 |
2-cyclohexyl-6-isobutyl-p-cresol |
R43 N;R50/53 |
|
* |
|
|
| 93840-40-5 |
2,6-dicyclohexyl-m-cresol |
R43 N;R50/53 |
|
* |
|
|
| 93840-44-9 |
2,6-dicyclohexyl-3,5-xylenol |
R43 N;R50/53 |
|
* |
|
|
| 93840-45-0 |
6-tert-butyl-2-cyclopentyl-4-(methoxymethyl)phenol |
R43 N;R50/53 |
|
* |
|
|
| 93840-60-9 |
4,4'-trimethylenbis(oxy)bis[3-brombenzonitril] |
R43 N;R50/53 |
|
* |
|
|
| 93840-76-7 |
4-(3-methoxyprop-1-en-1-yl)-1,3-dimethylcyclohexen |
N;R50/53 |
|
* |
|
|
| 93840-77-8 |
4-(2,5-dimethylcyclohexyliden)-2-butenal |
Xn;R22 N;R50/53 |
|
* |
|
|
| 93840-78-9 |
5,9-dimethyl-2-decenal |
N;R50/53 |
|
* |
|
|
| 93840-82-5 |
5-ethylnon-2-en-1-ol |
N;R50/53 |
|
* |
|
|
| 93840-84-7 |
ethyl-3-(2,5,6,6-tetramethyl-2-cyclohexen-1-yl)acrylat |
R43 N;R50/53 |
|
* |
|
|
| 93840-85-8 |
2-(4-methoxybutyliden)-1,3,3-trimethylbicyclo[2.2.1]heptan |
N;R50/53 |
|
* |
|
|
| 93841-36-2 |
2-cyclopentyl-6-isobutyl-p-cresol |
R43 N;R50/53 |
|
* |
|
|
| 93843-00-6 |
1-(3-cyclohexyl-3-phenyl-2-allyl)pyrrolidin |
N;R50/53 |
|
* |
|
|
| 93843-18-6 |
3-[[4-[(4-aminophenyl)methyl]phenyl]amino]-2-hydroxypropylneodecanoat |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 93843-20-0 |
isotetradecan-1-al |
N;R50/53 |
|
* |
|
|
| 93856-87-2 |
14-(p-chlor-m-methylphenoxy)-3,6,9,12-tetraoxatetradecan-1-ol |
R43 N;R50/53 |
|
* |
|
|
| 93856-91-8 |
1-[2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]-3-isopropylurinstof |
Mut3;R40 |
|
* |
|
|
| 93856-93-0 |
ethyl-[2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]-carbamat |
Mut3;R40 |
|
* |
|
|
| 93856-95-2 |
2,3,3-trichlor-N-[2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]acrylamid |
Mut3;R40 |
|
* |
|
|
| 93856-97-4 |
allyl-4-chlor-2-(allyloxy)benzoat |
R43 N;R50/53 |
|
* |
|
|
| 93857-06-8 |
6-[4,4-diethoxy-3-methyl-2(og 3)-butenyl]-1,5,5-trimethylcyclohexen |
N;R50/53 |
|
* |
|
|
| 93858-04-9 |
2-[[4-[[2-chlor-4-(methylsulfonyl)phenyl]azo]phenyl]ethylamino]ethanol |
Mut3;R40 R43 |
|
* |
|
|
| 93858-05-0 |
N,N'-(9,10-dihydro-2-nitro-9,10-dioxo-1,4-anthracendiyl)bisacetamid |
Mut3;R40 |
|
* |
|
|
| 93858-52-7 |
3,4-dimethyl-N-phenylphenethylamin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 93919-92-7 |
(±)-3,7-dimethyloct-6-enylisovalerat |
N;R50/53 |
|
* |
|
|
| 93919-94-9 |
2-(3,3-dimethylbicyclo[2.2.1]hept-2-yliden)ethylisobutyrat |
N;R50/53 |
|
* |
|
|
| 93919-95-0 |
1,1'-[(2-phenylethyliden)bis(oxy-2,1-ethandiyl)]bisbenzen |
N;R50/53 |
|
* |
|
|
| 93920-05-9 |
alpha-methyl-N-phenyl-N-[4-(1-phenylethyl)phenyl]benzylamin |
N;R50/53 |
|
* |
|
|
| 93920-06-0 |
alpha-methyl-N,N-diphenylbenzylamin |
N;R50/53 |
|
* |
|
|
| 93923-80-9 |
bicyclo[2.2.1]hept-2-ylmethylcyclohexancarboxylat |
N;R50/53 |
|
* |
|
|
| 93923-92-3 |
(2E,6Z)-dodeca-2,6-dienylacetat |
N;R50/53 |
|
* |
|
|
| 93939-85-6 |
trans-1,2,3,5,6,7,8,8a-octahydro-1a,8a-dimethyl-7-(1-methylethyliden)naphthalen |
N;R50/53 |
|
* |
|
|
| 93940-03-5 |
4-[(2-methoxy-5-methylphenyl)azo]naphthol |
Mut3;R40 |
|
* |
|
|
| 93940-29-5 |
ethyl-2-[[2-[(2-ethylhexyl)oxy]ethyliden]amino]benzoat |
R43 N;R50/53 |
|
* |
|
|
| 93940-30-8 |
methyl-2-[[2-[(3,7-dimethyl-6-octenyl)oxy]ethyliden]amino]benzoat |
N;R50/53 |
|
* |
|
|
| 93940-31-9 |
(Z)-3-hexenyl-2-[(7-hydroxy-3,7-dimethyloctyliden)amino]benzoat |
N;R50/53 |
|
* |
|
|
| 93940-59-1 |
(1alpha,2beta,5alpha)-2-isopropyl-5-methylcyclohexyloctanoat |
N;R50/53 |
|
* |
|
|
| 93941-02-7 |
isopropyl-1H-indol-3-propionat |
N;R50/53 |
|
* |
|
|
| 93941-77-6 |
1,2-phenylendihexanoat |
R43 N;R50/53 |
|
* |
|
|
| 93942-33-7 |
4',5-dichlor-2-hydroxychalcon |
R43 N;R50/53 |
|
* |
|
|
| 93942-39-3 |
ethyl-alpha-[[4-[bis(2-chlorethyl)amino]phenyl]methyl]-1,3-dihydro-1,3-dioxo-2H-isoindol-2-acetat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 93942-47-3 |
1-[5-(tert-butyl)-2-methylphenyl]-2-buten-1-on |
N;R50/53 |
|
* |
|
|
| 93942-61-1 |
1-(2,3-dichlorphenyl)ethan-1-onoxim |
R43 N;R50/53 |
|
* |
|
|
| 93942-75-7 |
1-phenyl-2-[4-(phenylmethoxy)phenyl]hydrazin |
Xn;R22 Carc3;R40 |
|
* |
|
|
| 93951-31-6 |
tris(chloropropanol)thiophosphat |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 93962-66-4 |
1-(3-brompropyl)-2,4-dichlorbenzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 93962-68-6 |
3-(5-chlor-2-hydroxyphenyl)-1-(4-chlorphenyl)propan-1-on |
N;R50/53 |
|
* |
|
|
| 93962-83-5 |
N,N'-dibenzylidenoctahydro-4,7-methano-1H-indendimethylamin |
N;R50/53 |
|
* |
|
|
| 93962-84-6 |
(octahydro-4,7-methano-1H-indenyl)methylacrylat |
Mut3;R40 R43 N;R50/53 |
|
* |
|
|
| 93963-10-1 |
ethyl-2-propylhept-2-enoat |
N;R50/53 |
|
* |
|
|
| 93963-27-0 |
3-chlor-N-[4-chlor-2-(anilino)phenyl]propionamid |
R43 N;R50/53 |
|
* |
|
|
| 93963-29-2 |
ethyl-2-phenylbicyclo[2.2.1]hept-5-en-2-carboxylat |
N;R50/53 |
|
* |
|
|
| 93963-32-7 |
ethyl-2-phenylbicyclo[2.2.1]heptan-2-carboxylat |
N;R50/53 |
|
* |
|
|
| 93963-43-0 |
2-[2-[4-isopropylcyclohexyl]-1-methylethyl]-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 93963-48-5 |
1-(hydroxymethyl)undecylmethacrylat |
R43 N;R50/53 |
|
* |
|
|
| 93963-89-4 |
N-isononylcyclohexylamin |
Xn;R22 N;R50/53 |
|
* |
|
|
| 93963-90-7 |
N,N-diisobutylisononylamin |
R43 N;R50/53 |
|
* |
|
|
| 93964-12-6 |
1,4-bis[(3-methoxypropyl)amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 93966-39-3 |
(±)(1alpha,2alpha,5beta)-5-methyl-2-(1-methylethyl)cyclohexylsalicylat |
N;R50/53 |
|
* |
|
|
| 93966-40-6 |
(±)(1alpha,2beta,5beta)-5-methyl-2-(1-methylethyl)cyclohexylsalicylat |
N;R50/53 |
|
* |
|
|
| 93966-58-6 |
1-[[4-[(4-aminophenyl)methyl]phenyl]amino]-3-butoxypropan-2-ol |
Xn;R22 Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 93980-93-9 |
1-(1,1-dimethylpropyl)-4-(2-nitrophenoxy)benzen |
N;R50/53 |
|
* |
|
|
| 93980-94-0 |
2,4-bis(2-methylphenoxy)-1-nitrobenzen |
Mut3;R40 Carc3;R40 N;R50/53 |
|
* |
|
|
| 93981-12-5 |
1-methylheptylcyclopent-2-en-1-acetat |
N;R50/53 |
|
* |
|
|
| 93981-55-6 |
(Z)-3,7-dimethyl-2,6-octadienyl-2-methylcrotonat |
N;R50/53 |
|
* |
|
|
| 93981-59-0 |
1-methoxytridec-5-en |
N;R50/53 |
|
* |
|
|
| 93981-81-8 |
1,3-dimethyl-3-phenylbutylisobutyrat |
N;R50/53 |
|
* |
|
|
| 93982-52-6 |
3-[(4-amino-2,5-dimethylphenyl)azo]naphthalen-1,5-disulfonsyre |
Mut3;R40 |
|
* |
|
|
| 93982-57-1 |
isopropyl-1H-indol-1-propionat |
N;R50/53 |
|
* |
|
|
| 93982-69-5 |
ethyl-beta-hexyl-2-oxocyclopentanpropionat |
N;R50/53 |
|
* |
|
|
| 93982-70-8 |
1-methyl-3-(2,6,6-trimethylcyclohex-2-enyl)allylisobutyrat |
N;R50/53 |
|
* |
|
|
| 93982-97-9 |
phenylmethyl[3-(2-methylphenoxy)-3-phenylpropyl]-carbamat |
N;R50/53 |
|
* |
|
|
| 93982-98-0 |
4-chlor-N-(5-ethyl-2-hydroxyphenyl)benzamid |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 93983-14-3 |
2-chlor-1-(chlormethyl)-3,4-dimethoxybenzen |
Mut3;R40 R43 |
|
* |
|
|
| 94006-37-8 |
methyl-3-(2-methoxy-5-nitrophenyl)acrylat |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 94021-31-5 |
2-[(3,5-diaminophenyl)azo]-4-[(2,4-diaminophenyl)azo]anisol |
Mut3;R40 |
|
* |
|
|
| 94021-76-8 |
6,7-dihydrodipyrido[1,2-a:2',1'-c]pyrazindiyliumdihydroxid |
Xn;R22 Tx;R26 Xi;R36/37/38 R43 T;R48/25 N;R50/53 |
* |
|
|
|
| 94021-79-1 |
3,5,5-trimethylcyclohexylpropionat |
N;R50/53 |
|
* |
|
|
| 94021-80-4 |
3,6,7-trimethyloct-2-en-1-ylacetat |
N;R50/53 |
|
* |
|
|
| 94021-96-2 |
3,7-dimethyloct-6-enyl-2-ethylbutyrat |
N;R50/53 |
|
* |
|
|
| 94022-03-4 |
(S)-3,7-dimethyl-6-octenyl-3-methyl-2-butenoat |
N;R50/53 |
|
* |
|
|
| 94022-18-1 |
5-tert-butyl-2-cyclopentyl-m-cresol |
R43 N;R50/53 |
|
* |
|
|
| 94022-20-5 |
2,4-dicyclopentyl-6-isopropyl-m-cresol |
R43 N;R50/53 |
|
* |
|
|
| 94022-22-7 |
2,5,6-triisopropyl-m-cresol |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 94022-23-8 |
2,6-dicyclopentyl-5-isopropyl-m-cresol |
R43 N;R50/53 |
|
* |
|
|
| 94022-25-0 |
4-amino-N-[4-[2,4-bis(1,1-dimethylethyl)phenoxy]butyl]-1-hydroxynaphthalen-2-carboxamid |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 94022-26-1 |
2,5-dimethoxy[1,1'-biphenyl]-4-amin |
Mut3;R40 |
|
* |
|
|
| 94022-31-8 |
2-[3-(4-chlorphenyl)propyl]pyridin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 94022-61-4 |
1-bicyclo[2.2.1]hept-2-ylethylbutyrat |
R43 N;R50/53 |
|
* |
|
|
| 94022-63-6 |
3-(bicyclo[2.2.1]hept-5-en-2-yl)-2-methylallylacetat |
N;R50/53 |
|
* |
|
|
| 94022-65-8 |
ethyl-5-(1,1-dimethylethyl)-alpha-methyl-2-oxocyclohexanacetat |
N;R50/53 |
|
* |
|
|
| 94022-94-3 |
1-(2-chlorethyl)-2-(trifluormethyl)benzen |
Xn;R22 N;R50/53 |
|
* |
|
|
| 94023-74-2 |
methyl-3,5-dichlor-4-[2-[2-chlor-4-(methoxycarbonyl)phenoxy]ethoxy]benzoat |
R43 N;R50/53 |
|
* |
|
|
| 94030-95-2 |
N-[3-[(3-fluorphenyl)methylamino]-2-hydroxypropyl]benzamid |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 94042-96-3 |
3,5-bis(1,1-dimethylethyl)-N,N-diethylanilin |
N;R50/53 |
|
* |
|
|
| 94043-01-3 |
hexyl-2-(2,4,5-trichlorphenoxy)propionat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 94050-51-8 |
4-chlorphenylcyclopropylketon-O-(4-aminobenzyl)oxim |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| 94097-88-8 |
(E,Z)-4-chlorphenyl(cyclopropyl)keton-O-(4-nitrophenylmethyl)oxim |
R43 N;R50/53 |
* |
|
|
|
| 94125-34-5 |
prosulfuron eller 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(3,3,3-trifluorpropyl)benzensulfonyl]urinstof |
Xn;R22 N;R50/53 |
* |
|
|
|
| 94134-18-6 |
2-methoxy-6-propylnaphthalen |
N;R50/53 |
|
* |
|
|
| 94134-28-8 |
[[(2-methyltetradecyl)oxy]methyl]oxiran |
Mut3;R40 R43 N;R51/53 |
|
* |
|
|
| 94134-29-9 |
bis[2-hydroxy-3-[4-(oxiranylmethoxy)butoxy]propyl]azelat |
Mut3;R40 R43 |
|
* |
|
|
| 94134-32-4 |
butyl-4-(1,1-dimethylethyl)benzoat |
N;R50/53 |
|
* |
|
|
| 94134-39-1 |
1-[(3,7-dimethyl-2,6-octadienyl)oxy]-3-phenylpropan-1,2-diol |
N;R50/53 |
|
* |
|
|
| 94134-43-7 |
2,2'-[heptylidenbis(thiomethylen)]bisfuran |
N;R50/53 |
|
* |
|
|
| 94134-48-2 |
methyl-3-(chlorcarbonyl)thiazolidin-4-carboxylat |
Mut3;R40 |
|
* |
|
|
| 94134-77-7 |
1-methyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)allylphenylacetat |
R43 N;R50/53 |
|
* |
|
|
| 94134-88-0 |
2-methyl-6-methylenoct-7-en-2-ylpropionat |
N;R50/53 |
|
* |
|
|
| 94134-93-7 |
[4-(1-methylethyl)phenyl]methylsalicylat |
R43 N;R50/53 |
|
* |
|
|
| 94134-95-9 |
(17beta)-17-[[[4-(butoxycarbonyl)cyclohexyl]carbonyl]oxy]androst-4-en-3-on |
N;R50/53 |
|
* |
|
|
| 94135-10-1 |
pentyl-4-methylsalicylat |
N;R50/53 |
|
* |
|
|
| 94135-46-3 |
butyl-3-hydroxy-3,4-dimethyl-5-(2,6,6-trimethyl-2-cyclohexen-1-yl)pent-4-en-1-oat |
N;R50/53 |
|
* |
|
|
| 94135-55-4 |
oxiranylmethyloctadecylcarbamat- |
Mut3;R40 R52/53 |
|
* |
|
|
| 94135-75-8 |
hex-3-enyl-(Z)-cinnamat |
N;R50/53 |
|
* |
|
|
| 94135-94-1 |
allyloct-2-enoat |
N;R50/53 |
|
* |
|
|
| 94135-97-4 |
alpha-ethyl-beta,beta,4-trimethylcyclohex-3-en-1-ethanol |
N;R50/53 |
|
* |
|
|
| 94136-01-3 |
5-(2-bromethyl)quinolin-8-ol |
Xn;R22 Mut3;R40 |
|
* |
|
|
| 94138-68-8 |
2-[4-(3-benzofuryl)phenyl]-5-naphtho[2,1-b]furan-2-yl-1,3,4-oxadiazol |
N;R50/53 |
|
* |
|
|
| 94138-69-9 |
2-[4-(2-benzofuryl)phenyl]-5-naphtho[2,3-b]furan-2-yl-1,3,4-oxadiazol |
N;R50/53 |
|
* |
|
|
| 94157-91-2 |
2,6-difluor-N-[[[2-methyl-4-[2,2,2-trifluor-1-hydroxy-1-(trifluormethyl)ethyl]phenyl]amino]carbonyl]benzamid |
N;R50/53 |
|
* |
|
|
| 94157-92-3 |
N-[[[2,5-dimethyl-4-[2,2,2-trifluor-1-hydroxy-1-(trifluormethyl)ethyl]phenyl]amino]carbonyl]-2,6-difluorbenzamid |
N;R50/53 |
|
* |
|
|
| 94158-36-8 |
4-(1,1-dimethylethyl)-2-[[4-(1,1-dimethylethyl)-2-hydroxyphenyl]dithio]phenol |
N;R50/53 |
|
* |
|
|
| 94158-50-6 |
1-[5-[[[(4-chlorphenyl)amino]carbonyl]amino]-o-tolyl]-3-(p-tolyl)urinstof |
Mut3;R40 N;R51/53 |
|
* |
|
|
| 94158-69-7 |
4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-hydroxyundecyldihydrogenphosphat |
N;R50/53 |
|
* |
|
|
| 94158-76-6 |
p-(2-methyl-1-phenyl-1-butenyl)toluen |
R43 N;R50/53 |
|
* |
|
|
| 94158-91-5 |
2-[formyl(2-hydroxyethyl)amino]ethyl-(9Z,12Z)-octadeca-9,12-dienoat |
N;R50/53 |
|
* |
|
|
| 94159-14-5 |
1-methylnonylmethacrylat |
R43 N;R50/53 |
|
* |
|
|
| 94159-40-7 |
ethylbis(3,5-dibrom-4-hydroxyphenyl)acetat |
R43 N;R50/53 |
|
* |
|
|
| 94159-41-8 |
bis(3,5-dibrom-4-hydroxyphenyl)eddikesyre |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 94159-45-2 |
ethyl-N-[[2-(2,4-diisopropylbenzensulfonylamino)]benzoyl]anthranilat |
N;R50/53 |
|
* |
|
|
| 94159-62-3 |
[(o-nonylphenoxy)methyl]oxiran |
Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 94159-75-8 |
3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxapentacontan-1-ol |
N;R50/53 |
|
* |
|
|
| 94159-81-6 |
1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecan-2-ol |
N;R50/53 |
|
* |
|
|
| 94159-84-9 |
4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecan-1,2-diol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 94159-85-0 |
alpha-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluornonyl)aziridin-1-ethanol |
N;R50/53 |
|
* |
|
|
| 94159-86-1 |
4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluor-1-(vinyloxy)undecan-2-ol |
N;R50/53 |
|
* |
|
|
| 94160-04-0 |
3-amino-4-chlor-N-phenylbenzensulfonamid |
Mut3;R40 |
|
* |
|
|
| 94160-26-6 |
1,2,3-propantriyltris[oxy(1-methyl-2,1-ethandiyl)]triacrylat |
R43 N;R50/53 |
|
* |
|
|
| 94160-29-9 |
2-[2,3-bis(2-hydroxypropoxy)propoxy]isopropyl-2-[2-(2-hydroxypropoxy)-3-[2-[(1-oxoallyl)oxy]propoxy]propoxy]isopropyladipat |
R43 N;R50/53 |
|
* |
|
|
| 94160-30-2 |
bis[2-[2-(2-hydroxypropoxy)-3-[2-[(1-oxoallyl)oxy]propoxy]propoxy]isopropyl]adipat |
R43 N;R50/53 |
|
* |
|
|
| 94160-32-4 |
1,4,12-trimethyl-14-oxo-8-[2-[(1-oxoallyl)oxy]propoxy]-3,6,10,13-tetraoxahexadec-15-en-1-ylacrylat |
R43 N;R50/53 |
|
* |
|
|
| 94160-34-6 |
2-[3-[2-(acryloyloxy)propoxy]-[2-(2-hydroxypropoxy)]propoxy]-1-methylethyl-2-[2,3-bis[2-(acryloyloxy)propoxy]propoxy]-1-methylethyladipat |
R43 N;R50/53 |
|
* |
|
|
| 94166-41-3 |
3-cyclohexyl-5-[4-(1-ethylnaphth[1,2-d]oxazol-2(1H)-yliden)-1-methylbut-2-enyliden]-2-thioxothiazolidin-4-on |
N;R50/53 |
|
* |
|
|
| 94166-53-7 |
1,3-bis(2-chlor-6-methylphenoxy)propan-2-ol |
R43 N;R50/53 |
|
* |
|
|
| 94166-78-6 |
5-[(2-isocyanatocyclohexyl)methyl]-o-tolylisocyanat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 94166-79-7 |
3-[(2-isocyanatocyclohexyl)methyl]-o-tolylisocyanat |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 94166-83-3 |
5-(o-isocyanatobenzyl)-2-methyl-m-phenylendiisocyanat |
R43 N;R50/53 |
|
* |
|
|
| 94166-84-4 |
5-(o-isocyanatobenzyl)-6-methyl-m-phenylendiisocyanat |
R43 N;R50/53 |
|
* |
|
|
| 94199-59-4 |
methyl-2-[(2,6,10-trimethyl-9-undecenyliden)amino]benzoat |
N;R50/53 |
|
* |
|
|
| 94199-92-5 |
2,4,6-tripropylbenzaldehyd |
R43 N;R50/53 |
|
* |
|
|
| 94200-04-1 |
2-phenylpropylsalicylat |
N;R50/53 |
|
* |
|
|
| 94200-05-2 |
2-ethylheptylbutyrat |
N;R50/53 |
|
* |
|
|
| 94200-07-4 |
2-ethylheptylisobutyrat |
N;R50/53 |
|
* |
|
|
| 94200-08-5 |
2-ethylheptylpropionat |
N;R50/53 |
|
* |
|
|
| 94200-12-1 |
3,3,5-trimethylcyclohexylbutyrat |
N;R50/53 |
|
* |
|
|
| 94200-27-8 |
2,4-bis-(2,2,3-trimethylcyclopent-3-enyl)butanol |
N;R50/53 |
|
* |
|
|
| 94200-28-9 |
beta,.delta.,2,2,3-pentamethylcyclopent-3-en-1-hexanol |
N;R50/53 |
|
* |
|
|
| 94200-29-0 |
bis[p-(1-phenylethyl)phenyl]hydrogenphosphat |
N;R50/53 |
|
* |
|
|
| 94200-30-3 |
bis[o-(1-phenylethyl)phenyl]hydrogenphosphat |
N;R50/53 |
|
* |
|
|
| 94200-71-2 |
2-acetamido-3-(p-hydroxyphenyl)-N-(p-nitrophenyl)propionamid |
Xn;R22 Mut3;R40 R43 |
|
* |
|
|
| 94200-95-0 |
alpha,alpha,3,3-tetramethylbicyclo[2.2.1]heptan-2-ethanol |
R43 N;R50/53 |
|
* |
|
|
| 94200-96-1 |
4-(3-ethyl-5-methylcyclohexyliden)-2-buten-1-ylacetat |
N;R50/53 |
|
* |
|
|
| 94200-97-2 |
4-(3-ethyl-5-methylcyclohexyl)-2-butenal |
N;R50/53 |
|
* |
|
|
| 94201-01-1 |
4-methyl-1-(3-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-3-enylacetat |
N;R50/53 |
|
* |
|
|
| 94201-02-2 |
2,4,6-trimethyl-alpha-(2-methylallyl)cyclohex-3-en-1-methylacetat |
N;R50/53 |
|
* |
|
|
| 94201-04-4 |
4-(1,3-dimethyl-1,3-butadienyl)-3,7,7-trimethylbicyclo[4.1.0]hept-2-en |
N;R50/53 |
|
* |
|
|
| 94201-12-4 |
2-(1-methylpentyl)-4-phenyl-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 94201-13-5 |
(3,3-dimethyl-2-norbornyl)-2-methyl-2-buten-1-ylacetat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 94201-14-6 |
4-(3,3-dimethyl-2-norbornyl)-2-methyl-2-buten-1-ol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 94201-15-7 |
1,1-dimethyl-2-phenylethyl-3-methyl-2-butenoat |
N;R50/53 |
|
* |
|
|
| 94201-28-2 |
1-(3-methylbicyclo[2.2.1]hept-2-yl)propylacetat |
N;R50/53 |
|
* |
|
|
| 94201-33-9 |
ethyl-3-[3,5-bis(1-methylethyl)phenyl]acrylat |
N;R50/53 |
|
* |
|
|
| 94201-35-1 |
1,5-dimethyl-1-(2-methylallyl)hex-4-enylacetat |
N;R50/53 |
|
* |
|
|
| 94201-38-4 |
5-(3,3-dimethyl-2-norbornyl)pent-4-en-1-al |
R43 N;R50/53 |
|
* |
|
|
| 94201-55-5 |
5-fluor-p-terphenyl-2-ol |
Mut3;R40 N;R50/53 |
|
* |
|
|
| 94201-65-7 |
alpha-(1,1-dimethylethyl)-2,4,6-trimethylcyclohex-3-en-1-methylacetat |
N;R50/53 |
|
* |
|
|
| 94201-66-8 |
tetrahydro-6-methyl-4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-2H-pyran-2-on |
R43 N;R50/53 |
|
* |
|
|
| 94201-67-9 |
tetrahydro-6-methyl-4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2H-pyran-2-on |
R43 N;R50/53 |
|
* |
|
|
| 94201-68-0 |
isobutyl-1,2,3,4,5,6,7,8-octahydro-2,8,8-trimethyl-2-naphthoat |
N;R50/53 |
|
* |
|
|
| 94201-71-5 |
2,6,10-trimethylundeca-1,9-dien-4-yl acetat |
N;R50/53 |
|
* |
|
|
| 94201-73-7 |
tetrahydro-4-methyl-2-phenyl-2H-pyran |
N;R50/53 |
|
* |
|
|
| 94201-85-1 |
1-(3,4-dichlorphenyl)-3-[3-(dimethylamino)phenyl]urinstof |
Xn;R22 Mut3;R40 N;R51/53 |
|
* |
|
|
| 94213-28-2 |
4-isocyanato-2-[(2-isocyanatocyclohexyl)methyl]-1-methylcyclohexan |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 94213-29-3 |
1-isocyanato-3-[(2-isocyanatocyclohexyl)methyl]-2-methylcyclohexan |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 94213-30-6 |
2-[(5-amino-2-methylphenyl)methyl]benzen-1,3-diamin |
Xn;R22 Carc3;R40 R43 |
|
* |
|
|
| 94213-31-7 |
2-[(3-amino-4-methylphenyl)methyl]benzen-1,3-diamin |
Xn;R22 Carc3;R40 R43 R52/53 |
|
* |
|
|
| 94213-33-9 |
4-[(5-amino-2-methylphenyl)methyl]benzen-1,3-diamin |
Carc3;R40 R43 |
|
* |
|
|
| 94213-34-0 |
4-[(3-amino-4-methylphenyl)methyl]benzen-1,3-diamin |
Carc3;R40 R43 R52/53 |
|
* |
|
|
| 94213-35-1 |
4-[(3-amino-2-methylphenyl)methyl]benzen-1,3-diamin |
Carc3;R40 R43 R52/53 |
|
* |
|
|
| 94213-36-2 |
2-[(5-isocyanato-2-methylphenyl)methyl]-m-phenylendiisocyanat |
R43 N;R50/53 |
|
* |
|
|
| 9421337-3 |
2-[(3-isocyanato-4-methylphenyl)methyl]-m-phenylendiisocyanat |
R43 N;R50/53 |
|
* |
|
|
| 94213-38-4 |
2-[(3-isocyanato-2-methylphenyl)methyl]-m-phenylendiisocyanat |
R43 N;R50/53 |
|
* |
|
|
| 94213-39-5 |
4-[(5-isocyanato-2-methylphenyl)methyl]-m-phenylendiisocyanat |
R43 N;R50/53 |
|
* |
|
|
| 94213-40-8 |
4-[(3-isocyanato-4-methylphenyl)methyl]-m-phenylendiisocyanat |
R43 N;R50/53 |
|
* |
|
|
| 94213-41-9 |
4-[(3-isocyanato-o-tolyl)methyl]-1,3-phenylendiisocyanat |
R43 N;R50/53 |
|
* |
|
|
| 94213-42-0 |
ethyl-2-nitro-3-phenyl-L-alaninat |
Mut3;R40 R43 |
|
* |
|
|
| 94213-46-4 |
4'-brom-alpha-(4-chlorphenyl)-alpha-ethyl[1,1'-biphenyl]-4-methanol |
R43 N;R50/53 |
|
* |
|
|
| 94230-80-5 |
propylundec-10-enoat |
N;R50/53 |
|
* |
|
|
| 94231-48-8 |
2-methyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)-2-butenylacetat |
N;R50/53 |
|
* |
|
|
| 94231-49-9 |
2-[2-(2,2,3-trimethyl-3-cyclopenten-1-yl)ethyliden]-1-pentylacetat |
N;R50/53 |
|
* |
|
|
| 94231-50-2 |
2-ethyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)-2-butenylacetat |
N;R50/53 |
|
* |
|
|
| 94231-52-4 |
decahydro-5-(2-methoxyethyl)-1,1,4a,6-tetramethylnaphthalen |
N;R50/53 |
|
* |
|
|
| 94231-53-5 |
ethyldecahydro-2,5,5,8a-tetramethylnaphthalen-1-acetat |
N;R50/53 |
|
* |
|
|
| 94231-55-7 |
6,6-dimethyl-alpha-propylbicyclo[3.1.1]heptan-2-propanol |
N;R50/53 |
|
* |
|
|
| 94231-62-6 |
2,6-di-tert-butyl-3-ethylphenol |
Xn;R22 N;R50/53 |
|
* |
|
|
| 94231-77-3 |
3-ethoxypropylisothiocyanat |
Xn;R22 N;R50/53 |
|
* |
|
|
| 94231-95-5 |
[bis(3-methylbutoxy)methyl]benzen |
N;R50/53 |
|
* |
|
|
| 94232-03-8 |
N,N'-ethylenbis[3-amino-4-methoxybenzensulfonamid] |
Mut3;R40 |
|
* |
|
|
| 94236-90-5 |
1,2,3-propantriyltris(3-oxodecanoat) |
N;R50/53 |
|
* |
|
|
| 94236-91-6 |
2-chlorethyl-4-[bis(2-chlorethyl)amino]phenylbutyrat |
Xn;R22 Carc3;R40 R43 N;R50/53 |
|
* |
|
|
| 94237-15-7 |
1-(4-nonylphenoxy)propan-2-ol |
N;R50/53 |
|
* |
|
|
| 94247-12-8 |
di-tert-hexyldisulfid |
N;R50/53 |
|
* |
|
|
| 94247-13-9 |
thiobis(tert-octan) |
N;R50/53 |
|
* |
|
|
| 94247-89-9 |
methylenbis[4,1-phenyleniminocarbonyloxy(methyl-2,1-ethandiyl)]diacrylat |
Xn;R22 Mut3;R40 N;R50/53 |
|
* |
|
|
| 94248-11-0 |
2-[[[[3-[[[3-hydroxy-2,2-bis[(methacryloyloxy)methyl]propoxy]carbonyl]amino]tolyl]carbamoyl]oxy]methyl]-2-[(methacryloyloxy)methyl]propan-1,3-diyldimethacrylat |
N;R50/53 |
|
* |
|
|
| 94248-13-2 |
nonylvalerat- |
N;R50/53 |
|
* |
|
|
| 94248-18-7 |
dinitro-1,4-bis(2,4,6-trinitrophenoxy)benzen |
N;R50/53 |
|
* |
|
|
| 94248-51-8 |
dinitro-1,3-bis(2,4,6-trinitrophenoxy)benzen |
N;R50/53 |
|
* |
|
|
| 94248-60-9 |
stearinsyre, monoester med 2,2'-[[(2-hydroxyethyl)imino]bis(ethylenimino)]diethanol |
R43 N;R50/53 |
|
* |
|
|
| 94248-66-5 |
isohexadecansyre, monoester med glycerol |
N;R50/53 |
|
* |
|
|
| 94248-78-9 |
diisohexylmaleat- |
R43 N;R50/53 |
|
* |
|
|
| 94266-22-5 |
2-(3,5-dichlor-4-methylbenzoyl)benzoesyre |
R43 N;R50/53 |
|
* |
|
|
| 94266-25-8 |
2,6,10,14,18,22,26,30,31-nonahydroxy-4,8,12,16,20,24,28-heptaoxahentriacontyloleat |
N;R50/53 |
|
* |
|
|
| 94277-02-8 |
2,7-dimethyloctylbutyrat |
N;R50/53 |
|
* |
|
|
| 94278-30-5 |
1-[6-ethyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]ethan-1-on |
N;R50/53 |
|
* |
|
|
| 94278-35-0 |
7-methoxy-5,7-dimethyl-2,4-octadien-1-ol |
N;R50/53 |
|
* |
|
|
| 94278-36-1 |
7-methoxy-5,7-dimethyloct-2-en-1-ol |
N;R50/53 |
|
* |
|
|
| 94278-37-2 |
octahydro-8-methoxy-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen |
N;R50/53 |
|
* |
|
|
| 94278-38-3 |
1,4-diethyloctylacetat |
N;R50/53 |
|
* |
|
|
| 94278-45-2 |
2-[2-(4-methylcyclohex-3-en-1-yl)propyl]tetrahydrofuran |
N;R50/53 |
|
* |
|
|
| 94291-44-8 |
6-methyl-3-(1-methylcyclopropyl)hept-2-en-1-ol |
N;R50/53 |
|
* |
|
|
| 94291-47-1 |
9-methyl-7-(1-methylethyliden)-2-oxabicyclo[3.3.1]nonan |
N;R50/53 |
|
* |
|
|
| 94291-51-7 |
5-(3,3-dimethylbicyclo[2.2.1]hept-2-yliden)-3-methylpentan-2-ol |
N;R50/53 |
|
* |
|
|
| 94291-53-9 |
2-[(3,3-dimethylbicyclo[2.2.1]hept-2-yl)methyl]tetrahydrofuran |
N;R50/53 |
|
* |
|
|
| 94291-56-2 |
4,4,6-trimethyl-2-[1-methyl-2-[4-(1-methylethyl)phenyl]ethyl]-1,3-dioxan |
N;R50/53 |
|
* |
|
|
| 94291-58-4 |
alpha-(1,1-dimethylethyl)-2,4-dimethylcyclohex-3-en-1-methanol |
N;R50/53 |
|
* |
|
|
| 94291-60-8 |
3,7-dimethyloct-6-en-1-ylphenethylcarbonat |
N;R50/53 |
|
* |
|
|
| 94291-61-9 |
4,4'-[hexan-1,6-diylbis(oxy)]bisbenzonitril |
N;R50/53 |
|
* |
|
|
| 94291-83-5 |
5-allyl-2-(pentyloxy)anisol |
Mut3;R40 Carc3;R40 N;R51/53 |
|
* |
|
|
| 94291-84-6 |
8-methoxy-2,6-dimethyl-8-(2-phenylethoxy)octan-2-ol |
N;R50/53 |
|
* |
|
|
| 94291-95-9 |
2-chlor-1,1-bis(2-methoxyethoxy)ethan |
Mut3;R40 R43 |
|
* |
|
|
| 94313-76-5 |
2-[(2-butoxyethyl)amino]-1,4-dihydroxyanthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 94313-79-8 |
1,4-dihydroxy-2-[[3-(2-methoxyethoxy)propyl]amino]anthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 94313-80-1 |
2-[(2-ethoxyethyl)amino]-1,4-dihydroxyanthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 94313-81-2 |
1-hydroxy-4-[[3-(2-methoxyethoxy)propyl]amino]anthraquinon |
Mut3;R40 |
|
* |
|
|
| 94313-82-3 |
1-[(2-ethoxyethyl)amino]-4-hydroxyanthraquinon |
Mut3;R40 |
|
* |
|
|
| 94313-83-4 |
1-[(2-butoxyethyl)amino]-4-hydroxyanthraquinon |
Mut3;R40 R43 |
|
* |
|
|
| 94313-87-8 |
N-(3-chlorpropyl)-3-methoxy-N-methylphenethylamin |
Xn;R22 Mut3;R40 Carc3;R40 R43 N;R50 |
|
* |
|
|
| 94345-75-2 |
(R)-3,7-dimethyloct-6-enylisovalerat |
N;R50/53 |
|
* |
|
|
| 94349-22-1 |
[(3,5-dibrom-2-methylphenoxy)methyl]oxiran |
Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 94349-44-7 |
2,4-dimethyl-2-[1-methyl-2-(2,6,6-trimethyl-2-cyclohexen-1-yl)vinyl]-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 94349-58-3 |
7-(1-methoxyethyl)-2-methyl-5-(1-methylethyl)bicyclo[2.2.2]oct-2-en |
N;R50/53 |
|
* |
|
|
| 94361-06-5 |
cyproconazol |
Xn;R22 Rep3;R63 N;R50/53 |
* |
|
|
|
| 94386-39-7 |
2-methyl-5-(1-methylvinyl)-2-cyclohexen-1-ylisovalerat |
N;R50/53 |
|
* |
|
|
| 94405-98-8 |
(17beta)-17-allyl-3-methoxyandrosta-3,5-dien-17-ol |
N;R50/53 |
|
* |
|
|
| 94405-99-9 |
(17beta)-3-methoxy-17-propylandrosta-3,5-dien-17-ol |
N;R50/53 |
|
* |
|
|
| 94406-00-5 |
1-(1,3-diphenylbutyl)-3-ethylbenzen |
N;R50/53 |
|
* |
|
|
| 94412-40-5 |
trans-4'-(4-propylcyclohexyl)[1,1'-biphenyl]-4-carbonitril |
N;R50/53 |
|
* |
|
|
| 94441-99-3 |
(E)-2',6'-dihydroxy-4,4'-dimethoxychalcon |
R43 N;R50 |
|
* |
|
|
| 94442-02-1 |
2-(4-neopentylphenoxy)anilin |
Mut3;R40 Carc3;R40 |
|
* |
|
|
| 94442-17-8 |
4-(2-methylbutyl)phenyl-(S)-4-propylbenzoat |
N;R50/53 |
|
* |
|
|
| 94612-91-6 |
natrium-4-(2,4,4-trimethylpentylcarbonyloxy)benzensulfonat |
Xn;R22 T;R23-48/23 Xi;R36/37 R43 |
* |
|
|
|
| 94732-94-2 |
(Z)-4-[3-brom-1-(4-chlorphenyl)-1-propenyl]-4'-chlor-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 94732-95-3 |
(E)-4-[3-brom-1-(4-nitrophenyl)-1-propenyl]-4'-chlor-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 94732-96-4 |
(E)-4-[3-brom-1-(4-chlorphenyl)-1-propenyl]-4'-chlor-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 94732-97-5 |
(Z)-4-[3-brom-1-(4-nitrophenyl)-1-propenyl]-4'-chlor-1,1'-biphenyl |
N;R50/53 |
|
* |
|
|
| 94944-80-6 |
3,3'-[[4-(tert-butyl)phenyl]methylen]bis(1H-indol) |
N;R50/53 |
|
* |
|
|
| 95046-34-7 |
2-(1-methyldecyl)-1,3-dioxolan |
N;R50/53 |
|
* |
|
|
| 96489-71-3 |
2-tert-butyl-5-(4-tert-butylbenzylthio)-4-chlorpyridazin-3(2H)-on |
T;R23/25 N;R50/53 |
* |
|
|
|
| 96525-23-4 |
flurtamon eller (RS)-5-methylamino-2-phenyl-4-(?,?,?-trifluor-m-tolyl)furan-3(2H)-on |
N;R50/53 |
* |
|
|
|
| 96648-14-5 |
(3'alpha,4'alpha,5'beta,6'aalpha)-5'-(benzoyloxy)hexahydrospiro[1,3-dioxolan-2,2'(1'H)-pentalen]-4'-methanol |
N;R50/53 |
|
* |
|
|
| 97043-74-8 |
N,N-dibutyl-2-chlor-4-nitroanilin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 97101-46-7 |
methyl 3-(acetylthio)-2-methylpropanat |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| 97259-65-9 |
oxiranylmethylveratrumat- |
Xn;R22 Mut3;R40 Carc3;R40 |
|
* |
|
|
| 97338-02-8 |
ethyl-(S)-alpha-[[4-[bis(2-hydroxyethyl)amino]phenyl]methyl]-1,3-dihydro-1,3-dioxo-2H-isoindol-2-acetat |
Xn;R22 Mut3;R40 Carc3;R40 R43 |
|
* |
|
|
| 97375-16-1 |
4-(1-methyl-2-phenylethyl)-N-phenylanilin |
Xn;R22 R43 N;R50/53 |
|
* |
|
|
| 97635-49-9 |
1-[2-(dimethylamino)ethyl]-1-phenylindan-7-ol |
R43 N;R50/53 |
|
* |
|
|
| 97659-29-5 |
6-ethyl-3,5-bis(isopropyl)-6-methylcyclohexen-1-on |
N;R50/53 |
|
* |
|
|
| 97692-44-9 |
5-ethyl-4-(isopropyl)-2-(isopropyliden)-5-methylcyclohexan-1-on |
N;R50/53 |
|
* |
|
|
| 97722-04-8 |
carbonhydrider, C26-55 aromatrige |
Carc2;R45 |
* |
|
|
|
| 97752-21-1 |
[2,2-bis[(3-methyl-2-butenyl)oxy]ethyl]benzen |
N;R50/53 |
|
* |
|
|
| 97890-15-8 |
2,2'-isopropylidenbis[4,6-dibromphenol] |
R43 N;R50/53 |
|
* |
|
|
| 97890-17-0 |
bis(2,3-epoxypropyl)-3,4,5,6-tetrachlorphthalat |
Mut3;R40 R43 |
|
* |
|
|
| 97926-59-5 |
gasolier (råolie), lette vakuum-, termisk-krakkede
hydroafsvovlede |
Carc2;R45 |
* |
|
|
|
| 98181-47-6 |
5(eller 6)-tert-butyl-2'-chlor-6'-ethylamino-3',7'-dimethylspiro(isobenzofuran-1(1H),9'-xanthen)-3-on |
Xn;R20 N;R50/53 |
* |
|
|
|
| 98219-64-8 |
rester, dampkrakkede, termisk behandlede |
Carc2;R45 |
* |
|
|
|
| 98886-44-3 |
fosthiazat eller (RS)-S-sec-butyl-O-ethyl-2-oxo-1,3-thiazolidin-3-ylphosphonothioat |
Xn;R21 T;R23/25-39 Xi;R41 R43 N;R50/53 |
* |
|
|
|
| 99610-72-7 |
2-(2-hydroxy-3,5-dinitroanilino)ethanol |
F;R11 Xn;R22 Rep3;R62 |
* |
|
|
|
| 99688-47-8 |
brombenzylbromtoluen, blanding af isomerer |
R43 Xn;R48/22 N;R50/53 |
* |
|
|
|
| 100181-71-3 |
isobutyl-3,4-epoxybutyrat |
Xi;R38 R43 N;R50/53 |
* |
|
|
|
| 101051-62-1 |
4-(1(eller 4 eller 5 eller 6)-methyl-8,9,10-trinorborn-5-en-2-yl)pyridin,
blanding af isomerer |
Xn;R21/22 Xi;R38 R43 N;R50/53 |
* |
|
|
|
| 101316-57-8 |
destillater (råolie), hydroafsvovlede full-range
middeltunge |
Carc2;R45 |
* |
|
|
|
| 101316-59-0 |
destillater (råolie), hydroafsvovlede middeltunge
coker- |
Carc2;R45 |
* |
|
|
|
| 101316-84-1 |
tjære, brunkuls-, lavtemperaturs- |
Carc1;R45 |
* |
|
|
|
| 101631-14-5 |
destillater (råolie), tunge dampkrakkede |
Carc2;R45 |
* |
|
|
|
| 102089-33-8 |
4-[3-(diethoxymethylsilyl-propoxy)-2,2,6,6-tetramethyl]-piperidin |
Xn;R22-48/21 Xi;R38-41 R52/53 |
* |
|
|
|
| 102851-06-9 |
cyan(3-phenoxyphenyl)methyl-N-[2-chlor-4-(trifluoromethyl)phenyl]-D-valinat
eller tau-fluvalinat |
Xn;R22 Xi;R38 N;R50/53 |
* |
|
|
|
| 103055-07-8 |
N-[2,5-dichlor-4-(1,1,2,3,3,3-hexafluorpropoxy)phenylaminocarbonyl]-2,6-difluorbenzamid |
R43 N;R50/53 |
* |
|
|
|
| 103361-09-7 |
flumioxazin eller N-(7-fluor-3,4-dihydro-3-oxo-4-prop-2-ynyl-2H-1,4-benzoxazin-6-yl)cyclohex-1-en-1,2-dicarboximid |
Rep2;R61 N;R50/53 |
* |
|
|
|
| 104040-78-0 |
flazasulfuron eller 1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-trifluormethyl-2-pyridylsulfonyl)urinstof |
N;R50/53 |
* |
|
|
|
| 104147-32-2 |
3,5-dichlor-4-(1,1,2,2-tetrafluorethoxy)anilin |
Xn;R22 N;R50/53 |
* |
|
|
|
| 105254-85-1 |
3-(bis(2-ethylhexyl)aminomethyl)benzothiazol-2(3H)-thion |
C;R34 R43 N;R50/53 |
* |
|
|
|
| 106264-79-3 |
6-methyl-2,4-bis(methylthio)phenylen-1,3-diamin |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| 106359-93-7 |
2-(4-(3-(4-chlorphenyl)-4,5-dihydropyrazolyl)phenylsulfonyl)ethyldimethylammoniumhydrogen-phosphonat |
Xi;R36 N;R50/53 |
* |
|
|
|
| 106917-30-0 |
3-dodecyl-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidin-2,5-dion |
Xn;R22-48/22 T;R23 C;R35 N;R50/53 |
* |
|
|
|
| 107231-51-6 |
tetranatrium-5'-(4,6-dichlor-5-cyanpyrimidin-2-ylamino)-4'-hydroxy-2,3'-azodinaphthalen-1,2',5,7'-disulfonat |
R42 N;R50/53 |
* |
|
|
|
| 107898-54-4 |
(+/-)trans-3,3-dimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)-pent-4-en-2-ol |
Xi;R38 N;R50/53 |
* |
|
|
|
| 108225-03-2 |
7-[[4,6-bis[(2-aminopropyl)amino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-(2-methoxyphenylazo)naphthalensulfonsyre,
monoformiat eller (6-(4-hydroxy-3-(2-methoxyphenylazo)-2-sulfonato-7-naphthylamino)-1,3,5-triazin-2,4-diyl)bis[(amino-1-methylethyl)ammonium]-format |
Carc2;R45 Xi;R41 N;R51/53 |
* |
|
|
|
| 110260-50-9 |
2-(4-(4-cyan-3-mehylisothiazol-5-ylazo)-N-ethyl-3-mehylanilino)ethylacetat |
Xn;R22-48/22 Xi;R38 R53 |
* |
|
|
|
| 110895-43-7 |
1-(N,N-dimethylcarbamoyl)-3-tert-butyl-5-carboxymethylthio-1H-1,2,4-triazol |
T;R23/25 N;R50/53 |
* |
|
|
|
| 111298-82-9 |
7-amino-3-((5-carboxymethyl-4-methyl-1,3-thiazol-2-ylthio)methyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-en-2-carboxylsyre |
R42/43 R52/53 |
* |
|
|
|
| 111850-24-9 |
4-(4-nitrophenylazo)-2,6-di-sec-butylphenol eller 2,6-di-sec-butyl-4-[(4-nitrophenyl)azo]phenol |
Xi;R36/38 R43 Xn;R48/22 N;R50/53 |
* |
|
|
|
| 112281-77-3 |
(+/-)-2-(2,4-dichlorphenyl)-3-(1H-1,2,4-triazol-1-yl)propyl-1,1,2,2-tetrafluorethylether |
Xn;R20/22 Carc3;R40 N;R51/53 |
* |
|
|
|
| 113674-95-6 |
4-(2-chlor-4-trifluormethyl)phenoxy-2-fluoranilinhydrochlorid |
Xn;R22 Xi;R41 R43 T;R48/25 N;R50/53 |
* |
|
|
|
| 113694-52-3 |
benzyl-2-hydroxydodecyldimethylammoniumbenzoat |
Xn;R22 C;R34 N;R50/53 |
* |
|
|
|
| 114369-43-6 |
4-(4-chlorphenyl)-2-phenyl-2-[(1H-1,2,4-triazol-1-yl)methyl]butannitril |
N;R50/53 |
* |
|
|
|
| 114565-66-1 |
4-[4-(1,3-dihydroxyprop-2-yl)phenylamino]-1,8-dihydroxy-5-nitroanthraquinon |
Carc3;R40 R43 R53 |
* |
|
|
|
| 115099-58-6 |
3-(5-acetamido-4-(4-[4,6-bis(3-diethylaminopropylamino)-1,3,5-triazin-2-ylamino]phenylazo)-2-(2-methoxyethoxy)phenylazo)-6-amino-4-hydroxy-2-naphthalensulfonsyre |
N;R50/53 |
* |
|
|
|
| 115662-06-1 |
5,6,12,13-tetrachloranthra(2,1,9-def:6,5,10-d'e'f')diisoquinolin-1,3,8,10(2H,9H)-tetron |
Rep3;R62 |
* |
|
|
|
| 116163-96-3 |
P,P,P',P'-tetrakis-(o-methoxyphenyl)propan-1,3-diphosphin |
N;R50/53 |
* |
|
|
|
| 116230-20-7 |
2-[2-(2-azabicyclo[2.2.1]hept-2-yl)ethoxy]ethanol eller
2-(2-(2-hydroxyethoxy)ethyl)-2-azabicyclo[2.2.1]heptan |
Xn;R21/22-48/20 Xi;R38-41 |
* |
|
|
|
| 116412-83-0 |
4-chlor-3',4'-dimethoxybenzophenon |
N;R50/53 |
* |
|
|
|
| 116753-76-5 |
O,O-tert-butyl-O-docosylmonoperoxyoxalat |
O;R7 N;R50/53 |
* |
|
|
|
| 116810-46-9 |
tetrakis(trimethylhexadecylammonium)hexa-?-oxotetra-?3-oxodi-?5-oxotetradecaoxooctamolybdat(4-) |
F;R11 Xi;R41 N;R50/53 |
* |
|
|
|
| 117291-73-3 |
methyl-[2-(1,1-dimethylethyl)-6-methoxypirimidin-4-yl]ethylphosphonothioat |
Xn;R22 N;R50/53 |
* |
|
|
|
| 117584-16-4 |
3-(2,6-dichlor-4-nitrophenylazo)-1-methyl-2-phenylindol |
N;R50/53 |
* |
|
|
|
| 118134-30-8 |
spiroxamin |
Xn;R20/21/22 Xi;R38 R43 N;R50/53 |
* |
|
|
|
| 118208-02-9 |
2,4-bis[2,2'-[2-(N,N-dimethylamino)ethyloxycarbonyl]phenylazo]-1,3-dihydroxybenzendihydrochlorid |
Xn;R22 Xi;R41 N;R51/53 |
* |
|
|
|
| 118562-73-5 |
2-cyclododecylpropan-1-ol |
N;R50/53 |
* |
|
|
|
| 118658-98-3 |
7-[4-(3-diethylaminopropylamino)-6-(3-diethylammoniopropylamino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-phenylazophenylazo)naphthalen-2-sulfonat,
eddikesyre, mælkesyre (2:1:1) |
R43 Xn;R48/22 R52/53 |
* |
|
|
|
| 118712-89-3 |
2,3,5,6-tetrafluorbenzyl-trans-2-(2,2-dichlorvinyl)-3,3-dimethylcyclopropancarboxylat |
Xi;R38 N;R50/53 |
* |
|
|
|
| 118725-24-9 |
(1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium-4-toluensulfonat |
Xi;R41 N;R50/53 |
* |
|
|
|
| 118832-72-7 |
iso(C10-C14)alkyl-(3,5-di-tert-butyl-4-hydroxyphenyl)methylthioacetat |
N;R50/53 |
* |
|
|
|
| 119313-12-1 |
2-benzyl-2-dimethylamino-4-morpholinobutyrophenon |
N;R50/53 |
* |
|
|
|
| 119462-56-5 |
1,3-bis(3-methyl-2,5-dioxo-1H-pyrrolinylmethyl)benzen |
Xi;R41 R43 Xn;R48/22 N;R50/53 |
* |
|
|
|
| 119738-06-6 |
(+/-)-tetrahydrofurfuryl-(R)-2-[4-(6-chlorchinoxalin-2-yloxy)-phenyloxy]propanoat |
Rep2;R61 Xn;R22-48/22 Rep3;R62 Mut3;R68 N;R50/53 |
* |
|
|
|
| 120162-55-2 |
azimsulfuron eller 1-(4,6-dimethoxypyrimidin-2-yl)-3-[[1-methyl-4-(2-methyl-2H-tetrazol-5-yl)pyrazol-5-yl]sulfonyl]urinstof |
N;R50/53 |
* |
|
|
|
| 120187-29-3 |
4'-ethoxy-2-benzimidazol-anilid |
Mut3;R68 R53 |
* |
|
|
|
| 120928-09-8 |
4-[2-[4-(1,1-dimethylethyl)phenyl]ethoxy]quinazolin |
Xn;R20 T;R25 N;R50/53 |
* |
|
|
|
| 121518-45-4 |
2,4-dichlor-3-ethylphenol |
C;R34 N;R50/53 |
* |
|
|
|
| 122012-52-6 |
diamindiisocyanoatozink |
Xn;R22 Xi;R41 R42/43 N;R50 |
* |
|
|
|
| 123748-85-6 |
1-methyl-5-norbornen-2,3-dicarboxylsyreanhydrid |
Xn;R22 Xi;R36/37/38 R42 |
* |
|
|
|
| 124088-59-1 |
benzyldimethyloctadecylammonium-3-nitrobenzensulfonat |
Xi;R38-41 N;R50/53 |
* |
|
|
|
| 124495-18-7 |
quinoxyfen |
R43 N;R50/53 |
* |
|
|
|
| 124719-26-2 |
4-(3,4-dichlorphenylazo)-2,6-di-sec-butylphenol eller 2,6-di-sec-butyl-4-[(3,4-dichlorphenyl)azo]phenol |
Xi;R38 Xn;R48/22 N;R50/53 |
* |
|
|
|
| 124737-31-1 |
4-dimethylaminobenzendiazonium-3-carboxy-4-hydroxybenzensulfonat |
E;R2 Xn;R21 T;R23/25 Xi;R41 R43 R48/22 R50/53 |
* |
|
|
|
| 125051-32-3 |
bis(.eta.5-cyclopentadienyl)bis[2,6-difluor-3-(pyrrol-1-yl)phenyl]titan |
F;R11 Xn;R48/22 Rep3;R62 N;R51/53 |
* |
|
|
|
| 125792-14-5 |
tributyltetradecylphosphonium tetrafluorborat |
Xn;R22-48/22 C;R34 R43 N;R50/53 |
* |
|
|
|
| 12680158-9 |
ethoxysulfuron eller 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethoxyphenoxysulfonyl)urinstof |
N;R50/53 |
* |
|
|
|
| 128639-02-1 |
carfentrazon-ethyl eller ethyl-(RS)-2-chlor-3-[2-chlor-4-fluor-5-[4-difluormethyl-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]propionat |
N;R50/53 |
* |
|
|
|
| 130066-57-8 |
bis[4-(ethenyloxy)butyl]-1,3-benzendicarboxylat |
R43 N;R50/53 |
* |
|
|
|
| 130201-57-9 |
tetranatrium-5-[4-chlor-6-(N-ethylanilino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(1,5-disulfonatonaphthalen-2-ylazo)naphthalen-2,7-disulfonat |
Xi;R41 R43 N;R51/53 |
* |
|
|
|
| 130296-87-6 |
hydroxyaluminiumbis[2-hydroxy-3,5-di-tert-butylbenzoat],
blanding med 3,5-di-tert-butylsalicylsyre |
Xn;R22 N;R50/53 |
* |
|
|
|
| 130728-76-6 |
N,N,N',N'-tetraglydicyl-4,4'-diamino-3,3'-diethyldiphenylmethan |
R43 Mut3;R68 N;R51/53 |
* |
|
|
|
| 131538-00-6 |
2,3-bis((2-mercaptoethyl)thio)-1-propanthiol |
Xn;R22-48/22 N;R50/53 |
* |
|
|
|
| 131860-33-8 |
azoxystrobin |
T;R23 N;R50/53 |
* |
|
|
|
| 132207-32-0 |
asbest |
Carc1;R45 T;R48/23 |
* |
|
|
|
| 133514-97-3 |
2-(4-(3-(4-chlorphenyl)2-pyrazolin-1-yl)phenylsulfonyl)ethyldimethylammoniumformiat |
C;R34 R43 Xn;R48/22 N;R50/53 |
* |
|
|
|
| 133855-98-8 |
(2RS,3RS)-3-(2-chlorphenyl)-2-(4-fluorphenyl)-[(1H-1,2,4-triazol-1-yl)methyl]oxiran |
Rep2;R61 Carc3;R40 Rep3;R62 N;R51/53 |
* |
|
|
|
| 135158-54-2 |
acibenzolar-S-methyl eller 1,2,3-benzothiadiazol-7-thiocarboxylsyre-S-methylester |
Xi;R36/37/38 R43 N;R50/53 |
* |
|
|
|
| 136213-73-5 |
2-((4-(ethyl-(2-hydroxyethyl)amino)-2-methylphenyl)azo)-6-methoxy-3-methylbenzothiazolium-methylsulfat |
R43 Xn;R48/22 N;R50/53 |
* |
|
|
|
| 136213-74-6 |
2-(4-(N-ethyl-N-(2-hydroxy)ethyl)amino-2-methylphenyl)azo-6-methoxy-3-methylbenzothiazoliumchlorid |
N;R50/53 |
* |
|
|
|
| 136426-54-5 |
3-(2,4-dichlorphenyl)-6-fluor-2-(1H-1,2,4-triazol-1-yl)quinazolin-4(3H)-on |
Xn;R21 T;R23/25-48/25 Xi;R38 N;R50/53 |
* |
|
|
|
| 137605-95-9 |
2-butyl-2-ethylpentan-1,5-diamin |
Xn;R21/22-48/22 C;R34 R43 R52/53 |
* |
|
|
|
| 138359-27-0 |
dodecyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-?-alaninat,
blanding med tetradecyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-?-alaninat |
Xn;R22-48/22 C;R34 N;R50/53 |
* |
|
|
|
| 138526-69-9 |
1-brom-3,4,5-triflourbenzen |
R10 Xi;R38-41 Carc3;R40 N;R51/53 |
* |
|
|
|
| 141112-29-0 |
isoxaflutol eller (5-cyclopropyl-1,2-oxazol-4-yl)(?,?,?-trifluor-2-mesyl-p-tolyl)keton |
Rep3;R63 N;R50/53 |
* |
|
|
|
| 142459-58-3 |
flufenacet eller N-(4-fluorphenyl)-N-isopropyl-2-[(5-trifluormethyl-1,3,4-thiadiazol-2-yl)oxy]acetamid |
Xn;R22-48/22 R43 N;R50/53 |
* |
|
|
|
| 143390-89-0 |
kresoxim-methyl eller methyl-(E)-2-methoxyimino-[2-(o-tolyloxymethyl)phenyl]acetat |
Carc3;R40 N;R50/53 |
* |
|
|
|
| 143747-73-3 |
1,3-dibrompropan, polymer med N,N-diethyl-N',N'-dimethyl-1,3-propandiamin |
N;R50/53 |
* |
|
|
|
| 144740-54-5 |
flupyrsulfuron-methyl-natrium |
N;R50/53 |
* |
|
|
|
| 145052-34-2 |
bis(2,6-dimethoxybenzoyl)-2,4,4-trimethylpentylphosphinoxid |
R43 N;R50/53 |
* |
|
|
|
| 147170-38-5 |
trimethylhexamethylendiamin (en blanding af 2,2,4-trimethyl-1,6-hexandiamin
og 2,4,4-trimethyl-1,6-hexandiamin, EINECS listet) (1), Epoxide 8 (mono[(C10-C16-alkyloxy)methyl]oxiran-derivater)
(2), p-toluensulfonsyre (3), reaktionsprodukter af (1),(2) og (3) |
Xn;R22 C;R34 N;R50/53 |
* |
|
|
|
| 147374-67-2 |
4-[(2-cyan-3-phenylaminoacryloyloxy)methyl]cyclohexylmethyl(2-cyan-3-phenylaminoacrylat) |
R43 Xn;R48/20/21 N;R51/53 |
* |
|
|
|
| 147741-93-3 |
N-acetyl-N-[5-cyano-3-(2-dibutylamino-4-phenylthiazol-5-ylmethylen)-4-methyl-2,6-dioxo-1,2,3,6-tetrahydropyridin-1-yl]benzamid |
N;R50/53 |
* |
|
|
|
| 148434-03-1 |
hydrazinbis(3-carboxy-4-hydroxybenzensulfonat) |
Carc2;R45 Xn;R22 C;R34 R43 R52/53 |
* |
|
|
|
| 154486-27-8 |
fluroxypyr-butometyl |
N;R50/53 |
* |
|
|
|
| 157661-93-3 |
2-methyl-4-(1,1-dimethylethyl)-6-(1-methylpentadecyl)phenol |
Xi;R38 R43 N;R50/53 |
* |
|
|
|
| 159120-95-3 |
S,S,S',S'-tetraphenylthiobis(4,1-phenylen)disulfoniumhexafluoroantimonat
(1), diphenyl(4-phenylthiophenyl)sulfoniumhexafluoroantimonat (2), blanding af
1 og 2 |
R43 N;R50/53 |
* |
|
|
|
| 164058-22-4 |
trinatrium-[4'-(8-acetylamino-3,6-disulfonato-2-naphthylazo)-4''-(6-benzoylamino-3-sulfonato-2-naphthylazo)-biphenyl-1,3',3'',1'''-tetraolato-O,O',O'',O''']kobber(II) |
Carc2;R45 |
* |
|
|
|
| 164578-13-6 |
5-tert-butyl-3-isoxazolylaminhydrochlorid |
Xn;R22-48/22 Xi;R41 R52/53 |
* |
|
|
|
| 164907-72-6 |
glutamsyre, reaktionsprodukter med N-(C12-14alkyl)propylen-1,3-diamin |
Xn;R22 Tx;R26 C;R34 N;R50/53 |
* |
|
|
|
| 164907-74-8 |
ethylendiammonium-O,O-bis(octyl)dithiophosphat, blanding
af isomerer |
Xn;R22 C;R34 N;R50/53 |
* |
|
|
|
| 166242-53-1 |
tetrakis-hydroxymethylphosphoniumchlorid, urinstof, UVCB
kondensationsprodukt med distillerede hydrogenerede C16-18-talg-alkylamin |
Xn;R22-48/22 C;R34 R43 Mut3;R68 N;R50/53 |
* |
|
|
|
| 168900-02-5 |
3-(2,4-dichlorphenyl)-6-fluorquinazolin-2,4(1H,3H)-dion |
N;R50/53 |
* |
|
|
|
| *104078-12-8 |
dinocton eller (4-isooctyl-2,6-dinitrophenyl)methylcarbonat,
isomerblanding med (6-isooctyl-2,4-dinitrophenyl)methylcarbonat |
Xn;R22 N;R50/53 |
* |
|
|
|
| *13775-53-6 |
trinatriumhexafluoroaluminat |
Xn;R20/22 T;R48/23/25 N;R51/53 |
* |
|
|
|
| *29757-24-2 |
nitroanilin (o,m,p) |
T;R23/24/25 R33 R52/53 |
* |
|
|
|
| *4170-30-3 |
2-butenal |
F;R11 T;R24/25 Tx;R26 Xi;R37/38-41 Xn;R48/22 Mut3;R68 N;R50 |
* |
|
|
|
| *60999-18-0 |
nitrotoluidin |
T;R23/24/25 R33 N;R51/53 |
* |
|
|
|
| *81412-43-3 |
tridemorph |
Rep2;R61 Xn;R20/22 Xi;R38 N;R50/53 |
* |
|
|
|
| *81-81-2 |
warfarin |
Rep1;R61 T;R48/25 R52/53 |
* |
|
|
|
| No CAS |
Methoxyetylacrylate tinbutyltin copolymer |
|
|
|
|
* |
| No CAS |
2,3,7,8 Tetrachlorodibenzo-p-dioxin (TCDD) |
|
|
|
|
* |
| No CAS |
Tributyltin compounds |
|
|
|
|
* |
| No CAS |
Tributyltincarboxylate |
|
|
|
|
* |
| No CAS |
Tributyltinpolyethoxylate |
|
|
|
|
* |
| No CAS |
Triphenyltin |
|
|
|
|
* |
| x |
acetophenon, reaktionsprodukt med formaldehyd, cyclohexylamin,
methanol og eddikesyre |
R10 Xn;R20 C;R34 Carc3;R40 R43 N;R50/53 |
* |
|
|
|
| x |
5-acetyl-3-amino-10,11-dihydro-5H-dibenz[b,f]acepin-hydrochlorid |
Xn;R22-48/22 Xi;R41 R43 N;R51/53 |
* |
|
|
|
| x |
4-allyl-2,6-bis(2,3-epoxypropyl)phenol (1), 4-allyl-6-[3-[6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol
(2), 4-allyl-6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol
(3), 4-allyl-6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol
(4), blanding af (1), (2), (3) og (4) |
R43 Mut3;R68 |
* |
|
|
|
| x |
4-aminobiphenyl, salte heraf |
Carc1;R45 Xn;R22 |
* |
|
|
|
| x |
ammonium-1-C14-C18-alkyloxycarbonyl-2-(3-allyloxy-2-hydroxypropoxycarbonyl)ethan-1-sulfonat
blanding med ammonium-2-C14-C18-alkyloxycarbonyl-1-(3-allyloxy-2-hydroxypropoxycarbonyl)ethan-1-sulfonat |
Xi;R38 R43 N;R50/53 |
* |
|
|
|
| x |
amylaser, undtagen sådanne nævnt andetsteds
i dette bilag |
R42 |
* |
|
|
|
| x |
2'-anilino-3'-methyl-6'-dipentylaminospiro(isobenzofuran-1(1H),9'-xanthen)-3-on |
N;R50/53 |
* |
|
|
|
| x |
anilin, salte heraf |
Xn;R20/21/22 Carc3;R40 T;R48/23/24/25 N;R50 |
* |
|
|
|
| x |
arsenforbindelser, undtagen sådanne nævnt andetsteds
i dette bilag |
T;R23/25 N;R50/53 |
* |
|
|
|
| x |
arsensyre og dets salte |
Carc1;R45 T;R23/25 N;R50/53 |
* |
|
|
|
| x |
benzidinbaserede azofarvestoffer, undtagen sådanne
nævnt andetsteds i dette bilag |
Carc2;R45 |
* |
|
|
|
| x |
(Z)-1-benzo[b]thien-2-ylethanonoximhydrochlorid |
Xn;R22-48/22 Xi;R41 R43 N;R51/53 |
* |
|
|
|
| x |
berylliumforbindelser med undtagelse af aluminiumberylliumsilicater
samt sådanne nævnt andetsteds i dette bilag |
Carc2;R49 T;R25-48/23 Tx;R26 Xi;R36/37/38 R43 N;R51/53 |
* |
|
|
|
| x |
1,6-bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexan |
Xn;R21/22 C;R34 R43 N;R50/53 |
* |
|
|
|
| x |
2-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-hydroxyphenol,
blanding med ((C10-16, rig på C12-13alkyloxy)methyl)oxyran |
N;R50/53 |
* |
|
|
|
| x |
4-[[bis-(4-fluorphenyl)methylsilyl]methyl]-4H-1,2,4-triazol,
blanding med 1-[[bis-(4-fluorphenyl)methylsilyl]methyl]-1H-1,2,4-triazol |
Rep2;R61 Xn;R22 Carc3;R40 N;R51/53 |
* |
|
|
|
| x |
2,5-bis(isocyanatomethyl)bicyclo[2.2.1]heptan |
Xn;R22 Tx;R26 C;R34 R42/43 R52/53 |
* |
|
|
|
| x |
bis[(1-methylimidazol)-(2-ethylhexanoat)], zinkcomplex |
Xi;R38-41 N;R50/53 |
* |
|
|
|
| x |
2,4-bis[N'-(4-methylphenyl)ureido]toluen |
N;R50/53 |
* |
|
|
|
| x |
4,4'-bi-o-toluidin baserede azofarvestoffer, undtagen sådanne
nævnt andetsteds i dette bilag |
Carc2;R45 |
* |
|
|
|
| x |
blyalkyler |
Rep1;R61 Tx;R26/27/28 R33 Rep3;R62 N;R50/53 |
* |
|
|
|
| x |
blyforbindelser, undtagen sådanne nævnt andetsteds
i dette bilag |
Rep1;R61 Xn;R20/22 R33 Rep3;R62 N;R50/53 |
* |
|
|
|
| x |
cadmiumforbindelser, med undtagelse af cadmiumsulfoselenid
(xCdS.yCdSe) og blandinger af cadmiumsulfid med zinksulfid (xCdS.yZnS), og blandinger
af cadmiumsulfid med kviksølvsulfid (xCdS.yHgS) såvel som cadmiumforbindelser
opført andetsteds i dettebilag |
Xn;R20/21/22 N;R50/53 |
* |
|
|
|
| x |
4,4'-carbonimidoylbis(N,N-dimethylanilin), salte heraf |
Xn;R22 Xi;R36 Carc3;R40 N;R51/53 |
* |
|
|
|
| x |
3-(7-carboxyhept-1-yl)-6-hexyl-4-cyclohexen-1,2-dicarboxylsyre,
kondensationsprodukt med polyaminer (fortrinsvis amino-ethyl-piperazin og triethylentetramin) |
Xn;R22 C;R34 R43 N;R50/53 |
* |
|
|
|
| x |
cellulaser, undtagen sådanne nævnt andetsteds
i dette bilag |
R42 |
* |
|
|
|
| x |
chloranilin (mono-, di- og tri-), undtagen sådanne
nævnt andetsteds i dette bilag |
T;R23/24/25 R33 N;R50/53 |
* |
|
|
|
| x |
N-(2-(6-chlor-7-methylpyrazolo(1,5-b)-1,2,4-triazol-4-yl)propyl)-2-(2,4-di-tert-pentylphenoxy)octanamid |
N;R50/53 |
* |
|
|
|
| x |
chlornitroaniliner undtagen sådanne nævnt andetsteds
i dette bilag |
Tx;R26/27/28 R33 N;R51/53 |
* |
|
|
|
| x |
(chlorphenyl)(chlortolyl)methan, blanding af isomerer |
N;R50/53 |
* |
|
|
|
| x |
chrom(VI)forbindelser, med undtagelse af bariumchromat
samt sådanne nævnt andetsteds i dette bilag |
Carc2;R49 R43 N;R50/53 |
* |
|
|
|
| x |
2,4-D, estere heraf |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| x |
o-dianisidin baserede azofarvestoffer, undtagen sådanne
nævnt andetsteds i dette bilag |
Carc2;R45 |
* |
|
|
|
| x |
o-dianisidin, salte heraf |
Carc2;R45 Xn;R22 |
* |
|
|
|
| x |
4,4'-diarylazobiphenyl farvestoffer, undtagen sådanne
nævntandetsteds i dette bilag |
Carc2;R45 |
* |
|
|
|
| x |
4,4'-diarylazo-3,3'-dimethoxybiphenyl farvestoffer, undtagen
sådanne nævnt andetsteds i dette bilag |
Carc2;R45 |
* |
|
|
|
| x |
4,4'-diarylazo-3,3'-dimethylbiphenyl farvestoffer, undtagen
sådanne nævnt andetsteds i dette bilag |
Carc2;R45 |
* |
|
|
|
| x |
dibenzylbenzen (1), dibenzyl(methyl)benzen (2), dibenzyl(dimethyl)benzen
(3), dibenzyl(trimethyl)benzen (4), blanding af isomerer af (1), (2), (3) og (4) |
N;R50/53 |
* |
|
|
|
| x |
2,2'-dichlor-4,4'-methylendianilin, salte heraf |
Carc2;R45 Xn;R22 N;R50/53 |
* |
|
|
|
| x |
4-(2,4-dichlorphenoxy)smørsyre, salte heraf |
Xn;R22 Xi;R41 N;R51/53 |
* |
|
|
|
| x |
O,O'-diisopropyl[trisulfan-1,3-bis(carbothioat)] (1), O,O'-diisopropyl[tetrasulfan-1,3-bis(carbothioat)]
(2), O,O'-diisopropyl[pentasulfan-1,3-bis(carbothioat)] (3), blanding af (1),
(2) og (3) |
Xn;R22 R43 N;R50/53 |
* |
|
|
|
| x |
3,3'-dimethoxybenzidin, salte heraf |
Carc2;R45 Xn;R22 |
* |
|
|
|
| x |
3-(N-(3-dimethylaminopropyl)-(C4-8)-perfluoralkylsulfonamido)propionsyre
(1), N-[dimethyl-3-(C4-8-perfluoralkylsulfonamido)propylammoniumpropionat (2),
3-(N-(3-dimethylpropylammonium)-(C4-8)-perfluoralkylsulfonamido)propionsyre-propionat
(3), blanding af (1), (2) og (3) |
Xn;R48/22 |
* |
|
|
|
| x |
2,4-dimethyl-6-(1-methylpentadecyl)phenol |
Xi;R38 R43 N;R50/53 |
* |
|
|
|
| x |
trans-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethylnaphthalen-2-yl)-1,3-dioxolan
blandet med cis-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethylnaphthalen-2-yl)-1,3-dioxolan |
N;R50/53 |
* |
|
|
|
| x |
dinatrium-(6-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)(1-(5-chlor-2-oxidophenylazo)-2-naphtholato)chromat(1-),
blanding med trinatriumbis(5-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)chromat(1-) |
R43 N;R50/53 |
* |
|
|
|
| x |
dinex, salte og estere |
T;R23/24/25 N;R50/53 |
* |
|
|
|
| x |
dinitrophenol, salte heraf |
T;R23/24/25 R33 N;R51/53 |
* |
|
|
|
| x |
dinosam, salte og estere |
T;R23/24/25 N;R50/53 |
* |
|
|
|
| x |
dinoseb, salte og estere, undtagen sådanne nævnt
andetsteds i dette bilag |
Rep2;R61 T;R24/25 Xi;R36 R44 Rep3;R62 N;R50/53 |
* |
|
|
|
| x |
dinoterb, salte og estere |
Rep2;R61 T;R24 Tx;R28 N;R50/53 |
* |
|
|
|
| x |
2-[N-ethyl-4-[(5,6-dichlorbenzothiazol-2-yl)azo]-m-toludin]ethylacetat,
blanding (1:1) med 2-[N-ethyl-4-[(6,7-dichlorbenzothiazol-2-yl)azo]-m-toludin]ethylacetat |
R43 T;R48/25 N;R51/53 |
* |
|
|
|
| x |
fenoprop, salte heraf |
Xn;R20/21/22 N;R50/53 |
* |
|
|
|
| x |
1,2,3,4,5,6-hexachlorcyclohexaner med undtagelse af sådanneangivet
andetsteds i dette bilag |
Xn;R21 T;R25 Carc3;R40 N;R50/53 |
* |
|
|
|
| x |
hexachloroplatinater, undtagen sådanne nævnt
andetsteds i dette bilag |
T;R25 Xi;R41 R42/43 |
* |
|
|
|
| x |
2-n-hexadecylhydroquinon |
Xi;R38 R43 Xn;R48/22 R53 |
* |
|
|
|
| x |
hexahydrocyclopenta[c]pirrole-1-(1H)-ammonium-N-ethoxycarbonyl-N-(p-tolylsulfonyl)azanid |
Xn;R22 Xi;R36 R43 Mut3;R68 N;R51/53 |
* |
|
|
|
| x |
hexyldioctylphosphinoxid (1), dihexyloctylphosphinoxid
(2), trioctylphosphinoxid (3), blanding af (1), (2), og (3) |
C;R34 N;R50/53 |
* |
|
|
|
| x |
hydrazin(trinitromethan) |
Carc2;R45 E;R3 O;R8 T;R23/25 R43 |
* |
|
|
|
| x |
hydrazin, salte heraf |
Carc2;R45 T;R23/24/25 R43 N;R50/53 |
* |
|
|
|
| x |
hydrogencyanid, salte heraf, med undtagelse af komplexe
salte som cyanoferrat(II) og -(III) og kviksølv(II)oxidcyanid |
Tx;R26/27/28 R32 N;R50/53 |
* |
|
|
|
| x |
3-hydroxy-1,1-dimethylbutyl-2-ethyl-2-methylheptanperoxoat |
O;R7 R10 Xi;R38 N;R50/53 |
* |
|
|
|
| x |
N-[3-hydroxy-2-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamid
(1), N-[2,3-bis(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamid
(2), methacrylamid (3), 2-methyl-N-(2-methylacryloylaminomethoxymethyl)acrylamid
(4), N-(2,3-dihydroxypropoxymethyl)-2-methylacrylamid (5), blanding af (1), (2),
(3), (4) og (5) |
Carc2;R45 Xn;R48/22 Mut3;R68 |
* |
|
|
|
| x |
2-hydroxy-4-(3-propenoxy)benzophenon og triethoxysilan,
reaktionsprodukt med (hydrolyseproduktet af silica og methyltrimethoxysilan) |
F;R11 Xn;R20/21/22 T;R39/23/24/25 |
* |
|
|
|
| x |
keramiske fibre; special fibre, undtagen sådanne
nævnt andetsteds i dette bilag [syntetiske glasagtige (silicat) fibre uden
bestemt orientering og med et indhold af alkaliske oxider og alkaliske jordarters
oxider (Na2O + K2O + CaO + MgO + BaO) på 18 vægtprocent og derunder] |
Carc2;R49 Xi;R38 |
* |
|
|
|
| x |
kobber(I)-O,O-diisopropyldithiophosphat (1), kobber(I)-O,O-bis(4-methylpent-2-yl)dithiophosphat
(3),kobber(I)-O-isopropyl-O-(4-methylpent-2-yl)dithiophosphat (2), blanding af
(1), (2) og (3) |
N;R50/53 |
* |
|
|
|
| x |
kviksølvforbindelser, organiske undtagen sådanne
nævnt andetsteds i dette bilag |
Tx;R26/27/28 R33 N;R50/53 |
* |
|
|
|
| x |
kviksølvforbindelser, uorganiske undtagen kviksølv(II)sulfid
(cinnober) samt sådanne nævnt andetsteds i dette bilag |
Tx;R26/27/28 R33 N;R50/53 |
* |
|
|
|
| x |
[1-(methoxymethyl)-2-(C12-alkoxy)ethoxy]eddikesyre, blanding
med [1-(methoxymethyl)-2-(C14-alkoxy)ethoxy]eddikesyre |
Xi;R38-41 N;R50/53 |
* |
|
|
|
| x |
methylacrylamidoglycolat (der indeholder mindst 0,1% acrylamid) |
Carc2;R45 Mut2;R46 C;R34 R43 |
* |
|
|
|
| x |
methylacrylamidomethoxyacetat (der inderholder mindst 0,1%
acrylamid) |
Carc2;R45 Mut2;R46 Xn;R22 Xi;R36 |
* |
|
|
|
| x |
4,4'-methylenbis(2-chloranilin), salte heraf |
Carc2;R45 Xn;R22 N;R50/53 |
* |
|
|
|
| x |
1,1'-(methylenbis(4,1-phenylen)dipyrrol-2,5-dion (1), N-(4-(4-(2,5-dioxopyrrol-1-yl)benzyl)phenyl)acetamid
(2), 1-(4-(4-(5-oxo-2H-2-furylidenamino)benzyl)phenyl)pyrrol-2,5-dion (3), blanding
af (1), (2) og(3) |
R43 N;R50/53 |
* |
|
|
|
| x |
mineraluld, undtagen sådanne nævnt andetsteds
i dette bilag [syntetiske glasagtige (silicat) fibre uden bestemt orientering
og med et indhold af alkaliske oxider og alkaliske jordarters oxider (Na2O + K2O
+ CaO + MgO + BaO) på over 18 vægtprocent] |
Xi;R38 Carc3;R40 |
* |
|
|
|
| x |
2-naphthylamino-6-sulfomethylamid |
R43 Xn;R48/22 N;R51/53 |
* |
|
|
|
| x |
1,1'-(1,3-phenylendioxy)bis(3-(2-(prop-2-enyl)phenoxy)propan-2-ol) |
R43 N;R50/53 |
* |
|
|
|
| x |
proteaser, undtagen sådanne nævnt andetsteds
i dette bilag |
Xi;R36/37/38 R42 |
* |
|
|
|
| x |
pyrethriner indeholdende cineriner |
Xn;R20/21/22 N;R50/53 |
* |
|
|
|
| x |
pyrethrin I |
Xn;R20/21/22 N;R50/53 |
* |
|
|
|
| x |
selenforbindelser med undtagelse af cadmiumsulfoselenid
(xCdS.yCdSe) |
T;R23/25 R33 N;R50/53 |
* |
|
|
|
| x |
strychnin, salte heraf |
Tx;R26/28 N;R50/53 |
* |
|
|
|
| x |
tetrachloroplatinater, undtagen sådanne nævnt
andetsteds i dette bilag |
T;R25 Xi;R41 R42/43 |
* |
|
|
|
| x |
thalliumforbindelser, undtagen sådanne nævnt
andetsteds i dette bilag |
Tx;R26/28 R33 N;R51/53 |
* |
|
|
|
| x |
thiobis(4,1-phenylen)-S,S,S',S'-tetraphenyldisulfoniumbishexafluorphosphat,
blanding med diphenyl(4-phenylthiophenyl)sulfoniumhexafluorphosphat |
Xi;R41 N;R50/53 |
* |
|
|
|
| x |
tributyltinforbindelser, undtagen sådanne nævnt
andetsteds i dette bilag |
Xn;R21 T;R25-48/23/25 Xi;R36/38 N;R50/53 |
* |
|
|
|
| x |
2,4,5-trichlorphenoxyeddikesyre, salte og estere heraf |
Xn;R22 Xi;R36/37/38 N;R50/53 |
* |
|
|
|
| x |
2-(2,4,5-trichlorphenoxy)propionsyre, salte heraf |
Xn;R20/21/22 N;R50/53 |
* |
|
|
|
| x |
S-(tricyclo(5.2.1.0'2,6)deca-3-en-8(eller 9)-yl-O-(isopropyl
eller isobutyl eller 2-ethylhexyl)-O-(isopropyl eller isobutyl eller 2-ethylhexyl)dithiophosphat |
N;R50/53 |
* |
|
|
|
| x |
triethyltinforbindelser, undtagen sådanne nævnt
andetsteds i dette bilag |
Tx;R26/27/28 N;R50/53 |
* |
|
|
|
| x |
trihexadecylmethylammoniumchlorid, blanding med dihexadecyldimethylammoniumchlorid |
Xi;R41 N;R50/53 |
* |
|
|
|
| x |
trimethyltinforbindelser, undtagen sådanne nævnt
andetsteds i dette bilag |
Tx;R26/27/28 N;R50/53 |
* |
|
|
|
| x |
trinatriumbis(7-acetamido-2-(4-nitro-2-oxidophenylazo)-3-sulfonato-1-naphtholato)chromat(1-) |
Mut3;R68 |
* |
|
|
|
| x |
triphenyltinforbindelser, undtagen sådanne nævnt
andetsteds i dette bilag |
T;R23/24/25 N;R50/53 |
* |
|
|
|
| x |
tripropyltinforbindelser, undtagen sådanne nævnt
andetstedsi dette bilag |
T;R23/24/25 N;R50/53 |
* |
|
|
|
| x |
2,4,5-T, salte og estere heraf |
Xn;R22 Xi;R36/37/38 N;R50/53 |
* |
|
|
|
| x |
uranforbindelser |
Tx;R26/28 R33 N;R51/53 |
* |
|
|
|
| x |
vanadium(IV)oxidhydrogenphosphathemihydrat, lithium, zink,
molybden, jern og chlor dopet |
Xn;R20-48/22 Xi;R41 N;R51/53 |
* |
|
|
|
| x |
wolframhexachlorid, reaktionsprodukt med 2-methylpropan-2-ol,
nonylphenol og pentan-2,4-dion |
F;R11 Xn;R20 C;R34 R43 N;R50/53 |
* |
|
|
|
| x |
xylidiner, med undtagelse af sådanne specificeret
andetsteds i dette bilag |
T;R23/24/25 R33 N;R51/53 |
* |
|
|
|
| x |
zinkchromater, herunder zinkkaliumchromat |
Carc1;R45 Xn;R22 R43 N;R50/53 |
* |
|
|
|
| |
|
|
|
|
|
|